Record Information |
---|
Version | 5.0 |
---|
Status | Expected but not Quantified |
---|
Creation Date | 2012-09-11 18:50:19 UTC |
---|
Update Date | 2022-03-07 02:53:58 UTC |
---|
HMDB ID | HMDB0034059 |
---|
Secondary Accession Numbers | |
---|
Metabolite Identification |
---|
Common Name | 4beta-Hydroxywithanolide E |
---|
Description | 4beta-Hydroxywithanolide E belongs to the class of organic compounds known as withanolides and derivatives. These are c28 steroids structurally characterized by an ergostane skeleton usually functionalized at carbons 1, 22 and 26 to form a lactone ring. Thus, 4beta-hydroxywithanolide e is considered to be a sterol lipid molecule. 4beta-Hydroxywithanolide E is a very hydrophobic molecule, practically insoluble (in water), and relatively neutral. |
---|
Structure | CC1=C(C)C(=O)OC(C1)C(C)(O)C1(O)CCC2(O)C3CC4OC44C(O)C=CC(=O)C4(C)C3CCC12C InChI=1S/C28H38O8/c1-14-12-20(35-22(31)15(14)2)25(5,32)27(34)11-10-26(33)17-13-21-28(36-21)19(30)7-6-18(29)24(28,4)16(17)8-9-23(26,27)3/h6-7,16-17,19-21,30,32-34H,8-13H2,1-5H3 |
---|
Synonyms | Value | Source |
---|
4b-Hydroxywithanolide e | Generator | 4Β-hydroxywithanolide e | Generator | 4-b-HYDROXY-withanolide e | HMDB | 4-beta-Hydroxy-withanolide e | HMDB | 4-beta-Hydroxywithanolide e | HMDB | 5,6b-Epoxy-4b,14a,17b,20S-tetrahydroxy-1-oxo-5b,22R-witha-2,24-dienolide | HMDB |
|
---|
Chemical Formula | C28H38O8 |
---|
Average Molecular Weight | 502.5965 |
---|
Monoisotopic Molecular Weight | 502.256668192 |
---|
IUPAC Name | 15-[1-(4,5-dimethyl-6-oxo-3,6-dihydro-2H-pyran-2-yl)-1-hydroxyethyl]-6,12,15-trihydroxy-2,16-dimethyl-8-oxapentacyclo[9.7.0.0²,⁷.0⁷,⁹.0¹²,¹⁶]octadec-4-en-3-one |
---|
Traditional Name | 15-[1-(4,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl)-1-hydroxyethyl]-6,12,15-trihydroxy-2,16-dimethyl-8-oxapentacyclo[9.7.0.0²,⁷.0⁷,⁹.0¹²,¹⁶]octadec-4-en-3-one |
---|
CAS Registry Number | 54334-04-2 |
---|
SMILES | CC1=C(C)C(=O)OC(C1)C(C)(O)C1(O)CCC2(O)C3CC4OC44C(O)C=CC(=O)C4(C)C3CCC12C |
---|
InChI Identifier | InChI=1S/C28H38O8/c1-14-12-20(35-22(31)15(14)2)25(5,32)27(34)11-10-26(33)17-13-21-28(36-21)19(30)7-6-18(29)24(28,4)16(17)8-9-23(26,27)3/h6-7,16-17,19-21,30,32-34H,8-13H2,1-5H3 |
---|
InChI Key | UPBUGICUKQIKTJ-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Description | Belongs to the class of organic compounds known as withanolides and derivatives. These are c28 steroids structurally characterized by an ergostane skeleton usually functionalized at carbons 1, 22 and 26 to form a lactone ring. |
---|
Kingdom | Organic compounds |
---|
Super Class | Lipids and lipid-like molecules |
---|
Class | Steroids and steroid derivatives |
---|
Sub Class | Steroid lactones |
---|
Direct Parent | Withanolides and derivatives |
---|
Alternative Parents | |
---|
Substituents | - Withanolide-skeleton
- 5,6-epoxysteroid
- Dihydropyranone
- Oxepane
- Cyclohexenone
- Pyran
- Alpha,beta-unsaturated carboxylic ester
- Enoate ester
- Cyclic alcohol
- Tertiary alcohol
- Carboxylic acid ester
- Ketone
- Secondary alcohol
- Lactone
- Oxacycle
- Carboxylic acid derivative
- Organoheterocyclic compound
- Dialkyl ether
- Oxirane
- Ether
- Polyol
- Monocarboxylic acid or derivatives
- Carbonyl group
- Organic oxide
- Organic oxygen compound
- Hydrocarbon derivative
- Alcohol
- Organooxygen compound
- Aliphatic heteropolycyclic compound
|
---|
Molecular Framework | Aliphatic heteropolycyclic compounds |
---|
External Descriptors | Not Available |
---|
Ontology |
---|
Physiological effect | Not Available |
---|
Disposition | |
---|
Process | |
---|
Role | |
---|
Physical Properties |
---|
State | Solid |
---|
Experimental Molecular Properties | Property | Value | Reference |
---|
Melting Point | 205 - 214 °C | Not Available | Boiling Point | Not Available | Not Available | Water Solubility | Not Available | Not Available | LogP | Not Available | Not Available |
|
---|
Experimental Chromatographic Properties | Not Available |
---|
Predicted Molecular Properties | |
---|
Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Kovats Retention IndicesUnderivatizedDerivatizedDerivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
---|
4beta-Hydroxywithanolide E,1TMS,isomer #1 | CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C)C2(O)CCC3(O)C4CC5OC56C(O)C=CC(=O)C6(C)C4CCC32C)C1 | 4206.1 | Semi standard non polar | 33892256 | 4beta-Hydroxywithanolide E,1TMS,isomer #2 | CC1=C(C)C(=O)OC(C(C)(O)C2(O[Si](C)(C)C)CCC3(O)C4CC5OC56C(O)C=CC(=O)C6(C)C4CCC32C)C1 | 4217.7 | Semi standard non polar | 33892256 | 4beta-Hydroxywithanolide E,1TMS,isomer #3 | CC1=C(C)C(=O)OC(C(C)(O)C2(O)CCC3(O[Si](C)(C)C)C4CC5OC56C(O)C=CC(=O)C6(C)C4CCC32C)C1 | 4233.4 | Semi standard non polar | 33892256 | 4beta-Hydroxywithanolide E,1TMS,isomer #4 | CC1=C(C)C(=O)OC(C(C)(O)C2(O)CCC3(O)C4CC5OC56C(O[Si](C)(C)C)C=CC(=O)C6(C)C4CCC32C)C1 | 4226.0 | Semi standard non polar | 33892256 | 4beta-Hydroxywithanolide E,2TMS,isomer #1 | CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C)C2(O[Si](C)(C)C)CCC3(O)C4CC5OC56C(O)C=CC(=O)C6(C)C4CCC32C)C1 | 4185.0 | Semi standard non polar | 33892256 | 4beta-Hydroxywithanolide E,2TMS,isomer #2 | CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C)C2(O)CCC3(O[Si](C)(C)C)C4CC5OC56C(O)C=CC(=O)C6(C)C4CCC32C)C1 | 4204.1 | Semi standard non polar | 33892256 | 4beta-Hydroxywithanolide E,2TMS,isomer #3 | CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C)C2(O)CCC3(O)C4CC5OC56C(O[Si](C)(C)C)C=CC(=O)C6(C)C4CCC32C)C1 | 4166.5 | Semi standard non polar | 33892256 | 4beta-Hydroxywithanolide E,2TMS,isomer #4 | CC1=C(C)C(=O)OC(C(C)(O)C2(O[Si](C)(C)C)CCC3(O[Si](C)(C)C)C4CC5OC56C(O)C=CC(=O)C6(C)C4CCC32C)C1 | 4204.8 | Semi standard non polar | 33892256 | 4beta-Hydroxywithanolide E,2TMS,isomer #5 | CC1=C(C)C(=O)OC(C(C)(O)C2(O[Si](C)(C)C)CCC3(O)C4CC5OC56C(O[Si](C)(C)C)C=CC(=O)C6(C)C4CCC32C)C1 | 4180.3 | Semi standard non polar | 33892256 | 4beta-Hydroxywithanolide E,2TMS,isomer #6 | CC1=C(C)C(=O)OC(C(C)(O)C2(O)CCC3(O[Si](C)(C)C)C4CC5OC56C(O[Si](C)(C)C)C=CC(=O)C6(C)C4CCC32C)C1 | 4191.7 | Semi standard non polar | 33892256 | 4beta-Hydroxywithanolide E,3TMS,isomer #1 | CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C)C2(O[Si](C)(C)C)CCC3(O[Si](C)(C)C)C4CC5OC56C(O)C=CC(=O)C6(C)C4CCC32C)C1 | 4165.5 | Semi standard non polar | 33892256 | 4beta-Hydroxywithanolide E,3TMS,isomer #2 | CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C)C2(O[Si](C)(C)C)CCC3(O)C4CC5OC56C(O[Si](C)(C)C)C=CC(=O)C6(C)C4CCC32C)C1 | 4115.2 | Semi standard non polar | 33892256 | 4beta-Hydroxywithanolide E,3TMS,isomer #3 | CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C)C2(O)CCC3(O[Si](C)(C)C)C4CC5OC56C(O[Si](C)(C)C)C=CC(=O)C6(C)C4CCC32C)C1 | 4113.0 | Semi standard non polar | 33892256 | 4beta-Hydroxywithanolide E,3TMS,isomer #4 | CC1=C(C)C(=O)OC(C(C)(O)C2(O[Si](C)(C)C)CCC3(O[Si](C)(C)C)C4CC5OC56C(O[Si](C)(C)C)C=CC(=O)C6(C)C4CCC32C)C1 | 4116.0 | Semi standard non polar | 33892256 | 4beta-Hydroxywithanolide E,4TMS,isomer #1 | CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C)C2(O[Si](C)(C)C)CCC3(O[Si](C)(C)C)C4CC5OC56C(O[Si](C)(C)C)C=CC(=O)C6(C)C4CCC32C)C1 | 4054.4 | Semi standard non polar | 33892256 | 4beta-Hydroxywithanolide E,1TBDMS,isomer #1 | CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C(C)(C)C)C2(O)CCC3(O)C4CC5OC56C(O)C=CC(=O)C6(C)C4CCC32C)C1 | 4435.7 | Semi standard non polar | 33892256 | 4beta-Hydroxywithanolide E,1TBDMS,isomer #2 | CC1=C(C)C(=O)OC(C(C)(O)C2(O[Si](C)(C)C(C)(C)C)CCC3(O)C4CC5OC56C(O)C=CC(=O)C6(C)C4CCC32C)C1 | 4444.2 | Semi standard non polar | 33892256 | 4beta-Hydroxywithanolide E,1TBDMS,isomer #3 | CC1=C(C)C(=O)OC(C(C)(O)C2(O)CCC3(O[Si](C)(C)C(C)(C)C)C4CC5OC56C(O)C=CC(=O)C6(C)C4CCC32C)C1 | 4453.9 | Semi standard non polar | 33892256 | 4beta-Hydroxywithanolide E,1TBDMS,isomer #4 | CC1=C(C)C(=O)OC(C(C)(O)C2(O)CCC3(O)C4CC5OC56C(O[Si](C)(C)C(C)(C)C)C=CC(=O)C6(C)C4CCC32C)C1 | 4458.1 | Semi standard non polar | 33892256 | 4beta-Hydroxywithanolide E,2TBDMS,isomer #1 | CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C(C)(C)C)C2(O[Si](C)(C)C(C)(C)C)CCC3(O)C4CC5OC56C(O)C=CC(=O)C6(C)C4CCC32C)C1 | 4653.0 | Semi standard non polar | 33892256 | 4beta-Hydroxywithanolide E,2TBDMS,isomer #2 | CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C(C)(C)C)C2(O)CCC3(O[Si](C)(C)C(C)(C)C)C4CC5OC56C(O)C=CC(=O)C6(C)C4CCC32C)C1 | 4659.3 | Semi standard non polar | 33892256 | 4beta-Hydroxywithanolide E,2TBDMS,isomer #3 | CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C(C)(C)C)C2(O)CCC3(O)C4CC5OC56C(O[Si](C)(C)C(C)(C)C)C=CC(=O)C6(C)C4CCC32C)C1 | 4628.5 | Semi standard non polar | 33892256 | 4beta-Hydroxywithanolide E,2TBDMS,isomer #4 | CC1=C(C)C(=O)OC(C(C)(O)C2(O[Si](C)(C)C(C)(C)C)CCC3(O[Si](C)(C)C(C)(C)C)C4CC5OC56C(O)C=CC(=O)C6(C)C4CCC32C)C1 | 4655.6 | Semi standard non polar | 33892256 | 4beta-Hydroxywithanolide E,2TBDMS,isomer #5 | CC1=C(C)C(=O)OC(C(C)(O)C2(O[Si](C)(C)C(C)(C)C)CCC3(O)C4CC5OC56C(O[Si](C)(C)C(C)(C)C)C=CC(=O)C6(C)C4CCC32C)C1 | 4639.4 | Semi standard non polar | 33892256 | 4beta-Hydroxywithanolide E,2TBDMS,isomer #6 | CC1=C(C)C(=O)OC(C(C)(O)C2(O)CCC3(O[Si](C)(C)C(C)(C)C)C4CC5OC56C(O[Si](C)(C)C(C)(C)C)C=CC(=O)C6(C)C4CCC32C)C1 | 4649.6 | Semi standard non polar | 33892256 | 4beta-Hydroxywithanolide E,3TBDMS,isomer #1 | CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C(C)(C)C)C2(O[Si](C)(C)C(C)(C)C)CCC3(O[Si](C)(C)C(C)(C)C)C4CC5OC56C(O)C=CC(=O)C6(C)C4CCC32C)C1 | 4828.1 | Semi standard non polar | 33892256 | 4beta-Hydroxywithanolide E,3TBDMS,isomer #2 | CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C(C)(C)C)C2(O[Si](C)(C)C(C)(C)C)CCC3(O)C4CC5OC56C(O[Si](C)(C)C(C)(C)C)C=CC(=O)C6(C)C4CCC32C)C1 | 4801.4 | Semi standard non polar | 33892256 | 4beta-Hydroxywithanolide E,3TBDMS,isomer #3 | CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C(C)(C)C)C2(O)CCC3(O[Si](C)(C)C(C)(C)C)C4CC5OC56C(O[Si](C)(C)C(C)(C)C)C=CC(=O)C6(C)C4CCC32C)C1 | 4792.5 | Semi standard non polar | 33892256 | 4beta-Hydroxywithanolide E,3TBDMS,isomer #4 | CC1=C(C)C(=O)OC(C(C)(O)C2(O[Si](C)(C)C(C)(C)C)CCC3(O[Si](C)(C)C(C)(C)C)C4CC5OC56C(O[Si](C)(C)C(C)(C)C)C=CC(=O)C6(C)C4CCC32C)C1 | 4779.3 | Semi standard non polar | 33892256 |
|
---|