Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2012-09-11 22:35:50 UTC

Update Date

2022-03-07 02:55:17 UTC

HMDB ID

HMDB0037356

Secondary Accession Numbers

HMDB37356

Metabolite Identification

Common Name

Quercetin 4',7-diglucoside

Description

Quercetin 4',7-diglucoside belongs to the class of organic compounds known as flavonoid-7-o-glycosides. These are phenolic compounds containing a flavonoid moiety which is O-glycosidically linked to carbohydrate moiety at the C7-position. Quercetin 4',7-diglucoside is found, on average, in the highest concentration within garden onion (var.). Quercetin 4',7-diglucoside has also been detected, but not quantified in, several different foods, such as red onion, garden onions (Allium cepa), welsh onions (Allium fistulosum), shallots (Allium ascalonicum), and onion-family vegetables. This could make quercetin 4',7-diglucoside a potential biomarker for the consumption of these foods. Based on a literature review very few articles have been published on Quercetin 4',7-diglucoside.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI


  Mrv0541 05061309442D          

 44 48  0  0  0  0            999 V2000
    3.5724   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2868    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0013   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    4.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    2.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2868   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    4.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4302    3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4302    2.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0  0  0  0
  8  1  1  0  0  0  0
  8  3  2  0  0  0  0
  9  4  2  0  0  0  0
  9  5  1  0  0  0  0
 10  3  1  0  0  0  0
 11  4  1  0  0  0  0
 12  2  1  0  0  0  0
 12 10  2  0  0  0  0
 13  5  2  0  0  0  0
 14  6  1  0  0  0  0
 15  7  1  0  0  0  0
 16 11  2  0  0  0  0
 16 13  1  0  0  0  0
 17 14  1  0  0  0  0
 18 15  1  0  0  0  0
 19 16  1  0  0  0  0
 20 17  1  0  0  0  0
 21 18  1  0  0  0  0
 22 19  1  0  0  0  0
 23 20  1  0  0  0  0
 24 21  1  0  0  0  0
 25  8  1  0  0  0  0
 25 22  2  0  0  0  0
 26 23  1  0  0  0  0
 27 24  1  0  0  0  0
 28  6  1  0  0  0  0
 29  7  1  0  0  0  0
 30 10  1  0  0  0  0
 31 11  1  0  0  0  0
 32 17  1  0  0  0  0
 33 18  1  0  0  0  0
 34 19  2  0  0  0  0
 35 20  1  0  0  0  0
 36 21  1  0  0  0  0
 37 22  1  0  0  0  0
 38 23  1  0  0  0  0
 39 24  1  0  0  0  0
 40  9  1  0  0  0  0
 40 26  1  0  0  0  0
 41 13  1  0  0  0  0
 41 25  1  0  0  0  0
 42 12  1  0  0  0  0
 42 27  1  0  0  0  0
 43 14  1  0  0  0  0
 43 26  1  0  0  0  0
 44 15  1  0  0  0  0
 44 27  1  0  0  0  0
M  END

HMDB0037356
     RDKit          3D
Quercetin 4',7-diglucoside
 74 78  0  0  0  0  0  0  0  0999 V2000
    1.0948    0.4233   -4.4075 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.9155    0.3241   -3.1787 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3518    0.2154   -2.5965 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4114    0.2235   -3.4635 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5263    0.1080   -1.2462 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8223   -0.0069   -0.6024 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8533   -0.0756    0.8033 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0377   -0.1932    1.4787 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2853   -0.2530    0.8373 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3996   -0.3704    1.6141 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7372   -0.4674    1.3509 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2141   -1.6266    1.9789 O   0  0  0  0  0  0  0  0  0  0  0  0
   -8.5426   -1.8801    1.7780 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8545   -2.7020    0.5541 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.4375   -2.1064   -0.6092 O   0  0  0  0  0  0  0  0  0  0  0  0
   -9.4036   -0.6355    1.8755 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.6198   -0.0264    0.6637 O   0  0  0  0  0  0  0  0  0  0  0  0
   -8.5985    0.3386    2.7440 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.0940   -0.3648    3.8518 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4205    0.7853    1.9268 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8386    1.6333    0.9032 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2509   -0.1860   -0.5264 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4437   -0.2390   -1.2280 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0309   -0.0653   -1.2120 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5776    0.1126   -0.5072 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7887    0.2117   -1.0013 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8730    0.2048   -0.1335 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1953    0.3054   -0.5836 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2374    0.2941    0.3083 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5645    0.3642   -0.0323 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1598    1.4672    0.5940 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4112    1.7212    0.0986 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3651    2.2424    1.1622 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5301    1.3353    2.2088 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0204    0.5984   -0.6690 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4234    0.7670   -0.6206 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7284   -0.7614   -0.1228 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7668   -1.6414   -1.2310 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3597   -0.8431    0.4915 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3491   -0.8318    1.8704 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3421    0.4112   -1.9372 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2890    0.4214   -2.8237 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4603    0.5302   -4.2005 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9984    0.3212   -2.3592 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2967    0.3019   -4.4569 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8976   -0.0308    1.3246 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0475   -0.2445    2.5701 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0363   -0.4950    0.2897 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8741   -2.5184    2.6528 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.3945   -3.7061    0.6657 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.9579   -2.8555    0.4939 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.3360   -2.7520   -1.3371 H   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3491   -0.8179    2.4264 H   0  0  0  0  0  0  0  0  0  0  0  0
  -10.5859    0.1907    0.5985 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.2290    1.1928    3.0507 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9249    0.2260    4.6310 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7460    1.3621    2.5710 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7150    1.1627    0.0225 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3962   -0.1875   -2.2343 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0938   -0.0207   -2.2839 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7156    0.1202    0.9254 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.8039    0.4123   -1.1057 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.3000    2.5803   -0.6277 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.9878    3.2224    1.5210 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.3719    2.4313    0.7375 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.0635    1.7815    2.8959 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.7766    0.6628   -1.7682 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.7998    1.1010   -1.4509 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.5260   -1.1342    0.5580 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.0724   -1.2701   -1.8649 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.8776   -1.7886    0.1706 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.5843   -1.7507    2.1770 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3360    0.4953   -2.3690 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3887    0.6050   -4.5855 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  3  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 13 16  1  0
 16 17  1  0
 16 18  1  0
 18 19  1  0
 18 20  1  0
 20 21  1  0
  9 22  1  0
 22 23  1  0
 22 24  2  0
  5 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 32 35  1  0
 35 36  1  0
 35 37  1  0
 37 38  1  0
 37 39  1  0
 39 40  1  0
 28 41  2  0
 41 42  1  0
 42 43  1  0
 42 44  2  0
 44  2  1  0
 24  6  1  0
 44 26  1  0
 20 11  1  0
 39 30  1  0
  4 45  1  0
  7 46  1  0
  8 47  1  0
 11 48  1  0
 13 49  1  0
 14 50  1  0
 14 51  1  0
 15 52  1  0
 16 53  1  0
 17 54  1  0
 18 55  1  0
 19 56  1  0
 20 57  1  0
 21 58  1  0
 23 59  1  0
 24 60  1  0
 27 61  1  0
 30 62  1  0
 32 63  1  0
 33 64  1  0
 33 65  1  0
 34 66  1  0
 35 67  1  0
 36 68  1  0
 37 69  1  0
 38 70  1  0
 39 71  1  0
 40 72  1  0
 41 73  1  0
 43 74  1  0
M  END


  Mrv0541 05061309442D          

 44 48  0  0  0  0            999 V2000
    3.5724   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2868    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0013   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    4.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    2.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2868   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    4.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4302    3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4302    2.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0  0  0  0
  8  1  1  0  0  0  0
  8  3  2  0  0  0  0
  9  4  2  0  0  0  0
  9  5  1  0  0  0  0
 10  3  1  0  0  0  0
 11  4  1  0  0  0  0
 12  2  1  0  0  0  0
 12 10  2  0  0  0  0
 13  5  2  0  0  0  0
 14  6  1  0  0  0  0
 15  7  1  0  0  0  0
 16 11  2  0  0  0  0
 16 13  1  0  0  0  0
 17 14  1  0  0  0  0
 18 15  1  0  0  0  0
 19 16  1  0  0  0  0
 20 17  1  0  0  0  0
 21 18  1  0  0  0  0
 22 19  1  0  0  0  0
 23 20  1  0  0  0  0
 24 21  1  0  0  0  0
 25  8  1  0  0  0  0
 25 22  2  0  0  0  0
 26 23  1  0  0  0  0
 27 24  1  0  0  0  0
 28  6  1  0  0  0  0
 29  7  1  0  0  0  0
 30 10  1  0  0  0  0
 31 11  1  0  0  0  0
 32 17  1  0  0  0  0
 33 18  1  0  0  0  0
 34 19  2  0  0  0  0
 35 20  1  0  0  0  0
 36 21  1  0  0  0  0
 37 22  1  0  0  0  0
 38 23  1  0  0  0  0
 39 24  1  0  0  0  0
 40  9  1  0  0  0  0
 40 26  1  0  0  0  0
 41 13  1  0  0  0  0
 41 25  1  0  0  0  0
 42 12  1  0  0  0  0
 42 27  1  0  0  0  0
 43 14  1  0  0  0  0
 43 26  1  0  0  0  0
 44 15  1  0  0  0  0
 44 27  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0037356

> <DATABASE_NAME>
hmdb

> <SMILES>
OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(OC3=C2)C2=CC(O)=C(OC3OC(CO)C(O)C(O)C3O)C=C2)C(O)C(O)C1O

> <INCHI_IDENTIFIER>
InChI=1S/C27H30O17/c28-6-14-17(32)20(35)23(38)26(43-14)40-9-4-11(31)16-13(5-9)41-25(22(37)19(16)34)8-1-2-12(10(30)3-8)42-27-24(39)21(36)18(33)15(7-29)44-27/h1-5,14-15,17-18,20-21,23-24,26-33,35-39H,6-7H2

> <INCHI_KEY>
QZXHFNCQMMUANB-UHFFFAOYSA-N

> <FORMULA>
C27H30O17

> <MOLECULAR_WEIGHT>
626.5169

> <EXACT_MASS>
626.148299534

> <JCHEM_ACCEPTOR_COUNT>
17

> <JCHEM_AVERAGE_POLARIZABILITY>
59.50370745549236

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
11

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
3,5-dihydroxy-2-(3-hydroxy-4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}phenyl)-7-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-4H-chromen-4-one

> <ALOGPS_LOGP>
-0.81

> <JCHEM_LOGP>
-2.3798367226666675

> <ALOGPS_LOGS>
-2.29

> <JCHEM_MDDR_LIKE_RULE>
1

> <JCHEM_NUMBER_OF_RINGS>
5

> <JCHEM_PHYSIOLOGICAL_CHARGE>
0

> <JCHEM_PKA>
9.032523294201432

> <JCHEM_PKA_STRONGEST_ACIDIC>
8.080854766332763

> <JCHEM_PKA_STRONGEST_BASIC>
-3.6483953658733803

> <JCHEM_POLAR_SURFACE_AREA>
285.75

> <JCHEM_REFRACTIVITY>
141.15099999999995

> <JCHEM_ROTATABLE_BOND_COUNT>
7

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
3.23e+00 g/l

> <JCHEM_TRADITIONAL_IUPAC>
3,5-dihydroxy-2-(3-hydroxy-4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}phenyl)-7-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}chromen-4-one

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0037356
     RDKit          3D
Quercetin 4',7-diglucoside
 74 78  0  0  0  0  0  0  0  0999 V2000
    1.0948    0.4233   -4.4075 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.9155    0.3241   -3.1787 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3518    0.2154   -2.5965 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4114    0.2235   -3.4635 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5263    0.1080   -1.2462 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8223   -0.0069   -0.6024 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8533   -0.0756    0.8033 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0377   -0.1932    1.4787 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2853   -0.2530    0.8373 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3996   -0.3704    1.6141 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7372   -0.4674    1.3509 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2141   -1.6266    1.9789 O   0  0  0  0  0  0  0  0  0  0  0  0
   -8.5426   -1.8801    1.7780 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8545   -2.7020    0.5541 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.4375   -2.1064   -0.6092 O   0  0  0  0  0  0  0  0  0  0  0  0
   -9.4036   -0.6355    1.8755 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.6198   -0.0264    0.6637 O   0  0  0  0  0  0  0  0  0  0  0  0
   -8.5985    0.3386    2.7440 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.0940   -0.3648    3.8518 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4205    0.7853    1.9268 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8386    1.6333    0.9032 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2509   -0.1860   -0.5264 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4437   -0.2390   -1.2280 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0309   -0.0653   -1.2120 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5776    0.1126   -0.5072 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7887    0.2117   -1.0013 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8730    0.2048   -0.1335 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1953    0.3054   -0.5836 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2374    0.2941    0.3083 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5645    0.3642   -0.0323 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1598    1.4672    0.5940 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4112    1.7212    0.0986 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3651    2.2424    1.1622 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5301    1.3353    2.2088 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0204    0.5984   -0.6690 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4234    0.7670   -0.6206 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7284   -0.7614   -0.1228 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7668   -1.6414   -1.2310 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3597   -0.8431    0.4915 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3491   -0.8318    1.8704 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3421    0.4112   -1.9372 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2890    0.4214   -2.8237 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4603    0.5302   -4.2005 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9984    0.3212   -2.3592 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2967    0.3019   -4.4569 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8976   -0.0308    1.3246 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0475   -0.2445    2.5701 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0363   -0.4950    0.2897 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8741   -2.5184    2.6528 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.3945   -3.7061    0.6657 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.9579   -2.8555    0.4939 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.3360   -2.7520   -1.3371 H   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3491   -0.8179    2.4264 H   0  0  0  0  0  0  0  0  0  0  0  0
  -10.5859    0.1907    0.5985 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.2290    1.1928    3.0507 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9249    0.2260    4.6310 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7460    1.3621    2.5710 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7150    1.1627    0.0225 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3962   -0.1875   -2.2343 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0938   -0.0207   -2.2839 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7156    0.1202    0.9254 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.8039    0.4123   -1.1057 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.3000    2.5803   -0.6277 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.9878    3.2224    1.5210 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.3719    2.4313    0.7375 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.0635    1.7815    2.8959 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.7766    0.6628   -1.7682 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.7998    1.1010   -1.4509 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.5260   -1.1342    0.5580 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.0724   -1.2701   -1.8649 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.8776   -1.7886    0.1706 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.5843   -1.7507    2.1770 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3360    0.4953   -2.3690 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3887    0.6050   -4.5855 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  3  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 13 16  1  0
 16 17  1  0
 16 18  1  0
 18 19  1  0
 18 20  1  0
 20 21  1  0
  9 22  1  0
 22 23  1  0
 22 24  2  0
  5 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 32 35  1  0
 35 36  1  0
 35 37  1  0
 37 38  1  0
 37 39  1  0
 39 40  1  0
 28 41  2  0
 41 42  1  0
 42 43  1  0
 42 44  2  0
 44  2  1  0
 24  6  1  0
 44 26  1  0
 20 11  1  0
 39 30  1  0
  4 45  1  0
  7 46  1  0
  8 47  1  0
 11 48  1  0
 13 49  1  0
 14 50  1  0
 14 51  1  0
 15 52  1  0
 16 53  1  0
 17 54  1  0
 18 55  1  0
 19 56  1  0
 20 57  1  0
 21 58  1  0
 23 59  1  0
 24 60  1  0
 27 61  1  0
 30 62  1  0
 32 63  1  0
 33 64  1  0
 33 65  1  0
 34 66  1  0
 35 67  1  0
 36 68  1  0
 37 69  1  0
 38 70  1  0
 39 71  1  0
 40 72  1  0
 41 73  1  0
 43 74  1  0
M  END

HEADER    PROTEIN                                 06-MAY-13   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   06-MAY-13         0                                  
HETATM    1  C   UNK     0       6.668  -0.770   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0       8.002   0.000   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0       5.335   1.540   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0      -1.334  -2.310   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0       0.000   0.000   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0      -8.002   0.000   0.000  0.00  0.00           C+0
HETATM    7  C   UNK     0       6.668   6.930   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0       5.335   0.000   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0      -1.334  -0.770   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0       6.668   2.310   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0       0.000  -3.080   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0       8.002   1.540   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0       1.334  -0.770   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0      -6.668  -0.770   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0       8.002   6.160   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0       1.334  -2.310   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0      -6.668  -2.310   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0       9.336   6.930   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0       2.667  -3.080   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0      -5.335  -3.080   0.000  0.00  0.00           C+0
HETATM   21  C   UNK     0      10.669   6.160   0.000  0.00  0.00           C+0
HETATM   22  C   UNK     0       4.001  -2.310   0.000  0.00  0.00           C+0
HETATM   23  C   UNK     0      -4.001  -2.310   0.000  0.00  0.00           C+0
HETATM   24  C   UNK     0      10.669   4.620   0.000  0.00  0.00           C+0
HETATM   25  C   UNK     0       4.001  -0.770   0.000  0.00  0.00           C+0
HETATM   26  C   UNK     0      -4.001  -0.770   0.000  0.00  0.00           C+0
HETATM   27  C   UNK     0       9.336   3.850   0.000  0.00  0.00           C+0
HETATM   28  O   UNK     0      -9.336  -0.770   0.000  0.00  0.00           O+0
HETATM   29  O   UNK     0       6.668   8.470   0.000  0.00  0.00           O+0
HETATM   30  O   UNK     0       6.668   3.850   0.000  0.00  0.00           O+0
HETATM   31  O   UNK     0       0.000  -4.620   0.000  0.00  0.00           O+0
HETATM   32  O   UNK     0      -8.002  -3.080   0.000  0.00  0.00           O+0
HETATM   33  O   UNK     0       9.336   8.470   0.000  0.00  0.00           O+0
HETATM   34  O   UNK     0       2.667  -4.620   0.000  0.00  0.00           O+0
HETATM   35  O   UNK     0      -5.335  -4.620   0.000  0.00  0.00           O+0
HETATM   36  O   UNK     0      12.003   6.930   0.000  0.00  0.00           O+0
HETATM   37  O   UNK     0       5.335  -3.080   0.000  0.00  0.00           O+0
HETATM   38  O   UNK     0      -2.667  -3.080   0.000  0.00  0.00           O+0
HETATM   39  O   UNK     0      12.003   3.850   0.000  0.00  0.00           O+0
HETATM   40  O   UNK     0      -2.667   0.000   0.000  0.00  0.00           O+0
HETATM   41  O   UNK     0       2.667   0.000   0.000  0.00  0.00           O+0
HETATM   42  O   UNK     0       9.336   2.310   0.000  0.00  0.00           O+0
HETATM   43  O   UNK     0      -5.335   0.000   0.000  0.00  0.00           O+0
HETATM   44  O   UNK     0       8.002   4.620   0.000  0.00  0.00           O+0
CONECT    1    2    8                                                       
CONECT    2    1   12                                                       
CONECT    3    8   10                                                       
CONECT    4    9   11                                                       
CONECT    5    9   13                                                       
CONECT    6   14   28                                                       
CONECT    7   15   29                                                       
CONECT    8    1    3   25                                                  
CONECT    9    4    5   40                                                  
CONECT   10    3   12   30                                                  
CONECT   11    4   16   31                                                  
CONECT   12    2   10   42                                                  
CONECT   13    5   16   41                                                  
CONECT   14    6   17   43                                                  
CONECT   15    7   18   44                                                  
CONECT   16   11   13   19                                                  
CONECT   17   14   20   32                                                  
CONECT   18   15   21   33                                                  
CONECT   19   16   22   34                                                  
CONECT   20   17   23   35                                                  
CONECT   21   18   24   36                                                  
CONECT   22   19   25   37                                                  
CONECT   23   20   26   38                                                  
CONECT   24   21   27   39                                                  
CONECT   25    8   22   41                                                  
CONECT   26   23   40   43                                                  
CONECT   27   24   42   44                                                  
CONECT   28    6                                                            
CONECT   29    7                                                            
CONECT   30   10                                                            
CONECT   31   11                                                            
CONECT   32   17                                                            
CONECT   33   18                                                            
CONECT   34   19                                                            
CONECT   35   20                                                            
CONECT   36   21                                                            
CONECT   37   22                                                            
CONECT   38   23                                                            
CONECT   39   24                                                            
CONECT   40    9   26                                                       
CONECT   41   13   25                                                       
CONECT   42   12   27                                                       
CONECT   43   14   26                                                       
CONECT   44   15   27                                                       
MASTER        0    0    0    0    0    0    0    0   44    0   96    0
END

COMPND    HMDB0037356
HETATM    1  O1  UNL     1       1.095   0.423  -4.408  1.00  0.00           O  
HETATM    2  C1  UNL     1       0.915   0.324  -3.179  1.00  0.00           C  
HETATM    3  C2  UNL     1      -0.352   0.215  -2.597  1.00  0.00           C  
HETATM    4  O2  UNL     1      -1.411   0.224  -3.463  1.00  0.00           O  
HETATM    5  C3  UNL     1      -0.526   0.108  -1.246  1.00  0.00           C  
HETATM    6  C4  UNL     1      -1.822  -0.007  -0.602  1.00  0.00           C  
HETATM    7  C5  UNL     1      -1.853  -0.076   0.803  1.00  0.00           C  
HETATM    8  C6  UNL     1      -3.038  -0.193   1.479  1.00  0.00           C  
HETATM    9  C7  UNL     1      -4.285  -0.253   0.837  1.00  0.00           C  
HETATM   10  O3  UNL     1      -5.400  -0.370   1.614  1.00  0.00           O  
HETATM   11  C8  UNL     1      -6.737  -0.467   1.351  1.00  0.00           C  
HETATM   12  O4  UNL     1      -7.214  -1.627   1.979  1.00  0.00           O  
HETATM   13  C9  UNL     1      -8.543  -1.880   1.778  1.00  0.00           C  
HETATM   14  C10 UNL     1      -8.854  -2.702   0.554  1.00  0.00           C  
HETATM   15  O5  UNL     1      -8.437  -2.106  -0.609  1.00  0.00           O  
HETATM   16  C11 UNL     1      -9.404  -0.635   1.875  1.00  0.00           C  
HETATM   17  O6  UNL     1      -9.620  -0.026   0.664  1.00  0.00           O  
HETATM   18  C12 UNL     1      -8.599   0.339   2.744  1.00  0.00           C  
HETATM   19  O7  UNL     1      -8.094  -0.365   3.852  1.00  0.00           O  
HETATM   20  C13 UNL     1      -7.421   0.785   1.927  1.00  0.00           C  
HETATM   21  O8  UNL     1      -7.839   1.633   0.903  1.00  0.00           O  
HETATM   22  C14 UNL     1      -4.251  -0.186  -0.526  1.00  0.00           C  
HETATM   23  O9  UNL     1      -5.444  -0.239  -1.228  1.00  0.00           O  
HETATM   24  C15 UNL     1      -3.031  -0.065  -1.212  1.00  0.00           C  
HETATM   25  O10 UNL     1       0.578   0.113  -0.507  1.00  0.00           O  
HETATM   26  C16 UNL     1       1.789   0.212  -1.001  1.00  0.00           C  
HETATM   27  C17 UNL     1       2.873   0.205  -0.134  1.00  0.00           C  
HETATM   28  C18 UNL     1       4.195   0.305  -0.584  1.00  0.00           C  
HETATM   29  O11 UNL     1       5.237   0.294   0.308  1.00  0.00           O  
HETATM   30  C19 UNL     1       6.564   0.364  -0.032  1.00  0.00           C  
HETATM   31  O12 UNL     1       7.160   1.467   0.594  1.00  0.00           O  
HETATM   32  C20 UNL     1       8.411   1.721   0.099  1.00  0.00           C  
HETATM   33  C21 UNL     1       9.365   2.242   1.162  1.00  0.00           C  
HETATM   34  O13 UNL     1       9.530   1.335   2.209  1.00  0.00           O  
HETATM   35  C22 UNL     1       9.020   0.598  -0.669  1.00  0.00           C  
HETATM   36  O14 UNL     1      10.423   0.767  -0.621  1.00  0.00           O  
HETATM   37  C23 UNL     1       8.728  -0.761  -0.123  1.00  0.00           C  
HETATM   38  O15 UNL     1       8.767  -1.641  -1.231  1.00  0.00           O  
HETATM   39  C24 UNL     1       7.360  -0.843   0.491  1.00  0.00           C  
HETATM   40  O16 UNL     1       7.349  -0.832   1.870  1.00  0.00           O  
HETATM   41  C25 UNL     1       4.342   0.411  -1.937  1.00  0.00           C  
HETATM   42  C26 UNL     1       3.289   0.421  -2.824  1.00  0.00           C  
HETATM   43  O17 UNL     1       3.460   0.530  -4.201  1.00  0.00           O  
HETATM   44  C27 UNL     1       1.998   0.321  -2.359  1.00  0.00           C  
HETATM   45  H1  UNL     1      -1.297   0.302  -4.457  1.00  0.00           H  
HETATM   46  H2  UNL     1      -0.898  -0.031   1.325  1.00  0.00           H  
HETATM   47  H3  UNL     1      -3.048  -0.245   2.570  1.00  0.00           H  
HETATM   48  H4  UNL     1      -7.036  -0.495   0.290  1.00  0.00           H  
HETATM   49  H5  UNL     1      -8.874  -2.518   2.653  1.00  0.00           H  
HETATM   50  H6  UNL     1      -8.395  -3.706   0.666  1.00  0.00           H  
HETATM   51  H7  UNL     1      -9.958  -2.855   0.494  1.00  0.00           H  
HETATM   52  H8  UNL     1      -8.336  -2.752  -1.337  1.00  0.00           H  
HETATM   53  H9  UNL     1     -10.349  -0.818   2.426  1.00  0.00           H  
HETATM   54  H10 UNL     1     -10.586   0.191   0.599  1.00  0.00           H  
HETATM   55  H11 UNL     1      -9.229   1.193   3.051  1.00  0.00           H  
HETATM   56  H12 UNL     1      -7.925   0.226   4.631  1.00  0.00           H  
HETATM   57  H13 UNL     1      -6.746   1.362   2.571  1.00  0.00           H  
HETATM   58  H14 UNL     1      -7.715   1.163   0.022  1.00  0.00           H  
HETATM   59  H15 UNL     1      -5.396  -0.187  -2.234  1.00  0.00           H  
HETATM   60  H16 UNL     1      -3.094  -0.021  -2.284  1.00  0.00           H  
HETATM   61  H17 UNL     1       2.716   0.120   0.925  1.00  0.00           H  
HETATM   62  H18 UNL     1       6.804   0.412  -1.106  1.00  0.00           H  
HETATM   63  H19 UNL     1       8.300   2.580  -0.628  1.00  0.00           H  
HETATM   64  H20 UNL     1       8.988   3.222   1.521  1.00  0.00           H  
HETATM   65  H21 UNL     1      10.372   2.431   0.737  1.00  0.00           H  
HETATM   66  H22 UNL     1      10.064   1.782   2.896  1.00  0.00           H  
HETATM   67  H23 UNL     1       8.777   0.663  -1.768  1.00  0.00           H  
HETATM   68  H24 UNL     1      10.800   1.101  -1.451  1.00  0.00           H  
HETATM   69  H25 UNL     1       9.526  -1.134   0.558  1.00  0.00           H  
HETATM   70  H26 UNL     1       8.072  -1.270  -1.865  1.00  0.00           H  
HETATM   71  H27 UNL     1       6.878  -1.789   0.171  1.00  0.00           H  
HETATM   72  H28 UNL     1       7.584  -1.751   2.177  1.00  0.00           H  
HETATM   73  H29 UNL     1       5.336   0.495  -2.369  1.00  0.00           H  
HETATM   74  H30 UNL     1       4.389   0.605  -4.585  1.00  0.00           H  
CONECT    1    2    2
CONECT    2    3   44
CONECT    3    4    5    5
CONECT    4   45
CONECT    5    6   25
CONECT    6    7    7   24
CONECT    7    8   46
CONECT    8    9    9   47
CONECT    9   10   22
CONECT   10   11
CONECT   11   12   20   48
CONECT   12   13
CONECT   13   14   16   49
CONECT   14   15   50   51
CONECT   15   52
CONECT   16   17   18   53
CONECT   17   54
CONECT   18   19   20   55
CONECT   19   56
CONECT   20   21   57
CONECT   21   58
CONECT   22   23   24   24
CONECT   23   59
CONECT   24   60
CONECT   25   26
CONECT   26   27   27   44
CONECT   27   28   61
CONECT   28   29   41   41
CONECT   29   30
CONECT   30   31   39   62
CONECT   31   32
CONECT   32   33   35   63
CONECT   33   34   64   65
CONECT   34   66
CONECT   35   36   37   67
CONECT   36   68
CONECT   37   38   39   69
CONECT   38   70
CONECT   39   40   71
CONECT   40   72
CONECT   41   42   73
CONECT   42   43   44   44
CONECT   43   74
END

HMDB0037356
     RDKit          3D
Quercetin 4',7-diglucoside
 74 78  0  0  0  0  0  0  0  0999 V2000
    1.0948    0.4233   -4.4075 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.9155    0.3241   -3.1787 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3518    0.2154   -2.5965 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4114    0.2235   -3.4635 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5263    0.1080   -1.2462 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8223   -0.0069   -0.6024 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8533   -0.0756    0.8033 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0377   -0.1932    1.4787 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2853   -0.2530    0.8373 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3996   -0.3704    1.6141 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7372   -0.4674    1.3509 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2141   -1.6266    1.9789 O   0  0  0  0  0  0  0  0  0  0  0  0
   -8.5426   -1.8801    1.7780 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8545   -2.7020    0.5541 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.4375   -2.1064   -0.6092 O   0  0  0  0  0  0  0  0  0  0  0  0
   -9.4036   -0.6355    1.8755 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.6198   -0.0264    0.6637 O   0  0  0  0  0  0  0  0  0  0  0  0
   -8.5985    0.3386    2.7440 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.0940   -0.3648    3.8518 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4205    0.7853    1.9268 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8386    1.6333    0.9032 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2509   -0.1860   -0.5264 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4437   -0.2390   -1.2280 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0309   -0.0653   -1.2120 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5776    0.1126   -0.5072 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7887    0.2117   -1.0013 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8730    0.2048   -0.1335 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1953    0.3054   -0.5836 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2374    0.2941    0.3083 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5645    0.3642   -0.0323 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1598    1.4672    0.5940 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4112    1.7212    0.0986 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3651    2.2424    1.1622 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5301    1.3353    2.2088 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0204    0.5984   -0.6690 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4234    0.7670   -0.6206 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7284   -0.7614   -0.1228 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7668   -1.6414   -1.2310 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3597   -0.8431    0.4915 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3491   -0.8318    1.8704 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3421    0.4112   -1.9372 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2890    0.4214   -2.8237 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4603    0.5302   -4.2005 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9984    0.3212   -2.3592 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2967    0.3019   -4.4569 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8976   -0.0308    1.3246 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0475   -0.2445    2.5701 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0363   -0.4950    0.2897 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8741   -2.5184    2.6528 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.3945   -3.7061    0.6657 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.9579   -2.8555    0.4939 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.3360   -2.7520   -1.3371 H   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3491   -0.8179    2.4264 H   0  0  0  0  0  0  0  0  0  0  0  0
  -10.5859    0.1907    0.5985 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.2290    1.1928    3.0507 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9249    0.2260    4.6310 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7460    1.3621    2.5710 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7150    1.1627    0.0225 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3962   -0.1875   -2.2343 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0938   -0.0207   -2.2839 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7156    0.1202    0.9254 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.8039    0.4123   -1.1057 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.3000    2.5803   -0.6277 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.9878    3.2224    1.5210 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.3719    2.4313    0.7375 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.0635    1.7815    2.8959 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.7766    0.6628   -1.7682 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.7998    1.1010   -1.4509 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.5260   -1.1342    0.5580 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.0724   -1.2701   -1.8649 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.8776   -1.7886    0.1706 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.5843   -1.7507    2.1770 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3360    0.4953   -2.3690 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3887    0.6050   -4.5855 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  3  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 13 16  1  0
 16 17  1  0
 16 18  1  0
 18 19  1  0
 18 20  1  0
 20 21  1  0
  9 22  1  0
 22 23  1  0
 22 24  2  0
  5 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 32 35  1  0
 35 36  1  0
 35 37  1  0
 37 38  1  0
 37 39  1  0
 39 40  1  0
 28 41  2  0
 41 42  1  0
 42 43  1  0
 42 44  2  0
 44  2  1  0
 24  6  1  0
 44 26  1  0
 20 11  1  0
 39 30  1  0
  4 45  1  0
  7 46  1  0
  8 47  1  0
 11 48  1  0
 13 49  1  0
 14 50  1  0
 14 51  1  0
 15 52  1  0
 16 53  1  0
 17 54  1  0
 18 55  1  0
 19 56  1  0
 20 57  1  0
 21 58  1  0
 23 59  1  0
 24 60  1  0
 27 61  1  0
 30 62  1  0
 32 63  1  0
 33 64  1  0
 33 65  1  0
 34 66  1  0
 35 67  1  0
 36 68  1  0
 37 69  1  0
 38 70  1  0
 39 71  1  0
 40 72  1  0
 41 73  1  0
 43 74  1  0
M  END

View in JSmol View NMR Assignments View Stereo Labels

Synonyms

Value	Source
Quercetin 7,4'-diglucoside	HMDB
Quercetin 7,4'-O-diglucoside	HMDB

Chemical Formula

C₂₇H₃₀O₁₇

Average Molecular Weight

626.5169

Monoisotopic Molecular Weight

626.148299534

IUPAC Name

3,5-dihydroxy-2-(3-hydroxy-4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}phenyl)-7-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-4H-chromen-4-one

Traditional Name

3,5-dihydroxy-2-(3-hydroxy-4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}phenyl)-7-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}chromen-4-one

CAS Registry Number

42900-82-3

SMILES

OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(OC3=C2)C2=CC(O)=C(OC3OC(CO)C(O)C(O)C3O)C=C2)C(O)C(O)C1O

InChI Identifier

InChI=1S/C27H30O17/c28-6-14-17(32)20(35)23(38)26(43-14)40-9-4-11(31)16-13(5-9)41-25(22(37)19(16)34)8-1-2-12(10(30)3-8)42-27-24(39)21(36)18(33)15(7-29)44-27/h1-5,14-15,17-18,20-21,23-24,26-33,35-39H,6-7H2

InChI Key

QZXHFNCQMMUANB-UHFFFAOYSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as flavonoid-7-o-glycosides. These are phenolic compounds containing a flavonoid moiety which is O-glycosidically linked to carbohydrate moiety at the C7-position.

Kingdom

Organic compounds

Super Class

Phenylpropanoids and polyketides

Class

Flavonoids

Sub Class

Flavonoid glycosides

Direct Parent

Flavonoid-7-O-glycosides

Alternative Parents

Substituents

Flavonoid-7-o-glycoside
3-hydroxyflavone
Hydroxyflavonoid
3'-hydroxyflavonoid
3-hydroxyflavonoid
5-hydroxyflavonoid
Flavone
Phenolic glycoside
Glycosyl compound
O-glycosyl compound
Chromone
Benzopyran
1-benzopyran
Phenoxy compound
Phenol ether
Pyranone
Phenol
1-hydroxy-4-unsubstituted benzenoid
1-hydroxy-2-unsubstituted benzenoid
Pyran
Monocyclic benzene moiety
Oxane
Monosaccharide
Benzenoid
Vinylogous acid
Heteroaromatic compound
Secondary alcohol
Acetal
Oxacycle
Organoheterocyclic compound
Polyol
Organic oxide
Alcohol
Hydrocarbon derivative
Primary alcohol
Organic oxygen compound
Organooxygen compound
Aromatic heteropolycyclic compound

Molecular Framework

Aromatic heteropolycyclic compounds

External Descriptors

Not Available

Ontology

Physiological effect

Not Available

Disposition

Biological location

Cellular substructure

Extracellular (HMDB: HMDB0037356)
Cytoplasm (HMDB: HMDB0037356)

Route of exposure

Enteral

Ingestion (HMDB: HMDB0037356)

Source

Exogenous

Food

Food (HMDB: HMDB0037356)

Herb and spice

Herb

Welsh onion (FooDB: FOOD00241)

Vegetable

Onion-family vegetable

Shallot (FooDB: FOOD00243)
Garden onion (FooDB: FOOD00006)
Garden onion (var.) (FooDB: FOOD00226)
Onion-family vegetables (FooDB: FOOD00855)
Green onion (FooDB: FOOD00963)
Red onion (FooDB: FOOD00962)

Endogenous

Plant

Plant (HMDB: HMDB0037356)

Not Available

Nutrient (HMDB: HMDB0037356)

Physical Properties

State

Solid

Experimental Molecular Properties

Property	Value	Reference
Melting Point	195 - 197 °C	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	Not Available	Not Available
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	3.23 g/L	ALOGPS
logP	-0.81	ALOGPS
logP	-2.4	ChemAxon
logS	-2.3	ALOGPS
pKa (Strongest Acidic)	8.08	ChemAxon
pKa (Strongest Basic)	-3.6	ChemAxon
Physiological Charge	0	ChemAxon
Hydrogen Acceptor Count	17	ChemAxon
Hydrogen Donor Count	11	ChemAxon
Polar Surface Area	285.75 Å²	ChemAxon
Rotatable Bond Count	7	ChemAxon
Refractivity	141.15 m³·mol⁻¹	ChemAxon
Polarizability	59.5 Å³	ChemAxon
Number of Rings	5	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	Yes	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DarkChem	[M+H]+	239.863	31661259
DarkChem	[M-H]-	234.152	31661259
DeepCCS	[M+H]+	231.991	30932474
DeepCCS	[M-H]-	230.02	30932474
DeepCCS	[M-2H]-	263.259	30932474
DeepCCS	[M+Na]+	237.731	30932474
AllCCS	[M+H]+	232.5	32859911
AllCCS	[M+H-H2O]+	231.4	32859911
AllCCS	[M+NH4]+	233.5	32859911
AllCCS	[M+Na]+	233.7	32859911
AllCCS	[M-H]-	228.9	32859911
AllCCS	[M+Na-2H]-	231.2	32859911
AllCCS	[M+HCOO]-	234.0	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
Quercetin 4',7-diglucoside	OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(OC3=C2)C2=CC(O)=C(OC3OC(CO)C(O)C(O)C3O)C=C2)C(O)C(O)C1O	5426.1	Standard polar	33892256
Quercetin 4',7-diglucoside	OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(OC3=C2)C2=CC(O)=C(OC3OC(CO)C(O)C(O)C3O)C=C2)C(O)C(O)C1O	5507.6	Standard non polar	33892256
Quercetin 4',7-diglucoside	OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(OC3=C2)C2=CC(O)=C(OC3OC(CO)C(O)C(O)C3O)C=C2)C(O)C(O)C1O	5825.5	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
Quercetin 4',7-diglucoside,1TMS,isomer #1	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O)C(O)=C4)OC3=C2)C(O)C(O)C1O	5745.8	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,1TMS,isomer #10	C[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O)C(O)=C4)OC3=C2)C1O	5784.5	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,1TMS,isomer #11	C[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O)C(O)=C4)OC3=C2)C(O)C1O	5790.0	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,1TMS,isomer #2	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O)C(O)C2O)=CC2=C1C(=O)C(O)=C(C1=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O)=C1)O2	5786.3	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,1TMS,isomer #3	C[Si](C)(C)OC1=C(C2=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O)=C2)OC2=CC(OC3OC(CO)C(O)C(O)C3O)=CC(O)=C2C1=O	5715.5	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,1TMS,isomer #4	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)=CC=C1OC1OC(CO)C(O)C(O)C1O	5782.5	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,1TMS,isomer #5	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O)C5O)C=C4O3)C=C2O)C(O)C(O)C1O	5751.5	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,1TMS,isomer #6	C[Si](C)(C)OC1C(CO)OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O)C5O)C=C4O3)C=C2O)C(O)C1O	5793.3	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,1TMS,isomer #7	C[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O)C5O)C=C4O3)C=C2O)C1O	5784.2	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,1TMS,isomer #8	C[Si](C)(C)OC1C(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O)C5O)C=C4O3)C=C2O)OC(CO)C(O)C1O	5799.2	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,1TMS,isomer #9	C[Si](C)(C)OC1C(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O)C(O)=C4)OC3=C2)OC(CO)C(O)C1O	5797.7	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #1	C[Si](C)(C)OCC1OC(OC2=CC(O[Si](C)(C)C)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O)C(O)=C4)OC3=C2)C(O)C(O)C1O	5580.7	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #10	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O)C(O)=C4)OC3=C2)C(O)C(O)C1O[Si](C)(C)C	5597.5	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #11	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)=CC2=C1C(=O)C(O)=C(C1=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O)=C1)O2	5597.1	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #12	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)=CC2=C1C(=O)C(O)=C(C1=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O)=C1)O2	5577.6	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #13	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)=CC2=C1C(=O)C(O)=C(C1=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O)=C1)O2	5605.7	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #14	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(OC5OC(CO)C(O)C(O)C5O)C=C4O3)C=C2O)C(O)C(O)C1O	5583.0	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #15	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O)C(O)C2O)=CC2=C1C(=O)C(O)=C(C1=CC=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(O)=C1)O2	5601.0	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #16	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O)C(O)C2O)=CC2=C1C(=O)C(O)=C(C1=CC=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(O)=C1)O2	5576.5	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #17	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O)C(O)C2O)=CC2=C1C(=O)C(O)=C(C1=CC=C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(O)=C1)O2	5609.8	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #18	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)=CC=C1OC1OC(CO)C(O)C(O)C1O	5599.6	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #19	C[Si](C)(C)OC1=C(C2=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O)=C2)OC2=CC(OC3OC(CO)C(O)C(O)C3O)=CC(O[Si](C)(C)C)=C2C1=O	5557.6	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #2	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O[Si](C)(C)C)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O)C(O)=C4)OC3=C2)C(O)C(O)C1O	5565.4	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #20	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O)C5O)C=C4O3)C=C2O)C(O)C(O)C1O	5568.2	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #21	C[Si](C)(C)OC1=C(C2=CC=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(O)=C2)OC2=CC(OC3OC(CO)C(O)C(O)C3O)=CC(O)=C2C1=O	5579.4	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #22	C[Si](C)(C)OC1=C(C2=CC=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(O)=C2)OC2=CC(OC3OC(CO)C(O)C(O)C3O)=CC(O)=C2C1=O	5554.0	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #23	C[Si](C)(C)OC1=C(C2=CC=C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(O)=C2)OC2=CC(OC3OC(CO)C(O)C(O)C3O)=CC(O)=C2C1=O	5592.3	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #24	C[Si](C)(C)OC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)=CC=C1OC1OC(CO)C(O)C(O)C1O	5582.2	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #25	C[Si](C)(C)OC1=C(C2=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O)=C2)OC2=CC(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=CC(O)=C2C1=O	5576.6	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #26	C[Si](C)(C)OC1=C(C2=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O)=C2)OC2=CC(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=CC(O)=C2C1=O	5556.3	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #27	C[Si](C)(C)OC1=C(C2=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O)=C2)OC2=CC(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=CC(O)=C2C1=O	5592.1	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #28	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C3O2)=CC=C1OC1OC(CO)C(O)C(O)C1O	5608.4	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #29	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C3O2)=CC=C1OC1OC(CO)C(O)C(O)C1O	5594.6	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #3	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO[Si](C)(C)C)C(O)C(O)C5O)C(O)=C4)OC3=C2)C(O)C(O)C1O	5583.5	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #30	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C3O2)=CC=C1OC1OC(CO)C(O)C(O)C1O	5622.8	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #31	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O)C5O)C=C4O3)C=C2O[Si](C)(C)C)C(O)C(O)C1O	5586.4	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #32	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	5610.9	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #33	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)=CC=C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	5590.6	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #34	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)=CC=C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	5620.5	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #35	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O[Si](C)(C)C)C(O)C5O)C=C4O3)C=C2O)C(O)C(O)C1O	5591.5	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #36	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C=C4O3)C=C2O)C(O)C(O)C1O	5585.1	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #37	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O)C5O[Si](C)(C)C)C=C4O3)C=C2O)C(O)C(O)C1O	5608.6	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #38	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O)C5O)C=C4O3)C=C2O)C(O[Si](C)(C)C)C(O)C1O	5616.8	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #39	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O)C5O)C=C4O3)C=C2O)C(O)C(O[Si](C)(C)C)C1O	5585.2	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #4	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O[Si](C)(C)C)C(O)C5O)C(O)=C4)OC3=C2)C(O)C(O)C1O	5590.0	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #40	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O)C5O)C=C4O3)C=C2O)C(O)C(O)C1O[Si](C)(C)C	5603.5	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #41	C[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O[Si](C)(C)C)C(O)C5O)C(O)=C4)OC3=C2)C(O)C1O	5612.0	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #42	C[Si](C)(C)OC1C(CO)OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C=C4O3)C=C2O)C(O)C1O	5598.6	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #43	C[Si](C)(C)OC1C(CO)OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O)C5O[Si](C)(C)C)C=C4O3)C=C2O)C(O)C1O	5627.6	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #44	C[Si](C)(C)OC1C(CO)OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O)C5O)C=C4O3)C=C2O)C(O[Si](C)(C)C)C1O	5616.7	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #45	C[Si](C)(C)OC1C(CO)OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O)C5O)C=C4O3)C=C2O)C(O)C1O[Si](C)(C)C	5617.7	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #46	C[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C(O)=C4)OC3=C2)C(O)C1O	5594.0	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #47	C[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C(O)=C4)OC3=C2)C1O	5578.1	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #48	C[Si](C)(C)OC1C(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C(O)=C4)OC3=C2)OC(CO)C(O)C1O	5608.7	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #49	C[Si](C)(C)OC1C(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O)C5O)C=C4O3)C=C2O)OC(CO)C(O)C1O[Si](C)(C)C	5649.9	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #5	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C(O)=C4)OC3=C2)C(O)C(O)C1O	5578.7	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #50	C[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O[Si](C)(C)C)C(O)=C4)OC3=C2)C(O)C1O	5626.8	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #51	C[Si](C)(C)OC1C(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C=C4O3)C=C2O)OC(CO)C(O)C1O	5614.1	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #52	C[Si](C)(C)OC1C(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O[Si](C)(C)C)C(O)=C4)OC3=C2)OC(CO)C(O)C1O	5643.9	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #53	C[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O)C(O)=C4)OC3=C2)C(O[Si](C)(C)C)C1O	5613.6	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #54	C[Si](C)(C)OC1C(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O)C(O)=C4)OC3=C2)OC(CO)C(O)C1O[Si](C)(C)C	5641.6	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #55	C[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O)C(O)=C4)OC3=C2)C(O)C1O[Si](C)(C)C	5619.7	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #6	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O[Si](C)(C)C)C(O)=C4)OC3=C2)C(O)C(O)C1O	5606.1	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #7	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O)C(O[Si](C)(C)C)=C4)OC3=C2)C(O)C(O)C1O	5582.1	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #8	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O)C(O)=C4)OC3=C2)C(O[Si](C)(C)C)C(O)C1O	5616.8	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TMS,isomer #9	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O)C(O)=C4)OC3=C2)C(O)C(O[Si](C)(C)C)C1O	5588.4	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #1	C[Si](C)(C)OCC1OC(OC2=CC(O[Si](C)(C)C)=C3C(=O)C(O[Si](C)(C)C)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O)C(O)=C4)OC3=C2)C(O)C(O)C1O	5370.0	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #10	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O[Si](C)(C)C)=C(C4=CC=C(OC5OC(CO[Si](C)(C)C)C(O)C(O)C5O)C(O)=C4)OC3=C2)C(O)C(O)C1O	5401.7	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #100	C[Si](C)(C)OC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)=CC=C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	5460.1	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #101	C[Si](C)(C)OC1=C(C2=CC=C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(O)=C2)OC2=CC(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=CC(O)=C2C1=O	5456.5	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #102	C[Si](C)(C)OC1=C(C2=CC=C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(O)=C2)OC2=CC(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=CC(O)=C2C1=O	5423.4	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #103	C[Si](C)(C)OC1=C(C2=CC=C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(O)=C2)OC2=CC(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=CC(O)=C2C1=O	5474.5	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #104	C[Si](C)(C)OC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C3O2)=CC=C1OC1OC(CO)C(O)C(O)C1O	5448.3	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #105	C[Si](C)(C)OC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C3O2)=CC=C1OC1OC(CO)C(O)C(O)C1O	5410.6	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #106	C[Si](C)(C)OC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C3O2)=CC=C1OC1OC(CO)C(O)C(O)C1O	5462.8	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #107	C[Si](C)(C)OC1=C(C2=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O)=C2)OC2=CC(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=CC(O)=C2C1=O	5425.6	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #108	C[Si](C)(C)OC1=C(C2=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O)=C2)OC2=CC(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=CC(O)=C2C1=O	5455.8	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #109	C[Si](C)(C)OC1=C(C2=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O)=C2)OC2=CC(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=CC(O)=C2C1=O	5464.8	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #11	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O[Si](C)(C)C)=C(C4=CC=C(OC5OC(CO)C(O[Si](C)(C)C)C(O)C5O)C(O)=C4)OC3=C2)C(O)C(O)C1O	5422.7	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #110	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C3O2)=CC=C1OC1OC(CO)C(O)C(O)C1O	5479.3	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #111	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C3O2)=CC=C1OC1OC(CO)C(O)C(O)C1O	5493.5	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #112	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O[Si](C)(C)C)C(O)C5O)C=C4O3)C=C2O[Si](C)(C)C)C(O)C(O)C1O	5450.0	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #113	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C3O2)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	5478.0	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #114	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C3O2)=CC=C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	5450.3	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #115	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C3O2)=CC=C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	5489.8	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #116	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C3O2)=CC=C1OC1OC(CO)C(O)C(O)C1O	5507.5	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #117	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C=C4O3)C=C2O[Si](C)(C)C)C(O)C(O)C1O	5427.6	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #118	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C3O2)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	5453.6	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #119	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C3O2)=CC=C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	5424.5	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #12	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O[Si](C)(C)C)=C(C4=CC=C(OC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C(O)=C4)OC3=C2)C(O)C(O)C1O	5378.5	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #120	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C3O2)=CC=C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	5460.9	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #121	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O)C5O[Si](C)(C)C)C=C4O3)C=C2O[Si](C)(C)C)C(O)C(O)C1O	5474.1	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #122	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C3O2)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	5494.7	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #123	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C3O2)=CC=C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	5461.9	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #124	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C3O2)=CC=C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	5511.2	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #125	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O)C5O)C=C4O3)C=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5490.2	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #126	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O)C5O)C=C4O3)C=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5439.4	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #127	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O)C5O)C=C4O3)C=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	5468.3	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #128	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5478.1	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #129	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5492.7	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #13	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O[Si](C)(C)C)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O[Si](C)(C)C)C(O)=C4)OC3=C2)C(O)C(O)C1O	5437.8	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #130	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)=CC=C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5509.4	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #131	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)C=C4O3)C=C2O)C(O)C(O)C1O	5465.6	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #132	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)C=C4O3)C=C2O)C(O)C(O)C1O	5473.1	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #133	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O[Si](C)(C)C)C(O)C5O)C=C4O3)C=C2O)C(O[Si](C)(C)C)C(O)C1O	5503.6	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #134	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O[Si](C)(C)C)C(O)C5O)C=C4O3)C=C2O)C(O)C(O[Si](C)(C)C)C1O	5458.1	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #135	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O[Si](C)(C)C)C(O)C5O)C=C4O3)C=C2O)C(O)C(O)C1O[Si](C)(C)C	5484.1	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #136	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)C=C4O3)C=C2O)C(O)C(O)C1O	5498.6	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #137	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C=C4O3)C=C2O)C(O[Si](C)(C)C)C(O)C1O	5485.0	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #138	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C=C4O3)C=C2O)C(O)C(O[Si](C)(C)C)C1O	5439.0	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #139	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C=C4O3)C=C2O)C(O)C(O)C1O[Si](C)(C)C	5467.6	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #14	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O[Si](C)(C)C)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O)C(O[Si](C)(C)C)=C4)OC3=C2)C(O)C(O)C1O	5411.7	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #140	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O)C5O[Si](C)(C)C)C=C4O3)C=C2O)C(O[Si](C)(C)C)C(O)C1O	5523.9	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #141	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O)C5O[Si](C)(C)C)C=C4O3)C=C2O)C(O)C(O[Si](C)(C)C)C1O	5476.5	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #142	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O)C5O[Si](C)(C)C)C=C4O3)C=C2O)C(O)C(O)C1O[Si](C)(C)C	5503.5	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #143	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O)C5O)C=C4O3)C=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5513.1	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #144	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O)C5O)C=C4O3)C=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5505.2	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #145	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O)C5O)C=C4O3)C=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5480.2	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #146	C[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)C(O)=C4)OC3=C2)C(O)C1O	5486.8	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #147	C[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)C(O)=C4)OC3=C2)C(O)C1O	5498.7	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #148	C[Si](C)(C)OC1C(CO)OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)C=C4O3)C=C2O)C(O)C1O	5500.0	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #149	C[Si](C)(C)OC1C(CO)OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)C=C4O3)C=C2O)C(O)C1O	5488.7	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #15	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O[Si](C)(C)C)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O)C(O)=C4)OC3=C2)C(O[Si](C)(C)C)C(O)C1O	5456.6	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #150	C[Si](C)(C)OC1C(CO)OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)C=C4O3)C=C2O)C(O)C1O	5515.5	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #151	C[Si](C)(C)OC1C(CO)OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C=C4O3)C=C2O)C(O[Si](C)(C)C)C1O	5481.0	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #152	C[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)C(O)=C4)OC3=C2)C1O	5470.7	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #153	C[Si](C)(C)OC1C(CO)OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O)C5O[Si](C)(C)C)C=C4O3)C=C2O)C(O[Si](C)(C)C)C1O	5514.1	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #154	C[Si](C)(C)OC1C(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)C(O)=C4)OC3=C2)OC(CO)C(O)C1O	5500.7	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #155	C[Si](C)(C)OC1C(CO)OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O)C5O)C=C4O3)C=C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5546.9	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #156	C[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)C(O)=C4)OC3=C2)C(O)C1O	5514.8	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #157	C[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C(O)=C4)OC3=C2)C(O[Si](C)(C)C)C1O	5480.4	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #158	C[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)C=C4O3)C=C2O)C1O	5469.7	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #159	C[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)C(O)=C4)OC3=C2)C1O	5495.6	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #16	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O[Si](C)(C)C)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O)C(O)=C4)OC3=C2)C(O)C(O[Si](C)(C)C)C1O	5396.4	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #160	C[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)C=C4O3)C=C2O)C1O	5494.9	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #161	C[Si](C)(C)OC1C(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)C(O)=C4)OC3=C2)OC(CO)C(O)C1O	5529.6	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #162	C[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O[Si](C)(C)C)C(O)=C4)OC3=C2)C(O[Si](C)(C)C)C1O	5512.7	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #163	C[Si](C)(C)OC1C(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)C=C4O3)C=C2O)OC(CO)C(O)C1O	5499.4	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #164	C[Si](C)(C)OC1C(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)C=C4O3)C=C2O)OC(CO)C(O)C1O	5529.0	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #165	C[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O)C(O)=C4)OC3=C2)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5542.7	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #17	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O[Si](C)(C)C)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O)C(O)=C4)OC3=C2)C(O)C(O)C1O[Si](C)(C)C	5426.9	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #18	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)C(O)=C4)OC3=C2)C(O)C(O)C1O	5463.9	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #19	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)C(O)=C4)OC3=C2)C(O)C(O)C1O	5433.6	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #2	C[Si](C)(C)OCC1OC(OC2=CC(O[Si](C)(C)C)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO[Si](C)(C)C)C(O)C(O)C5O)C(O)=C4)OC3=C2)C(O)C(O)C1O	5413.2	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #20	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)C(O)=C4)OC3=C2)C(O)C(O)C1O	5483.0	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #21	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO[Si](C)(C)C)C(O)C(O)C5O)C(O[Si](C)(C)C)=C4)OC3=C2)C(O)C(O)C1O	5426.7	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #22	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)C=C4O3)C=C2O)C(O)C(O)C1O	5484.3	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #23	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)C=C4O3)C=C2O)C(O)C(O)C1O	5438.5	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #24	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)C=C4O3)C=C2O)C(O)C(O)C1O	5460.7	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #25	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)C(O)=C4)OC3=C2)C(O)C(O)C1O	5462.1	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #26	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)C(O)=C4)OC3=C2)C(O)C(O)C1O	5472.4	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #27	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O[Si](C)(C)C)C(O)C5O)C(O[Si](C)(C)C)=C4)OC3=C2)C(O)C(O)C1O	5453.3	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #28	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O[Si](C)(C)C)C(O)C5O)C(O)=C4)OC3=C2)C(O[Si](C)(C)C)C(O)C1O	5504.6	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #29	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O[Si](C)(C)C)C(O)C5O)C(O)=C4)OC3=C2)C(O)C(O[Si](C)(C)C)C1O	5461.6	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #3	C[Si](C)(C)OCC1OC(OC2=CC(O[Si](C)(C)C)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O[Si](C)(C)C)C(O)C5O)C(O)=C4)OC3=C2)C(O)C(O)C1O	5432.4	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #30	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O[Si](C)(C)C)C(O)C5O)C(O)=C4)OC3=C2)C(O)C(O)C1O[Si](C)(C)C	5479.7	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #31	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)C(O)=C4)OC3=C2)C(O)C(O)C1O	5498.8	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #32	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C(O[Si](C)(C)C)=C4)OC3=C2)C(O)C(O)C1O	5423.8	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #33	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C(O)=C4)OC3=C2)C(O[Si](C)(C)C)C(O)C1O	5482.0	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #34	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C(O)=C4)OC3=C2)C(O)C(O[Si](C)(C)C)C1O	5437.1	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #35	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C(O)=C4)OC3=C2)C(O)C(O)C1O[Si](C)(C)C	5459.4	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #36	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)OC3=C2)C(O)C(O)C1O	5470.8	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #37	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O[Si](C)(C)C)C(O)=C4)OC3=C2)C(O[Si](C)(C)C)C(O)C1O	5521.3	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #38	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O[Si](C)(C)C)C(O)=C4)OC3=C2)C(O)C(O[Si](C)(C)C)C1O	5475.3	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #39	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O[Si](C)(C)C)C(O)=C4)OC3=C2)C(O)C(O)C1O[Si](C)(C)C	5496.0	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #4	C[Si](C)(C)OCC1OC(OC2=CC(O[Si](C)(C)C)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C(O)=C4)OC3=C2)C(O)C(O)C1O	5400.6	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #40	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O)C(O[Si](C)(C)C)=C4)OC3=C2)C(O[Si](C)(C)C)C(O)C1O	5488.4	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #41	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O)C(O[Si](C)(C)C)=C4)OC3=C2)C(O)C(O[Si](C)(C)C)C1O	5439.7	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #42	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O)C(O[Si](C)(C)C)=C4)OC3=C2)C(O)C(O)C1O[Si](C)(C)C	5462.4	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #43	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O)C(O)=C4)OC3=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5504.8	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #44	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O)C(O)=C4)OC3=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5500.5	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #45	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O)C(O)=C4)OC3=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5476.6	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #46	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)=CC2=C1C(=O)C(O)=C(C1=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O)=C1)O2	5455.6	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #47	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)=CC2=C1C(=O)C(O)=C(C1=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O)=C1)O2	5467.7	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #48	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(OC5OC(CO)C(O[Si](C)(C)C)C(O)C5O)C=C4O3)C=C2O)C(O)C(O)C1O	5430.0	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #49	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)=CC2=C1C(=O)C(O)=C(C1=CC=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(O)=C1)O2	5463.7	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #5	C[Si](C)(C)OCC1OC(OC2=CC(O[Si](C)(C)C)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O[Si](C)(C)C)C(O)=C4)OC3=C2)C(O)C(O)C1O	5447.8	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #50	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)=CC2=C1C(=O)C(O)=C(C1=CC=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(O)=C1)O2	5432.0	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #51	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)=CC2=C1C(=O)C(O)=C(C1=CC=C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(O)=C1)O2	5469.0	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #52	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C3O2)=CC=C1OC1OC(CO)C(O)C(O)C1O	5458.1	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #53	C[Si](C)(C)OC1=C(C2=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O)=C2)OC2=CC(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=CC(O[Si](C)(C)C)=C2C1=O	5403.8	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #54	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=CC2=C1C(=O)C(O)=C(C1=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O)=C1)O2	5484.8	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #55	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(OC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C=C4O3)C=C2O)C(O)C(O)C1O	5401.6	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #56	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)=CC2=C1C(=O)C(O)=C(C1=CC=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(O)=C1)O2	5435.7	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #57	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)=CC2=C1C(=O)C(O)=C(C1=CC=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(O)=C1)O2	5398.5	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #58	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)=CC2=C1C(=O)C(O)=C(C1=CC=C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(O)=C1)O2	5440.9	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #59	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C3O2)=CC=C1OC1OC(CO)C(O)C(O)C1O	5425.1	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #6	C[Si](C)(C)OCC1OC(OC2=CC(O[Si](C)(C)C)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O)C(O[Si](C)(C)C)=C4)OC3=C2)C(O)C(O)C1O	5424.1	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #60	C[Si](C)(C)OC1=C(C2=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O)=C2)OC2=CC(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=CC(O[Si](C)(C)C)=C2C1=O	5361.3	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #61	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(OC5OC(CO)C(O)C(O)C5O[Si](C)(C)C)C=C4O3)C=C2O)C(O)C(O)C1O	5450.9	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #62	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)=CC2=C1C(=O)C(O)=C(C1=CC=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(O)=C1)O2	5474.0	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #63	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)=CC2=C1C(=O)C(O)=C(C1=CC=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(O)=C1)O2	5440.8	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #64	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)=CC2=C1C(=O)C(O)=C(C1=CC=C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(O)=C1)O2	5484.5	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #65	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C3O2)=CC=C1OC1OC(CO)C(O)C(O)C1O	5470.2	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #66	C[Si](C)(C)OC1=C(C2=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O)=C2)OC2=CC(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C2C1=O	5417.6	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #67	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O[Si](C)(C)C)C(=O)C4=C(O[Si](C)(C)C)C=C(OC5OC(CO)C(O)C(O)C5O)C=C4O3)C=C2O)C(O)C(O)C1O	5368.4	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #68	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(OC5OC(CO)C(O)C(O)C5O)C=C4O3)C=C2O[Si](C)(C)C)C(O)C(O)C1O	5422.5	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #69	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(OC5OC(CO)C(O)C(O)C5O)C=C4O3)C=C2O)C(O[Si](C)(C)C)C(O)C1O	5470.5	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #7	C[Si](C)(C)OCC1OC(OC2=CC(O[Si](C)(C)C)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O)C(O)=C4)OC3=C2)C(O[Si](C)(C)C)C(O)C1O	5469.5	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #70	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(OC5OC(CO)C(O)C(O)C5O)C=C4O3)C=C2O)C(O)C(O[Si](C)(C)C)C1O	5416.4	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #71	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(OC5OC(CO)C(O)C(O)C5O)C=C4O3)C=C2O)C(O)C(O)C1O[Si](C)(C)C	5449.9	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #72	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O)C(O)C2O)=CC2=C1C(=O)C(O)=C(C1=CC=C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(O)=C1)O2	5457.0	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #73	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O)C(O)C2O)=CC2=C1C(=O)C(O)=C(C1=CC=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(O)=C1)O2	5468.9	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #74	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	5461.7	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #75	C[Si](C)(C)OC1=C(C2=CC=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(O)=C2)OC2=CC(OC3OC(CO)C(O)C(O)C3O)=CC(O[Si](C)(C)C)=C2C1=O	5408.3	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #76	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O)C(O)C2O)=CC2=C1C(=O)C(O)=C(C1=CC=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)=C1)O2	5488.8	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #77	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)=CC=C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	5425.0	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #78	C[Si](C)(C)OC1=C(C2=CC=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(O)=C2)OC2=CC(OC3OC(CO)C(O)C(O)C3O)=CC(O[Si](C)(C)C)=C2C1=O	5359.4	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #79	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)=CC=C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	5469.0	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #8	C[Si](C)(C)OCC1OC(OC2=CC(O[Si](C)(C)C)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O)C(O)=C4)OC3=C2)C(O)C(O[Si](C)(C)C)C1O	5414.1	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #80	C[Si](C)(C)OC1=C(C2=CC=C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(O)=C2)OC2=CC(OC3OC(CO)C(O)C(O)C3O)=CC(O[Si](C)(C)C)=C2C1=O	5410.9	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #81	C[Si](C)(C)OC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)=CC=C1OC1OC(CO)C(O)C(O)C1O	5404.2	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #82	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(OC5OC(CO)C(O[Si](C)(C)C)C(O)C5O)C=C4O3)C=C2O)C(O)C(O)C1O	5418.1	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #83	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C=C4O3)C=C2O)C(O)C(O)C1O	5381.6	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #84	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O)C5O[Si](C)(C)C)C=C4O3)C=C2O)C(O)C(O)C1O	5440.3	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #85	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O)C5O)C=C4O3)C=C2O[Si](C)(C)C)C(O)C(O)C1O	5408.1	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #86	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O)C5O)C=C4O3)C=C2O)C(O[Si](C)(C)C)C(O)C1O	5453.9	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #87	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O)C5O)C=C4O3)C=C2O)C(O)C(O[Si](C)(C)C)C1O	5393.3	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #88	C[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O)C5O)C=C4O3)C=C2O)C(O)C(O)C1O[Si](C)(C)C	5430.3	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #89	C[Si](C)(C)OC1=C(C2=CC=C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(O)=C2)OC2=CC(OC3OC(CO)C(O)C(O)C3O)=CC(O)=C2C1=O	5422.1	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #9	C[Si](C)(C)OCC1OC(OC2=CC(O[Si](C)(C)C)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O)C(O)=C4)OC3=C2)C(O)C(O)C1O[Si](C)(C)C	5444.0	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #90	C[Si](C)(C)OC1=C(C2=CC=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(O)=C2)OC2=CC(OC3OC(CO)C(O)C(O)C3O)=CC(O)=C2C1=O	5455.2	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #91	C[Si](C)(C)OC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	5450.3	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #92	C[Si](C)(C)OC1=C(C2=CC=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(O)=C2)OC2=CC(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=CC(O)=C2C1=O	5446.6	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #93	C[Si](C)(C)OC1=C(C2=CC=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(O)=C2)OC2=CC(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=CC(O)=C2C1=O	5416.0	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #94	C[Si](C)(C)OC1=C(C2=CC=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(O)=C2)OC2=CC(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=CC(O)=C2C1=O	5462.7	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #95	C[Si](C)(C)OC1=C(C2=CC=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)=C2)OC2=CC(OC3OC(CO)C(O)C(O)C3O)=CC(O)=C2C1=O	5465.0	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #96	C[Si](C)(C)OC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)=CC=C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	5407.9	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #97	C[Si](C)(C)OC1=C(C2=CC=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(O)=C2)OC2=CC(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=CC(O)=C2C1=O	5409.0	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #98	C[Si](C)(C)OC1=C(C2=CC=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(O)=C2)OC2=CC(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=CC(O)=C2C1=O	5374.6	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,3TMS,isomer #99	C[Si](C)(C)OC1=C(C2=CC=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(O)=C2)OC2=CC(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=CC(O)=C2C1=O	5424.0	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,1TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O)C(O)=C4)OC3=C2)C(O)C(O)C1O	5936.4	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,1TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O)C(O)=C4)OC3=C2)C1O	6022.9	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,1TBDMS,isomer #11	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O)C(O)=C4)OC3=C2)C(O)C1O	6023.7	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,1TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OC1=CC(OC2OC(CO)C(O)C(O)C2O)=CC2=C1C(=O)C(O)=C(C1=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O)=C1)O2	5979.8	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,1TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OC1=C(C2=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O)=C2)OC2=CC(OC3OC(CO)C(O)C(O)C3O)=CC(O)=C2C1=O	5945.7	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,1TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)=CC=C1OC1OC(CO)C(O)C(O)C1O	5961.0	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,1TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O)C5O)C=C4O3)C=C2O)C(O)C(O)C1O	5941.7	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,1TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O)C5O)C=C4O3)C=C2O)C(O)C1O	6028.4	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,1TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O)C5O)C=C4O3)C=C2O)C1O	6020.1	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,1TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OC1C(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O)C5O)C=C4O3)C=C2O)OC(CO)C(O)C1O	6024.8	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,1TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OC1C(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O)C(O)=C4)OC3=C2)OC(CO)C(O)C1O	6023.1	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(O[Si](C)(C)C(C)(C)C)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O)C(O)=C4)OC3=C2)C(O)C(O)C1O	5982.5	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O)C(O)=C4)OC3=C2)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5982.9	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #11	CC(C)(C)[Si](C)(C)OC1=CC(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)=CC2=C1C(=O)C(O)=C(C1=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O)=C1)O2	6013.8	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #12	CC(C)(C)[Si](C)(C)OC1=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)=CC2=C1C(=O)C(O)=C(C1=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O)=C1)O2	6003.9	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #13	CC(C)(C)[Si](C)(C)OC1=CC(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)=CC2=C1C(=O)C(O)=C(C1=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O)=C1)O2	6006.8	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #14	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=C(OC5OC(CO)C(O)C(O)C5O)C=C4O3)C=C2O)C(O)C(O)C1O	5984.9	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #15	CC(C)(C)[Si](C)(C)OC1=CC(OC2OC(CO)C(O)C(O)C2O)=CC2=C1C(=O)C(O)=C(C1=CC=C(OC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)C(O)=C1)O2	6016.8	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #16	CC(C)(C)[Si](C)(C)OC1=CC(OC2OC(CO)C(O)C(O)C2O)=CC2=C1C(=O)C(O)=C(C1=CC=C(OC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)C(O)=C1)O2	6008.2	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #17	CC(C)(C)[Si](C)(C)OC1=CC(OC2OC(CO)C(O)C(O)C2O)=CC2=C1C(=O)C(O)=C(C1=CC=C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)C(O)=C1)O2	6015.0	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #18	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)=CC=C1OC1OC(CO)C(O)C(O)C1O	5998.6	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #19	CC(C)(C)[Si](C)(C)OC1=C(C2=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O)=C2)OC2=CC(OC3OC(CO)C(O)C(O)C3O)=CC(O[Si](C)(C)C(C)(C)C)=C2C1=O	5970.6	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O[Si](C)(C)C(C)(C)C)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O)C(O)=C4)OC3=C2)C(O)C(O)C1O	5951.4	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #20	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O[Si](C)(C)C(C)(C)C)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O)C5O)C=C4O3)C=C2O)C(O)C(O)C1O	5952.4	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #21	CC(C)(C)[Si](C)(C)OC1=C(C2=CC=C(OC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)C(O)=C2)OC2=CC(OC3OC(CO)C(O)C(O)C3O)=CC(O)=C2C1=O	5974.8	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #22	CC(C)(C)[Si](C)(C)OC1=C(C2=CC=C(OC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)C(O)=C2)OC2=CC(OC3OC(CO)C(O)C(O)C3O)=CC(O)=C2C1=O	5956.1	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #23	CC(C)(C)[Si](C)(C)OC1=C(C2=CC=C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)C(O)=C2)OC2=CC(OC3OC(CO)C(O)C(O)C3O)=CC(O)=C2C1=O	5975.0	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #24	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)=CC=C1OC1OC(CO)C(O)C(O)C1O	5959.2	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #25	CC(C)(C)[Si](C)(C)OC1=C(C2=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O)=C2)OC2=CC(OC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)=CC(O)=C2C1=O	5971.9	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #26	CC(C)(C)[Si](C)(C)OC1=C(C2=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O)=C2)OC2=CC(OC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)=CC(O)=C2C1=O	5958.8	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #27	CC(C)(C)[Si](C)(C)OC1=C(C2=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O)=C2)OC2=CC(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)=CC(O)=C2C1=O	5974.2	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #28	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)C=C3O2)=CC=C1OC1OC(CO)C(O)C(O)C1O	5995.1	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #29	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)C=C3O2)=CC=C1OC1OC(CO)C(O)C(O)C1O	5984.5	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C5O)C(O)=C4)OC3=C2)C(O)C(O)C1O	5962.9	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #30	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)C=C3O2)=CC=C1OC1OC(CO)C(O)C(O)C1O	5998.3	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #31	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O)C5O)C=C4O3)C=C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	5963.8	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #32	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)=CC=C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5997.2	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #33	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)=CC=C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5985.5	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #34	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)=CC=C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	6000.0	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #35	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C5O)C=C4O3)C=C2O)C(O)C(O)C1O	5992.8	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #36	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C5O)C=C4O3)C=C2O)C(O)C(O)C1O	5983.2	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #37	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O)C5O[Si](C)(C)C(C)(C)C)C=C4O3)C=C2O)C(O)C(O)C1O	5991.7	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #38	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O)C5O)C=C4O3)C=C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	6009.4	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #39	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O)C5O)C=C4O3)C=C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	6008.5	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C5O)C(O)=C4)OC3=C2)C(O)C(O)C1O	5992.3	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #40	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O)C5O)C=C4O3)C=C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5988.3	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #41	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C5O)C(O)=C4)OC3=C2)C(O)C1O	6024.0	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #42	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C5O)C=C4O3)C=C2O)C(O)C1O	6015.7	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #43	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O)C5O[Si](C)(C)C(C)(C)C)C=C4O3)C=C2O)C(O)C1O	6026.4	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #44	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O)C5O)C=C4O3)C=C2O)C(O[Si](C)(C)C(C)(C)C)C1O	6031.0	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #45	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O)C5O)C=C4O3)C=C2O)C(O)C1O[Si](C)(C)C(C)(C)C	6019.3	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #46	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C5O)C(O)=C4)OC3=C2)C(O)C1O	6012.5	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #47	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C5O)C(O)=C4)OC3=C2)C1O	6003.2	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #48	CC(C)(C)[Si](C)(C)OC1C(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C5O)C(O)=C4)OC3=C2)OC(CO)C(O)C1O	6011.1	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #49	CC(C)(C)[Si](C)(C)OC1C(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O)C5O)C=C4O3)C=C2O)OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C	6050.7	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C5O)C(O)=C4)OC3=C2)C(O)C(O)C1O	5979.4	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #50	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O[Si](C)(C)C(C)(C)C)C(O)=C4)OC3=C2)C(O)C1O	6026.4	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #51	CC(C)(C)[Si](C)(C)OC1C(OC2=CC=C(C3=C(O)C(=O)C4=C(O)C=C(OC5OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C5O)C=C4O3)C=C2O)OC(CO)C(O)C1O	6015.4	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #52	CC(C)(C)[Si](C)(C)OC1C(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O[Si](C)(C)C(C)(C)C)C(O)=C4)OC3=C2)OC(CO)C(O)C1O	6030.5	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #53	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O)C(O)=C4)OC3=C2)C(O[Si](C)(C)C(C)(C)C)C1O	6026.1	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #54	CC(C)(C)[Si](C)(C)OC1C(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O)C(O)=C4)OC3=C2)OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C	6042.1	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #55	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O)C(O)=C4)OC3=C2)C(O)C1O[Si](C)(C)C(C)(C)C	6017.2	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O[Si](C)(C)C(C)(C)C)C(O)=C4)OC3=C2)C(O)C(O)C1O	5994.4	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O)C(O[Si](C)(C)C(C)(C)C)=C4)OC3=C2)C(O)C(O)C1O	5960.5	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O)C(O)=C4)OC3=C2)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	6003.1	Semi standard non polar	33892256
Quercetin 4',7-diglucoside,2TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(OC5OC(CO)C(O)C(O)C5O)C(O)=C4)OC3=C2)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	6005.0	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - Quercetin 4',7-diglucoside GC-MS (TMS_1_1) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Quercetin 4',7-diglucoside GC-MS (TMS_1_2) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Quercetin 4',7-diglucoside GC-MS (TMS_1_3) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Quercetin 4',7-diglucoside GC-MS (TMS_1_4) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Quercetin 4',7-diglucoside GC-MS (TMS_1_5) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Quercetin 4',7-diglucoside GC-MS (TMS_1_6) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Quercetin 4',7-diglucoside GC-MS (TMS_1_7) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Quercetin 4',7-diglucoside GC-MS (TMS_1_8) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Quercetin 4',7-diglucoside GC-MS (TMS_1_9) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Quercetin 4',7-diglucoside GC-MS (TMS_1_10) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Quercetin 4',7-diglucoside GC-MS (TMS_1_11) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Quercetin 4',7-diglucoside GC-MS (TMS_2_1) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Quercetin 4',7-diglucoside GC-MS (TMS_2_2) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Quercetin 4',7-diglucoside GC-MS (TMS_2_3) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Quercetin 4',7-diglucoside GC-MS (TMS_2_4) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Quercetin 4',7-diglucoside GC-MS (TMS_2_5) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Quercetin 4',7-diglucoside GC-MS (TMS_2_6) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Quercetin 4',7-diglucoside GC-MS (TMS_2_7) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Quercetin 4',7-diglucoside GC-MS (TMS_2_8) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Quercetin 4',7-diglucoside GC-MS (TMS_2_9) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Quercetin 4',7-diglucoside GC-MS (TMS_2_10) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Quercetin 4',7-diglucoside GC-MS (TMS_2_11) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Quercetin 4',7-diglucoside GC-MS (TMS_2_12) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Quercetin 4',7-diglucoside GC-MS (TMS_2_13) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Quercetin 4',7-diglucoside GC-MS (TMS_2_14) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Quercetin 4',7-diglucoside 10V, Positive-QTOF	splash10-05mk-0001903000-3291dab8ec825a01fe3c	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Quercetin 4',7-diglucoside 20V, Positive-QTOF	splash10-0udj-0118900000-ef5287ba4eadf44eee9c	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Quercetin 4',7-diglucoside 40V, Positive-QTOF	splash10-0udi-1529300000-b426105a327818db24e3	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Quercetin 4',7-diglucoside 10V, Negative-QTOF	splash10-01t9-0203829000-b298286c7ace64e9f7d3	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Quercetin 4',7-diglucoside 20V, Negative-QTOF	splash10-03dj-1112912000-b4a4b825b045e98693ba	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Quercetin 4',7-diglucoside 40V, Negative-QTOF	splash10-0gvp-4259400000-53c9195d65808533667a	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Quercetin 4',7-diglucoside 10V, Negative-QTOF	splash10-004i-0000009000-5ca4b2c692a1518fb742	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Quercetin 4',7-diglucoside 20V, Negative-QTOF	splash10-01t9-0000509000-d360df325d24f5da9e80	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Quercetin 4',7-diglucoside 40V, Negative-QTOF	splash10-03di-0000901000-a418c0a968d0f1c896e7	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Quercetin 4',7-diglucoside 10V, Positive-QTOF	splash10-016r-0000904000-94056ff7825302606da7	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Quercetin 4',7-diglucoside 20V, Positive-QTOF	splash10-014i-0000901000-8e8a411362fda094740e	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Quercetin 4',7-diglucoside 40V, Positive-QTOF	splash10-014i-0000900000-efd108638fa903352a90	2021-09-25	Wishart Lab	View Spectrum

NMR Spectra

Spectrum Type	Description	Deposition Date	Source	View
Predicted 1D NMR	¹H NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Cytoplasm
Extracellular

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

FDB016381

KNApSAcK ID

C00005438

Chemspider ID

Not Available

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

73157268

PDB ID

Not Available

ChEBI ID

Not Available

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

Not Available

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

(). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .

Showing metabocard for Quercetin 4',7-diglucoside (HMDB0037356)

MOL for HMDB0037356 (Quercetin 4',7-diglucoside)

3D MOL for HMDB0037356 (Quercetin 4',7-diglucoside)

3D SDF for HMDB0037356 (Quercetin 4',7-diglucoside)

3D-SDF for HMDB0037356 (Quercetin 4',7-diglucoside)

PDB for HMDB0037356 (Quercetin 4',7-diglucoside)

3D PDB for HMDB0037356 (Quercetin 4',7-diglucoside)

SMILES for HMDB0037356 (Quercetin 4',7-diglucoside)

INCHI for HMDB0037356 (Quercetin 4',7-diglucoside)

Structure for HMDB0037356 (Quercetin 4',7-diglucoside)

3D Structure for HMDB0037356 (Quercetin 4',7-diglucoside)

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra

NMR Spectra