Record Information |
---|
Version | 5.0 |
---|
Status | Expected but not Quantified |
---|
Creation Date | 2009-04-02 17:32:33 UTC |
---|
Update Date | 2022-03-07 02:51:21 UTC |
---|
HMDB ID | HMDB0012110 |
---|
Secondary Accession Numbers | |
---|
Metabolite Identification |
---|
Common Name | 5(6)-Epoxy Prostaglandin E1 |
---|
Description | Prostaglandins are eicosanoids. The eicosanoids consist of the prostaglandins (PGs), thromboxanes (TXs), leukotrienes (LTs), and lipoxins (LXs). The PGs and TXs are collectively identified as prostanoids. Prostaglandins were originally shown to be synthesized in the prostate gland, thromboxanes from platelets (thrombocytes), and leukotrienes from leukocytes, hence the derivation of their names. All mammalian cells except erythrocytes synthesize eicosanoids. These molecules are extremely potent, able to cause profound physiological effects at very dilute concentrations. All eicosanoids function locally at the site of synthesis, through receptor-mediated G-protein linked signalling pathways. |
---|
Structure | CCCCC[C@H](O)\C=C\[C@@H]1[C@@H](O)CC(=O)[C@H]1CC1OC1CCCC(O)=O InChI=1S/C20H32O6/c1-2-3-4-6-13(21)9-10-14-15(17(23)12-16(14)22)11-19-18(26-19)7-5-8-20(24)25/h9-10,13-16,18-19,21-22H,2-8,11-12H2,1H3,(H,24,25)/b10-9+/t13-,14-,15-,16-,18?,19?/m0/s1 |
---|
Synonyms | Value | Source |
---|
5(6)-Epoxy pge1 | HMDB | Prostaglandins | HMDB |
|
---|
Chemical Formula | C20H32O6 |
---|
Average Molecular Weight | 368.4645 |
---|
Monoisotopic Molecular Weight | 368.219888756 |
---|
IUPAC Name | 4-(3-{[(1S,2S,3S)-3-hydroxy-2-[(1E,3S)-3-hydroxyoct-1-en-1-yl]-5-oxocyclopentyl]methyl}oxiran-2-yl)butanoic acid |
---|
Traditional Name | 4-(3-{[(1S,2S,3S)-3-hydroxy-2-[(1E,3S)-3-hydroxyoct-1-en-1-yl]-5-oxocyclopentyl]methyl}oxiran-2-yl)butanoic acid |
---|
CAS Registry Number | Not Available |
---|
SMILES | CCCCC[C@H](O)\C=C\[C@@H]1[C@@H](O)CC(=O)[C@H]1CC1OC1CCCC(O)=O |
---|
InChI Identifier | InChI=1S/C20H32O6/c1-2-3-4-6-13(21)9-10-14-15(17(23)12-16(14)22)11-19-18(26-19)7-5-8-20(24)25/h9-10,13-16,18-19,21-22H,2-8,11-12H2,1H3,(H,24,25)/b10-9+/t13-,14-,15-,16-,18?,19?/m0/s1 |
---|
InChI Key | CBOBGOJUDRNUHE-HHECASJMSA-N |
---|
Chemical Taxonomy |
---|
Description | Belongs to the class of organic compounds known as prostaglandins and related compounds. These are unsaturated carboxylic acids consisting of a 20 carbon skeleton that also contains a five member ring, and are based upon the fatty acid arachidonic acid. |
---|
Kingdom | Organic compounds |
---|
Super Class | Lipids and lipid-like molecules |
---|
Class | Fatty Acyls |
---|
Sub Class | Eicosanoids |
---|
Direct Parent | Prostaglandins and related compounds |
---|
Alternative Parents | |
---|
Substituents | - Prostaglandin skeleton
- Fatty alcohol
- Epoxy fatty acid
- Heterocyclic fatty acid
- Hydroxy fatty acid
- Short-chain hydroxy acid
- Cyclopentanol
- Cyclic alcohol
- Cyclic ketone
- Secondary alcohol
- Ketone
- Oxacycle
- Organoheterocyclic compound
- Carboxylic acid derivative
- Carboxylic acid
- Dialkyl ether
- Oxirane
- Ether
- Monocarboxylic acid or derivatives
- Organic oxide
- Alcohol
- Organooxygen compound
- Organic oxygen compound
- Carbonyl group
- Hydrocarbon derivative
- Aliphatic heteromonocyclic compound
|
---|
Molecular Framework | Aliphatic heteromonocyclic compounds |
---|
External Descriptors | Not Available |
---|
Ontology |
---|
Physiological effect | Not Available |
---|
Disposition | |
---|
Process | |
---|
Role | |
---|
Physical Properties |
---|
State | Solid |
---|
Experimental Molecular Properties | Property | Value | Reference |
---|
Melting Point | Not Available | Not Available | Boiling Point | Not Available | Not Available | Water Solubility | Not Available | Not Available | LogP | Not Available | Not Available |
|
---|
Experimental Chromatographic Properties | Not Available |
---|
Predicted Molecular Properties | |
---|
Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Kovats Retention IndicesUnderivatizedDerivatizedDerivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
---|
5(6)-Epoxy Prostaglandin E1,1TMS,isomer #1 | CCCCC[C@@H](/C=C/[C@@H]1[C@@H](O)CC(=O)[C@H]1CC1OC1CCCC(=O)O)O[Si](C)(C)C | 2849.5 | Semi standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,1TMS,isomer #2 | CCCCC[C@H](O)/C=C/[C@@H]1[C@@H](O[Si](C)(C)C)CC(=O)[C@H]1CC1OC1CCCC(=O)O | 2798.9 | Semi standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,1TMS,isomer #3 | CCCCC[C@H](O)/C=C/[C@@H]1[C@@H](O)CC(=O)[C@H]1CC1OC1CCCC(=O)O[Si](C)(C)C | 2807.2 | Semi standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,1TMS,isomer #4 | CCCCC[C@H](O)/C=C/[C@H]1C(CC2OC2CCCC(=O)O)=C(O[Si](C)(C)C)C[C@@H]1O | 2849.7 | Semi standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,1TMS,isomer #5 | CCCCC[C@H](O)/C=C/[C@H]1[C@H](CC2OC2CCCC(=O)O)C(O[Si](C)(C)C)=C[C@@H]1O | 2757.6 | Semi standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,2TMS,isomer #1 | CCCCC[C@@H](/C=C/[C@@H]1[C@@H](O[Si](C)(C)C)CC(=O)[C@H]1CC1OC1CCCC(=O)O)O[Si](C)(C)C | 2817.5 | Semi standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,2TMS,isomer #2 | CCCCC[C@@H](/C=C/[C@@H]1[C@@H](O)CC(=O)[C@H]1CC1OC1CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C | 2846.8 | Semi standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,2TMS,isomer #3 | CCCCC[C@@H](/C=C/[C@H]1C(CC2OC2CCCC(=O)O)=C(O[Si](C)(C)C)C[C@@H]1O)O[Si](C)(C)C | 2917.4 | Semi standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,2TMS,isomer #4 | CCCCC[C@@H](/C=C/[C@H]1[C@H](CC2OC2CCCC(=O)O)C(O[Si](C)(C)C)=C[C@@H]1O)O[Si](C)(C)C | 2803.5 | Semi standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,2TMS,isomer #5 | CCCCC[C@H](O)/C=C/[C@@H]1[C@@H](O[Si](C)(C)C)CC(=O)[C@H]1CC1OC1CCCC(=O)O[Si](C)(C)C | 2786.0 | Semi standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,2TMS,isomer #6 | CCCCC[C@H](O)/C=C/[C@H]1C(CC2OC2CCCC(=O)O)=C(O[Si](C)(C)C)C[C@@H]1O[Si](C)(C)C | 2866.5 | Semi standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,2TMS,isomer #7 | CCCCC[C@H](O)/C=C/[C@H]1[C@H](CC2OC2CCCC(=O)O)C(O[Si](C)(C)C)=C[C@@H]1O[Si](C)(C)C | 2799.9 | Semi standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,2TMS,isomer #8 | CCCCC[C@H](O)/C=C/[C@H]1C(CC2OC2CCCC(=O)O[Si](C)(C)C)=C(O[Si](C)(C)C)C[C@@H]1O | 2866.7 | Semi standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,2TMS,isomer #9 | CCCCC[C@H](O)/C=C/[C@H]1[C@H](CC2OC2CCCC(=O)O[Si](C)(C)C)C(O[Si](C)(C)C)=C[C@@H]1O | 2779.9 | Semi standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,3TMS,isomer #1 | CCCCC[C@@H](/C=C/[C@@H]1[C@@H](O[Si](C)(C)C)CC(=O)[C@H]1CC1OC1CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C | 2793.4 | Semi standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,3TMS,isomer #2 | CCCCC[C@@H](/C=C/[C@H]1C(CC2OC2CCCC(=O)O)=C(O[Si](C)(C)C)C[C@@H]1O[Si](C)(C)C)O[Si](C)(C)C | 2880.2 | Semi standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,3TMS,isomer #3 | CCCCC[C@@H](/C=C/[C@H]1[C@H](CC2OC2CCCC(=O)O)C(O[Si](C)(C)C)=C[C@@H]1O[Si](C)(C)C)O[Si](C)(C)C | 2822.0 | Semi standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,3TMS,isomer #4 | CCCCC[C@@H](/C=C/[C@H]1C(CC2OC2CCCC(=O)O[Si](C)(C)C)=C(O[Si](C)(C)C)C[C@@H]1O)O[Si](C)(C)C | 2891.2 | Semi standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,3TMS,isomer #5 | CCCCC[C@@H](/C=C/[C@H]1[C@H](CC2OC2CCCC(=O)O[Si](C)(C)C)C(O[Si](C)(C)C)=C[C@@H]1O)O[Si](C)(C)C | 2796.1 | Semi standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,3TMS,isomer #6 | CCCCC[C@H](O)/C=C/[C@H]1C(CC2OC2CCCC(=O)O[Si](C)(C)C)=C(O[Si](C)(C)C)C[C@@H]1O[Si](C)(C)C | 2847.4 | Semi standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,3TMS,isomer #7 | CCCCC[C@H](O)/C=C/[C@H]1[C@H](CC2OC2CCCC(=O)O[Si](C)(C)C)C(O[Si](C)(C)C)=C[C@@H]1O[Si](C)(C)C | 2790.1 | Semi standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,4TMS,isomer #1 | CCCCC[C@@H](/C=C/[C@H]1C(CC2OC2CCCC(=O)O[Si](C)(C)C)=C(O[Si](C)(C)C)C[C@@H]1O[Si](C)(C)C)O[Si](C)(C)C | 2848.0 | Semi standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,4TMS,isomer #1 | CCCCC[C@@H](/C=C/[C@H]1C(CC2OC2CCCC(=O)O[Si](C)(C)C)=C(O[Si](C)(C)C)C[C@@H]1O[Si](C)(C)C)O[Si](C)(C)C | 3009.8 | Standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,4TMS,isomer #1 | CCCCC[C@@H](/C=C/[C@H]1C(CC2OC2CCCC(=O)O[Si](C)(C)C)=C(O[Si](C)(C)C)C[C@@H]1O[Si](C)(C)C)O[Si](C)(C)C | 3052.6 | Standard polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,4TMS,isomer #2 | CCCCC[C@@H](/C=C/[C@H]1[C@H](CC2OC2CCCC(=O)O[Si](C)(C)C)C(O[Si](C)(C)C)=C[C@@H]1O[Si](C)(C)C)O[Si](C)(C)C | 2802.5 | Semi standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,4TMS,isomer #2 | CCCCC[C@@H](/C=C/[C@H]1[C@H](CC2OC2CCCC(=O)O[Si](C)(C)C)C(O[Si](C)(C)C)=C[C@@H]1O[Si](C)(C)C)O[Si](C)(C)C | 2876.4 | Standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,4TMS,isomer #2 | CCCCC[C@@H](/C=C/[C@H]1[C@H](CC2OC2CCCC(=O)O[Si](C)(C)C)C(O[Si](C)(C)C)=C[C@@H]1O[Si](C)(C)C)O[Si](C)(C)C | 3135.7 | Standard polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,1TBDMS,isomer #1 | CCCCC[C@@H](/C=C/[C@@H]1[C@@H](O)CC(=O)[C@H]1CC1OC1CCCC(=O)O)O[Si](C)(C)C(C)(C)C | 3100.5 | Semi standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,1TBDMS,isomer #2 | CCCCC[C@H](O)/C=C/[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(=O)[C@H]1CC1OC1CCCC(=O)O | 3029.5 | Semi standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,1TBDMS,isomer #3 | CCCCC[C@H](O)/C=C/[C@@H]1[C@@H](O)CC(=O)[C@H]1CC1OC1CCCC(=O)O[Si](C)(C)C(C)(C)C | 3069.0 | Semi standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,1TBDMS,isomer #4 | CCCCC[C@H](O)/C=C/[C@H]1C(CC2OC2CCCC(=O)O)=C(O[Si](C)(C)C(C)(C)C)C[C@@H]1O | 3116.9 | Semi standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,1TBDMS,isomer #5 | CCCCC[C@H](O)/C=C/[C@H]1[C@H](CC2OC2CCCC(=O)O)C(O[Si](C)(C)C(C)(C)C)=C[C@@H]1O | 3011.4 | Semi standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,2TBDMS,isomer #1 | CCCCC[C@@H](/C=C/[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(=O)[C@H]1CC1OC1CCCC(=O)O)O[Si](C)(C)C(C)(C)C | 3309.4 | Semi standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,2TBDMS,isomer #2 | CCCCC[C@@H](/C=C/[C@@H]1[C@@H](O)CC(=O)[C@H]1CC1OC1CCCC(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3340.9 | Semi standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,2TBDMS,isomer #3 | CCCCC[C@@H](/C=C/[C@H]1C(CC2OC2CCCC(=O)O)=C(O[Si](C)(C)C(C)(C)C)C[C@@H]1O)O[Si](C)(C)C(C)(C)C | 3384.5 | Semi standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,2TBDMS,isomer #4 | CCCCC[C@@H](/C=C/[C@H]1[C@H](CC2OC2CCCC(=O)O)C(O[Si](C)(C)C(C)(C)C)=C[C@@H]1O)O[Si](C)(C)C(C)(C)C | 3278.1 | Semi standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,2TBDMS,isomer #5 | CCCCC[C@H](O)/C=C/[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(=O)[C@H]1CC1OC1CCCC(=O)O[Si](C)(C)C(C)(C)C | 3266.8 | Semi standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,2TBDMS,isomer #6 | CCCCC[C@H](O)/C=C/[C@H]1C(CC2OC2CCCC(=O)O)=C(O[Si](C)(C)C(C)(C)C)C[C@@H]1O[Si](C)(C)C(C)(C)C | 3320.8 | Semi standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,2TBDMS,isomer #7 | CCCCC[C@H](O)/C=C/[C@H]1[C@H](CC2OC2CCCC(=O)O)C(O[Si](C)(C)C(C)(C)C)=C[C@@H]1O[Si](C)(C)C(C)(C)C | 3260.6 | Semi standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,2TBDMS,isomer #8 | CCCCC[C@H](O)/C=C/[C@H]1C(CC2OC2CCCC(=O)O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C[C@@H]1O | 3338.8 | Semi standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,2TBDMS,isomer #9 | CCCCC[C@H](O)/C=C/[C@H]1[C@H](CC2OC2CCCC(=O)O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C[C@@H]1O | 3261.9 | Semi standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,3TBDMS,isomer #1 | CCCCC[C@@H](/C=C/[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(=O)[C@H]1CC1OC1CCCC(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3535.7 | Semi standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,3TBDMS,isomer #2 | CCCCC[C@@H](/C=C/[C@H]1C(CC2OC2CCCC(=O)O)=C(O[Si](C)(C)C(C)(C)C)C[C@@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3569.6 | Semi standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,3TBDMS,isomer #3 | CCCCC[C@@H](/C=C/[C@H]1[C@H](CC2OC2CCCC(=O)O)C(O[Si](C)(C)C(C)(C)C)=C[C@@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3528.0 | Semi standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,3TBDMS,isomer #4 | CCCCC[C@@H](/C=C/[C@H]1C(CC2OC2CCCC(=O)O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C[C@@H]1O)O[Si](C)(C)C(C)(C)C | 3610.6 | Semi standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,3TBDMS,isomer #5 | CCCCC[C@@H](/C=C/[C@H]1[C@H](CC2OC2CCCC(=O)O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C[C@@H]1O)O[Si](C)(C)C(C)(C)C | 3533.2 | Semi standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,3TBDMS,isomer #6 | CCCCC[C@H](O)/C=C/[C@H]1C(CC2OC2CCCC(=O)O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C[C@@H]1O[Si](C)(C)C(C)(C)C | 3530.6 | Semi standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,3TBDMS,isomer #7 | CCCCC[C@H](O)/C=C/[C@H]1[C@H](CC2OC2CCCC(=O)O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C[C@@H]1O[Si](C)(C)C(C)(C)C | 3500.0 | Semi standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,4TBDMS,isomer #1 | CCCCC[C@@H](/C=C/[C@H]1C(CC2OC2CCCC(=O)O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C[C@@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3750.4 | Semi standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,4TBDMS,isomer #1 | CCCCC[C@@H](/C=C/[C@H]1C(CC2OC2CCCC(=O)O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C[C@@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3623.9 | Standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,4TBDMS,isomer #1 | CCCCC[C@@H](/C=C/[C@H]1C(CC2OC2CCCC(=O)O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C[C@@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3358.3 | Standard polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,4TBDMS,isomer #2 | CCCCC[C@@H](/C=C/[C@H]1[C@H](CC2OC2CCCC(=O)O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C[C@@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3724.8 | Semi standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,4TBDMS,isomer #2 | CCCCC[C@@H](/C=C/[C@H]1[C@H](CC2OC2CCCC(=O)O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C[C@@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3387.6 | Standard non polar | 33892256 | 5(6)-Epoxy Prostaglandin E1,4TBDMS,isomer #2 | CCCCC[C@@H](/C=C/[C@H]1[C@H](CC2OC2CCCC(=O)O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C[C@@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3390.5 | Standard polar | 33892256 |
|
---|