| Record Information |
| Version |
3.5 |
| Creation Date |
2006-10-17 05:25:30 -0600 |
| Update Date |
2013-02-08 17:13:49 -0700 |
| HMDB ID |
HMDB05038 |
| Secondary Accession Numbers |
None |
| Metabolite Identification |
| Common Name |
Citalopram |
| Description |
Citalopram is an antidepressant drug used to treat depression associated with mood disorders. It is also used on occasion in the treatment of body dysmorphic disorder and anxiety; Citalopram belongs to a class of drugs known as selective serotonin reuptake inhibitors (SSRIs). It is sold under the brand-names Celexa (U.S., Forest Laboratories, Inc.), Cipramil, Seropram (Europe and Australia) and Ciazil (Australia); A furancarbonitrile that is one of the serotonin uptake inhibitors used as an antidepressant. The drug is also effective in reducing ethanol uptake in alcoholics and is used in depressed patients who also suffer from tardive dyskinesia in preference to tricyclic antidepressants, which aggravate this condition; Citalopram is an antidepressant drug used to treat depression associated with mood disorders. It is also used on occasion in the treatment of body dysmorphic disorder and anxiety. Citalopram belongs to a class of drugs known as selective serotonin reuptake inhibitors (SSRIs). |
| Structure |
Download:
MOL |
SDF |
SMILES |
InChI
Display:
2D Structure |
3D Structure
|
| Synonyms |
- Bonitrile
- Celexa
- Citalopram hydrobromide
- Nitalapram
|
| Chemical Formula |
C20H21FN2O |
| Average Molecular Weight |
324.3919 |
| Monoisotopic Molecular Weight |
324.163791509 |
| IUPAC Name |
1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-1,3-dihydro-2-benzofuran-5-carbonitrile |
| Traditional IUPAC Name |
citalopram |
| CAS Registry Number |
59729-33-8 |
| SMILES |
CN(C)CCCC1(OCC2=C1C=CC(=C2)C#N)C1=CC=C(F)C=C1 |
| InChI Identifier |
InChI=1S/C20H21FN2O/c1-23(2)11-3-10-20(17-5-7-18(21)8-6-17)19-9-4-15(13-22)12-16(19)14-24-20/h4-9,12H,3,10-11,14H2,1-2H3 |
| InChI Key |
WSEQXVZVJXJVFP-UHFFFAOYSA-N |
| Chemical Taxonomy |
| Kingdom |
Organic Compounds |
| Super Class |
Aromatic Heteropolycyclic Compounds |
| Class |
Phenylbutylamines |
| Sub Class |
N/A |
| Other Descriptors |
- Aromatic Heteropolycyclic Compounds
- citalopram(ChEBI)
|
| Substituents |
- Aryl Fluoride
- Benzofuran
- Benzonitrile
- Dialkyl Ether
- Dihydrofuran
- Fluorobenzene
- Nitrile
- Organofluoride
- Tertiary Aliphatic Amine (Trialkylamine)
|
| Direct Parent |
Phenylbutylamines |
| Ontology |
| Status |
Expected and Not Quantified |
| Origin |
|
| Biofunction |
Not Available |
| Application |
Not Available |
| Cellular locations |
Not Available |
| Physical Properties |
| State |
Solid |
| Experimental Properties |
| Property |
Value |
Reference |
| Melting Point |
178 °C |
Not Available |
| Boiling Point |
Not Available |
Not Available |
| Water Solubility |
Not Available |
Not Available |
| LogP |
Not Available |
Not Available |
|
| Predicted Properties |
|
| Spectra |
|
|
| Biological Properties |
| Cellular Locations |
Not Available
|
| Biofluid Locations |
Not Available
|
| Tissue Location |
|
| Pathways |
Not Available
|
| Normal Concentrations |
|
Not Available |
| Abnormal Concentrations |
|
Not Available |
| Associated Disorders and Diseases |
| Disease References |
None |
| Associated OMIM IDs |
None |
| External Links |
| DrugBank ID |
Not Available |
| Phenol Explorer Compound ID |
Not Available |
| Phenol Explorer Metabolite ID |
Not Available |
| FoodDB ID |
FDB023605 |
| KNApSAcK ID |
Not Available |
| Chemspider ID |
2669  |
| KEGG Compound ID |
C07572  |
| BioCyc ID |
Not Available |
| BiGG ID |
Not Available |
| Wikipedia Link |
Citalopram  |
| NuGOwiki Link |
HMDB05038  |
| Metagene Link |
HMDB05038  |
| METLIN ID |
1781  |
| PubChem Compound |
2771  |
| PDB ID |
Not Available |
| ChEBI ID |
3723  |
| References |
| Synthesis Reference |
Petersen, Hans; Bogeso, Klaus Peter; Bech Sommer, Michael. Lundbeck A/S, Method for the preparation of citalopram. PCT Int. Appl. (1998), 16 pp. |
| Material Safety Data Sheet (MSDS) |
Download (PDF)
|
| General References |
- Gleason OC, Yates WR, Isbell MD, Philipsen MA: An open-label trial of citalopram for major depression in patients with hepatitis C. J Clin Psychiatry. 2002 Mar;63(3):194-8.
Pubmed: 11926717
- Blardi P, de Lalla A, Urso R, Auteri A, Dell'Erba A, Bossini L, Castrogiovanni P: Activity of citalopram on adenosine and serotonin circulating levels in depressed patients. J Clin Psychopharmacol. 2005 Jun;25(3):262-6.
Pubmed: 15876907
- Bhagwagar Z, Hafizi S, Cowen PJ: Acute citalopram administration produces correlated increases in plasma and salivary cortisol. Psychopharmacology (Berl). 2002 Aug;163(1):118-20. Epub 2002 Jun 27.
Pubmed: 12185409
- Nikisch G, Mathe AA, Czernik A, Eap CB, Jimenez-Vasquez P, Brawand-Amey M, Baumann P: Stereoselective metabolism of citalopram in plasma and cerebrospinal fluid of depressive patients: relationship with 5-HIAA in CSF and clinical response. J Clin Psychopharmacol. 2004 Jun;24(3):283-90.
Pubmed: 15118482
- Anastos N, McIntyre IM, Lynch MJ, Drummer OH: Postmortem concentrations of citalopram. J Forensic Sci. 2002 Jul;47(4):882-4.
Pubmed: 12137000
- Horak EL, Jenkins AJ: Postmortem tissue distribution of olanzapine and citalopram in a drug intoxication. J Forensic Sci. 2005 May;50(3):679-81.
Pubmed: 15932107
- Lapatto-Reiniluoto O, Kivisto KT, Neuvonen PJ: Effect of activated charcoal alone or given after gastric lavage in reducing the absorption of diazepam, ibuprofen and citalopram. Br J Clin Pharmacol. 1999 Aug;48(2):148-53.
Pubmed: 10417490
- Worm K, Dragsholt C, Simonsen KW, Kringsholm B: [Citalopram in forensic samples. Citalopram concentrations in samples from legal autopsies and from living persons in connection with traffic accidents or cases of violence in Denmark 1989-1996] Ugeskr Laeger. 1999 Jul 26;161(30):4291-2.
Pubmed: 10439690
- Jensen PN, Olesen OV, Bertelsen A, Linnet K: Citalopram and desmethylcitalopram concentrations in breast milk and in serum of mother and infant. Ther Drug Monit. 1997 Apr;19(2):236-9.
Pubmed: 9108657
- Schmidt K, Olesen OV, Jensen PN: Citalopram and breast-feeding: serum concentration and side effects in the infant. Biol Psychiatry. 2000 Jan 15;47(2):164-5.
Pubmed: 10664835
- Rochat B, Kosel M, Boss G, Testa B, Gillet M, Baumann P: Stereoselective biotransformation of the selective serotonin reuptake inhibitor citalopram and its demethylated metabolites by monoamine oxidases in human liver. Biochem Pharmacol. 1998 Jul 1;56(1):15-23.
Pubmed: 9698084
- Kristoffersen L, Bugge A, Lundanes E, Slordal L: Simultaneous determination of citalopram, fluoxetine, paroxetine and their metabolites in plasma and whole blood by high-performance liquid chromatography with ultraviolet and fluorescence detection. J Chromatogr B Biomed Sci Appl. 1999 Nov 12;734(2):229-46.
Pubmed: 10595721
- Nordeng H, Bergsholm YK, Bohler E, Spigset O: [The transfer of selective serotonin reuptake inhibitors to human milk] Tidsskr Nor Laegeforen. 2001 Jan 20;121(2):199-203.
Pubmed: 11475200
- Plenge P, Mellerup ET: [3H]citalopram binding to brain and platelet membranes of human and rat. J Neurochem. 1991 Jan;56(1):248-52.
Pubmed: 1824783
- Nikisch G, Mathe AA, Czernik A, Thiele J, Bohner J, Eap CB, Agren H, Baumann P: Long-term citalopram administration reduces responsiveness of HPA axis in patients with major depression: relationship with S-citalopram concentrations in plasma and cerebrospinal fluid (CSF) and clinical response. Psychopharmacology (Berl). 2005 Oct;181(4):751-60. Epub 2005 Sep 29.
Pubmed: 15988572
- Spigset O, Hagg S, Stegmayr B, Dahlqvist R: Citalopram pharmacokinetics in patients with chronic renal failure and the effect of haemodialysis. Eur J Clin Pharmacol. 2000 Dec;56(9-10):699-703.
Pubmed: 11214779
- Anderer P, Saletu B, Semlitsch HV, Pascual-Marqui RD: Perceptual and cognitive event-related potentials in neuropsychopharmacology: methodological aspects and clinical applications (pharmaco-ERP topography and tomography). Methods Find Exp Clin Pharmacol. 2002;24 Suppl C:121-37.
Pubmed: 12575494
- Kosel M, Gnerre C, Voirol P, Amey M, Rochat B, Bouras C, Testa B, Baumann P: In vitro biotransformation of the selective serotonin reuptake inhibitor citalopram, its enantiomers and demethylated metabolites by monoamine oxidase in rat and human brain preparations. Mol Psychiatry. 2002;7(2):181-8.
Pubmed: 11840311
- Spigset O, Wilhelmsson C, Mjorndal T, Eriksson S: Low serum sodium concentrations during treatment with citalopram in elderly patients: relationship to serum citalopram levels and to platelet serotonin 5-HT2A receptor status. J Clin Psychopharmacol. 2000 Oct;20(5):582-4.
Pubmed: 11001247
|
| Enzymes |
|
|
|
|
| Name: |
Cytochrome P450 3A4
|
| Reactions: |
- (1) taurochenodeoxycholate + NADPH + H+ + O2 = taurohyocholate + NADP+ + H2O [RN:R07205]
- (2) lithocholate + NADPH + H+ + O2 = hyodeoxycholate + NADP+ + H2O [RN:R07206]
|
| Gene Name: |
CYP3A4 |
| Uniprot ID: |
P08684  |
| Protein Sequence: |
FASTA |
| Gene Sequence: |
FASTA |
|
| Name: |
Cytochrome P450 2C9
|
| Reactions: |
- (R)-limonene + NADPH + H+ + O2 = (+)-trans-carveol + NADP+ + H2O [RN:R06119]
|
| Gene Name: |
CYP2C9 |
| Uniprot ID: |
P11712  |
| Protein Sequence: |
FASTA |
| Gene Sequence: |
FASTA |
|
| Name: |
Cytochrome P450 2C19
|
| Reactions: |
- (R)-limonene + NADPH + H+ + O2 = (+)-trans-carveol + NADP+ + H2O [RN:R06119]
|
| Gene Name: |
CYP2C19 |
| Uniprot ID: |
P33261  |
| Protein Sequence: |
FASTA |
| Gene Sequence: |
FASTA |
|
|
|
| Name: |
Cytochrome P450 3A43
|
| Reactions: |
- RH + reduced flavoprotein + O2 = ROH + oxidized flavoprotein + H2O [RN:R04122]
|
| Gene Name: |
CYP3A43 |
| Uniprot ID: |
Q9HB55  |
| Protein Sequence: |
FASTA |
| Gene Sequence: |
FASTA |
|
| Name: |
Cytochrome P450 1B1
|
| Reactions: |
- RH + reduced flavoprotein + O2 = ROH + oxidized flavoprotein + H2O [RN:R04122]
|
| Gene Name: |
CYP1B1 |
| Uniprot ID: |
Q16678  |
| Protein Sequence: |
FASTA |
| Gene Sequence: |
FASTA |
|
| Name: |
Cytochrome P450 2D6
|
| Reactions: |
- RH + reduced flavoprotein + O2 = ROH + oxidized flavoprotein + H2O [RN:R04122]
|
| Gene Name: |
CYP2D6 |
| Uniprot ID: |
P10635  |
| Protein Sequence: |
FASTA |
| Gene Sequence: |
FASTA |
|
| Name: |
Cytochrome P450 2C18
|
| Reactions: |
- RH + reduced flavoprotein + O2 = ROH + oxidized flavoprotein + H2O [RN:R04122]
|
| Gene Name: |
CYP2C18 |
| Uniprot ID: |
P33260  |
| Protein Sequence: |
FASTA |
| Gene Sequence: |
FASTA |
|
| Name: |
Cytochrome P450 2F1
|
| Reactions: |
- RH + reduced flavoprotein + O2 = ROH + oxidized flavoprotein + H2O [RN:R04122]
|
| Gene Name: |
CYP2F1 |
| Uniprot ID: |
P24903  |
| Protein Sequence: |
FASTA |
| Gene Sequence: |
FASTA |
|
| Name: |
Cytochrome P450 4X1
|
| Reactions: |
- RH + reduced flavoprotein + O2 = ROH + oxidized flavoprotein + H2O [RN:R04122]
|
| Gene Name: |
CYP4X1 |
| Uniprot ID: |
Q8N118  |
| Protein Sequence: |
FASTA |
| Gene Sequence: |
FASTA |
|
| Name: |
Cytochrome P450 2B6
|
| Reactions: |
- RH + reduced flavoprotein + O2 = ROH + oxidized flavoprotein + H2O [RN:R04122]
|
| Gene Name: |
CYP2B6 |
| Uniprot ID: |
P20813  |
| Protein Sequence: |
FASTA |
| Gene Sequence: |
FASTA |
|
| Name: |
Cytochrome P450 3A5
|
| Reactions: |
- RH + reduced flavoprotein + O2 = ROH + oxidized flavoprotein + H2O [RN:R04122]
|
| Gene Name: |
CYP3A5 |
| Uniprot ID: |
P20815  |
| Protein Sequence: |
FASTA |
| Gene Sequence: |
FASTA |
|
| Name: |
Cytochrome P450 2A13
|
| Reactions: |
- RH + reduced flavoprotein + O2 = ROH + oxidized flavoprotein + H2O [RN:R04122]
|
| Gene Name: |
CYP2A13 |
| Uniprot ID: |
Q16696  |
| Protein Sequence: |
FASTA |
| Gene Sequence: |
FASTA |
|
| Name: |
Cytochrome P450 3A7
|
| Reactions: |
- RH + reduced flavoprotein + O2 = ROH + oxidized flavoprotein + H2O [RN:R04122]
|
| Gene Name: |
CYP3A7 |
| Uniprot ID: |
P24462  |
| Protein Sequence: |
FASTA |
| Gene Sequence: |
FASTA |
|
| Name: |
Cytochrome P450 4B1
|
| Reactions: |
- RH + reduced flavoprotein + O2 = ROH + oxidized flavoprotein + H2O [RN:R04122]
|
| Gene Name: |
CYP4B1 |
| Uniprot ID: |
P13584  |
| Protein Sequence: |
FASTA |
| Gene Sequence: |
FASTA |
|
| Name: |
Cytochrome P450 4Z1
|
| Reactions: |
- RH + reduced flavoprotein + O2 = ROH + oxidized flavoprotein + H2O [RN:R04122]
|
| Gene Name: |
CYP4Z1 |
| Uniprot ID: |
Q86W10  |
| Protein Sequence: |
FASTA |
| Gene Sequence: |
FASTA |
|
| Name: |
Cytochrome P450 1A2
|
| Reactions: |
- RH + reduced flavoprotein + O2 = ROH + oxidized flavoprotein + H2O [RN:R04122]
|
| Gene Name: |
CYP1A2 |
| Uniprot ID: |
P05177  |
| Protein Sequence: |
FASTA |
| Gene Sequence: |
FASTA |
|
| Name: |
Cytochrome P450 19A1
|
| Reactions: |
- RH + reduced flavoprotein + O2 = ROH + oxidized flavoprotein + H2O [RN:R04122]
|
| Gene Name: |
CYP19A1 |
| Uniprot ID: |
P11511  |
| Protein Sequence: |
FASTA |
| Gene Sequence: |
FASTA |
|
| Name: |
Cytochrome P450 2C8
|
| Reactions: |
- RH + reduced flavoprotein + O2 = ROH + oxidized flavoprotein + H2O [RN:R04122]
|
| Gene Name: |
CYP2C8 |
| Uniprot ID: |
P10632  |
| Protein Sequence: |
FASTA |
| Gene Sequence: |
FASTA |
|
| Name: |
Cytochrome P450 2S1
|
| Reactions: |
- RH + reduced flavoprotein + O2 = ROH + oxidized flavoprotein + H2O [RN:R04122]
|
| Gene Name: |
CYP2S1 |
| Uniprot ID: |
Q96SQ9  |
| Protein Sequence: |
FASTA |
| Gene Sequence: |
FASTA |
|
| Name: |
Cytochrome P450 2J2
|
| Reactions: |
- RH + reduced flavoprotein + O2 = ROH + oxidized flavoprotein + H2O [RN:R04122]
|
| Gene Name: |
CYP2J2 |
| Uniprot ID: |
P51589  |
| Protein Sequence: |
FASTA |
| Gene Sequence: |
FASTA |
|
| Name: |
Cytochrome P450 2A7
|
| Reactions: |
- RH + reduced flavoprotein + O2 = ROH + oxidized flavoprotein + H2O [RN:R04122]
|
| Gene Name: |
CYP2A7 |
| Uniprot ID: |
P20853  |
| Protein Sequence: |
FASTA |
| Gene Sequence: |
FASTA |
|
| Name: |
Cytochrome P450 2A6
|
| Reactions: |
- RH + reduced flavoprotein + O2 = ROH + oxidized flavoprotein + H2O [RN:R04122]
|
| Gene Name: |
CYP2A6 |
| Uniprot ID: |
P11509  |
| Protein Sequence: |
FASTA |
| Gene Sequence: |
FASTA |
|
|
|
|
|