| Chromatographic Method | Retention Time | Reference |
|---|
| Predicted by Siyang on May 30, 2022 | 10.4831 minutes | 33406817 |
| Predicted by Siyang using ReTip algorithm on June 8, 2022 | 4.84 minutes | 32390414 |
| Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 1457.2 seconds | 40023050 |
| Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 346.6 seconds | 40023050 |
| Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 98.2 seconds | 40023050 |
| Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 216.1 seconds | 40023050 |
| RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 86.4 seconds | 40023050 |
| Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 303.4 seconds | 40023050 |
| BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 422.5 seconds | 40023050 |
| HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 332.4 seconds | 40023050 |
| UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 817.0 seconds | 40023050 |
| BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 171.1 seconds | 40023050 |
| UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 901.7 seconds | 40023050 |
| SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 250.4 seconds | 40023050 |
| RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 232.9 seconds | 40023050 |
| MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 414.2 seconds | 40023050 |
| KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 363.9 seconds | 40023050 |
| Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 88.7 seconds | 40023050 |
| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| (S)-2-Amino-4-methylsulfanyl-butane-1-thiol,1TMS,isomer #1 | CSCCC(N)CS[Si](C)(C)C | 1485.7 | Semi standard non polar | 33892256 |
| (S)-2-Amino-4-methylsulfanyl-butane-1-thiol,1TMS,isomer #1 | CSCCC(N)CS[Si](C)(C)C | 1507.3 | Standard non polar | 33892256 |
| (S)-2-Amino-4-methylsulfanyl-butane-1-thiol,1TMS,isomer #1 | CSCCC(N)CS[Si](C)(C)C | 2226.0 | Standard polar | 33892256 |
| (S)-2-Amino-4-methylsulfanyl-butane-1-thiol,1TMS,isomer #2 | CSCCC(CS)N[Si](C)(C)C | 1492.8 | Semi standard non polar | 33892256 |
| (S)-2-Amino-4-methylsulfanyl-butane-1-thiol,1TMS,isomer #2 | CSCCC(CS)N[Si](C)(C)C | 1385.8 | Standard non polar | 33892256 |
| (S)-2-Amino-4-methylsulfanyl-butane-1-thiol,1TMS,isomer #2 | CSCCC(CS)N[Si](C)(C)C | 1901.9 | Standard polar | 33892256 |
| (S)-2-Amino-4-methylsulfanyl-butane-1-thiol,2TMS,isomer #1 | CSCCC(CS[Si](C)(C)C)N[Si](C)(C)C | 1647.6 | Semi standard non polar | 33892256 |
| (S)-2-Amino-4-methylsulfanyl-butane-1-thiol,2TMS,isomer #1 | CSCCC(CS[Si](C)(C)C)N[Si](C)(C)C | 1645.7 | Standard non polar | 33892256 |
| (S)-2-Amino-4-methylsulfanyl-butane-1-thiol,2TMS,isomer #1 | CSCCC(CS[Si](C)(C)C)N[Si](C)(C)C | 1811.3 | Standard polar | 33892256 |
| (S)-2-Amino-4-methylsulfanyl-butane-1-thiol,2TMS,isomer #2 | CSCCC(CS)N([Si](C)(C)C)[Si](C)(C)C | 1679.1 | Semi standard non polar | 33892256 |
| (S)-2-Amino-4-methylsulfanyl-butane-1-thiol,2TMS,isomer #2 | CSCCC(CS)N([Si](C)(C)C)[Si](C)(C)C | 1646.9 | Standard non polar | 33892256 |
| (S)-2-Amino-4-methylsulfanyl-butane-1-thiol,2TMS,isomer #2 | CSCCC(CS)N([Si](C)(C)C)[Si](C)(C)C | 1892.2 | Standard polar | 33892256 |
| (S)-2-Amino-4-methylsulfanyl-butane-1-thiol,3TMS,isomer #1 | CSCCC(CS[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 1806.4 | Semi standard non polar | 33892256 |
| (S)-2-Amino-4-methylsulfanyl-butane-1-thiol,3TMS,isomer #1 | CSCCC(CS[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 1835.6 | Standard non polar | 33892256 |
| (S)-2-Amino-4-methylsulfanyl-butane-1-thiol,3TMS,isomer #1 | CSCCC(CS[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 1781.6 | Standard polar | 33892256 |
| (S)-2-Amino-4-methylsulfanyl-butane-1-thiol,1TBDMS,isomer #1 | CSCCC(N)CS[Si](C)(C)C(C)(C)C | 1738.3 | Semi standard non polar | 33892256 |
| (S)-2-Amino-4-methylsulfanyl-butane-1-thiol,1TBDMS,isomer #1 | CSCCC(N)CS[Si](C)(C)C(C)(C)C | 1763.9 | Standard non polar | 33892256 |
| (S)-2-Amino-4-methylsulfanyl-butane-1-thiol,1TBDMS,isomer #1 | CSCCC(N)CS[Si](C)(C)C(C)(C)C | 2342.4 | Standard polar | 33892256 |
| (S)-2-Amino-4-methylsulfanyl-butane-1-thiol,1TBDMS,isomer #2 | CSCCC(CS)N[Si](C)(C)C(C)(C)C | 1709.6 | Semi standard non polar | 33892256 |
| (S)-2-Amino-4-methylsulfanyl-butane-1-thiol,1TBDMS,isomer #2 | CSCCC(CS)N[Si](C)(C)C(C)(C)C | 1632.5 | Standard non polar | 33892256 |
| (S)-2-Amino-4-methylsulfanyl-butane-1-thiol,1TBDMS,isomer #2 | CSCCC(CS)N[Si](C)(C)C(C)(C)C | 2051.0 | Standard polar | 33892256 |
| (S)-2-Amino-4-methylsulfanyl-butane-1-thiol,2TBDMS,isomer #1 | CSCCC(CS[Si](C)(C)C(C)(C)C)N[Si](C)(C)C(C)(C)C | 2110.9 | Semi standard non polar | 33892256 |
| (S)-2-Amino-4-methylsulfanyl-butane-1-thiol,2TBDMS,isomer #1 | CSCCC(CS[Si](C)(C)C(C)(C)C)N[Si](C)(C)C(C)(C)C | 2083.5 | Standard non polar | 33892256 |
| (S)-2-Amino-4-methylsulfanyl-butane-1-thiol,2TBDMS,isomer #1 | CSCCC(CS[Si](C)(C)C(C)(C)C)N[Si](C)(C)C(C)(C)C | 2021.3 | Standard polar | 33892256 |
| (S)-2-Amino-4-methylsulfanyl-butane-1-thiol,2TBDMS,isomer #2 | CSCCC(CS)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2103.1 | Semi standard non polar | 33892256 |
| (S)-2-Amino-4-methylsulfanyl-butane-1-thiol,2TBDMS,isomer #2 | CSCCC(CS)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2052.6 | Standard non polar | 33892256 |
| (S)-2-Amino-4-methylsulfanyl-butane-1-thiol,2TBDMS,isomer #2 | CSCCC(CS)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2077.6 | Standard polar | 33892256 |
| (S)-2-Amino-4-methylsulfanyl-butane-1-thiol,3TBDMS,isomer #1 | CSCCC(CS[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2499.8 | Semi standard non polar | 33892256 |
| (S)-2-Amino-4-methylsulfanyl-butane-1-thiol,3TBDMS,isomer #1 | CSCCC(CS[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2462.1 | Standard non polar | 33892256 |
| (S)-2-Amino-4-methylsulfanyl-butane-1-thiol,3TBDMS,isomer #1 | CSCCC(CS[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2121.5 | Standard polar | 33892256 |