Record Information
Version3.6
Creation Date2005-11-16 15:48:42 UTC
Update Date2013-02-09 00:08:06 UTC
HMDB IDHMDB00221
Secondary Accession Numbers
  • HMDB00799
  • HMDB06341
Metabolite Identification
Common NameNADPH
DescriptionNicotinamide adenine dinucleotide phosphate. A coenzyme composed of ribosylnicotinamide 5'-phosphate (NMN) coupled by pyrophosphate linkage to the 5'-phosphate adenosine 2',5'-bisphosphate. It serves as an electron carrier in a number of reactions, being alternately oxidized (NADP+) and reduced (NADPH). (Dorland, 27th ed.).
Structure
Thumb
Synonyms
  1. 2'-(Dihydrogen phosphate) 5'-(trihydrogen pyrophosphate) Adenosine 5'-ester with 1,4-dihydro-1-b-D-ribofuranosylnicotinamide
  2. 2'-(Dihydrogen phosphate) 5'-(trihydrogen pyrophosphate) Adenosine 5'-ester with 1,4-dihydro-1-beta-delta-ribofuranosylnicotinamide
  3. Adenosine 5'-(trihydrogen diphosphate) 2'-(dihydrogen phosphate) P'-5'-ester with 1,4-dihydro-1-beta-D-ribofuranosyl-3-pyridinecarboxamide
  4. Adenosine 5'-(trihydrogen diphosphate) 2'-(dihydrogen phosphate) P'-5'-ester with 1,4-dihydro-1-beta-delta-ribofuranosyl-3-pyridinecarboxamide
  5. b-NADPH
  6. b-Nicotinamide-adenine-dinucleotide-phosphorate
  7. b-Nicotinamide-adenine-dinucleotide-phosphoric acid
  8. beta-NADPH
  9. beta-Nicotinamide-adenine-dinucleotide-phosphorate
  10. beta-Nicotinamide-adenine-dinucleotide-phosphoric acid
  11. Dihydrocodehydrogenase II
  12. Dihydronicotinamide adenine dinucleotide phosphate
  13. Dihydronicotinamide adenine dinucleotide-P
  14. Dihydrotriphosphopyridine nucleotide reduced
  15. NADP-reduced
  16. NADPH
  17. Nicotinamide adenine dinucleotide phosphate - reduced
  18. Nicotinamide-adenine-dinucleotide-phosphorate
  19. Nicotinamide-adenine-dinucleotide-phosphoric acid
  20. Reduced Codehydrase II
  21. Reduced Coenzyme II
  22. Reduced Cozymase II
  23. Reduced triphosphopyridine nucleotide
  24. Triphosphopyridine nucleotide reduced
Chemical FormulaC21H30N7O17P3
Average Molecular Weight745.4209
Monoisotopic Molecular Weight745.091102105
IUPAC Name{[(2S,3S,4S,5S)-2-(6-amino-9H-purin-9-yl)-5-[({[({[(2S,3R,4S,5S)-5-(3-carbamoyl-1,4-dihydropyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy](hydroxy)phosphoryl}oxy)methyl]-4-hydroxyoxolan-3-yl]oxy}phosphonic acid
Traditional IUPAC Name[(2S,3S,4S,5S)-2-(6-aminopurin-9-yl)-5-{[({[(2S,3R,4S,5S)-5-(3-carbamoyl-4H-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy(hydroxy)phosphoryl}oxy(hydroxy)phosphoryl)oxy]methyl}-4-hydroxyoxolan-3-yl]oxyphosphonic acid
CAS Registry Number53-57-6
SMILES
NC(=O)C1=CN(C=CC1)[C@H]1O[C@@H](COP(O)(=O)OP(O)(=O)OC[C@@H]2O[C@@H]([C@@H](OP(O)(O)=O)[C@H]2O)N2C=NC3=C(N)N=CN=C23)[C@H](O)[C@@H]1O
InChI Identifier
InChI=1S/C21H30N7O17P3/c22-17-12-19(25-7-24-17)28(8-26-12)21-16(44-46(33,34)35)14(30)11(43-21)6-41-48(38,39)45-47(36,37)40-5-10-13(29)15(31)20(42-10)27-3-1-2-9(4-27)18(23)32/h1,3-4,7-8,10-11,13-16,20-21,29-31H,2,5-6H2,(H2,23,32)(H,36,37)(H,38,39)(H2,22,24,25)(H2,33,34,35)/t10-,11-,13-,14-,15-,16-,20-,21-/m0/s1
InChI KeyACFIXJIJDZMPPO-NCHANQSKSA-N
Chemical Taxonomy
KingdomOrganic Compounds
Super ClassNucleosides, Nucleotides, and Analogues
ClassPurine Nucleotides
Sub ClassPurine Ribonucleotides
Other Descriptors
  • Aromatic Heteropolycyclic Compounds
Substituents
  • 1,2 Diol
  • 1 Phosphoribosyl Imidazole
  • Aminopyrimidine
  • Carboxamide Group
  • Dihydropyridine
  • Disaccharide Phosphate
  • Enamine
  • Glycosyl Compound
  • Hemiaminal
  • Hydropyridine
  • Imidazole
  • Imidazopyrimidine
  • N Glycosyl Compound
  • Nicotinamide Nucleotide
  • Organic Hypophosphite
  • Organic Phosphite
  • Organic Pyrophosphate
  • Oxolane
  • Pentose Disaccharide
  • Phosphoric Acid Ester
  • Primary Carboxylic Acid Amide
  • Purine
  • Pyrimidine
  • Saccharide
  • Secondary Alcohol
Direct ParentPurine Ribonucleoside 2',5'-Bisphosphates
Ontology
StatusDetected and Quantified
Origin
  • Endogenous
Biofunction
  • Component of Androgen and estrogen metabolism
  • Component of Arginine and proline metabolism
  • Component of Bile acid biosynthesis
  • Component of C21-Steroid hormone metabolism
  • Component of Folate biosynthesis
  • Component of Fructose and mannose metabolism
  • Component of Glutamate metabolism
  • Component of Glutathione metabolism
  • Component of Glycerolipid metabolism
  • Component of Glyoxylate and dicarboxylate metabolism
  • Component of Monoterpenoid biosynthesis
  • Component of Nicotinate and nicotinamide metabolism
  • Component of Pantothenate and CoA biosynthesis
  • Component of Porphyrin and chlorophyll metabolism
  • Component of Prostaglandin and leukotriene metabolism
  • Component of Purine metabolism
  • Component of Pyrimidine metabolism
  • Component of Pyruvate metabolism
  • Component of beta-Alanine metabolism
ApplicationNot Available
Cellular locations
  • Cytoplasm (predicted from logP)
Physical Properties
StateSolid
Experimental Properties
PropertyValueReference
Melting PointNot AvailableNot Available
Boiling PointNot AvailableNot Available
Water SolubilityNot AvailableNot Available
LogPNot AvailableNot Available
Predicted Properties
PropertyValueSource
water solubility5.45 g/LALOGPS
logP-1.1ALOGPS
logP-7.5ChemAxon
logS-2.1ALOGPS
pKa (strongest acidic)0.66ChemAxon
pKa (strongest basic)4.92ChemAxon
physiological charge-4ChemAxon
hydrogen acceptor count18ChemAxon
hydrogen donor count9ChemAxon
polar surface area364.15ChemAxon
rotatable bond count13ChemAxon
refractivity153.87ChemAxon
polarizability60.22ChemAxon
Spectra
Spectra
Biological Properties
Cellular Locations
  • Cytoplasm (predicted from logP)
Biofluid Locations
  • Blood
Tissue Location
  • All Tissues
Pathways
NameSMPDB LinkKEGG Link
Arachidonic Acid MetabolismSMP00075map00590
Ethanol DegradationSMP00449Not Available
Folate MetabolismSMP00053map00670
Glucose-Alanine CycleSMP00127Not Available
Glutathione MetabolismSMP00015map00480
Glycerolipid MetabolismSMP00039map00561
Histidine MetabolismSMP00044map00340
Phytanic Acid Peroxisomal OxidationSMP00450Not Available
Plasmalogen SynthesisSMP00479Not Available
Pterine BiosynthesisSMP00005map00790
Transfer of Acetyl Groups into MitochondriaSMP00466Not Available
Vitamin K MetabolismSMP00464Not Available
Normal Concentrations
BiofluidStatusValueAgeSexConditionReference
BloodDetected and Quantified51.0 (34.0-81.0) uMAdult (>18 years old)BothNormal
  • Geigy Scient...
Abnormal Concentrations
Not Available
Associated Disorders and Diseases
Disease ReferencesNone
Associated OMIM IDsNone
DrugBank IDNot Available
DrugBank Metabolite IDNot Available
Phenol Explorer Compound IDNot Available
Phenol Explorer Metabolite IDNot Available
FoodDB IDFDB021909
KNApSAcK IDNot Available
Chemspider ID17215925
KEGG Compound IDC00005
BioCyc IDNADPH
BiGG ID33486
Wikipedia LinkNADPH
NuGOwiki LinkHMDB00221
Metagene LinkHMDB00221
METLIN ID3691
PubChem Compound22833512
PDB IDNot Available
ChEBI ID16474
References
Synthesis ReferenceSeelbach, Karsten; Riebel, Bettina; Hummel, Werner; Kula, Maria-Regina; Tishkov, Vladimir I.; Egorov, Alexey M.; Wandrey, Christian; Kragl, Udo. A novel, efficient regenerating method of NADPH using a new formate dehydrogenase. Tetrahedron Letters (1996), 37(9), 1377-80.
Material Safety Data Sheet (MSDS)Not Available
General References
  1. Nakayama Y, Kinoshita A, Tomita M: Dynamic simulation of red blood cell metabolism and its application to the analysis of a pathological condition. Theor Biol Med Model. 2005 May 9;2(1):18. Pubmed: 15882454
  2. Shindo Y, Witt E, Han D, Epstein W, Packer L: Enzymic and non-enzymic antioxidants in epidermis and dermis of human skin. J Invest Dermatol. 1994 Jan;102(1):122-4. Pubmed: 8288904
  3. Iwata H, Tezuka Y, Kadota S, Hiratsuka A, Watabe T: Mechanism-based inactivation of human liver microsomal CYP3A4 by rutaecarpine and limonin from Evodia fruit extract. Drug Metab Pharmacokinet. 2005 Feb;20(1):34-45. Pubmed: 15770073
  4. Birkmayer GJ, Birkmayer W: Stimulation of endogenous L-dopa biosynthesis--a new principle for the therapy of Parkinson's disease. The clinical effect of nicotinamide adenine dinucleotide (NADH) and nicotinamide adenine dinucleotidephosphate (NADPH). Acta Neurol Scand Suppl. 1989;126:183-7. Pubmed: 2618590
  5. Lee AJ, Zhu BT: NADPH-dependent formation of polar and nonpolar estrogen metabolites following incubations of 17 beta-estradiol with human liver microsomes. Drug Metab Dispos. 2004 Aug;32(8):876-83. Pubmed: 15258114
  6. Kochansky CJ, Xia YQ, Wang S, Cato B, Creighton M, Vincent SH, Franklin RB, Reed JR: Species differences in the elimination of a peroxisome proliferator-activated receptor agonist highlighted by oxidative metabolism of its acyl glucuronide. Drug Metab Dispos. 2005 Dec;33(12):1894-904. Epub 2005 Sep 23. Pubmed: 16183782
  7. Karanam BV, Hop CE, Liu DQ, Wallace M, Dean D, Satoh H, Komuro M, Awano K, Vincent SH: In vitro metabolism of MK-0767 [(+/-)-5-[(2,4-dioxothiazolidin-5-yl)methyl]-2-methoxy-N-[[(4-trifluoromet hyl) phenyl]methyl]benzamide], a peroxisome proliferator-activated receptor alpha/gamma agonist. I. Role of cytochrome P450, methyltransferases, flavin monooxygenases, and esterases. Drug Metab Dispos. 2004 Sep;32(9):1015-22. Pubmed: 15319344
  8. Soglia JR, Contillo LG, Kalgutkar AS, Zhao S, Hop CE, Boyd JG, Cole MJ: A semiquantitative method for the determination of reactive metabolite conjugate levels in vitro utilizing liquid chromatography-tandem mass spectrometry and novel quaternary ammonium glutathione analogues. Chem Res Toxicol. 2006 Mar;19(3):480-90. Pubmed: 16544956
  9. Afanas'ev IB, Suslova TB, Cheremisina ZP, Abramova NE, Korkina LG: Study of antioxidant properties of metal aspartates. Analyst. 1995 Mar;120(3):859-62. Pubmed: 7741242
  10. Lin CC, Wong BK, Burgey CS, Gibson CR, Singh R: In vitro metabolism of a thrombin inhibitor and quantitation of metabolically generated cyanide. J Pharm Biomed Anal. 2005 Oct 4;39(5):1014-20. Epub 2005 Jul 14. Pubmed: 16023819
  11. Conley AJ, Pattison JC, Bird IM: Variations in adrenal androgen production among (nonhuman) primates. Semin Reprod Med. 2004 Nov;22(4):311-26. Pubmed: 15635499

Only showing the first 50 proteins. There are 203 proteins in total.

Enzymes

Gene Name:
FASN
Uniprot ID:
P49327
Reactions
(3R)-3-hydroxyacyl-[acyl-carrier-protein] + NADP unknown 3-oxoacyl-[acyl-carrier-protein] + NADPHdetails
Acyl-[acyl-carrier-protein] + NADP unknown trans-2,3-dehydroacyl-[acyl-carrier-protein] + NADPHdetails
Butyryl-[acp] + NADP unknown But-2-enoyl-[acyl-carrier protein] + NADPH + Hydrogen Iondetails
(3R)-3-Hydroxybutanoyl-[acyl-carrier protein] + NADP unknown Acetoacetyl-[acp] + NADPH + Hydrogen Iondetails
(3R)-3-Hydroxydecanoyl-[acyl-carrier protein] + NADP unknown 3-Oxodecanoyl-[acp] + NADPHdetails
(3R)-3-Hydroxyoctanoyl-[acyl-carrier protein] + NADP unknown 3-Oxooctanoyl-[acp] + NADPH + Hydrogen Iondetails
(3R)-3-Hydroxypalmitoyl-[acyl-carrier protein] + NADP unknown 3-Oxohexadecanoyl-[acp] + NADPH + Hydrogen Iondetails
(3R)-3-Hydroxytetradecanoyl-[acyl-carrier protein] + NADP unknown 3-Oxotetradecanoyl-[acp] + NADPH + Hydrogen Iondetails
Dodecanoyl-[acyl-carrier protein] + NADP unknown trans-Dodec-2-enoyl-[acp] + NADPH + Hydrogen Iondetails
(R)-3-Hydroxyhexanoyl-[acp] + NADP unknown 3-Oxohexanoyl-[acp] + NADPH + Hydrogen Iondetails
Hexanoyl-[acp] + NADP unknown trans-Hex-2-enoyl-[acp] + NADPH + Hydrogen Iondetails
Octanoyl-[acp] + NADP unknown trans-Oct-2-enoyl-[acp] + NADPH + Hydrogen Iondetails
Decanoyl-[acp] + NADP unknown trans-Dec-2-enoyl-[acp] + NADPH + Hydrogen Iondetails
Tetradecanoyl-[acp] + NADP unknown trans-Tetradec-2-enoyl-[acp] + NADPH + Hydrogen Iondetails
Hexadecanoyl-[acp] + NADP unknown trans-Hexadec-2-enoyl-[acp] + NADPH + Hydrogen Iondetails
Gene Name:
ALDH6A1
Uniprot ID:
Q02252
Reactions
Malonic semialdehyde + Coenzyme A + NADP unknown Acetyl-CoA + Carbon dioxide + NADPH + Hydrogen Iondetails
Malonic semialdehyde + Coenzyme A + NADP unknown Malonyl-CoA + NADPH + Hydrogen Iondetails
Gene Name:
AKR1C4
Uniprot ID:
P17516
Reactions
Chlordecone alcohol + NADP unknown Chlordecone + NADPHdetails
Androsterone + NADP unknown Androstanedione + NADPH + Hydrogen Iondetails
Etiocholanolone + NADP unknown Etiocholanedione + NADPH + Hydrogen Iondetails
3a,7a-Dihydroxy-5b-cholestane + NADP unknown 7a-Hydroxy-5b-cholestan-3-one + NADPH + Hydrogen Iondetails
5-b-Cholestane-3a ,7a ,12a-triol + NADP unknown 7a,12a-Dihydroxy-5b-cholestan-3-one + NADPH + Hydrogen Iondetails
17a,21-Dihydroxy-5b-pregnane-3,11,20-trione + Hydrogen Ion + NADPH unknown Tetrahydrocortisone + NADPdetails
Tetrahydrocortisol + NADP unknown Dihydrocortisol + NADPH + Hydrogen Iondetails
3a,11b,21-Trihydroxy-20-oxo-5b-pregnan-18-al + NADP unknown 11b,21-Dihydroxy-3,20-oxo-5b-pregnan-18-al + NADPH + Hydrogen Iondetails
Tetrahydrocorticosterone + NADP unknown 11b,21-Dihydroxy-5b-pregnane-3,20-dione + NADPH + Hydrogen Iondetails
3a,21-Dihydroxy-5b-pregnane-11,20-dione + NADP unknown 21-Hydroxy-5b-pregnane-3,11,20-trione + NADPH + Hydrogen Iondetails
3a-Hydroxy-5b-pregnane-20-one + NADP unknown 5a-Pregnane-3,20-dione + NADPH + Hydrogen Iondetails
Dihydrotestosterone + NADPH + Hydrogen Ion unknown Androstan-3alpha,17beta-diol + NADPdetails
Gene Name:
CBR1
Uniprot ID:
P16152
Reactions
R-CHOH-R' + NADP unknown R-CO-R' + NADPHdetails
(5Z,13E)-(15S)-9-alpha,11-alpha,15-trihydroxyprosta-5,13-dienoate + NADP unknown (5Z,13E)-(15S)-11-alpha,15-dihydroxy-9-oxoprosta-5,13-dienoate + NADPHdetails
(13E)-(15S)-11-alpha,15-dihydroxy-9-oxoprost-13-enoate + NADP unknown (13E)-11-alpha-hydroxy-9,15-dioxoprost-13-enoate + NADPHdetails
Prostaglandin F2a + NADP unknown Prostaglandin E2 + NADPH + Hydrogen Iondetails
4-(Methylnitrosamino)-1-(3-pyridyl)-1-butanone + NADPH + Hydrogen Ion unknown 4-(Methylnitrosamino)-1-(3-pyridyl)-1-butanol + NADPdetails
Gene Name:
DHRS4
Uniprot ID:
Q9BTZ2
Reactions
R-CHOH-R' + NADP unknown R-CO-R' + NADPHdetails
Gene Name:
CBR3
Uniprot ID:
O75828
Reactions
R-CHOH-R' + NADP unknown R-CO-R' + NADPHdetails
Prostaglandin F2a + NADP unknown Prostaglandin E2 + NADPH + Hydrogen Iondetails
4-(Methylnitrosamino)-1-(3-pyridyl)-1-butanone + NADPH + Hydrogen Ion unknown 4-(Methylnitrosamino)-1-(3-pyridyl)-1-butanol + NADPdetails
Gene Name:
AKR1B1
Uniprot ID:
P15121
Reactions
Glycerol + NADP unknown Glyceraldehyde + NADPH + Hydrogen Iondetails
Beta-D-Galactose + NADPH + Hydrogen Ion unknown Galactitol + NADPdetails
D-Xylitol + NADP unknown D-Xylose + NADPH + Hydrogen Iondetails
L-Arabitol + NADP unknown L-Arabinose + NADPH + Hydrogen Iondetails
Sorbitol + NADP unknown Alpha-D-Glucose + NADPH + Hydrogen Iondetails
Propylene glycol + NADP unknown Lactaldehyde + NADPH + Hydrogen Iondetails
Gene Name:
TXNRD1
Uniprot ID:
Q16881
Reactions
Thioredoxin + NADP unknown thioredoxin disulfide + NADPHdetails
Thioredoxin + NADP unknown Thioredoxin disulfide + NADPH + Hydrogen Iondetails
Hydrogen selenide + NADP + Water unknown Selenite + NADPH + Hydrogen Iondetails
NADPH + Hydrogen Ion + Methylselenic acid unknown NADP + Water + Methaneselenoldetails
Gene Name:
SC5DL
Uniprot ID:
O75845
Reactions
Lathosterol + NADPH + Hydrogen Ion + Oxygen unknown 7-Dehydrocholesterol + NADP + Waterdetails
Episterol + NADP unknown 5,7,24(28)-Ergostatrienol + NADPH + Hydrogen Iondetails
Gene Name:
FMO5
Uniprot ID:
P49326
Reactions
N,N-Dimethylaniline + NADPH + Oxygen unknown Dimethylaniline-N-oxide + NADP + Waterdetails
Trimethylamine + NADPH + Hydrogen Ion + Oxygen unknown Trimethylamine N-oxide + NADP + Waterdetails
Tamoxifen + Oxygen + NADPH + Hydrogen Ion unknown Tamoxifen N-oxide + NADP + Waterdetails
Gene Name:
HMOX2
Uniprot ID:
P30519
Gene Name:
SQLE
Uniprot ID:
Q14534
Reactions
Squalene + NADPH + Oxygen unknown (3S)-2,3-epoxy-2,3-dihydrosqualene + NADP + Waterdetails
Squalene + Oxygen + NADPH + Hydrogen Ion unknown (3S)-2,3-epoxy-2,3-dihydrosqualene + NADP + Waterdetails
Gene Name:
FMO2
Uniprot ID:
Q99518
Reactions
N,N-Dimethylaniline + NADPH + Oxygen unknown Dimethylaniline-N-oxide + NADP + Waterdetails
Trimethylamine + NADPH + Hydrogen Ion + Oxygen unknown Trimethylamine N-oxide + NADP + Waterdetails
Tamoxifen + Oxygen + NADPH + Hydrogen Ion unknown Tamoxifen N-oxide + NADP + Waterdetails
Gene Name:
ALDH4A1
Uniprot ID:
P30038
Reactions
1-Pyrroline-5-carboxylic acid + NADP + Water unknown L-Glutamic acid + NADPH + Hydrogen Iondetails
Pyrroline hydroxycarboxylic acid + NADP + Water unknown 4-Hydroxy-L-glutamic acid + NADPH + Hydrogen Iondetails
Gene Name:
TXNRD2
Uniprot ID:
Q9NNW7
Reactions
Thioredoxin + NADP unknown thioredoxin disulfide + NADPHdetails
Thioredoxin + NADP unknown Thioredoxin disulfide + NADPH + Hydrogen Iondetails
Hydrogen selenide + NADP + Water unknown Selenite + NADPH + Hydrogen Iondetails
NADPH + Hydrogen Ion + Methylselenic acid unknown NADP + Water + Methaneselenoldetails
Gene Name:
FMO4
Uniprot ID:
P31512
Reactions
N,N-Dimethylaniline + NADPH + Oxygen unknown Dimethylaniline-N-oxide + NADP + Waterdetails
Trimethylamine + NADPH + Hydrogen Ion + Oxygen unknown Trimethylamine N-oxide + NADP + Waterdetails
Tamoxifen + Oxygen + NADPH + Hydrogen Ion unknown Tamoxifen N-oxide + NADP + Waterdetails
Gene Name:
FMO3
Uniprot ID:
P31513
Reactions
N,N-Dimethylaniline + NADPH + Oxygen unknown Dimethylaniline-N-oxide + NADP + Waterdetails
Trimethylamine + NADPH + Oxygen unknown Trimethylamine N-oxide + NADP + Waterdetails
Trimethylamine + NADPH + Hydrogen Ion + Oxygen unknown Trimethylamine N-oxide + NADP + Waterdetails
Tamoxifen + Oxygen + NADPH + Hydrogen Ion unknown Tamoxifen N-oxide + NADP + Waterdetails
Gene Name:
POR
Uniprot ID:
P16435
Reactions
NADPH + n oxidized hemoprotein unknown NADP + n reduced hemoproteindetails
Gene Name:
FMO1
Uniprot ID:
Q01740
Reactions
N,N-Dimethylaniline + NADPH + Oxygen unknown Dimethylaniline-N-oxide + NADP + Waterdetails
Trimethylamine + NADPH + Hydrogen Ion + Oxygen unknown Trimethylamine N-oxide + NADP + Waterdetails
Tamoxifen + Oxygen + NADPH + Hydrogen Ion unknown Tamoxifen N-oxide + NADP + Waterdetails
Gene Name:
MTHFR
Uniprot ID:
P42898
Reactions
5-Methyltetrahydrofolic acid + NADP unknown 5,10-Methylene-THF + NADPH + Hydrogen Iondetails
Gene Name:
GSR
Uniprot ID:
P00390
Reactions
Glutathione + NADP unknown Oxidized glutathione + NADPHdetails
Glutathione + NADP unknown Oxidized glutathione + NADPH + Hydrogen Iondetails
Gene Name:
HMOX1
Uniprot ID:
P09601
Gene Name:
FDXR
Uniprot ID:
P22570
Reactions
reduced adrenodoxin + NADP unknown oxidized adrenodoxin + NADPHdetails
Reduced adrenal ferredoxin + NADP + Hydrogen Ion unknown Oxidized adrenal ferredoxin + NADPHdetails
Gene Name:
FDFT1
Uniprot ID:
P37268
Reactions
Presqualene diphosphate + NADPH + Hydrogen Ion unknown Pyrophosphate + Squalene + NADPdetails
Farnesyl pyrophosphate + NADPH + Hydrogen Ion unknown Squalene + Pyrophosphate + NADPdetails
Gene Name:
TM7SF2
Uniprot ID:
O76062
Reactions
4,4-Dimethyl-5a-cholesta-8,24-dien-3-b-ol + NADP unknown 4,4-Dimethylcholesta-8,14,24-trienol + NADPHdetails
4,4-Dimethyl-5a-cholesta-8,24-dien-3-b-ol + NADP unknown 4,4-Dimethylcholesta-8,14,24-trienol + NADPH + Hydrogen Iondetails
Delta 8,14 -Sterol + NADPH + Hydrogen Ion unknown 4a-Methylfecosterol + NADPdetails
Gene Name:
MSMO1
Uniprot ID:
Q15800
Reactions
4,4-Dimethyl-5a-cholesta-8,24-dien-3-b-ol + NADPH + Hydrogen Ion + Oxygen unknown 4a-Carboxy-4b-methyl-5a-cholesta-8,24-dien-3b-ol + NADP + Waterdetails
4,4-Dimethyl-5a-cholesta-8,24-dien-3-b-ol + NADPH + Hydrogen Ion + Oxygen unknown 3-beta-Hydroxy-4-beta-methyl-5-alpha-cholest-7-ene-4-alpha-carboxylate + NADP + Waterdetails
Gene Name:
NSDHL
Uniprot ID:
Q15738
Reactions
4a-Carboxy-4b-methyl-5a-cholesta-8,24-dien-3b-ol + NADP unknown 3-Keto-4-methylzymosterol + NADPH + Hydrogen Ion + Carbon dioxidedetails
Gene Name:
CYP51A1
Uniprot ID:
Q16850
Reactions
Obtusifoliol + Oxygen + NADPH unknown Delta 8,14 -Sterol + Formic acid + NADP + Waterdetails
Lanosterin + Oxygen + NADPH + Hydrogen Ion unknown 4,4-Dimethylcholesta-8,14,24-trienol + Formic acid + NADP + Waterdetails
Obtusifoliol + Oxygen + NADPH + Hydrogen Ion unknown Delta 8,14 -Sterol + Formic acid + NADP + Waterdetails
Gene Name:
ALDH9A1
Uniprot ID:
P49189
Reactions
4-Aminobutyraldehyde + NADP + Water unknown Gamma-Aminobutyric acid + NADPH + Hydrogen Iondetails
Gene Name:
ALDH3A1
Uniprot ID:
P30838
Reactions
Acetaldehyde + NADP + Water unknown Acetic acid + NADPH + Hydrogen Iondetails
Phenylacetaldehyde + NADP + Water unknown Phenylacetic acid + NADPH + Hydrogen Iondetails
4-Hydroxyphenylacetaldehyde + NADP + Water unknown p-Hydroxyphenylacetic acid + NADPH + Hydrogen Iondetails
3,4-Dihydroxyphenylacetaldehyde + NADP + Water unknown 3,4-Dihydroxybenzeneacetic acid + NADPH + Hydrogen Iondetails
3,4-Dihydroxymandelaldehyde + NADP + Water unknown 3,4-Dihydroxymandelic acid + NADPH + Hydrogen Iondetails
Homovanillin + NADP + Water unknown Homovanillic acid + NADPH + Hydrogen Iondetails
3-Methoxy-4-hydroxyphenylglycolaldehyde + NADP + Water unknown Vanillylmandelic acid + NADPH + Hydrogen Iondetails
Aldophosphamide + NADP + Water unknown Carboxyphosphamide + NADPH + Hydrogen Iondetails
Gene Name:
ALDH7A1
Uniprot ID:
P49419
Reactions
4-Aminobutyraldehyde + NADP + Water unknown Gamma-Aminobutyric acid + NADPH + Hydrogen Iondetails
Betaine aldehyde + NADP + Water unknown Trimethylammonioacetate + NADPH + Hydrogen Iondetails
(S)-2-amino-6-oxohexanoate + NADP + Water unknown Aminoadipic acid + NADPH + Hydrogen Iondetails
alpha-Aminoadipoyl-S-acyl enzyme + NADPH + Hydrogen Ion unknown (S)-2-amino-6-oxohexanoate + Holo-Lys2 + NADPdetails
Gene Name:
ALDH1A3
Uniprot ID:
P47895
Reactions
Acetaldehyde + NADP + Water unknown Acetic acid + NADPH + Hydrogen Iondetails
Phenylacetaldehyde + NADP + Water unknown Phenylacetic acid + NADPH + Hydrogen Iondetails
4-Hydroxyphenylacetaldehyde + NADP + Water unknown p-Hydroxyphenylacetic acid + NADPH + Hydrogen Iondetails
3,4-Dihydroxyphenylacetaldehyde + NADP + Water unknown 3,4-Dihydroxybenzeneacetic acid + NADPH + Hydrogen Iondetails
3,4-Dihydroxymandelaldehyde + NADP + Water unknown 3,4-Dihydroxymandelic acid + NADPH + Hydrogen Iondetails
Homovanillin + NADP + Water unknown Homovanillic acid + NADPH + Hydrogen Iondetails
3-Methoxy-4-hydroxyphenylglycolaldehyde + NADP + Water unknown Vanillylmandelic acid + NADPH + Hydrogen Iondetails
Aldophosphamide + NADP + Water unknown Carboxyphosphamide + NADPH + Hydrogen Iondetails
Gene Name:
ALDH2
Uniprot ID:
P05091
Reactions
2,5-Dioxopentanoate + NADP + Water unknown Oxoglutaric acid + NADPH + Hydrogen Iondetails
Acetaldehyde + NADP + Water unknown Acetic acid + NADPH + Hydrogen Iondetails
4-Aminobutyraldehyde + NADP + Water unknown Gamma-Aminobutyric acid + NADPH + Hydrogen Iondetails
Gene Name:
ALDH3A2
Uniprot ID:
P51648
Reactions
2,5-Dioxopentanoate + NADP + Water unknown Oxoglutaric acid + NADPH + Hydrogen Iondetails
Acetaldehyde + NADP + Water unknown Acetic acid + NADPH + Hydrogen Iondetails
4-Aminobutyraldehyde + NADP + Water unknown Gamma-Aminobutyric acid + NADPH + Hydrogen Iondetails
Gene Name:
ALDH1B1
Uniprot ID:
P30837
Reactions
2,5-Dioxopentanoate + NADP + Water unknown Oxoglutaric acid + NADPH + Hydrogen Iondetails
Acetaldehyde + NADP + Water unknown Acetic acid + NADPH + Hydrogen Iondetails
4-Aminobutyraldehyde + NADP + Water unknown Gamma-Aminobutyric acid + NADPH + Hydrogen Iondetails
Gene Name:
PYCR1
Uniprot ID:
P32322
Reactions
L-Proline + NADP unknown 1-Pyrroline-5-carboxylic acid + NADPH + Hydrogen Iondetails
4-Hydroxyproline + NADP unknown Pyrroline hydroxycarboxylic acid + NADPH + Hydrogen Iondetails
Gene Name:
PYCR2
Uniprot ID:
Q96C36
Reactions
L-Proline + NADP unknown 1-Pyrroline-5-carboxylic acid + NADPH + Hydrogen Iondetails
4-Hydroxyproline + NADP unknown Pyrroline hydroxycarboxylic acid + NADPH + Hydrogen Iondetails
Gene Name:
DCXR
Uniprot ID:
Q7Z4W1
Reactions
D-Xylitol + NADP unknown L-Threo-2-pentulose + NADPHdetails
D-Xylitol + NADP unknown L-Threo-2-pentulose + NADPH + Hydrogen Iondetails
Gene Name:
G6PD
Uniprot ID:
P11413
Reactions
Glucose 6-phosphate + NADP unknown 6-phospho-D-glucono-1,5-lactone + NADPHdetails
Beta-D-Glucose 6-phosphate + NADP unknown 6-Phosphonoglucono-D-lactone + NADPH + Hydrogen Iondetails
Gene Name:
H6PD
Uniprot ID:
O95479
Reactions
Beta-D-Glucose 6-phosphate + NADP unknown 6-Phosphonoglucono-D-lactone + NADPH + Hydrogen Iondetails
Gene Name:
AKR1C3
Uniprot ID:
P42330
Reactions
trans-1,2-Dihydrobenzene-1,2-diol + NADP unknown Pyrocatechol + NADPHdetails
(5Z,13E)-(15S)-9-alpha,11-alpha,15-trihydroxyprosta-5,13-dienoate + NADP unknown (5Z,13E)-(15S)-9-alpha,15-dihydroxy-11-oxoprosta-5,13-dienoate + NADPHdetails
Testosterone + NADP unknown Androstenedione + NADPHdetails
5alpha-Dihydrodeoxycorticosterone + NADPH + Hydrogen Ion unknown Tetrahydrodeoxycorticosterone + NADPdetails
5a-Pregnane-3,20-dione + NADPH + Hydrogen Ion unknown Allopregnanolone + NADPdetails
5alpha-Pregnan-20alpha-ol-3-one + NADPH + Hydrogen Ion unknown 5alpha-Pregnane-3alpha,20alpha-diol + NADPdetails
Gene Name:
AKR1C1
Uniprot ID:
Q04828
Reactions
trans-1,2-Dihydrobenzene-1,2-diol + NADP unknown Pyrocatechol + NADPHdetails
5alpha-Dihydrodeoxycorticosterone + NADPH + Hydrogen Ion unknown Tetrahydrodeoxycorticosterone + NADPdetails
5a-Pregnane-3,20-dione + NADPH + Hydrogen Ion unknown Allopregnanolone + NADPdetails
5alpha-Pregnan-20alpha-ol-3-one + NADPH + Hydrogen Ion unknown 5alpha-Pregnane-3alpha,20alpha-diol + NADPdetails
Gene Name:
AKR1C2
Uniprot ID:
P52895
Reactions
trans-1,2-Dihydrobenzene-1,2-diol + NADP unknown Pyrocatechol + NADPHdetails
5alpha-Dihydrodeoxycorticosterone + NADPH + Hydrogen Ion unknown Tetrahydrodeoxycorticosterone + NADPdetails
5a-Pregnane-3,20-dione + NADPH + Hydrogen Ion unknown Allopregnanolone + NADPdetails
5alpha-Pregnan-20alpha-ol-3-one + NADPH + Hydrogen Ion unknown 5alpha-Pregnane-3alpha,20alpha-diol + NADPdetails
Gene Name:
GRHPR
Uniprot ID:
Q9UBQ7
Reactions
Glycolic acid + NADP unknown Glyoxylic acid + NADPHdetails
Glycolic acid + NADP unknown Glyoxylic acid + NADPH + Hydrogen Iondetails
Glyceric acid + NADP unknown Hydroxypyruvic acid + NADPH + Hydrogen Iondetails
Gene Name:
CYP4A11
Uniprot ID:
Q02928
Reactions
Arachidonic acid + Oxygen + NADPH + Hydrogen Ion unknown 20-Hydroxyeicosatetraenoic acid + NADP + Waterdetails
Arachidonic acid + Oxygen + NADPH + Hydrogen Ion unknown 11,12-EpETrE + NADP + Waterdetails
All-trans-retinoic acid + NADPH + Hydrogen Ion + Oxygen unknown all-trans-18-Hydroxyretinoic acid + NADP + Waterdetails
Gene Name:
MTRR
Uniprot ID:
Q9UBK8
Reactions
[methionine synthase]-methylcob(I)alamin + S-Adenosylhomocysteine + NADP unknown [methionine synthase]-cob(II)alamin + NADPH + S-Adenosylmethioninedetails
Gene Name:
SPR
Uniprot ID:
P35270
Reactions
Dihydrobiopterin + NADP unknown Sepiapterin + NADPHdetails
L-erythro-tetrahydrobiopterin + NADP unknown Dyspropterin + NADPHdetails
L-erythro-tetrahydrobiopterin + NADP unknown 6-Lactoyltetrahydropterin + NADPH + Hydrogen Iondetails
6-Lactoyltetrahydropterin + NADP unknown Dyspropterin + NADPH + Hydrogen Iondetails
Gene Name:
HSD17B2
Uniprot ID:
P37059
Reactions
Estradiol + NADP unknown Estrone + NADPH + Hydrogen Iondetails
Estriol + NADP unknown 16b-Hydroxyestrone + NADPH + Hydrogen Iondetails
11beta,17beta-Dihydroxy-4-androsten-3-one + NADP unknown 11b-Hydroxyandrost-4-ene-3,17-dione + NADPH + Hydrogen Iondetails
Gene Name:
HSD17B8
Uniprot ID:
Q92506
Reactions
Estradiol + NADP unknown Estrone + NADPH + Hydrogen Iondetails
Estriol + NADP unknown 16b-Hydroxyestrone + NADPH + Hydrogen Iondetails
11beta,17beta-Dihydroxy-4-androsten-3-one + NADP unknown 11b-Hydroxyandrost-4-ene-3,17-dione + NADPH + Hydrogen Iondetails
Gene Name:
DHDH
Uniprot ID:
Q9UQ10
Reactions
trans-1,2-Dihydrobenzene-1,2-diol + NADP unknown Pyrocatechol + NADPHdetails
D-Xylose + NADP unknown D-Xylono-1,5-lactone + NADPHdetails
D-Xylose + NADP unknown D-Xylono-1,5-lactone + NADPH + Hydrogen Iondetails
1,2-Dihydronaphthalene-1,2-diol + NADP unknown Naphthalene-1,2-diol + NADPH + Hydrogen Iondetails

Only showing the first 50 proteins. There are 203 proteins in total.