| Record Information |
|---|
| Version | 4.0 |
|---|
| Status | Expected but not Quantified |
|---|
| Creation Date | 2012-09-11 17:31:23 UTC |
|---|
| Update Date | 2019-01-11 19:38:25 UTC |
|---|
| HMDB ID | HMDB0029598 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Metenamine |
|---|
| Description | Metenamine belongs to the family of Aminals. These are organic compounds containing the aminal functional group |
|---|
| Structure | |
|---|
| Synonyms | | Value | Source |
|---|
| 1,3,5,7-tetraazatricyclo[3.3.1.1(3,7)]Decane | ChEBI | | Hexamethylenamine | ChEBI | | Hexamethylene tetramine | ChEBI | | Hexamethylentetramin | ChEBI | | Hexamethylentetraminum | ChEBI | | Hexamine | ChEBI | | Hexaminum | ChEBI | | HMT | ChEBI | | HMTA | ChEBI | | Metenamina | ChEBI | | Methenamine | ChEBI | | Methenaminum | ChEBI | | Uritone | ChEBI | | Urotropin | ChEBI | | 1,3,5,7-Tetraazaadamantane | HMDB | | 1,3,5,7-tetraazatricyclo (3.3.1.1(3,7))Decane | HMDB | | 1,3,5,7-tetraazatricyclo(3.3.1.13,7)Decane | HMDB | | 1,3,5,7-tetraazatricyclo(3.3.1.13,7)Decane hydroiodide | HMDB | | 1,3,5,7-tetraazatricyclo[3.3.1.13,7 ]Decane | HMDB | | 1,3,5,7-tetraazatricyclo[3.3.1.1~3,7~]decane | HMDB | | aceto HMT | HMDB | | Aminoform | HMDB | | Aminoformaldehyde | HMDB | | Ammoform | HMDB | | Ammonioformaldehyde | HMDB | | Antihydral | HMDB | | Carin | HMDB | | Cystamin | HMDB | | Cystogen | HMDB | | Duirexol | HMDB | | e239 | HMDB | | Ekagom H | HMDB | | Esametilentetramina | HMDB | | Formaldehyde-ammonia 6:4 | HMDB | | Formamine | HMDB | | Formin | HMDB | | Formin (heterocycle) | HMDB | | Formin (the heterocyclic compound) | HMDB | | Grasselerator 102 | HMDB | | H.m.t. | HMDB | | Herax uts | HMDB | | Heterin | HMDB | | HEX | HMDB | | Hexa | HMDB | | Hexa (vulcanization accelerator) | HMDB | | Hexa-flo-pulver | HMDB | | Hexaform | HMDB | | Hexaloids | HMDB | | Hexamethylamine | HMDB | | Hexamethyleneamine | HMDB | | Hexamethylenetetraamine | HMDB | | Hexamethylenetetramine | HMDB | | Hexamethylenetetramine (aliphatic) | HMDB | | Hexamethylenetetramine, 8ci | HMDB | | Hexamethylenetetramine, acs | HMDB | | Hexamethylenetetramine-palladium chloride adduct | HMDB | | Hexamethylenetetraminum | HMDB | | Hexamethylentetramine | HMDB | | Hexamine (heterocycle) | HMDB | | Hexamine silver | HMDB | | Hexasan | HMDB | | Hexilmethylenamine | HMDB | | Mandelamine | HMDB | | Methamin | HMDB | | Methenamin | HMDB | | Methenamine silver | HMDB | | Metramine | HMDB | | Naphthamine | HMDB | | Natasol fast orange GR salt | HMDB | | Nocceler H | HMDB | | Preparation af | HMDB | | Resotropin | HMDB | | S 4 (Heterocycle) | HMDB | | Sanceler H | HMDB | | Silver methenamine | HMDB | | Tetraazaadamantane | HMDB | | Uramin | HMDB | | Uratrine | HMDB | | Urisol | HMDB | | uro-Phosphate | HMDB | | Urodeine | HMDB | | Urotropine | HMDB | | Vesaloin | HMDB | | Vesalvine | HMDB | | Vulkacit H 30 | HMDB | | Vulkacit H30 | HMDB | | Xametrin | HMDB | | [16]-Adamazane, inn | HMDB | | Methenamine, silver | MeSH | | Silver, hexamine | MeSH | | Silver, methenamine | MeSH |
|
|---|
| Chemical Formula | C6H12N4 |
|---|
| Average Molecular Weight | 140.1863 |
|---|
| Monoisotopic Molecular Weight | 140.106196404 |
|---|
| IUPAC Name | 1,3,5,7-tetraazatricyclo[3.3.1.1³,⁷]decane |
|---|
| Traditional Name | formin |
|---|
| CAS Registry Number | 100-97-0 |
|---|
| SMILES | C1N2CN3CN1CN(C2)C3 |
|---|
| InChI Identifier | InChI=1S/C6H12N4/c1-7-2-9-4-8(1)5-10(3-7)6-9/h1-6H2 |
|---|
| InChI Key | VKYKSIONXSXAKP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | This compound belongs to the class of organic compounds known as 1,3,5-triazinanes. These are triazinanes having three nitrogen ring atoms at the 1-, 3-, and 5- positions. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Organoheterocyclic compounds |
|---|
| Class | Triazinanes |
|---|
| Sub Class | 1,3,5-triazinanes |
|---|
| Direct Parent | 1,3,5-triazinanes |
|---|
| Alternative Parents | |
|---|
| Substituents | - 1,3,5-triazinane
- Azacycle
- Aminal
- Organic nitrogen compound
- Organopnictogen compound
- Hydrocarbon derivative
- Organonitrogen compound
- Aliphatic heteropolycyclic compound
|
|---|
| Molecular Framework | Aliphatic heteropolycyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
|
| Disposition | Source: Biological location: |
|---|
| Role | Industrial application: |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Properties | | Property | Value | Reference |
|---|
| Melting Point | > 250 °C | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | 449 mg/mL at 12 °C | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Predicted Properties | |
|---|
