| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Predicted by Siyang on May 30, 2022 | 8.7804 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 3.27 minutes | 32390414 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 459.7 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 363.2 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 69.1 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 261.8 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 153.6 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 283.1 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 247.4 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 854.9 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 578.6 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 40.3 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 610.1 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 225.8 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 329.0 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 719.2 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 551.4 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 388.2 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Guanazole,1TMS,isomer #1 | C[Si](C)(C)N=C1[NH][NH]C(=N)[NH]1 | 1559.9 | Semi standard non polar | 33892256 | | Guanazole,1TMS,isomer #1 | C[Si](C)(C)N=C1[NH][NH]C(=N)[NH]1 | 1588.3 | Standard non polar | 33892256 | | Guanazole,1TMS,isomer #1 | C[Si](C)(C)N=C1[NH][NH]C(=N)[NH]1 | 2701.0 | Standard polar | 33892256 | | Guanazole,1TMS,isomer #2 | C[Si](C)(C)N1[NH]C(=N)[NH]C1=N | 1535.6 | Semi standard non polar | 33892256 | | Guanazole,1TMS,isomer #2 | C[Si](C)(C)N1[NH]C(=N)[NH]C1=N | 1502.7 | Standard non polar | 33892256 | | Guanazole,1TMS,isomer #2 | C[Si](C)(C)N1[NH]C(=N)[NH]C1=N | 2805.8 | Standard polar | 33892256 | | Guanazole,1TMS,isomer #3 | C[Si](C)(C)N1C(=N)[NH][NH]C1=N | 1541.6 | Semi standard non polar | 33892256 | | Guanazole,1TMS,isomer #3 | C[Si](C)(C)N1C(=N)[NH][NH]C1=N | 1543.9 | Standard non polar | 33892256 | | Guanazole,1TMS,isomer #3 | C[Si](C)(C)N1C(=N)[NH][NH]C1=N | 2801.5 | Standard polar | 33892256 | | Guanazole,2TMS,isomer #1 | C[Si](C)(C)N=C1[NH]C(=N)[NH]N1[Si](C)(C)C | 1554.7 | Semi standard non polar | 33892256 | | Guanazole,2TMS,isomer #1 | C[Si](C)(C)N=C1[NH]C(=N)[NH]N1[Si](C)(C)C | 1583.9 | Standard non polar | 33892256 | | Guanazole,2TMS,isomer #1 | C[Si](C)(C)N=C1[NH]C(=N)[NH]N1[Si](C)(C)C | 2614.1 | Standard polar | 33892256 | | Guanazole,2TMS,isomer #2 | C[Si](C)(C)N=C1[NH]C(=N)N([Si](C)(C)C)[NH]1 | 1522.3 | Semi standard non polar | 33892256 | | Guanazole,2TMS,isomer #2 | C[Si](C)(C)N=C1[NH]C(=N)N([Si](C)(C)C)[NH]1 | 1614.6 | Standard non polar | 33892256 | | Guanazole,2TMS,isomer #2 | C[Si](C)(C)N=C1[NH]C(=N)N([Si](C)(C)C)[NH]1 | 2681.7 | Standard polar | 33892256 | | Guanazole,2TMS,isomer #3 | C[Si](C)(C)N=C1[NH][NH]C(=N[Si](C)(C)C)[NH]1 | 1445.3 | Semi standard non polar | 33892256 | | Guanazole,2TMS,isomer #3 | C[Si](C)(C)N=C1[NH][NH]C(=N[Si](C)(C)C)[NH]1 | 1682.2 | Standard non polar | 33892256 | | Guanazole,2TMS,isomer #3 | C[Si](C)(C)N=C1[NH][NH]C(=N[Si](C)(C)C)[NH]1 | 2681.9 | Standard polar | 33892256 | | Guanazole,2TMS,isomer #4 | C[Si](C)(C)N=C1[NH][NH]C(=N)N1[Si](C)(C)C | 1538.1 | Semi standard non polar | 33892256 | | Guanazole,2TMS,isomer #4 | C[Si](C)(C)N=C1[NH][NH]C(=N)N1[Si](C)(C)C | 1657.6 | Standard non polar | 33892256 | | Guanazole,2TMS,isomer #4 | C[Si](C)(C)N=C1[NH][NH]C(=N)N1[Si](C)(C)C | 2660.2 | Standard polar | 33892256 | | Guanazole,2TMS,isomer #5 | C[Si](C)(C)N1C(=N)[NH]C(=N)N1[Si](C)(C)C | 1533.0 | Semi standard non polar | 33892256 | | Guanazole,2TMS,isomer #5 | C[Si](C)(C)N1C(=N)[NH]C(=N)N1[Si](C)(C)C | 1524.6 | Standard non polar | 33892256 | | Guanazole,2TMS,isomer #5 | C[Si](C)(C)N1C(=N)[NH]C(=N)N1[Si](C)(C)C | 2599.6 | Standard polar | 33892256 | | Guanazole,2TMS,isomer #6 | C[Si](C)(C)N1[NH]C(=N)N([Si](C)(C)C)C1=N | 1543.2 | Semi standard non polar | 33892256 | | Guanazole,2TMS,isomer #6 | C[Si](C)(C)N1[NH]C(=N)N([Si](C)(C)C)C1=N | 1556.2 | Standard non polar | 33892256 | | Guanazole,2TMS,isomer #6 | C[Si](C)(C)N1[NH]C(=N)N([Si](C)(C)C)C1=N | 2646.8 | Standard polar | 33892256 | | Guanazole,3TMS,isomer #1 | C[Si](C)(C)N=C1N([Si](C)(C)C)[NH]C(=N)N1[Si](C)(C)C | 1683.7 | Semi standard non polar | 33892256 | | Guanazole,3TMS,isomer #1 | C[Si](C)(C)N=C1N([Si](C)(C)C)[NH]C(=N)N1[Si](C)(C)C | 1640.0 | Standard non polar | 33892256 | | Guanazole,3TMS,isomer #1 | C[Si](C)(C)N=C1N([Si](C)(C)C)[NH]C(=N)N1[Si](C)(C)C | 2468.0 | Standard polar | 33892256 | | Guanazole,3TMS,isomer #2 | C[Si](C)(C)N=C1[NH]C(=N[Si](C)(C)C)N([Si](C)(C)C)[NH]1 | 1538.4 | Semi standard non polar | 33892256 | | Guanazole,3TMS,isomer #2 | C[Si](C)(C)N=C1[NH]C(=N[Si](C)(C)C)N([Si](C)(C)C)[NH]1 | 1697.8 | Standard non polar | 33892256 | | Guanazole,3TMS,isomer #2 | C[Si](C)(C)N=C1[NH]C(=N[Si](C)(C)C)N([Si](C)(C)C)[NH]1 | 2531.8 | Standard polar | 33892256 | | Guanazole,3TMS,isomer #3 | C[Si](C)(C)N=C1[NH]C(=N)N([Si](C)(C)C)N1[Si](C)(C)C | 1594.6 | Semi standard non polar | 33892256 | | Guanazole,3TMS,isomer #3 | C[Si](C)(C)N=C1[NH]C(=N)N([Si](C)(C)C)N1[Si](C)(C)C | 1604.1 | Standard non polar | 33892256 | | Guanazole,3TMS,isomer #3 | C[Si](C)(C)N=C1[NH]C(=N)N([Si](C)(C)C)N1[Si](C)(C)C | 2477.0 | Standard polar | 33892256 | | Guanazole,3TMS,isomer #4 | C[Si](C)(C)N=C1[NH]N([Si](C)(C)C)C(=N)N1[Si](C)(C)C | 1592.3 | Semi standard non polar | 33892256 | | Guanazole,3TMS,isomer #4 | C[Si](C)(C)N=C1[NH]N([Si](C)(C)C)C(=N)N1[Si](C)(C)C | 1661.7 | Standard non polar | 33892256 | | Guanazole,3TMS,isomer #4 | C[Si](C)(C)N=C1[NH]N([Si](C)(C)C)C(=N)N1[Si](C)(C)C | 2536.8 | Standard polar | 33892256 | | Guanazole,3TMS,isomer #5 | C[Si](C)(C)N=C1[NH][NH]C(=N[Si](C)(C)C)N1[Si](C)(C)C | 1503.7 | Semi standard non polar | 33892256 | | Guanazole,3TMS,isomer #5 | C[Si](C)(C)N=C1[NH][NH]C(=N[Si](C)(C)C)N1[Si](C)(C)C | 1765.4 | Standard non polar | 33892256 | | Guanazole,3TMS,isomer #5 | C[Si](C)(C)N=C1[NH][NH]C(=N[Si](C)(C)C)N1[Si](C)(C)C | 2559.5 | Standard polar | 33892256 | | Guanazole,3TMS,isomer #6 | C[Si](C)(C)N1C(=N)N([Si](C)(C)C)N([Si](C)(C)C)C1=N | 1610.9 | Semi standard non polar | 33892256 | | Guanazole,3TMS,isomer #6 | C[Si](C)(C)N1C(=N)N([Si](C)(C)C)N([Si](C)(C)C)C1=N | 1632.0 | Standard non polar | 33892256 | | Guanazole,3TMS,isomer #6 | C[Si](C)(C)N1C(=N)N([Si](C)(C)C)N([Si](C)(C)C)C1=N | 2391.0 | Standard polar | 33892256 | | Guanazole,4TMS,isomer #1 | C[Si](C)(C)N=C1N([Si](C)(C)C)C(=N)N([Si](C)(C)C)N1[Si](C)(C)C | 1703.0 | Semi standard non polar | 33892256 | | Guanazole,4TMS,isomer #1 | C[Si](C)(C)N=C1N([Si](C)(C)C)C(=N)N([Si](C)(C)C)N1[Si](C)(C)C | 1717.9 | Standard non polar | 33892256 | | Guanazole,4TMS,isomer #1 | C[Si](C)(C)N=C1N([Si](C)(C)C)C(=N)N([Si](C)(C)C)N1[Si](C)(C)C | 2213.3 | Standard polar | 33892256 | | Guanazole,4TMS,isomer #2 | C[Si](C)(C)N=C1[NH]N([Si](C)(C)C)C(=N[Si](C)(C)C)N1[Si](C)(C)C | 1689.0 | Semi standard non polar | 33892256 | | Guanazole,4TMS,isomer #2 | C[Si](C)(C)N=C1[NH]N([Si](C)(C)C)C(=N[Si](C)(C)C)N1[Si](C)(C)C | 1712.4 | Standard non polar | 33892256 | | Guanazole,4TMS,isomer #2 | C[Si](C)(C)N=C1[NH]N([Si](C)(C)C)C(=N[Si](C)(C)C)N1[Si](C)(C)C | 2292.5 | Standard polar | 33892256 | | Guanazole,4TMS,isomer #3 | C[Si](C)(C)N=C1[NH]C(=N[Si](C)(C)C)N([Si](C)(C)C)N1[Si](C)(C)C | 1628.4 | Semi standard non polar | 33892256 | | Guanazole,4TMS,isomer #3 | C[Si](C)(C)N=C1[NH]C(=N[Si](C)(C)C)N([Si](C)(C)C)N1[Si](C)(C)C | 1678.4 | Standard non polar | 33892256 | | Guanazole,4TMS,isomer #3 | C[Si](C)(C)N=C1[NH]C(=N[Si](C)(C)C)N([Si](C)(C)C)N1[Si](C)(C)C | 2269.9 | Standard polar | 33892256 | | Guanazole,5TMS,isomer #1 | C[Si](C)(C)N=C1N([Si](C)(C)C)C(=N[Si](C)(C)C)N([Si](C)(C)C)N1[Si](C)(C)C | 1811.5 | Semi standard non polar | 33892256 | | Guanazole,5TMS,isomer #1 | C[Si](C)(C)N=C1N([Si](C)(C)C)C(=N[Si](C)(C)C)N([Si](C)(C)C)N1[Si](C)(C)C | 1764.7 | Standard non polar | 33892256 | | Guanazole,5TMS,isomer #1 | C[Si](C)(C)N=C1N([Si](C)(C)C)C(=N[Si](C)(C)C)N([Si](C)(C)C)N1[Si](C)(C)C | 2002.4 | Standard polar | 33892256 | | Guanazole,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)N=C1[NH][NH]C(=N)[NH]1 | 1782.9 | Semi standard non polar | 33892256 | | Guanazole,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)N=C1[NH][NH]C(=N)[NH]1 | 1808.8 | Standard non polar | 33892256 | | Guanazole,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)N=C1[NH][NH]C(=N)[NH]1 | 2886.1 | Standard polar | 33892256 | | Guanazole,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)N1[NH]C(=N)[NH]C1=N | 1787.2 | Semi standard non polar | 33892256 | | Guanazole,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)N1[NH]C(=N)[NH]C1=N | 1623.0 | Standard non polar | 33892256 | | Guanazole,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)N1[NH]C(=N)[NH]C1=N | 2810.2 | Standard polar | 33892256 | | Guanazole,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N1C(=N)[NH][NH]C1=N | 1814.1 | Semi standard non polar | 33892256 | | Guanazole,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N1C(=N)[NH][NH]C1=N | 1636.5 | Standard non polar | 33892256 | | Guanazole,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N1C(=N)[NH][NH]C1=N | 2878.4 | Standard polar | 33892256 | | Guanazole,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)N=C1[NH]C(=N)[NH]N1[Si](C)(C)C(C)(C)C | 2022.6 | Semi standard non polar | 33892256 | | Guanazole,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)N=C1[NH]C(=N)[NH]N1[Si](C)(C)C(C)(C)C | 1981.6 | Standard non polar | 33892256 | | Guanazole,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)N=C1[NH]C(=N)[NH]N1[Si](C)(C)C(C)(C)C | 2716.8 | Standard polar | 33892256 | | Guanazole,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)N=C1[NH]C(=N)N([Si](C)(C)C(C)(C)C)[NH]1 | 1976.8 | Semi standard non polar | 33892256 | | Guanazole,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)N=C1[NH]C(=N)N([Si](C)(C)C(C)(C)C)[NH]1 | 1963.5 | Standard non polar | 33892256 | | Guanazole,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)N=C1[NH]C(=N)N([Si](C)(C)C(C)(C)C)[NH]1 | 2742.9 | Standard polar | 33892256 | | Guanazole,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N=C1[NH][NH]C(=N[Si](C)(C)C(C)(C)C)[NH]1 | 1939.6 | Semi standard non polar | 33892256 | | Guanazole,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N=C1[NH][NH]C(=N[Si](C)(C)C(C)(C)C)[NH]1 | 2059.3 | Standard non polar | 33892256 | | Guanazole,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N=C1[NH][NH]C(=N[Si](C)(C)C(C)(C)C)[NH]1 | 2878.5 | Standard polar | 33892256 | | Guanazole,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N=C1[NH][NH]C(=N)N1[Si](C)(C)C(C)(C)C | 2012.7 | Semi standard non polar | 33892256 | | Guanazole,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N=C1[NH][NH]C(=N)N1[Si](C)(C)C(C)(C)C | 1988.1 | Standard non polar | 33892256 | | Guanazole,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N=C1[NH][NH]C(=N)N1[Si](C)(C)C(C)(C)C | 2770.4 | Standard polar | 33892256 | | Guanazole,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)N1C(=N)[NH]C(=N)N1[Si](C)(C)C(C)(C)C | 1967.1 | Semi standard non polar | 33892256 | | Guanazole,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)N1C(=N)[NH]C(=N)N1[Si](C)(C)C(C)(C)C | 1917.3 | Standard non polar | 33892256 | | Guanazole,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)N1C(=N)[NH]C(=N)N1[Si](C)(C)C(C)(C)C | 2574.9 | Standard polar | 33892256 | | Guanazole,2TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)N1[NH]C(=N)N([Si](C)(C)C(C)(C)C)C1=N | 2012.0 | Semi standard non polar | 33892256 | | Guanazole,2TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)N1[NH]C(=N)N([Si](C)(C)C(C)(C)C)C1=N | 1922.9 | Standard non polar | 33892256 | | Guanazole,2TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)N1[NH]C(=N)N([Si](C)(C)C(C)(C)C)C1=N | 2597.4 | Standard polar | 33892256 | | Guanazole,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)N=C1N([Si](C)(C)C(C)(C)C)[NH]C(=N)N1[Si](C)(C)C(C)(C)C | 2195.1 | Semi standard non polar | 33892256 | | Guanazole,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)N=C1N([Si](C)(C)C(C)(C)C)[NH]C(=N)N1[Si](C)(C)C(C)(C)C | 2249.9 | Standard non polar | 33892256 | | Guanazole,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)N=C1N([Si](C)(C)C(C)(C)C)[NH]C(=N)N1[Si](C)(C)C(C)(C)C | 2536.3 | Standard polar | 33892256 | | Guanazole,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)N=C1[NH]C(=N[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[NH]1 | 2124.2 | Semi standard non polar | 33892256 | | Guanazole,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)N=C1[NH]C(=N[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[NH]1 | 2235.8 | Standard non polar | 33892256 | | Guanazole,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)N=C1[NH]C(=N[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[NH]1 | 2655.3 | Standard polar | 33892256 | | Guanazole,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N=C1[NH]C(=N)N([Si](C)(C)C(C)(C)C)N1[Si](C)(C)C(C)(C)C | 2148.9 | Semi standard non polar | 33892256 | | Guanazole,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N=C1[NH]C(=N)N([Si](C)(C)C(C)(C)C)N1[Si](C)(C)C(C)(C)C | 2222.9 | Standard non polar | 33892256 | | Guanazole,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N=C1[NH]C(=N)N([Si](C)(C)C(C)(C)C)N1[Si](C)(C)C(C)(C)C | 2573.7 | Standard polar | 33892256 | | Guanazole,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N=C1[NH]N([Si](C)(C)C(C)(C)C)C(=N)N1[Si](C)(C)C(C)(C)C | 2182.2 | Semi standard non polar | 33892256 | | Guanazole,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N=C1[NH]N([Si](C)(C)C(C)(C)C)C(=N)N1[Si](C)(C)C(C)(C)C | 2243.9 | Standard non polar | 33892256 | | Guanazole,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N=C1[NH]N([Si](C)(C)C(C)(C)C)C(=N)N1[Si](C)(C)C(C)(C)C | 2584.4 | Standard polar | 33892256 | | Guanazole,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)N=C1[NH][NH]C(=N[Si](C)(C)C(C)(C)C)N1[Si](C)(C)C(C)(C)C | 2176.3 | Semi standard non polar | 33892256 | | Guanazole,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)N=C1[NH][NH]C(=N[Si](C)(C)C(C)(C)C)N1[Si](C)(C)C(C)(C)C | 2319.9 | Standard non polar | 33892256 | | Guanazole,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)N=C1[NH][NH]C(=N[Si](C)(C)C(C)(C)C)N1[Si](C)(C)C(C)(C)C | 2725.4 | Standard polar | 33892256 | | Guanazole,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)N1C(=N)N([Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C1=N | 2240.0 | Semi standard non polar | 33892256 | | Guanazole,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)N1C(=N)N([Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C1=N | 2255.5 | Standard non polar | 33892256 | | Guanazole,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)N1C(=N)N([Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C1=N | 2435.8 | Standard polar | 33892256 | | Guanazole,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)N=C1N([Si](C)(C)C(C)(C)C)C(=N)N([Si](C)(C)C(C)(C)C)N1[Si](C)(C)C(C)(C)C | 2426.7 | Semi standard non polar | 33892256 | | Guanazole,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)N=C1N([Si](C)(C)C(C)(C)C)C(=N)N([Si](C)(C)C(C)(C)C)N1[Si](C)(C)C(C)(C)C | 2474.6 | Standard non polar | 33892256 | | Guanazole,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)N=C1N([Si](C)(C)C(C)(C)C)C(=N)N([Si](C)(C)C(C)(C)C)N1[Si](C)(C)C(C)(C)C | 2440.8 | Standard polar | 33892256 | | Guanazole,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)N=C1[NH]N([Si](C)(C)C(C)(C)C)C(=N[Si](C)(C)C(C)(C)C)N1[Si](C)(C)C(C)(C)C | 2391.7 | Semi standard non polar | 33892256 | | Guanazole,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)N=C1[NH]N([Si](C)(C)C(C)(C)C)C(=N[Si](C)(C)C(C)(C)C)N1[Si](C)(C)C(C)(C)C | 2460.2 | Standard non polar | 33892256 | | Guanazole,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)N=C1[NH]N([Si](C)(C)C(C)(C)C)C(=N[Si](C)(C)C(C)(C)C)N1[Si](C)(C)C(C)(C)C | 2490.1 | Standard polar | 33892256 | | Guanazole,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N=C1[NH]C(=N[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)N1[Si](C)(C)C(C)(C)C | 2372.2 | Semi standard non polar | 33892256 | | Guanazole,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N=C1[NH]C(=N[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)N1[Si](C)(C)C(C)(C)C | 2434.5 | Standard non polar | 33892256 | | Guanazole,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N=C1[NH]C(=N[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)N1[Si](C)(C)C(C)(C)C | 2492.9 | Standard polar | 33892256 | | Guanazole,5TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)N=C1N([Si](C)(C)C(C)(C)C)C(=N[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)N1[Si](C)(C)C(C)(C)C | 2669.9 | Semi standard non polar | 33892256 | | Guanazole,5TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)N=C1N([Si](C)(C)C(C)(C)C)C(=N[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)N1[Si](C)(C)C(C)(C)C | 2645.3 | Standard non polar | 33892256 | | Guanazole,5TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)N=C1N([Si](C)(C)C(C)(C)C)C(=N[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)N1[Si](C)(C)C(C)(C)C | 2442.0 | Standard polar | 33892256 |
|
|---|