| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Expected but not Quantified |
|---|
| Creation Date | 2012-09-06 15:16:49 UTC |
|---|
| Update Date | 2022-03-07 02:51:36 UTC |
|---|
| HMDB ID | HMDB0014385 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Alclometasone |
|---|
| Description | Alclometasone is only found in individuals that have used or taken this drug. It is synthetic glucocorticoid steroid for topical use in dermatology as anti-inflammatory, antipruritic, antiallergic, antiproliferative and vasoconstrictive agent. [Wikipedia ]The mechanism of the anti-inflammatory activity of the topical steroids, in general, is unclear. However, corticosteroids are thought to act by the induction of phospholipase A2 inhibitory proteins, collectively called lipocortins. It is postulated that these proteins control the biosynthesis of potent mediators of inflammation such as prostaglandins and leukotrienes by inhibiting the release of their common precursor, arachidonic acid. Arachidonic acid is released from membrane phospholipids by phospholipase A2. Alclometasone initially binds the corticosteroid receptor. This complex migrates to the nucleus where it binds to different glucocorticoid response elements on the DNA. This in turn enhances and represses various genes, especially those involved in inflammatory pathways. |
|---|
| Structure | [H][C@@]12C[C@@H](C)[C@](O)(C(=O)CO)[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])[C@H](Cl)CC2=CC(=O)C=C[C@]12C InChI=1S/C22H29ClO5/c1-11-6-14-18-15(23)8-12-7-13(25)4-5-20(12,2)19(18)16(26)9-21(14,3)22(11,28)17(27)10-24/h4-5,7,11,14-16,18-19,24,26,28H,6,8-10H2,1-3H3/t11-,14+,15-,16+,18-,19+,20+,21+,22+/m1/s1 |
|---|
| Synonyms | | Value | Source |
|---|
| 7alpha-Chloro-16alpha-methylprednisolone | ChEBI | | Aclometasone | ChEBI | | 7a-Chloro-16a-methylprednisolone | Generator | | 7Α-chloro-16α-methylprednisolone | Generator | | Alclometasone dipropionate | HMDB |
|
|---|
| Chemical Formula | C22H29ClO5 |
|---|
| Average Molecular Weight | 408.916 |
|---|
| Monoisotopic Molecular Weight | 408.170351745 |
|---|
| IUPAC Name | (1S,2R,9R,10S,11S,13R,14R,15S,17S)-9-chloro-14,17-dihydroxy-14-(2-hydroxyacetyl)-2,13,15-trimethyltetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadeca-3,6-dien-5-one |
|---|
| Traditional Name | alclometasone |
|---|
| CAS Registry Number | 66734-13-2 |
|---|
| SMILES | [H][C@@]12C[C@@H](C)[C@](O)(C(=O)CO)[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])[C@H](Cl)CC2=CC(=O)C=C[C@]12C |
|---|
| InChI Identifier | InChI=1S/C22H29ClO5/c1-11-6-14-18-15(23)8-12-7-13(25)4-5-20(12,2)19(18)16(26)9-21(14,3)22(11,28)17(27)10-24/h4-5,7,11,14-16,18-19,24,26,28H,6,8-10H2,1-3H3/t11-,14+,15-,16+,18-,19+,20+,21+,22+/m1/s1 |
|---|
| InChI Key | FJXOGVLKCZQRDN-PHCHRAKRSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as 21-hydroxysteroids. These are steroids carrying a hydroxyl group at the 21-position of the steroid backbone. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Lipids and lipid-like molecules |
|---|
| Class | Steroids and steroid derivatives |
|---|
| Sub Class | Hydroxysteroids |
|---|
| Direct Parent | 21-hydroxysteroids |
|---|
| Alternative Parents | |
|---|
| Substituents | - 21-hydroxysteroid
- Progestogin-skeleton
- 20-oxosteroid
- Pregnane-skeleton
- Halo-steroid
- 3-oxo-delta-1,4-steroid
- 7-halo-steroid
- 3-oxosteroid
- Oxosteroid
- 11-beta-hydroxysteroid
- 11-hydroxysteroid
- 17-hydroxysteroid
- Delta-1,4-steroid
- Cyclic alcohol
- Tertiary alcohol
- Alpha-hydroxy ketone
- Secondary alcohol
- Ketone
- Cyclic ketone
- Organic oxygen compound
- Organohalogen compound
- Organochloride
- Organooxygen compound
- Primary alcohol
- Carbonyl group
- Hydrocarbon derivative
- Alkyl halide
- Alkyl chloride
- Alcohol
- Organic oxide
- Aliphatic homopolycyclic compound
|
|---|
| Molecular Framework | Aliphatic homopolycyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Physiological effect | Not Available |
|---|
| Disposition | |
|---|
| Process | Not Available |
|---|
| Role | Not Available |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | 0.14 g/L | Not Available | | LogP | 2.7 | Not Available |
|
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 4.55 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 13.3299 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 1.53 minutes | 32390414 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 2545.4 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 232.0 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 180.6 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 179.3 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 145.4 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 572.5 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 576.6 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 91.7 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 1097.8 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 480.9 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1487.3 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 368.5 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 449.2 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 253.4 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 274.6 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 14.5 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Alclometasone,1TMS,isomer #1 | C[C@@H]1C[C@H]2[C@H]3[C@H]([C@@H](O)C[C@]2(C)[C@@]1(O[Si](C)(C)C)C(=O)CO)[C@@]1(C)C=CC(=O)C=C1C[C@H]3Cl | 3403.0 | Semi standard non polar | 33892256 | | Alclometasone,1TMS,isomer #2 | C[C@@H]1C[C@H]2[C@H]3[C@H]([C@@H](O)C[C@]2(C)[C@@]1(O)C(=O)CO[Si](C)(C)C)[C@@]1(C)C=CC(=O)C=C1C[C@H]3Cl | 3398.1 | Semi standard non polar | 33892256 | | Alclometasone,1TMS,isomer #3 | C[C@@H]1C[C@H]2[C@H]3[C@H]([C@@H](O[Si](C)(C)C)C[C@]2(C)[C@@]1(O)C(=O)CO)[C@@]1(C)C=CC(=O)C=C1C[C@H]3Cl | 3344.6 | Semi standard non polar | 33892256 | | Alclometasone,1TMS,isomer #4 | C[C@@H]1C[C@H]2[C@H]3[C@H]([C@@H](O)C[C@]2(C)[C@@]1(O)C(=CO)O[Si](C)(C)C)[C@@]1(C)C=CC(=O)C=C1C[C@H]3Cl | 3371.6 | Semi standard non polar | 33892256 | | Alclometasone,2TMS,isomer #1 | C[C@@H]1C[C@H]2[C@H]3[C@H]([C@@H](O[Si](C)(C)C)C[C@]2(C)[C@@]1(O[Si](C)(C)C)C(=O)CO)[C@@]1(C)C=CC(=O)C=C1C[C@H]3Cl | 3306.6 | Semi standard non polar | 33892256 | | Alclometasone,2TMS,isomer #2 | C[C@@H]1C[C@H]2[C@H]3[C@H]([C@@H](O)C[C@]2(C)[C@@]1(O[Si](C)(C)C)C(=O)CO[Si](C)(C)C)[C@@]1(C)C=CC(=O)C=C1C[C@H]3Cl | 3429.9 | Semi standard non polar | 33892256 | | Alclometasone,2TMS,isomer #3 | C[C@@H]1C[C@H]2[C@H]3[C@H]([C@@H](O)C[C@]2(C)[C@@]1(O[Si](C)(C)C)C(=CO)O[Si](C)(C)C)[C@@]1(C)C=CC(=O)C=C1C[C@H]3Cl | 3358.0 | Semi standard non polar | 33892256 | | Alclometasone,2TMS,isomer #4 | C[C@@H]1C[C@H]2[C@H]3[C@H]([C@@H](O[Si](C)(C)C)C[C@]2(C)[C@@]1(O)C(=O)CO[Si](C)(C)C)[C@@]1(C)C=CC(=O)C=C1C[C@H]3Cl | 3284.6 | Semi standard non polar | 33892256 | | Alclometasone,2TMS,isomer #5 | C[C@@H]1C[C@H]2[C@H]3[C@H]([C@@H](O)C[C@]2(C)[C@@]1(O)C(=CO[Si](C)(C)C)O[Si](C)(C)C)[C@@]1(C)C=CC(=O)C=C1C[C@H]3Cl | 3349.5 | Semi standard non polar | 33892256 | | Alclometasone,2TMS,isomer #6 | C[C@@H]1C[C@H]2[C@H]3[C@H]([C@@H](O[Si](C)(C)C)C[C@]2(C)[C@@]1(O)C(=CO)O[Si](C)(C)C)[C@@]1(C)C=CC(=O)C=C1C[C@H]3Cl | 3252.0 | Semi standard non polar | 33892256 | | Alclometasone,3TMS,isomer #1 | C[C@@H]1C[C@H]2[C@H]3[C@H]([C@@H](O[Si](C)(C)C)C[C@]2(C)[C@@]1(O[Si](C)(C)C)C(=O)CO[Si](C)(C)C)[C@@]1(C)C=CC(=O)C=C1C[C@H]3Cl | 3316.2 | Semi standard non polar | 33892256 | | Alclometasone,3TMS,isomer #2 | C[C@@H]1C[C@H]2[C@H]3[C@H]([C@@H](O[Si](C)(C)C)C[C@]2(C)[C@@]1(O[Si](C)(C)C)C(=CO)O[Si](C)(C)C)[C@@]1(C)C=CC(=O)C=C1C[C@H]3Cl | 3239.0 | Semi standard non polar | 33892256 | | Alclometasone,3TMS,isomer #3 | C[C@@H]1C[C@H]2[C@H]3[C@H]([C@@H](O)C[C@]2(C)[C@@]1(O[Si](C)(C)C)C(=CO[Si](C)(C)C)O[Si](C)(C)C)[C@@]1(C)C=CC(=O)C=C1C[C@H]3Cl | 3351.9 | Semi standard non polar | 33892256 | | Alclometasone,3TMS,isomer #4 | C[C@@H]1C[C@H]2[C@H]3[C@H]([C@@H](O[Si](C)(C)C)C[C@]2(C)[C@@]1(O)C(=CO[Si](C)(C)C)O[Si](C)(C)C)[C@@]1(C)C=CC(=O)C=C1C[C@H]3Cl | 3222.8 | Semi standard non polar | 33892256 | | Alclometasone,4TMS,isomer #1 | C[C@@H]1C[C@H]2[C@H]3[C@H]([C@@H](O[Si](C)(C)C)C[C@]2(C)[C@@]1(O[Si](C)(C)C)C(=CO[Si](C)(C)C)O[Si](C)(C)C)[C@@]1(C)C=CC(=O)C=C1C[C@H]3Cl | 3247.9 | Semi standard non polar | 33892256 | | Alclometasone,4TMS,isomer #1 | C[C@@H]1C[C@H]2[C@H]3[C@H]([C@@H](O[Si](C)(C)C)C[C@]2(C)[C@@]1(O[Si](C)(C)C)C(=CO[Si](C)(C)C)O[Si](C)(C)C)[C@@]1(C)C=CC(=O)C=C1C[C@H]3Cl | 3296.9 | Standard non polar | 33892256 | | Alclometasone,4TMS,isomer #1 | C[C@@H]1C[C@H]2[C@H]3[C@H]([C@@H](O[Si](C)(C)C)C[C@]2(C)[C@@]1(O[Si](C)(C)C)C(=CO[Si](C)(C)C)O[Si](C)(C)C)[C@@]1(C)C=CC(=O)C=C1C[C@H]3Cl | 3451.8 | Standard polar | 33892256 | | Alclometasone,1TBDMS,isomer #1 | C[C@@H]1C[C@H]2[C@H]3[C@H]([C@@H](O)C[C@]2(C)[C@@]1(O[Si](C)(C)C(C)(C)C)C(=O)CO)[C@@]1(C)C=CC(=O)C=C1C[C@H]3Cl | 3635.6 | Semi standard non polar | 33892256 | | Alclometasone,1TBDMS,isomer #2 | C[C@@H]1C[C@H]2[C@H]3[C@H]([C@@H](O)C[C@]2(C)[C@@]1(O)C(=O)CO[Si](C)(C)C(C)(C)C)[C@@]1(C)C=CC(=O)C=C1C[C@H]3Cl | 3645.6 | Semi standard non polar | 33892256 | | Alclometasone,1TBDMS,isomer #3 | C[C@@H]1C[C@H]2[C@H]3[C@H]([C@@H](O[Si](C)(C)C(C)(C)C)C[C@]2(C)[C@@]1(O)C(=O)CO)[C@@]1(C)C=CC(=O)C=C1C[C@H]3Cl | 3571.4 | Semi standard non polar | 33892256 | | Alclometasone,1TBDMS,isomer #4 | C[C@@H]1C[C@H]2[C@H]3[C@H]([C@@H](O)C[C@]2(C)[C@@]1(O)C(=CO)O[Si](C)(C)C(C)(C)C)[C@@]1(C)C=CC(=O)C=C1C[C@H]3Cl | 3591.9 | Semi standard non polar | 33892256 | | Alclometasone,2TBDMS,isomer #1 | C[C@@H]1C[C@H]2[C@H]3[C@H]([C@@H](O[Si](C)(C)C(C)(C)C)C[C@]2(C)[C@@]1(O[Si](C)(C)C(C)(C)C)C(=O)CO)[C@@]1(C)C=CC(=O)C=C1C[C@H]3Cl | 3763.0 | Semi standard non polar | 33892256 | | Alclometasone,2TBDMS,isomer #2 | C[C@@H]1C[C@H]2[C@H]3[C@H]([C@@H](O)C[C@]2(C)[C@@]1(O[Si](C)(C)C(C)(C)C)C(=O)CO[Si](C)(C)C(C)(C)C)[C@@]1(C)C=CC(=O)C=C1C[C@H]3Cl | 3906.5 | Semi standard non polar | 33892256 | | Alclometasone,2TBDMS,isomer #3 | C[C@@H]1C[C@H]2[C@H]3[C@H]([C@@H](O)C[C@]2(C)[C@@]1(O[Si](C)(C)C(C)(C)C)C(=CO)O[Si](C)(C)C(C)(C)C)[C@@]1(C)C=CC(=O)C=C1C[C@H]3Cl | 3824.3 | Semi standard non polar | 33892256 | | Alclometasone,2TBDMS,isomer #4 | C[C@@H]1C[C@H]2[C@H]3[C@H]([C@@H](O[Si](C)(C)C(C)(C)C)C[C@]2(C)[C@@]1(O)C(=O)CO[Si](C)(C)C(C)(C)C)[C@@]1(C)C=CC(=O)C=C1C[C@H]3Cl | 3769.2 | Semi standard non polar | 33892256 | | Alclometasone,2TBDMS,isomer #5 | C[C@@H]1C[C@H]2[C@H]3[C@H]([C@@H](O)C[C@]2(C)[C@@]1(O)C(=CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@]1(C)C=CC(=O)C=C1C[C@H]3Cl | 3806.8 | Semi standard non polar | 33892256 | | Alclometasone,2TBDMS,isomer #6 | C[C@@H]1C[C@H]2[C@H]3[C@H]([C@@H](O[Si](C)(C)C(C)(C)C)C[C@]2(C)[C@@]1(O)C(=CO)O[Si](C)(C)C(C)(C)C)[C@@]1(C)C=CC(=O)C=C1C[C@H]3Cl | 3696.1 | Semi standard non polar | 33892256 | | Alclometasone,3TBDMS,isomer #1 | C[C@@H]1C[C@H]2[C@H]3[C@H]([C@@H](O[Si](C)(C)C(C)(C)C)C[C@]2(C)[C@@]1(O[Si](C)(C)C(C)(C)C)C(=O)CO[Si](C)(C)C(C)(C)C)[C@@]1(C)C=CC(=O)C=C1C[C@H]3Cl | 4021.4 | Semi standard non polar | 33892256 | | Alclometasone,3TBDMS,isomer #2 | C[C@@H]1C[C@H]2[C@H]3[C@H]([C@@H](O[Si](C)(C)C(C)(C)C)C[C@]2(C)[C@@]1(O[Si](C)(C)C(C)(C)C)C(=CO)O[Si](C)(C)C(C)(C)C)[C@@]1(C)C=CC(=O)C=C1C[C@H]3Cl | 3929.3 | Semi standard non polar | 33892256 | | Alclometasone,3TBDMS,isomer #3 | C[C@@H]1C[C@H]2[C@H]3[C@H]([C@@H](O)C[C@]2(C)[C@@]1(O[Si](C)(C)C(C)(C)C)C(=CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@]1(C)C=CC(=O)C=C1C[C@H]3Cl | 4039.3 | Semi standard non polar | 33892256 | | Alclometasone,3TBDMS,isomer #4 | C[C@@H]1C[C@H]2[C@H]3[C@H]([C@@H](O[Si](C)(C)C(C)(C)C)C[C@]2(C)[C@@]1(O)C(=CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@]1(C)C=CC(=O)C=C1C[C@H]3Cl | 3893.6 | Semi standard non polar | 33892256 | | Alclometasone,4TBDMS,isomer #1 | C[C@@H]1C[C@H]2[C@H]3[C@H]([C@@H](O[Si](C)(C)C(C)(C)C)C[C@]2(C)[C@@]1(O[Si](C)(C)C(C)(C)C)C(=CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@]1(C)C=CC(=O)C=C1C[C@H]3Cl | 4112.6 | Semi standard non polar | 33892256 | | Alclometasone,4TBDMS,isomer #1 | C[C@@H]1C[C@H]2[C@H]3[C@H]([C@@H](O[Si](C)(C)C(C)(C)C)C[C@]2(C)[C@@]1(O[Si](C)(C)C(C)(C)C)C(=CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@]1(C)C=CC(=O)C=C1C[C@H]3Cl | 4058.4 | Standard non polar | 33892256 | | Alclometasone,4TBDMS,isomer #1 | C[C@@H]1C[C@H]2[C@H]3[C@H]([C@@H](O[Si](C)(C)C(C)(C)C)C[C@]2(C)[C@@]1(O[Si](C)(C)C(C)(C)C)C(=CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@]1(C)C=CC(=O)C=C1C[C@H]3Cl | 3681.5 | Standard polar | 33892256 |
|
|---|