Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2009-07-25 00:12:30 UTC

Update Date

2021-09-14 15:47:04 UTC

HMDB ID

HMDB0013060

Secondary Accession Numbers

HMDB13060

Metabolite Identification

Common Name

S-(9-hydroxy-PGA2)-glutathione

Description

S-(9-hydroxy-PGA2)-glutathione is the glutathione conjugate of S-(9-hydroxy-PGA2). Inside L1210 cells, PGA2 was initially conjugated to glutathione and then reduced at the 9-keto position to form 9-OH-PGA2-GSH. The 9-OH-PGA2-GSH was then secreted from the cells and apparently degraded to form the CysGly and Cys derivatives. Intracellular glutathione was decreased markedly by the addition of the PGA2 in L1210 and L929 cells. This result confirms that conjugation of PGA2 to glutathione occurs in both cell types. Formation of the 9-OH-PGA2-GSH and other glutathione-related conjugates was prevented when glutathione was depleted by growth in buthionine sulfoximine. The glutathione-depleted cells were insensitive to the cytotoxicity of the PGA2, suggesting that one of the glutathione-related conjugates may be involved in the cytotoxicity of PGA2. These results end the controversy over the metabolism of PGA2 and suggest mechanisms for its antiviral and antigrowth actions.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI


  Mrv1652303102016492D          

 44 44  0  0  1  0            999 V2000
   14.6633   -5.4889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8563   -5.6604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3043   -5.0473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4973   -5.2188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9453   -4.6057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1383   -4.7773    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   10.5863   -4.1641    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8834   -5.5619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0764   -5.7335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8215   -6.5181    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   10.3064   -7.1855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8215   -7.8529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0369   -7.5980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3694   -8.0829    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0369   -6.7730    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
    8.3694   -6.2881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4556   -5.4676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7882   -4.9826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0345   -5.3182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3671   -4.8333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6134   -5.1689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9460   -4.6839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0322   -3.8634    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1923   -5.0195    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.1314   -7.1855    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   11.5439   -7.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3689   -7.9000    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   12.7814   -8.6144    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.3689   -9.3289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5439   -9.3289    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.7814  -10.0434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3689  -10.7578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7814  -11.4723    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   13.6064  -11.4723    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.3689  -12.1868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5439  -12.1868    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.7814  -12.9013    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.7814   -7.1855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3689   -6.4710    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.6064   -7.1855    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.0189   -7.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8439   -7.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2564   -8.6144    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.2564   -7.1855    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  2  3  1  0  0  0  0
  3  4  1  0  0  0  0
  4  5  1  0  0  0  0
  5  6  1  0  0  0  0
  6  7  1  1  0  0  0
  6  8  1  0  0  0  0
  8  9  2  0  0  0  0
 10  9  1  6  0  0  0
 10 11  1  0  0  0  0
 10 15  1  0  0  0  0
 11 12  1  0  0  0  0
 11 25  1  0  0  0  0
 12 13  1  0  0  0  0
 13 14  1  0  0  0  0
 13 15  1  0  0  0  0
 15 16  1  6  0  0  0
 16 17  1  0  0  0  0
 17 18  2  0  0  0  0
 18 19  1  0  0  0  0
 19 20  1  0  0  0  0
 20 21  1  0  0  0  0
 21 22  1  0  0  0  0
 22 23  1  0  0  0  0
 22 24  2  0  0  0  0
 25 26  1  0  0  0  0
 26 27  1  0  0  0  0
 27 28  1  0  0  0  0
 27 38  1  6  0  0  0
 28 29  1  0  0  0  0
 29 30  2  0  0  0  0
 29 31  1  0  0  0  0
 31 32  1  0  0  0  0
 32 33  1  0  0  0  0
 33 34  1  1  0  0  0
 33 35  1  0  0  0  0
 35 36  1  0  0  0  0
 35 37  2  0  0  0  0
 38 39  2  0  0  0  0
 38 40  1  0  0  0  0
 40 41  1  0  0  0  0
 41 42  1  0  0  0  0
 42 43  1  0  0  0  0
 42 44  2  0  0  0  0
M  END

HMDB0013060
     RDKit          3D
S-(9-hydroxy-PGA2)-glutathione
 93 93  0  0  0  0  0  0  0  0999 V2000
   -4.4227    6.0477   -0.0164 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2276    4.8431   -0.4208 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3057    3.6083   -0.4400 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7186    3.3825    0.9192 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8450    2.1827    0.9948 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6669    2.2322    0.0889 C   0  0  2  0  0  0  0  0  0  0  0  0
   -1.9743    2.3196   -1.2531 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7738    1.0478    0.3613 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9468   -0.1017   -0.2639 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0455   -1.2664    0.0207 C   0  0  2  0  0  0  0  0  0  0  0  0
    0.5816   -1.7181   -1.3172 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0950   -2.5945   -0.9703 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.3675   -1.6343   -0.1879 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8963   -0.4715   -0.9801 C   0  0  1  0  0  0  0  0  0  0  0  0
    4.9263    0.1371   -0.1152 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7225    1.3743    0.5240 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6692    1.9952    0.3853 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8202    1.9160    1.3797 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3361    3.1619    2.0364 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3747    3.7983    2.9027 C   0  0  1  0  0  0  0  0  0  0  0  0
    5.7507    4.9960    3.4751 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8224    2.9225    3.9946 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4814    1.8849    3.7717 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5116    3.2465    5.3011 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5348   -0.9067   -2.2172 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7857   -0.7424   -2.3854 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8416   -1.5239   -3.2939 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5043   -1.9403   -4.5094 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1413   -0.8055   -5.2127 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0806    0.3638   -4.7578 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8263   -1.0007   -6.3998 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5045   -2.6692   -1.8244 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8174   -3.4444   -0.5715 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1105   -4.4762   -0.3877 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7735   -2.4477    0.5333 C   0  0  2  0  0  0  0  0  0  0  0  0
   -2.1849   -2.0784    1.0436 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7793   -3.3194    1.5158 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8804   -3.8177    1.0303 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6367   -3.1851   -0.0409 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0369   -2.8509    0.4522 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8316   -4.0153    0.9111 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1221   -5.0509   -0.0872 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7765   -4.9183   -1.2711 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7926   -6.1923    0.3029 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3273    5.8858   -0.2044 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7399    6.9479   -0.6200 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5453    6.2034    1.0653 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1209    4.6648    0.1929 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5696    4.9790   -1.4699 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5407    3.8667   -1.2163 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9423    2.7537   -0.7279 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0644    4.2639    1.2086 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5449    3.3435    1.6884 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4210    1.2258    0.8635 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4646    2.1123    2.0497 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0584    3.1542    0.3365 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3658    1.8087   -1.8436 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0264    1.1563    1.0906 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7493   -0.1813   -0.9827 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.7114   -0.9383    0.7349 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.6902   -0.8770   -2.0007 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1256   -1.3005    0.8398 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.2569   -2.3193   -0.0452 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1166    0.3164   -1.0964 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.8384   -0.3843    0.0173 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.1679    1.1356    2.0924 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.6853    2.1359    0.7197 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.0408    3.8919    1.2497 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.4302    2.9368    2.6399 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.2120    4.1806    2.2644 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7702    4.7738    3.7751 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.2759    5.1983    4.3486 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.2175    3.6203    5.9519 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.8181   -1.6734   -3.1937 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7517   -2.4165   -5.1648 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2816   -2.7231   -4.2960 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.1276   -1.9173   -6.7099 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4165   -2.1281   -2.1041 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1155   -3.3493   -2.5849 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8512   -3.8570   -0.6871 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0678   -5.0948   -1.1582 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1925   -2.8919    1.3856 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6434   -1.5492    0.2269 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9706   -1.3777    1.9139 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2554   -3.8662    2.3389 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3094   -4.7715    1.4143 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7807   -3.9900   -0.8304 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1906   -2.3508   -0.5712 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9362   -2.1561    1.3297 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6094   -2.3151   -0.3338 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8439   -3.5980    1.2168 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4095   -4.4573    1.8561 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.7502   -6.3603    0.0086 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  6  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 16 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  1  0
 22 23  2  0
 22 24  1  0
 14 25  1  0
 25 26  2  0
 25 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  2  0
 29 31  1  0
 11 32  1  0
 32 33  1  0
 33 34  1  0
 33 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  2  0
 38 39  1  0
 39 40  1  0
 40 41  1  0
 41 42  1  0
 42 43  2  0
 42 44  1  0
 35 10  1  0
  1 45  1  0
  1 46  1  0
  1 47  1  0
  2 48  1  0
  2 49  1  0
  3 50  1  0
  3 51  1  0
  4 52  1  0
  4 53  1  0
  5 54  1  0
  5 55  1  0
  6 56  1  1
  7 57  1  0
  8 58  1  0
  9 59  1  0
 10 60  1  1
 11 61  1  0
 13 62  1  0
 13 63  1  0
 14 64  1  6
 15 65  1  0
 18 66  1  0
 18 67  1  0
 19 68  1  0
 19 69  1  0
 20 70  1  6
 21 71  1  0
 21 72  1  0
 24 73  1  0
 27 74  1  0
 28 75  1  0
 28 76  1  0
 31 77  1  0
 32 78  1  0
 32 79  1  0
 33 80  1  0
 34 81  1  0
 35 82  1  1
 36 83  1  0
 36 84  1  0
 37 85  1  0
 38 86  1  0
 39 87  1  0
 39 88  1  0
 40 89  1  0
 40 90  1  0
 41 91  1  0
 41 92  1  0
 44 93  1  0
M  END


  Mrv1652303102016492D          

 44 44  0  0  1  0            999 V2000
   14.6633   -5.4889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8563   -5.6604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3043   -5.0473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4973   -5.2188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9453   -4.6057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1383   -4.7773    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   10.5863   -4.1641    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8834   -5.5619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0764   -5.7335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8215   -6.5181    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   10.3064   -7.1855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8215   -7.8529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0369   -7.5980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3694   -8.0829    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0369   -6.7730    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
    8.3694   -6.2881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4556   -5.4676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7882   -4.9826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0345   -5.3182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3671   -4.8333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6134   -5.1689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9460   -4.6839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0322   -3.8634    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1923   -5.0195    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.1314   -7.1855    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   11.5439   -7.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3689   -7.9000    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   12.7814   -8.6144    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.3689   -9.3289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5439   -9.3289    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.7814  -10.0434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3689  -10.7578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7814  -11.4723    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   13.6064  -11.4723    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.3689  -12.1868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5439  -12.1868    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.7814  -12.9013    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.7814   -7.1855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3689   -6.4710    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.6064   -7.1855    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.0189   -7.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8439   -7.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2564   -8.6144    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.2564   -7.1855    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  2  3  1  0  0  0  0
  3  4  1  0  0  0  0
  4  5  1  0  0  0  0
  5  6  1  0  0  0  0
  6  7  1  1  0  0  0
  6  8  1  0  0  0  0
  8  9  2  0  0  0  0
 10  9  1  6  0  0  0
 10 11  1  0  0  0  0
 10 15  1  0  0  0  0
 11 12  1  0  0  0  0
 11 25  1  0  0  0  0
 12 13  1  0  0  0  0
 13 14  1  0  0  0  0
 13 15  1  0  0  0  0
 15 16  1  6  0  0  0
 16 17  1  0  0  0  0
 17 18  2  0  0  0  0
 18 19  1  0  0  0  0
 19 20  1  0  0  0  0
 20 21  1  0  0  0  0
 21 22  1  0  0  0  0
 22 23  1  0  0  0  0
 22 24  2  0  0  0  0
 25 26  1  0  0  0  0
 26 27  1  0  0  0  0
 27 28  1  0  0  0  0
 27 38  1  6  0  0  0
 28 29  1  0  0  0  0
 29 30  2  0  0  0  0
 29 31  1  0  0  0  0
 31 32  1  0  0  0  0
 32 33  1  0  0  0  0
 33 34  1  1  0  0  0
 33 35  1  0  0  0  0
 35 36  1  0  0  0  0
 35 37  2  0  0  0  0
 38 39  2  0  0  0  0
 38 40  1  0  0  0  0
 40 41  1  0  0  0  0
 41 42  1  0  0  0  0
 42 43  1  0  0  0  0
 42 44  2  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0013060

> <DATABASE_NAME>
hmdb

> <SMILES>
CCCCC[C@H](O)\C=C\[C@@H]1C(CC(O)[C@@H]1C\C=C/CCCC(O)=O)SC[C@@H](NC(=O)CC[C@@H](N)C(O)=O)C(=O)NCC(O)=O

> <INCHI_IDENTIFIER>
InChI=1S/C30H49N3O10S/c1-2-3-6-9-19(34)12-13-21-20(10-7-4-5-8-11-27(37)38)24(35)16-25(21)44-18-23(29(41)32-17-28(39)40)33-26(36)15-14-22(31)30(42)43/h4,7,12-13,19-25,34-35H,2-3,5-6,8-11,14-18,31H2,1H3,(H,32,41)(H,33,36)(H,37,38)(H,39,40)(H,42,43)/b7-4-,13-12+/t19-,20+,21-,22+,23+,24?,25?/m0/s1

> <INCHI_KEY>
KUKCWBNBPICNAJ-BTGAYFLPSA-N

> <FORMULA>
C30H49N3O10S

> <MOLECULAR_WEIGHT>
643.789

> <EXACT_MASS>
643.313865493

> <JCHEM_ACCEPTOR_COUNT>
11

> <JCHEM_ATOM_COUNT>
93

> <JCHEM_AVERAGE_POLARIZABILITY>
69.43220542607368

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
8

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
(5Z)-7-[(1R,2S)-3-{[(2S)-2-[(4R)-4-amino-4-carboxybutanamido]-2-[(carboxymethyl)carbamoyl]ethyl]sulfanyl}-5-hydroxy-2-[(1E,3S)-3-hydroxyoct-1-en-1-yl]cyclopentyl]hept-5-enoic acid

> <ALOGPS_LOGP>
-1.57

> <JCHEM_LOGP>
-1.5975217947897562

> <ALOGPS_LOGS>
-4.62

> <JCHEM_MDDR_LIKE_RULE>
0

> <JCHEM_NUMBER_OF_RINGS>
1

> <JCHEM_PHYSIOLOGICAL_CHARGE>
-2

> <JCHEM_PKA>
3.590724318566351

> <JCHEM_PKA_STRONGEST_ACIDIC>
1.8064640868160087

> <JCHEM_PKA_STRONGEST_BASIC>
9.311616371074425

> <JCHEM_POLAR_SURFACE_AREA>
236.57999999999996

> <JCHEM_REFRACTIVITY>
166.0737000000001

> <JCHEM_ROTATABLE_BOND_COUNT>
23

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
1.55e-02 g/l

> <JCHEM_TRADITIONAL_IUPAC>
(5Z)-7-[(1R,2S)-3-{[(2S)-2-[(4R)-4-amino-4-carboxybutanamido]-2-(carboxymethylcarbamoyl)ethyl]sulfanyl}-5-hydroxy-2-[(1E,3S)-3-hydroxyoct-1-en-1-yl]cyclopentyl]hept-5-enoic acid

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0013060
     RDKit          3D
S-(9-hydroxy-PGA2)-glutathione
 93 93  0  0  0  0  0  0  0  0999 V2000
   -4.4227    6.0477   -0.0164 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2276    4.8431   -0.4208 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3057    3.6083   -0.4400 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7186    3.3825    0.9192 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8450    2.1827    0.9948 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6669    2.2322    0.0889 C   0  0  2  0  0  0  0  0  0  0  0  0
   -1.9743    2.3196   -1.2531 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7738    1.0478    0.3613 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9468   -0.1017   -0.2639 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0455   -1.2664    0.0207 C   0  0  2  0  0  0  0  0  0  0  0  0
    0.5816   -1.7181   -1.3172 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0950   -2.5945   -0.9703 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.3675   -1.6343   -0.1879 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8963   -0.4715   -0.9801 C   0  0  1  0  0  0  0  0  0  0  0  0
    4.9263    0.1371   -0.1152 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7225    1.3743    0.5240 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6692    1.9952    0.3853 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8202    1.9160    1.3797 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3361    3.1619    2.0364 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3747    3.7983    2.9027 C   0  0  1  0  0  0  0  0  0  0  0  0
    5.7507    4.9960    3.4751 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8224    2.9225    3.9946 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4814    1.8849    3.7717 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5116    3.2465    5.3011 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5348   -0.9067   -2.2172 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7857   -0.7424   -2.3854 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8416   -1.5239   -3.2939 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5043   -1.9403   -4.5094 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1413   -0.8055   -5.2127 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0806    0.3638   -4.7578 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8263   -1.0007   -6.3998 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5045   -2.6692   -1.8244 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8174   -3.4444   -0.5715 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1105   -4.4762   -0.3877 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7735   -2.4477    0.5333 C   0  0  2  0  0  0  0  0  0  0  0  0
   -2.1849   -2.0784    1.0436 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7793   -3.3194    1.5158 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8804   -3.8177    1.0303 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6367   -3.1851   -0.0409 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0369   -2.8509    0.4522 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8316   -4.0153    0.9111 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1221   -5.0509   -0.0872 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7765   -4.9183   -1.2711 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7926   -6.1923    0.3029 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3273    5.8858   -0.2044 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7399    6.9479   -0.6200 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5453    6.2034    1.0653 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1209    4.6648    0.1929 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5696    4.9790   -1.4699 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5407    3.8667   -1.2163 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9423    2.7537   -0.7279 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0644    4.2639    1.2086 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5449    3.3435    1.6884 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4210    1.2258    0.8635 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4646    2.1123    2.0497 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0584    3.1542    0.3365 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3658    1.8087   -1.8436 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0264    1.1563    1.0906 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7493   -0.1813   -0.9827 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.7114   -0.9383    0.7349 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.6902   -0.8770   -2.0007 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1256   -1.3005    0.8398 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.2569   -2.3193   -0.0452 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1166    0.3164   -1.0964 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.8384   -0.3843    0.0173 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.1679    1.1356    2.0924 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.6853    2.1359    0.7197 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.0408    3.8919    1.2497 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.4302    2.9368    2.6399 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.2120    4.1806    2.2644 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7702    4.7738    3.7751 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.2759    5.1983    4.3486 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.2175    3.6203    5.9519 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.8181   -1.6734   -3.1937 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7517   -2.4165   -5.1648 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2816   -2.7231   -4.2960 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.1276   -1.9173   -6.7099 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4165   -2.1281   -2.1041 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1155   -3.3493   -2.5849 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8512   -3.8570   -0.6871 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0678   -5.0948   -1.1582 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1925   -2.8919    1.3856 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6434   -1.5492    0.2269 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9706   -1.3777    1.9139 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2554   -3.8662    2.3389 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3094   -4.7715    1.4143 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7807   -3.9900   -0.8304 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1906   -2.3508   -0.5712 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9362   -2.1561    1.3297 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6094   -2.3151   -0.3338 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8439   -3.5980    1.2168 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4095   -4.4573    1.8561 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.7502   -6.3603    0.0086 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  6  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 16 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  1  0
 22 23  2  0
 22 24  1  0
 14 25  1  0
 25 26  2  0
 25 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  2  0
 29 31  1  0
 11 32  1  0
 32 33  1  0
 33 34  1  0
 33 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  2  0
 38 39  1  0
 39 40  1  0
 40 41  1  0
 41 42  1  0
 42 43  2  0
 42 44  1  0
 35 10  1  0
  1 45  1  0
  1 46  1  0
  1 47  1  0
  2 48  1  0
  2 49  1  0
  3 50  1  0
  3 51  1  0
  4 52  1  0
  4 53  1  0
  5 54  1  0
  5 55  1  0
  6 56  1  1
  7 57  1  0
  8 58  1  0
  9 59  1  0
 10 60  1  1
 11 61  1  0
 13 62  1  0
 13 63  1  0
 14 64  1  6
 15 65  1  0
 18 66  1  0
 18 67  1  0
 19 68  1  0
 19 69  1  0
 20 70  1  6
 21 71  1  0
 21 72  1  0
 24 73  1  0
 27 74  1  0
 28 75  1  0
 28 76  1  0
 31 77  1  0
 32 78  1  0
 32 79  1  0
 33 80  1  0
 34 81  1  0
 35 82  1  1
 36 83  1  0
 36 84  1  0
 37 85  1  0
 38 86  1  0
 39 87  1  0
 39 88  1  0
 40 89  1  0
 40 90  1  0
 41 91  1  0
 41 92  1  0
 44 93  1  0
M  END

HEADER    PROTEIN                                 10-MAR-20   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   10-MAR-20         0                                  
HETATM    1  C   UNK     0      27.371 -10.246   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0      25.865 -10.566   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0      24.835  -9.422   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0      23.328  -9.742   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0      22.298  -8.597   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0      20.791  -8.918   0.000  0.00  0.00           C+0
HETATM    7  O   UNK     0      19.761  -7.773   0.000  0.00  0.00           O+0
HETATM    8  C   UNK     0      20.316 -10.382   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0      18.809 -10.703   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0      18.333 -12.167   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0      19.239 -13.413   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0      18.333 -14.659   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0      16.869 -14.183   0.000  0.00  0.00           C+0
HETATM   14  O   UNK     0      15.623 -15.088   0.000  0.00  0.00           O+0
HETATM   15  C   UNK     0      16.869 -12.643   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0      15.623 -11.738   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0      15.784 -10.206   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0      14.538  -9.301   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0      13.131  -9.927   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0      11.885  -9.022   0.000  0.00  0.00           C+0
HETATM   21  C   UNK     0      10.478  -9.649   0.000  0.00  0.00           C+0
HETATM   22  C   UNK     0       9.233  -8.743   0.000  0.00  0.00           C+0
HETATM   23  O   UNK     0       9.393  -7.212   0.000  0.00  0.00           O+0
HETATM   24  O   UNK     0       7.826  -9.370   0.000  0.00  0.00           O+0
HETATM   25  S   UNK     0      20.779 -13.413   0.000  0.00  0.00           S+0
HETATM   26  C   UNK     0      21.549 -14.747   0.000  0.00  0.00           C+0
HETATM   27  C   UNK     0      23.089 -14.747   0.000  0.00  0.00           C+0
HETATM   28  N   UNK     0      23.859 -16.080   0.000  0.00  0.00           N+0
HETATM   29  C   UNK     0      23.089 -17.414   0.000  0.00  0.00           C+0
HETATM   30  O   UNK     0      21.549 -17.414   0.000  0.00  0.00           O+0
HETATM   31  C   UNK     0      23.859 -18.748   0.000  0.00  0.00           C+0
HETATM   32  C   UNK     0      23.089 -20.081   0.000  0.00  0.00           C+0
HETATM   33  C   UNK     0      23.859 -21.415   0.000  0.00  0.00           C+0
HETATM   34  N   UNK     0      25.399 -21.415   0.000  0.00  0.00           N+0
HETATM   35  C   UNK     0      23.089 -22.749   0.000  0.00  0.00           C+0
HETATM   36  O   UNK     0      21.549 -22.749   0.000  0.00  0.00           O+0
HETATM   37  O   UNK     0      23.859 -24.082   0.000  0.00  0.00           O+0
HETATM   38  C   UNK     0      23.859 -13.413   0.000  0.00  0.00           C+0
HETATM   39  O   UNK     0      23.089 -12.079   0.000  0.00  0.00           O+0
HETATM   40  N   UNK     0      25.399 -13.413   0.000  0.00  0.00           N+0
HETATM   41  C   UNK     0      26.169 -14.747   0.000  0.00  0.00           C+0
HETATM   42  C   UNK     0      27.709 -14.747   0.000  0.00  0.00           C+0
HETATM   43  O   UNK     0      28.479 -16.080   0.000  0.00  0.00           O+0
HETATM   44  O   UNK     0      28.479 -13.413   0.000  0.00  0.00           O+0
CONECT    1    2                                                            
CONECT    2    1    3                                                       
CONECT    3    2    4                                                       
CONECT    4    3    5                                                       
CONECT    5    4    6                                                       
CONECT    6    5    7    8                                                  
CONECT    7    6                                                            
CONECT    8    6    9                                                       
CONECT    9    8   10                                                       
CONECT   10    9   11   15                                                  
CONECT   11   10   12   25                                                  
CONECT   12   11   13                                                       
CONECT   13   12   14   15                                                  
CONECT   14   13                                                            
CONECT   15   10   13   16                                                  
CONECT   16   15   17                                                       
CONECT   17   16   18                                                       
CONECT   18   17   19                                                       
CONECT   19   18   20                                                       
CONECT   20   19   21                                                       
CONECT   21   20   22                                                       
CONECT   22   21   23   24                                                  
CONECT   23   22                                                            
CONECT   24   22                                                            
CONECT   25   11   26                                                       
CONECT   26   25   27                                                       
CONECT   27   26   28   38                                                  
CONECT   28   27   29                                                       
CONECT   29   28   30   31                                                  
CONECT   30   29                                                            
CONECT   31   29   32                                                       
CONECT   32   31   33                                                       
CONECT   33   32   34   35                                                  
CONECT   34   33                                                            
CONECT   35   33   36   37                                                  
CONECT   36   35                                                            
CONECT   37   35                                                            
CONECT   38   27   39   40                                                  
CONECT   39   38                                                            
CONECT   40   38   41                                                       
CONECT   41   40   42                                                       
CONECT   42   41   43   44                                                  
CONECT   43   42                                                            
CONECT   44   42                                                            
MASTER        0    0    0    0    0    0    0    0   44    0   88    0
END

COMPND    HMDB0013060
HETATM    1  C1  UNL     1      -4.423   6.048  -0.016  1.00  0.00           C  
HETATM    2  C2  UNL     1      -5.228   4.843  -0.421  1.00  0.00           C  
HETATM    3  C3  UNL     1      -4.306   3.608  -0.440  1.00  0.00           C  
HETATM    4  C4  UNL     1      -3.719   3.382   0.919  1.00  0.00           C  
HETATM    5  C5  UNL     1      -2.845   2.183   0.995  1.00  0.00           C  
HETATM    6  C6  UNL     1      -1.667   2.232   0.089  1.00  0.00           C  
HETATM    7  O1  UNL     1      -1.974   2.320  -1.253  1.00  0.00           O  
HETATM    8  C7  UNL     1      -0.774   1.048   0.361  1.00  0.00           C  
HETATM    9  C8  UNL     1      -0.947  -0.102  -0.264  1.00  0.00           C  
HETATM   10  C9  UNL     1      -0.045  -1.266   0.021  1.00  0.00           C  
HETATM   11  C10 UNL     1       0.582  -1.718  -1.317  1.00  0.00           C  
HETATM   12  S1  UNL     1       2.095  -2.594  -0.970  1.00  0.00           S  
HETATM   13  C11 UNL     1       3.367  -1.634  -0.188  1.00  0.00           C  
HETATM   14  C12 UNL     1       3.896  -0.471  -0.980  1.00  0.00           C  
HETATM   15  N1  UNL     1       4.926   0.137  -0.115  1.00  0.00           N  
HETATM   16  C13 UNL     1       4.722   1.374   0.524  1.00  0.00           C  
HETATM   17  O2  UNL     1       3.669   1.995   0.385  1.00  0.00           O  
HETATM   18  C14 UNL     1       5.820   1.916   1.380  1.00  0.00           C  
HETATM   19  C15 UNL     1       5.336   3.162   2.036  1.00  0.00           C  
HETATM   20  C16 UNL     1       6.375   3.798   2.903  1.00  0.00           C  
HETATM   21  N2  UNL     1       5.751   4.996   3.475  1.00  0.00           N  
HETATM   22  C17 UNL     1       6.822   2.923   3.995  1.00  0.00           C  
HETATM   23  O3  UNL     1       7.481   1.885   3.772  1.00  0.00           O  
HETATM   24  O4  UNL     1       6.512   3.246   5.301  1.00  0.00           O  
HETATM   25  C18 UNL     1       4.535  -0.907  -2.217  1.00  0.00           C  
HETATM   26  O5  UNL     1       5.786  -0.742  -2.385  1.00  0.00           O  
HETATM   27  N3  UNL     1       3.842  -1.524  -3.294  1.00  0.00           N  
HETATM   28  C19 UNL     1       4.504  -1.940  -4.509  1.00  0.00           C  
HETATM   29  C20 UNL     1       5.141  -0.806  -5.213  1.00  0.00           C  
HETATM   30  O6  UNL     1       5.081   0.364  -4.758  1.00  0.00           O  
HETATM   31  O7  UNL     1       5.826  -1.001  -6.400  1.00  0.00           O  
HETATM   32  C21 UNL     1      -0.505  -2.669  -1.824  1.00  0.00           C  
HETATM   33  C22 UNL     1      -0.817  -3.444  -0.571  1.00  0.00           C  
HETATM   34  O8  UNL     1       0.110  -4.476  -0.388  1.00  0.00           O  
HETATM   35  C23 UNL     1      -0.773  -2.448   0.533  1.00  0.00           C  
HETATM   36  C24 UNL     1      -2.185  -2.078   1.044  1.00  0.00           C  
HETATM   37  C25 UNL     1      -2.779  -3.319   1.516  1.00  0.00           C  
HETATM   38  C26 UNL     1      -3.880  -3.818   1.030  1.00  0.00           C  
HETATM   39  C27 UNL     1      -4.637  -3.185  -0.041  1.00  0.00           C  
HETATM   40  C28 UNL     1      -6.037  -2.851   0.452  1.00  0.00           C  
HETATM   41  C29 UNL     1      -6.832  -4.015   0.911  1.00  0.00           C  
HETATM   42  C30 UNL     1      -7.122  -5.051  -0.087  1.00  0.00           C  
HETATM   43  O9  UNL     1      -6.777  -4.918  -1.271  1.00  0.00           O  
HETATM   44  O10 UNL     1      -7.793  -6.192   0.303  1.00  0.00           O  
HETATM   45  H1  UNL     1      -3.327   5.886  -0.204  1.00  0.00           H  
HETATM   46  H2  UNL     1      -4.740   6.948  -0.620  1.00  0.00           H  
HETATM   47  H3  UNL     1      -4.545   6.203   1.065  1.00  0.00           H  
HETATM   48  H4  UNL     1      -6.121   4.665   0.193  1.00  0.00           H  
HETATM   49  H5  UNL     1      -5.570   4.979  -1.470  1.00  0.00           H  
HETATM   50  H6  UNL     1      -3.541   3.867  -1.216  1.00  0.00           H  
HETATM   51  H7  UNL     1      -4.942   2.754  -0.728  1.00  0.00           H  
HETATM   52  H8  UNL     1      -3.064   4.264   1.209  1.00  0.00           H  
HETATM   53  H9  UNL     1      -4.545   3.344   1.688  1.00  0.00           H  
HETATM   54  H10 UNL     1      -3.421   1.226   0.863  1.00  0.00           H  
HETATM   55  H11 UNL     1      -2.465   2.112   2.050  1.00  0.00           H  
HETATM   56  H12 UNL     1      -1.058   3.154   0.337  1.00  0.00           H  
HETATM   57  H13 UNL     1      -1.366   1.809  -1.844  1.00  0.00           H  
HETATM   58  H14 UNL     1       0.026   1.156   1.091  1.00  0.00           H  
HETATM   59  H15 UNL     1      -1.749  -0.181  -0.983  1.00  0.00           H  
HETATM   60  H16 UNL     1       0.711  -0.938   0.735  1.00  0.00           H  
HETATM   61  H17 UNL     1       0.690  -0.877  -2.001  1.00  0.00           H  
HETATM   62  H18 UNL     1       3.126  -1.301   0.840  1.00  0.00           H  
HETATM   63  H19 UNL     1       4.257  -2.319  -0.045  1.00  0.00           H  
HETATM   64  H20 UNL     1       3.117   0.316  -1.096  1.00  0.00           H  
HETATM   65  H21 UNL     1       5.838  -0.384   0.017  1.00  0.00           H  
HETATM   66  H22 UNL     1       6.168   1.136   2.092  1.00  0.00           H  
HETATM   67  H23 UNL     1       6.685   2.136   0.720  1.00  0.00           H  
HETATM   68  H24 UNL     1       5.041   3.892   1.250  1.00  0.00           H  
HETATM   69  H25 UNL     1       4.430   2.937   2.640  1.00  0.00           H  
HETATM   70  H26 UNL     1       7.212   4.181   2.264  1.00  0.00           H  
HETATM   71  H27 UNL     1       4.770   4.774   3.775  1.00  0.00           H  
HETATM   72  H28 UNL     1       6.276   5.198   4.349  1.00  0.00           H  
HETATM   73  H29 UNL     1       7.218   3.620   5.952  1.00  0.00           H  
HETATM   74  H30 UNL     1       2.818  -1.673  -3.194  1.00  0.00           H  
HETATM   75  H31 UNL     1       3.752  -2.417  -5.165  1.00  0.00           H  
HETATM   76  H32 UNL     1       5.282  -2.723  -4.296  1.00  0.00           H  
HETATM   77  H33 UNL     1       6.128  -1.917  -6.710  1.00  0.00           H  
HETATM   78  H34 UNL     1      -1.416  -2.128  -2.104  1.00  0.00           H  
HETATM   79  H35 UNL     1      -0.115  -3.349  -2.585  1.00  0.00           H  
HETATM   80  H36 UNL     1      -1.851  -3.857  -0.687  1.00  0.00           H  
HETATM   81  H37 UNL     1       0.068  -5.095  -1.158  1.00  0.00           H  
HETATM   82  H38 UNL     1      -0.193  -2.892   1.386  1.00  0.00           H  
HETATM   83  H39 UNL     1      -2.643  -1.549   0.227  1.00  0.00           H  
HETATM   84  H40 UNL     1      -1.971  -1.378   1.914  1.00  0.00           H  
HETATM   85  H41 UNL     1      -2.255  -3.866   2.339  1.00  0.00           H  
HETATM   86  H42 UNL     1      -4.309  -4.771   1.414  1.00  0.00           H  
HETATM   87  H43 UNL     1      -4.781  -3.990  -0.830  1.00  0.00           H  
HETATM   88  H44 UNL     1      -4.191  -2.351  -0.571  1.00  0.00           H  
HETATM   89  H45 UNL     1      -5.936  -2.156   1.330  1.00  0.00           H  
HETATM   90  H46 UNL     1      -6.609  -2.315  -0.334  1.00  0.00           H  
HETATM   91  H47 UNL     1      -7.844  -3.598   1.217  1.00  0.00           H  
HETATM   92  H48 UNL     1      -6.409  -4.457   1.856  1.00  0.00           H  
HETATM   93  H49 UNL     1      -8.750  -6.360   0.009  1.00  0.00           H  
CONECT    1    2   45   46   47
CONECT    2    3   48   49
CONECT    3    4   50   51
CONECT    4    5   52   53
CONECT    5    6   54   55
CONECT    6    7    8   56
CONECT    7   57
CONECT    8    9    9   58
CONECT    9   10   59
CONECT   10   11   35   60
CONECT   11   12   32   61
CONECT   12   13
CONECT   13   14   62   63
CONECT   14   15   25   64
CONECT   15   16   65
CONECT   16   17   17   18
CONECT   18   19   66   67
CONECT   19   20   68   69
CONECT   20   21   22   70
CONECT   21   71   72
CONECT   22   23   23   24
CONECT   24   73
CONECT   25   26   26   27
CONECT   27   28   74
CONECT   28   29   75   76
CONECT   29   30   30   31
CONECT   31   77
CONECT   32   33   78   79
CONECT   33   34   35   80
CONECT   34   81
CONECT   35   36   82
CONECT   36   37   83   84
CONECT   37   38   38   85
CONECT   38   39   86
CONECT   39   40   87   88
CONECT   40   41   89   90
CONECT   41   42   91   92
CONECT   42   43   43   44
CONECT   44   93
END

HMDB0013060
     RDKit          3D
S-(9-hydroxy-PGA2)-glutathione
 93 93  0  0  0  0  0  0  0  0999 V2000
   -4.4227    6.0477   -0.0164 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2276    4.8431   -0.4208 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3057    3.6083   -0.4400 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7186    3.3825    0.9192 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8450    2.1827    0.9948 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6669    2.2322    0.0889 C   0  0  2  0  0  0  0  0  0  0  0  0
   -1.9743    2.3196   -1.2531 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7738    1.0478    0.3613 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9468   -0.1017   -0.2639 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0455   -1.2664    0.0207 C   0  0  2  0  0  0  0  0  0  0  0  0
    0.5816   -1.7181   -1.3172 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0950   -2.5945   -0.9703 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.3675   -1.6343   -0.1879 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8963   -0.4715   -0.9801 C   0  0  1  0  0  0  0  0  0  0  0  0
    4.9263    0.1371   -0.1152 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7225    1.3743    0.5240 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6692    1.9952    0.3853 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8202    1.9160    1.3797 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3361    3.1619    2.0364 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3747    3.7983    2.9027 C   0  0  1  0  0  0  0  0  0  0  0  0
    5.7507    4.9960    3.4751 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8224    2.9225    3.9946 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4814    1.8849    3.7717 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5116    3.2465    5.3011 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5348   -0.9067   -2.2172 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7857   -0.7424   -2.3854 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8416   -1.5239   -3.2939 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5043   -1.9403   -4.5094 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1413   -0.8055   -5.2127 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0806    0.3638   -4.7578 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8263   -1.0007   -6.3998 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5045   -2.6692   -1.8244 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8174   -3.4444   -0.5715 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1105   -4.4762   -0.3877 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7735   -2.4477    0.5333 C   0  0  2  0  0  0  0  0  0  0  0  0
   -2.1849   -2.0784    1.0436 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7793   -3.3194    1.5158 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8804   -3.8177    1.0303 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6367   -3.1851   -0.0409 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0369   -2.8509    0.4522 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8316   -4.0153    0.9111 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1221   -5.0509   -0.0872 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7765   -4.9183   -1.2711 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7926   -6.1923    0.3029 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3273    5.8858   -0.2044 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7399    6.9479   -0.6200 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5453    6.2034    1.0653 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1209    4.6648    0.1929 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5696    4.9790   -1.4699 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5407    3.8667   -1.2163 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9423    2.7537   -0.7279 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0644    4.2639    1.2086 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5449    3.3435    1.6884 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4210    1.2258    0.8635 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4646    2.1123    2.0497 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0584    3.1542    0.3365 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3658    1.8087   -1.8436 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0264    1.1563    1.0906 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7493   -0.1813   -0.9827 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.7114   -0.9383    0.7349 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.6902   -0.8770   -2.0007 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1256   -1.3005    0.8398 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.2569   -2.3193   -0.0452 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1166    0.3164   -1.0964 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.8384   -0.3843    0.0173 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.1679    1.1356    2.0924 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.6853    2.1359    0.7197 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.0408    3.8919    1.2497 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.4302    2.9368    2.6399 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.2120    4.1806    2.2644 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7702    4.7738    3.7751 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.2759    5.1983    4.3486 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.2175    3.6203    5.9519 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.8181   -1.6734   -3.1937 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7517   -2.4165   -5.1648 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2816   -2.7231   -4.2960 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.1276   -1.9173   -6.7099 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4165   -2.1281   -2.1041 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1155   -3.3493   -2.5849 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8512   -3.8570   -0.6871 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0678   -5.0948   -1.1582 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1925   -2.8919    1.3856 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6434   -1.5492    0.2269 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9706   -1.3777    1.9139 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2554   -3.8662    2.3389 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3094   -4.7715    1.4143 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7807   -3.9900   -0.8304 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1906   -2.3508   -0.5712 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9362   -2.1561    1.3297 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6094   -2.3151   -0.3338 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8439   -3.5980    1.2168 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4095   -4.4573    1.8561 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.7502   -6.3603    0.0086 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  6  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 16 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  1  0
 22 23  2  0
 22 24  1  0
 14 25  1  0
 25 26  2  0
 25 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  2  0
 29 31  1  0
 11 32  1  0
 32 33  1  0
 33 34  1  0
 33 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  2  0
 38 39  1  0
 39 40  1  0
 40 41  1  0
 41 42  1  0
 42 43  2  0
 42 44  1  0
 35 10  1  0
  1 45  1  0
  1 46  1  0
  1 47  1  0
  2 48  1  0
  2 49  1  0
  3 50  1  0
  3 51  1  0
  4 52  1  0
  4 53  1  0
  5 54  1  0
  5 55  1  0
  6 56  1  1
  7 57  1  0
  8 58  1  0
  9 59  1  0
 10 60  1  1
 11 61  1  0
 13 62  1  0
 13 63  1  0
 14 64  1  6
 15 65  1  0
 18 66  1  0
 18 67  1  0
 19 68  1  0
 19 69  1  0
 20 70  1  6
 21 71  1  0
 21 72  1  0
 24 73  1  0
 27 74  1  0
 28 75  1  0
 28 76  1  0
 31 77  1  0
 32 78  1  0
 32 79  1  0
 33 80  1  0
 34 81  1  0
 35 82  1  1
 36 83  1  0
 36 84  1  0
 37 85  1  0
 38 86  1  0
 39 87  1  0
 39 88  1  0
 40 89  1  0
 40 90  1  0
 41 91  1  0
 41 92  1  0
 44 93  1  0
M  END

View in JSmol View NMR Assignments View Stereo Labels

Synonyms

Value	Source
11-(S-Glutathionyl)-9-hydroxyprostaglandin a(,2)	HMDB
GSOHPGA2	HMDB
(5Z)-7-[(1R,2S)-3-{[(2S)-2-{[(4R)-4-amino-4-carboxy-1-hydroxybutylidene]amino}-2-[(carboxymethyl)-C-hydroxycarbonimidoyl]ethyl]sulfanyl}-5-hydroxy-2-[(1E,3S)-3-hydroxyoct-1-en-1-yl]cyclopentyl]hept-5-enoate	Generator
(5Z)-7-[(1R,2S)-3-{[(2S)-2-{[(4R)-4-amino-4-carboxy-1-hydroxybutylidene]amino}-2-[(carboxymethyl)-C-hydroxycarbonimidoyl]ethyl]sulphanyl}-5-hydroxy-2-[(1E,3S)-3-hydroxyoct-1-en-1-yl]cyclopentyl]hept-5-enoate	Generator
(5Z)-7-[(1R,2S)-3-{[(2S)-2-{[(4R)-4-amino-4-carboxy-1-hydroxybutylidene]amino}-2-[(carboxymethyl)-C-hydroxycarbonimidoyl]ethyl]sulphanyl}-5-hydroxy-2-[(1E,3S)-3-hydroxyoct-1-en-1-yl]cyclopentyl]hept-5-enoic acid	Generator

Chemical Formula

C₃₀H₄₉N₃O₁₀S

Average Molecular Weight

643.789

Monoisotopic Molecular Weight

643.313865493

IUPAC Name

(5Z)-7-[(1R,2S)-3-{[(2S)-2-[(4R)-4-amino-4-carboxybutanamido]-2-[(carboxymethyl)carbamoyl]ethyl]sulfanyl}-5-hydroxy-2-[(1E,3S)-3-hydroxyoct-1-en-1-yl]cyclopentyl]hept-5-enoic acid

Traditional Name

(5Z)-7-[(1R,2S)-3-{[(2S)-2-[(4R)-4-amino-4-carboxybutanamido]-2-(carboxymethylcarbamoyl)ethyl]sulfanyl}-5-hydroxy-2-[(1E,3S)-3-hydroxyoct-1-en-1-yl]cyclopentyl]hept-5-enoic acid

CAS Registry Number

Not Available

SMILES

CCCCC[C@H](O)\C=C\[C@@H]1C(CC(O)[C@@H]1C\C=C/CCCC(O)=O)SC[C@@H](NC(=O)CC[C@@H](N)C(O)=O)C(=O)NCC(O)=O

InChI Identifier

InChI=1S/C30H49N3O10S/c1-2-3-6-9-19(34)12-13-21-20(10-7-4-5-8-11-27(37)38)24(35)16-25(21)44-18-23(29(41)32-17-28(39)40)33-26(36)15-14-22(31)30(42)43/h4,7,12-13,19-25,34-35H,2-3,5-6,8-11,14-18,31H2,1H3,(H,32,41)(H,33,36)(H,37,38)(H,39,40)(H,42,43)/b7-4-,13-12+/t19-,20+,21-,22+,23+,24?,25?/m0/s1

InChI Key

KUKCWBNBPICNAJ-BTGAYFLPSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as oligopeptides. These are organic compounds containing a sequence of between three and ten alpha-amino acids joined by peptide bonds.

Kingdom

Organic compounds

Super Class

Organic acids and derivatives

Class

Carboxylic acids and derivatives

Sub Class

Amino acids, peptides, and analogues

Direct Parent

Oligopeptides

Alternative Parents

Substituents

Alpha-oligopeptide
Gamma-glutamyl alpha peptide
Prostaglandin skeleton
Eicosanoid
Glutamine or derivatives
N-acyl-alpha-amino acid
N-acyl-alpha amino acid or derivatives
Alpha-amino acid amide
Cysteine or derivatives
D-alpha-amino acid
N-substituted-alpha-amino acid
Alpha-amino acid
Alpha-amino acid or derivatives
Tricarboxylic acid or derivatives
Fatty amide
Fatty acyl
N-acyl-amine
Secondary alcohol
Secondary carboxylic acid amide
Cyclic ketone
Ketone
Carboxamide group
Amino acid or derivatives
Amino acid
Dialkylthioether
Carboxylic acid
Sulfenyl compound
Thioether
Primary amine
Organic oxygen compound
Organic nitrogen compound
Alcohol
Carbonyl group
Hydrocarbon derivative
Amine
Organic oxide
Organopnictogen compound
Organosulfur compound
Primary aliphatic amine
Organooxygen compound
Organonitrogen compound
Aliphatic homomonocyclic compound

Molecular Framework

Aliphatic homomonocyclic compounds

External Descriptors

Not Available

Ontology

Not Available

Endogenous (HMDB: HMDB0013060)

Process

Not Available

Role

Not Available

Physical Properties

State

Solid

Experimental Molecular Properties

Property	Value	Reference
Melting Point	Not Available	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	Not Available	Not Available
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	0.016 g/L	ALOGPS
logP	-1.6	ALOGPS
logP	-1.6	ChemAxon
logS	-4.6	ALOGPS
pKa (Strongest Acidic)	1.81	ChemAxon
pKa (Strongest Basic)	9.31	ChemAxon
Physiological Charge	-2	ChemAxon
Hydrogen Acceptor Count	11	ChemAxon
Hydrogen Donor Count	8	ChemAxon
Polar Surface Area	236.58 Å²	ChemAxon
Rotatable Bond Count	23	ChemAxon
Refractivity	166.07 m³·mol⁻¹	ChemAxon
Polarizability	69.43 Å³	ChemAxon
Number of Rings	1	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	No	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DarkChem	[M+H]+	251.156	31661259
DarkChem	[M-H]-	240.88	31661259
DeepCCS	[M+H]+	248.592	30932474
DeepCCS	[M-H]-	246.697	30932474
DeepCCS	[M-2H]-	280.218	30932474
DeepCCS	[M+Na]+	254.263	30932474
AllCCS	[M+H]+	254.3	32859911
AllCCS	[M+H-H2O]+	253.5	32859911
AllCCS	[M+NH4]+	254.9	32859911
AllCCS	[M+Na]+	255.1	32859911
AllCCS	[M-H]-	245.5	32859911
AllCCS	[M+Na-2H]-	249.3	32859911
AllCCS	[M+HCOO]-	253.7	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
S-(9-hydroxy-PGA2)-glutathione	CCCCC[C@H](O)\C=C\[C@@H]1C(CC(O)[C@@H]1C\C=C/CCCC(O)=O)SC[C@@H](NC(=O)CC[C@@H](N)C(O)=O)C(=O)NCC(O)=O	6424.3	Standard polar	33892256
S-(9-hydroxy-PGA2)-glutathione	CCCCC[C@H](O)\C=C\[C@@H]1C(CC(O)[C@@H]1C\C=C/CCCC(O)=O)SC[C@@H](NC(=O)CC[C@@H](N)C(O)=O)C(=O)NCC(O)=O	3743.5	Standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione	CCCCC[C@H](O)\C=C\[C@@H]1C(CC(O)[C@@H]1C\C=C/CCCC(O)=O)SC[C@@H](NC(=O)CC[C@@H](N)C(O)=O)C(=O)NCC(O)=O	5285.2	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
S-(9-hydroxy-PGA2)-glutathione,1TMS,isomer #1	CCCCC[C@@H](/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O)C(=O)NCC(=O)O)CC(O)[C@@H]1C/C=C\CCCC(=O)O)O[Si](C)(C)C	5260.1	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,1TMS,isomer #2	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O)C(=O)NCC(=O)O)CC(O[Si](C)(C)C)[C@@H]1C/C=C\CCCC(=O)O	5129.6	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,1TMS,isomer #3	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O)C(=O)NCC(=O)O)CC(O)[C@@H]1C/C=C\CCCC(=O)O[Si](C)(C)C	5195.1	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,1TMS,isomer #4	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O[Si](C)(C)C)C(=O)NCC(=O)O)CC(O)[C@@H]1C/C=C\CCCC(=O)O	5111.5	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,1TMS,isomer #5	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O)C(=O)NCC(=O)O[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O	5181.0	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,1TMS,isomer #6	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N[Si](C)(C)C)C(=O)O)C(=O)NCC(=O)O)CC(O)[C@@H]1C/C=C\CCCC(=O)O	5308.7	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,1TMS,isomer #7	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@H](C(=O)NCC(=O)O)N(C(=O)CC[C@@H](N)C(=O)O)[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O	5096.7	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,1TMS,isomer #8	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O)C(=O)N(CC(=O)O)[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O	5105.1	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TMS,isomer #1	CCCCC[C@@H](/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O[Si](C)(C)C)C(=O)NCC(=O)O)CC(O)[C@@H]1C/C=C\CCCC(=O)O)O[Si](C)(C)C	5011.7	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TMS,isomer #10	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O)C(=O)NCC(=O)O)CC(O[Si](C)(C)C)[C@@H]1C/C=C\CCCC(=O)O[Si](C)(C)C	4974.9	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TMS,isomer #11	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N[Si](C)(C)C)C(=O)O)C(=O)NCC(=O)O)CC(O[Si](C)(C)C)[C@@H]1C/C=C\CCCC(=O)O	5125.5	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TMS,isomer #12	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@H](C(=O)NCC(=O)O)N(C(=O)CC[C@@H](N)C(=O)O)[Si](C)(C)C)CC(O[Si](C)(C)C)[C@@H]1C/C=C\CCCC(=O)O	4925.9	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TMS,isomer #13	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O)C(=O)N(CC(=O)O)[Si](C)(C)C)CC(O[Si](C)(C)C)[C@@H]1C/C=C\CCCC(=O)O	4939.7	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TMS,isomer #14	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O[Si](C)(C)C)C(=O)NCC(=O)O)CC(O)[C@@H]1C/C=C\CCCC(=O)O[Si](C)(C)C	4980.4	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TMS,isomer #15	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O)C(=O)NCC(=O)O[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O[Si](C)(C)C	5024.4	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TMS,isomer #16	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N[Si](C)(C)C)C(=O)O)C(=O)NCC(=O)O)CC(O)[C@@H]1C/C=C\CCCC(=O)O[Si](C)(C)C	5172.2	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TMS,isomer #17	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@H](C(=O)NCC(=O)O)N(C(=O)CC[C@@H](N)C(=O)O)[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O[Si](C)(C)C	4953.0	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TMS,isomer #18	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O)C(=O)N(CC(=O)O)[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O[Si](C)(C)C	4968.1	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TMS,isomer #19	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O[Si](C)(C)C)C(=O)NCC(=O)O[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O	4968.7	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TMS,isomer #2	CCCCC[C@@H](/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O)C(=O)NCC(=O)O[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O)O[Si](C)(C)C	5052.8	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TMS,isomer #20	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N[Si](C)(C)C)C(=O)O[Si](C)(C)C)C(=O)NCC(=O)O)CC(O)[C@@H]1C/C=C\CCCC(=O)O	5130.4	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TMS,isomer #21	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@H](C(=O)NCC(=O)O)N(C(=O)CC[C@@H](N)C(=O)O[Si](C)(C)C)[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O	4903.4	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TMS,isomer #22	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O[Si](C)(C)C)C(=O)N(CC(=O)O)[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O	4921.3	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TMS,isomer #23	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N[Si](C)(C)C)C(=O)O)C(=O)NCC(=O)O[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O	5166.4	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TMS,isomer #24	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@H](C(=O)NCC(=O)O[Si](C)(C)C)N(C(=O)CC[C@@H](N)C(=O)O)[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O	4936.6	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TMS,isomer #25	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O)C(=O)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O	4970.6	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TMS,isomer #26	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@H](C(=O)NCC(=O)O)N(C(=O)CC[C@@H](N[Si](C)(C)C)C(=O)O)[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O	5080.5	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TMS,isomer #27	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)NCC(=O)O)CC(O)[C@@H]1C/C=C\CCCC(=O)O	5287.9	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TMS,isomer #28	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N[Si](C)(C)C)C(=O)O)C(=O)N(CC(=O)O)[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O	5095.6	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TMS,isomer #29	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@H](C(=O)N(CC(=O)O)[Si](C)(C)C)N(C(=O)CC[C@@H](N)C(=O)O)[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O	4918.8	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TMS,isomer #3	CCCCC[C@@H](/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O)C(=O)NCC(=O)O)CC(O[Si](C)(C)C)[C@@H]1C/C=C\CCCC(=O)O)O[Si](C)(C)C	5011.6	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TMS,isomer #4	CCCCC[C@@H](/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O)C(=O)NCC(=O)O)CC(O)[C@@H]1C/C=C\CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C	5062.6	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TMS,isomer #5	CCCCC[C@@H](/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N[Si](C)(C)C)C(=O)O)C(=O)NCC(=O)O)CC(O)[C@@H]1C/C=C\CCCC(=O)O)O[Si](C)(C)C	5236.7	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TMS,isomer #6	CCCCC[C@@H](/C=C/[C@@H]1C(SC[C@H](C(=O)NCC(=O)O)N(C(=O)CC[C@@H](N)C(=O)O)[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O)O[Si](C)(C)C	4999.5	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TMS,isomer #7	CCCCC[C@@H](/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O)C(=O)N(CC(=O)O)[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O)O[Si](C)(C)C	5006.8	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TMS,isomer #8	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O[Si](C)(C)C)C(=O)NCC(=O)O)CC(O[Si](C)(C)C)[C@@H]1C/C=C\CCCC(=O)O	4931.1	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TMS,isomer #9	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O)C(=O)NCC(=O)O[Si](C)(C)C)CC(O[Si](C)(C)C)[C@@H]1C/C=C\CCCC(=O)O	4963.9	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #1	CCCCC[C@@H](/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O[Si](C)(C)C)C(=O)NCC(=O)O[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O)O[Si](C)(C)C	4871.2	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #10	CCCCC[C@@H](/C=C/[C@@H]1C(SC[C@H](C(=O)NCC(=O)O[Si](C)(C)C)N(C(=O)CC[C@@H](N)C(=O)O)[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O)O[Si](C)(C)C	4866.8	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #11	CCCCC[C@@H](/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O)C(=O)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O)O[Si](C)(C)C	4874.8	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #12	CCCCC[C@@H](/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O)C(=O)NCC(=O)O)CC(O[Si](C)(C)C)[C@@H]1C/C=C\CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C	4843.6	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #13	CCCCC[C@@H](/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N[Si](C)(C)C)C(=O)O)C(=O)NCC(=O)O)CC(O[Si](C)(C)C)[C@@H]1C/C=C\CCCC(=O)O)O[Si](C)(C)C	5053.2	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #14	CCCCC[C@@H](/C=C/[C@@H]1C(SC[C@H](C(=O)NCC(=O)O)N(C(=O)CC[C@@H](N)C(=O)O)[Si](C)(C)C)CC(O[Si](C)(C)C)[C@@H]1C/C=C\CCCC(=O)O)O[Si](C)(C)C	4844.0	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #15	CCCCC[C@@H](/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O)C(=O)N(CC(=O)O)[Si](C)(C)C)CC(O[Si](C)(C)C)[C@@H]1C/C=C\CCCC(=O)O)O[Si](C)(C)C	4859.6	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #16	CCCCC[C@@H](/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N[Si](C)(C)C)C(=O)O)C(=O)NCC(=O)O)CC(O)[C@@H]1C/C=C\CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C	5079.7	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #17	CCCCC[C@@H](/C=C/[C@@H]1C(SC[C@H](C(=O)NCC(=O)O)N(C(=O)CC[C@@H](N)C(=O)O)[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C	4863.5	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #18	CCCCC[C@@H](/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O)C(=O)N(CC(=O)O)[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C	4872.2	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #19	CCCCC[C@@H](/C=C/[C@@H]1C(SC[C@H](C(=O)NCC(=O)O)N(C(=O)CC[C@@H](N[Si](C)(C)C)C(=O)O)[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O)O[Si](C)(C)C	5025.1	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #2	CCCCC[C@@H](/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O[Si](C)(C)C)C(=O)NCC(=O)O)CC(O[Si](C)(C)C)[C@@H]1C/C=C\CCCC(=O)O)O[Si](C)(C)C	4837.4	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #20	CCCCC[C@@H](/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)NCC(=O)O)CC(O)[C@@H]1C/C=C\CCCC(=O)O)O[Si](C)(C)C	5160.6	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #21	CCCCC[C@@H](/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N[Si](C)(C)C)C(=O)O)C(=O)N(CC(=O)O)[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O)O[Si](C)(C)C	5032.7	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #22	CCCCC[C@@H](/C=C/[C@@H]1C(SC[C@H](C(=O)N(CC(=O)O)[Si](C)(C)C)N(C(=O)CC[C@@H](N)C(=O)O)[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O)O[Si](C)(C)C	4895.7	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #23	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O[Si](C)(C)C)C(=O)NCC(=O)O[Si](C)(C)C)CC(O[Si](C)(C)C)[C@@H]1C/C=C\CCCC(=O)O	4805.6	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #24	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O[Si](C)(C)C)C(=O)NCC(=O)O)CC(O[Si](C)(C)C)[C@@H]1C/C=C\CCCC(=O)O[Si](C)(C)C	4800.2	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #25	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N[Si](C)(C)C)C(=O)O[Si](C)(C)C)C(=O)NCC(=O)O)CC(O[Si](C)(C)C)[C@@H]1C/C=C\CCCC(=O)O	4985.1	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #26	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@H](C(=O)NCC(=O)O)N(C(=O)CC[C@@H](N)C(=O)O[Si](C)(C)C)[Si](C)(C)C)CC(O[Si](C)(C)C)[C@@H]1C/C=C\CCCC(=O)O	4762.8	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #27	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O[Si](C)(C)C)C(=O)N(CC(=O)O)[Si](C)(C)C)CC(O[Si](C)(C)C)[C@@H]1C/C=C\CCCC(=O)O	4786.1	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #28	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O)C(=O)NCC(=O)O[Si](C)(C)C)CC(O[Si](C)(C)C)[C@@H]1C/C=C\CCCC(=O)O[Si](C)(C)C	4825.4	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #29	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N[Si](C)(C)C)C(=O)O)C(=O)NCC(=O)O[Si](C)(C)C)CC(O[Si](C)(C)C)[C@@H]1C/C=C\CCCC(=O)O	5008.4	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #3	CCCCC[C@@H](/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O[Si](C)(C)C)C(=O)NCC(=O)O)CC(O)[C@@H]1C/C=C\CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C	4867.6	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #30	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@H](C(=O)NCC(=O)O[Si](C)(C)C)N(C(=O)CC[C@@H](N)C(=O)O)[Si](C)(C)C)CC(O[Si](C)(C)C)[C@@H]1C/C=C\CCCC(=O)O	4780.8	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #31	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O)C(=O)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C)CC(O[Si](C)(C)C)[C@@H]1C/C=C\CCCC(=O)O	4801.1	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #32	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N[Si](C)(C)C)C(=O)O)C(=O)NCC(=O)O)CC(O[Si](C)(C)C)[C@@H]1C/C=C\CCCC(=O)O[Si](C)(C)C	5013.2	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #33	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@H](C(=O)NCC(=O)O)N(C(=O)CC[C@@H](N)C(=O)O)[Si](C)(C)C)CC(O[Si](C)(C)C)[C@@H]1C/C=C\CCCC(=O)O[Si](C)(C)C	4780.2	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #34	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O)C(=O)N(CC(=O)O)[Si](C)(C)C)CC(O[Si](C)(C)C)[C@@H]1C/C=C\CCCC(=O)O[Si](C)(C)C	4800.0	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #35	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@H](C(=O)NCC(=O)O)N(C(=O)CC[C@@H](N[Si](C)(C)C)C(=O)O)[Si](C)(C)C)CC(O[Si](C)(C)C)[C@@H]1C/C=C\CCCC(=O)O	4959.5	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #36	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)NCC(=O)O)CC(O[Si](C)(C)C)[C@@H]1C/C=C\CCCC(=O)O	5090.7	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #37	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N[Si](C)(C)C)C(=O)O)C(=O)N(CC(=O)O)[Si](C)(C)C)CC(O[Si](C)(C)C)[C@@H]1C/C=C\CCCC(=O)O	4973.0	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #38	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@H](C(=O)N(CC(=O)O)[Si](C)(C)C)N(C(=O)CC[C@@H](N)C(=O)O)[Si](C)(C)C)CC(O[Si](C)(C)C)[C@@H]1C/C=C\CCCC(=O)O	4814.1	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #39	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O[Si](C)(C)C)C(=O)NCC(=O)O[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O[Si](C)(C)C	4844.2	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #4	CCCCC[C@@H](/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N[Si](C)(C)C)C(=O)O[Si](C)(C)C)C(=O)NCC(=O)O)CC(O)[C@@H]1C/C=C\CCCC(=O)O)O[Si](C)(C)C	5052.2	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #40	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N[Si](C)(C)C)C(=O)O[Si](C)(C)C)C(=O)NCC(=O)O)CC(O)[C@@H]1C/C=C\CCCC(=O)O[Si](C)(C)C	5020.2	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #41	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@H](C(=O)NCC(=O)O)N(C(=O)CC[C@@H](N)C(=O)O[Si](C)(C)C)[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O[Si](C)(C)C	4795.1	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #42	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O[Si](C)(C)C)C(=O)N(CC(=O)O)[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O[Si](C)(C)C	4814.6	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #43	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N[Si](C)(C)C)C(=O)O)C(=O)NCC(=O)O[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O[Si](C)(C)C	5055.2	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #44	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@H](C(=O)NCC(=O)O[Si](C)(C)C)N(C(=O)CC[C@@H](N)C(=O)O)[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O[Si](C)(C)C	4819.1	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #45	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O)C(=O)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O[Si](C)(C)C	4833.1	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #46	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@H](C(=O)NCC(=O)O)N(C(=O)CC[C@@H](N[Si](C)(C)C)C(=O)O)[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O[Si](C)(C)C	4983.6	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #47	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)NCC(=O)O)CC(O)[C@@H]1C/C=C\CCCC(=O)O[Si](C)(C)C	5130.4	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #48	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N[Si](C)(C)C)C(=O)O)C(=O)N(CC(=O)O)[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O[Si](C)(C)C	4994.6	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #49	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@H](C(=O)N(CC(=O)O)[Si](C)(C)C)N(C(=O)CC[C@@H](N)C(=O)O)[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O[Si](C)(C)C	4845.5	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #5	CCCCC[C@@H](/C=C/[C@@H]1C(SC[C@H](C(=O)NCC(=O)O)N(C(=O)CC[C@@H](N)C(=O)O[Si](C)(C)C)[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O)O[Si](C)(C)C	4847.6	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #50	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N[Si](C)(C)C)C(=O)O[Si](C)(C)C)C(=O)NCC(=O)O[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O	5015.5	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #51	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@H](C(=O)NCC(=O)O[Si](C)(C)C)N(C(=O)CC[C@@H](N)C(=O)O[Si](C)(C)C)[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O	4795.6	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #52	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O[Si](C)(C)C)C(=O)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O	4815.2	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #53	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@H](C(=O)NCC(=O)O)N(C(=O)CC[C@@H](N[Si](C)(C)C)C(=O)O[Si](C)(C)C)[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O	4954.4	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #54	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@H](C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)C(=O)NCC(=O)O)CC(O)[C@@H]1C/C=C\CCCC(=O)O	5141.9	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #55	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N[Si](C)(C)C)C(=O)O[Si](C)(C)C)C(=O)N(CC(=O)O)[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O	4968.5	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #56	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@H](C(=O)N(CC(=O)O)[Si](C)(C)C)N(C(=O)CC[C@@H](N)C(=O)O[Si](C)(C)C)[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O	4826.5	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #57	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@H](C(=O)NCC(=O)O[Si](C)(C)C)N(C(=O)CC[C@@H](N[Si](C)(C)C)C(=O)O)[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O	4975.2	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #58	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)NCC(=O)O[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O	5127.8	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #59	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N[Si](C)(C)C)C(=O)O)C(=O)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O	4996.3	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #6	CCCCC[C@@H](/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O[Si](C)(C)C)C(=O)N(CC(=O)O)[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O)O[Si](C)(C)C	4859.3	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #60	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@H](C(=O)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C)N(C(=O)CC[C@@H](N)C(=O)O)[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O	4860.7	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #61	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@H](C(=O)N(CC(=O)O)[Si](C)(C)C)N(C(=O)CC[C@@H](N[Si](C)(C)C)C(=O)O)[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O	4969.8	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #62	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@H](C(=O)NCC(=O)O)N(C(=O)CC[C@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O	5095.2	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #63	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)N(CC(=O)O)[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O	5108.1	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #7	CCCCC[C@@H](/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O)C(=O)NCC(=O)O[Si](C)(C)C)CC(O[Si](C)(C)C)[C@@H]1C/C=C\CCCC(=O)O)O[Si](C)(C)C	4848.0	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #8	CCCCC[C@@H](/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O)C(=O)NCC(=O)O[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C	4890.3	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,3TMS,isomer #9	CCCCC[C@@H](/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N[Si](C)(C)C)C(=O)O)C(=O)NCC(=O)O[Si](C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O)O[Si](C)(C)C	5081.2	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,1TBDMS,isomer #1	CCCCC[C@@H](/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O)C(=O)NCC(=O)O)CC(O)[C@@H]1C/C=C\CCCC(=O)O)O[Si](C)(C)C(C)(C)C	5434.4	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,1TBDMS,isomer #2	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O)C(=O)NCC(=O)O)CC(O[Si](C)(C)C(C)(C)C)[C@@H]1C/C=C\CCCC(=O)O	5336.2	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,1TBDMS,isomer #3	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O)C(=O)NCC(=O)O)CC(O)[C@@H]1C/C=C\CCCC(=O)O[Si](C)(C)C(C)(C)C	5430.3	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,1TBDMS,isomer #4	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O[Si](C)(C)C(C)(C)C)C(=O)NCC(=O)O)CC(O)[C@@H]1C/C=C\CCCC(=O)O	5328.9	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,1TBDMS,isomer #5	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O)C(=O)NCC(=O)O[Si](C)(C)C(C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O	5428.1	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,1TBDMS,isomer #6	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N[Si](C)(C)C(C)(C)C)C(=O)O)C(=O)NCC(=O)O)CC(O)[C@@H]1C/C=C\CCCC(=O)O	5534.6	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,1TBDMS,isomer #7	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@H](C(=O)NCC(=O)O)N(C(=O)CC[C@@H](N)C(=O)O)[Si](C)(C)C(C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O	5334.2	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,1TBDMS,isomer #8	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O)C(=O)N(CC(=O)O)[Si](C)(C)C(C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O	5349.5	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TBDMS,isomer #1	CCCCC[C@@H](/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O[Si](C)(C)C(C)(C)C)C(=O)NCC(=O)O)CC(O)[C@@H]1C/C=C\CCCC(=O)O)O[Si](C)(C)C(C)(C)C	5399.5	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TBDMS,isomer #10	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O)C(=O)NCC(=O)O)CC(O[Si](C)(C)C(C)(C)C)[C@@H]1C/C=C\CCCC(=O)O[Si](C)(C)C(C)(C)C	5384.3	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TBDMS,isomer #11	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N[Si](C)(C)C(C)(C)C)C(=O)O)C(=O)NCC(=O)O)CC(O[Si](C)(C)C(C)(C)C)[C@@H]1C/C=C\CCCC(=O)O	5516.0	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TBDMS,isomer #12	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@H](C(=O)NCC(=O)O)N(C(=O)CC[C@@H](N)C(=O)O)[Si](C)(C)C(C)(C)C)CC(O[Si](C)(C)C(C)(C)C)[C@@H]1C/C=C\CCCC(=O)O	5349.9	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TBDMS,isomer #13	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O)C(=O)N(CC(=O)O)[Si](C)(C)C(C)(C)C)CC(O[Si](C)(C)C(C)(C)C)[C@@H]1C/C=C\CCCC(=O)O	5365.1	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TBDMS,isomer #14	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O[Si](C)(C)C(C)(C)C)C(=O)NCC(=O)O)CC(O)[C@@H]1C/C=C\CCCC(=O)O[Si](C)(C)C(C)(C)C	5406.2	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TBDMS,isomer #15	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O)C(=O)NCC(=O)O[Si](C)(C)C(C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O[Si](C)(C)C(C)(C)C	5470.2	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TBDMS,isomer #16	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N[Si](C)(C)C(C)(C)C)C(=O)O)C(=O)NCC(=O)O)CC(O)[C@@H]1C/C=C\CCCC(=O)O[Si](C)(C)C(C)(C)C	5601.0	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TBDMS,isomer #17	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@H](C(=O)NCC(=O)O)N(C(=O)CC[C@@H](N)C(=O)O)[Si](C)(C)C(C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O[Si](C)(C)C(C)(C)C	5414.0	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TBDMS,isomer #18	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O)C(=O)N(CC(=O)O)[Si](C)(C)C(C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O[Si](C)(C)C(C)(C)C	5422.2	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TBDMS,isomer #19	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O[Si](C)(C)C(C)(C)C)C(=O)NCC(=O)O[Si](C)(C)C(C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O	5409.3	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TBDMS,isomer #2	CCCCC[C@@H](/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O)C(=O)NCC(=O)O[Si](C)(C)C(C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O)O[Si](C)(C)C(C)(C)C	5473.4	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TBDMS,isomer #20	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C)C(=O)NCC(=O)O)CC(O)[C@@H]1C/C=C\CCCC(=O)O	5532.9	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TBDMS,isomer #21	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@H](C(=O)NCC(=O)O)N(C(=O)CC[C@@H](N)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O	5355.6	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TBDMS,isomer #22	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O[Si](C)(C)C(C)(C)C)C(=O)N(CC(=O)O)[Si](C)(C)C(C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O	5361.7	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TBDMS,isomer #23	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N[Si](C)(C)C(C)(C)C)C(=O)O)C(=O)NCC(=O)O[Si](C)(C)C(C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O	5608.1	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TBDMS,isomer #24	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@H](C(=O)NCC(=O)O[Si](C)(C)C(C)(C)C)N(C(=O)CC[C@@H](N)C(=O)O)[Si](C)(C)C(C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O	5410.9	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TBDMS,isomer #25	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O)C(=O)N(CC(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O	5426.2	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TBDMS,isomer #26	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@H](C(=O)NCC(=O)O)N(C(=O)CC[C@@H](N[Si](C)(C)C(C)(C)C)C(=O)O)[Si](C)(C)C(C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O	5528.6	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TBDMS,isomer #27	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@H](C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)NCC(=O)O)CC(O)[C@@H]1C/C=C\CCCC(=O)O	5706.9	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TBDMS,isomer #28	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N[Si](C)(C)C(C)(C)C)C(=O)O)C(=O)N(CC(=O)O)[Si](C)(C)C(C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O	5537.3	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TBDMS,isomer #29	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@H](C(=O)N(CC(=O)O)[Si](C)(C)C(C)(C)C)N(C(=O)CC[C@@H](N)C(=O)O)[Si](C)(C)C(C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O	5370.8	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TBDMS,isomer #3	CCCCC[C@@H](/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O)C(=O)NCC(=O)O)CC(O[Si](C)(C)C(C)(C)C)[C@@H]1C/C=C\CCCC(=O)O)O[Si](C)(C)C(C)(C)C	5362.2	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TBDMS,isomer #4	CCCCC[C@@H](/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O)C(=O)NCC(=O)O)CC(O)[C@@H]1C/C=C\CCCC(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C	5467.8	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TBDMS,isomer #5	CCCCC[C@@H](/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N[Si](C)(C)C(C)(C)C)C(=O)O)C(=O)NCC(=O)O)CC(O)[C@@H]1C/C=C\CCCC(=O)O)O[Si](C)(C)C(C)(C)C	5609.7	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TBDMS,isomer #6	CCCCC[C@@H](/C=C/[C@@H]1C(SC[C@H](C(=O)NCC(=O)O)N(C(=O)CC[C@@H](N)C(=O)O)[Si](C)(C)C(C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O)O[Si](C)(C)C(C)(C)C	5407.9	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TBDMS,isomer #7	CCCCC[C@@H](/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O)C(=O)N(CC(=O)O)[Si](C)(C)C(C)(C)C)CC(O)[C@@H]1C/C=C\CCCC(=O)O)O[Si](C)(C)C(C)(C)C	5417.0	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TBDMS,isomer #8	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O[Si](C)(C)C(C)(C)C)C(=O)NCC(=O)O)CC(O[Si](C)(C)C(C)(C)C)[C@@H]1C/C=C\CCCC(=O)O	5343.6	Semi standard non polar	33892256
S-(9-hydroxy-PGA2)-glutathione,2TBDMS,isomer #9	CCCCC[C@H](O)/C=C/[C@@H]1C(SC[C@@H](NC(=O)CC[C@@H](N)C(=O)O)C(=O)NCC(=O)O[Si](C)(C)C(C)(C)C)CC(O[Si](C)(C)C(C)(C)C)[C@@H]1C/C=C\CCCC(=O)O	5388.9	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - S-(9-hydroxy-PGA2)-glutathione GC-MS (Non-derivatized) - 70eV, Positive	splash10-00fv-2101091000-0b90c30505c2813e739e	2017-09-01	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - S-(9-hydroxy-PGA2)-glutathione GC-MS (TMS_1_1) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - S-(9-hydroxy-PGA2)-glutathione GC-MS (TMS_1_2) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - S-(9-hydroxy-PGA2)-glutathione GC-MS (TMS_1_3) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - S-(9-hydroxy-PGA2)-glutathione GC-MS (TMS_1_4) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - S-(9-hydroxy-PGA2)-glutathione GC-MS (TMS_1_5) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - S-(9-hydroxy-PGA2)-glutathione GC-MS (TMS_1_6) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - S-(9-hydroxy-PGA2)-glutathione GC-MS (TMS_1_7) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - S-(9-hydroxy-PGA2)-glutathione GC-MS (TMS_1_8) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - S-(9-hydroxy-PGA2)-glutathione GC-MS (TMS_2_1) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - S-(9-hydroxy-PGA2)-glutathione GC-MS (TMS_2_2) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - S-(9-hydroxy-PGA2)-glutathione GC-MS (TMS_2_3) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - S-(9-hydroxy-PGA2)-glutathione GC-MS (TMS_2_4) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - S-(9-hydroxy-PGA2)-glutathione GC-MS (TMS_2_5) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - S-(9-hydroxy-PGA2)-glutathione GC-MS (TMS_2_6) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - S-(9-hydroxy-PGA2)-glutathione GC-MS (TMS_2_7) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - S-(9-hydroxy-PGA2)-glutathione GC-MS (TMS_2_8) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - S-(9-hydroxy-PGA2)-glutathione GC-MS (TMS_2_9) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - S-(9-hydroxy-PGA2)-glutathione GC-MS (TMS_2_10) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - S-(9-hydroxy-PGA2)-glutathione GC-MS (TMS_2_11) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - S-(9-hydroxy-PGA2)-glutathione GC-MS (TMS_2_12) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - S-(9-hydroxy-PGA2)-glutathione GC-MS (TMS_2_13) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - S-(9-hydroxy-PGA2)-glutathione GC-MS (TMS_2_14) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - S-(9-hydroxy-PGA2)-glutathione GC-MS (TMS_2_15) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - S-(9-hydroxy-PGA2)-glutathione GC-MS (TMS_2_16) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - S-(9-hydroxy-PGA2)-glutathione 10V, Positive-QTOF	splash10-0a7j-0001169000-17b9a9ed58371b1c0cfb	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - S-(9-hydroxy-PGA2)-glutathione 20V, Positive-QTOF	splash10-0032-5102593000-2a6f895e44477eadc68e	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - S-(9-hydroxy-PGA2)-glutathione 40V, Positive-QTOF	splash10-0r99-9303530000-0db64f6939d11f8787ea	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - S-(9-hydroxy-PGA2)-glutathione 10V, Negative-QTOF	splash10-00dl-0016049000-c637530b2d4b493f8b73	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - S-(9-hydroxy-PGA2)-glutathione 20V, Negative-QTOF	splash10-0uxr-0009010000-52e7e5da313ad3f9b92a	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - S-(9-hydroxy-PGA2)-glutathione 40V, Negative-QTOF	splash10-0fdn-4903000000-290d38d069e229c6f412	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - S-(9-hydroxy-PGA2)-glutathione 10V, Positive-QTOF	splash10-0a6r-0004119000-8b0fac94bce55e8fd4d5	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - S-(9-hydroxy-PGA2)-glutathione 20V, Positive-QTOF	splash10-05nb-3004975000-55936a3153e74748b722	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - S-(9-hydroxy-PGA2)-glutathione 40V, Positive-QTOF	splash10-001i-9300220000-ac2254f85ffa60f3575a	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - S-(9-hydroxy-PGA2)-glutathione 10V, Negative-QTOF	splash10-006x-0010019000-8c167014734179945dce	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - S-(9-hydroxy-PGA2)-glutathione 20V, Negative-QTOF	splash10-0596-1930123000-03f10998874828120533	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - S-(9-hydroxy-PGA2)-glutathione 40V, Negative-QTOF	splash10-0006-9600000000-412a6c348e7591082fee	2021-09-25	Wishart Lab	View Spectrum

NMR Spectra

Spectrum Type	Description	Deposition Date	Source	View
Predicted 1D NMR	¹H NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-16	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-16	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-16	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-16	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-16	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-16	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-16	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-16	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-16	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-16	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-16	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-16	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-16	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-16	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-16	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-16	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-16	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-16	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-16	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-16	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Not Available

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

FDB029275

KNApSAcK ID

Not Available

Chemspider ID

35032569

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

53481600

PDB ID

Not Available

ChEBI ID

Not Available

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

Not Available

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

Not Available

Showing metabocard for S-(9-hydroxy-PGA2)-glutathione (HMDB0013060)

MOL for HMDB0013060 (S-(9-hydroxy-PGA2)-glutathione)

3D MOL for HMDB0013060 (S-(9-hydroxy-PGA2)-glutathione)

3D SDF for HMDB0013060 (S-(9-hydroxy-PGA2)-glutathione)

3D-SDF for HMDB0013060 (S-(9-hydroxy-PGA2)-glutathione)

PDB for HMDB0013060 (S-(9-hydroxy-PGA2)-glutathione)

3D PDB for HMDB0013060 (S-(9-hydroxy-PGA2)-glutathione)

SMILES for HMDB0013060 (S-(9-hydroxy-PGA2)-glutathione)

INCHI for HMDB0013060 (S-(9-hydroxy-PGA2)-glutathione)

Structure for HMDB0013060 (S-(9-hydroxy-PGA2)-glutathione)

3D Structure for HMDB0013060 (S-(9-hydroxy-PGA2)-glutathione)

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra

NMR Spectra