| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Expected but not Quantified |
|---|
| Creation Date | 2012-09-11 18:48:45 UTC |
|---|
| Update Date | 2022-03-07 02:53:57 UTC |
|---|
| HMDB ID | HMDB0034037 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Palmidin B |
|---|
| Description | Palmidin B belongs to the class of organic compounds known as anthracenes. These are organic compounds containing a system of three linearly fused benzene rings. Palmidin B has been detected, but not quantified in, green vegetables. This could make palmidin b a potential biomarker for the consumption of these foods. Based on a literature review very few articles have been published on Palmidin B. |
|---|
| Structure | CC1=CC2=C(C(O)=C1)C(=O)C1=C(C=CC=C1O)C2C1C2=C(C(O)=CC=C2)C(=O)C2=C1C=C(CO)C=C2O InChI=1S/C30H22O7/c1-13-8-17-23(15-4-2-6-19(32)25(15)29(36)27(17)21(34)9-13)24-16-5-3-7-20(33)26(16)30(37)28-18(24)10-14(12-31)11-22(28)35/h2-11,23-24,31-35H,12H2,1H3 |
|---|
| Synonyms | | Value | Source |
|---|
| 4,4',5,5'-Tetrahydroxy-2-(hydroxymethyl)-2'-methyl-[9,9'-bianthracene]-10,10'(9H,9'H)-dione, 9ci | HMDB | | Aloeemodin-chrysophanol bianthrone | HMDB |
|
|---|
| Chemical Formula | C30H22O7 |
|---|
| Average Molecular Weight | 494.4915 |
|---|
| Monoisotopic Molecular Weight | 494.136553058 |
|---|
| IUPAC Name | 10-[4,5-dihydroxy-2-(hydroxymethyl)-10-oxo-9,10-dihydroanthracen-9-yl]-1,8-dihydroxy-3-methyl-9,10-dihydroanthracen-9-one |
|---|
| Traditional Name | 10-[4,5-dihydroxy-2-(hydroxymethyl)-10-oxo-9H-anthracen-9-yl]-1,8-dihydroxy-3-methyl-10H-anthracen-9-one |
|---|
| CAS Registry Number | 17062-56-5 |
|---|
| SMILES | CC1=CC2=C(C(O)=C1)C(=O)C1=C(C=CC=C1O)C2C1C2=C(C(O)=CC=C2)C(=O)C2=C1C=C(CO)C=C2O |
|---|
| InChI Identifier | InChI=1S/C30H22O7/c1-13-8-17-23(15-4-2-6-19(32)25(15)29(36)27(17)21(34)9-13)24-16-5-3-7-20(33)26(16)30(37)28-18(24)10-14(12-31)11-22(28)35/h2-11,23-24,31-35H,12H2,1H3 |
|---|
| InChI Key | AGYHUJLPTURBHW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as anthracenes. These are organic compounds containing a system of three linearly fused benzene rings. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Benzenoids |
|---|
| Class | Anthracenes |
|---|
| Sub Class | Not Available |
|---|
| Direct Parent | Anthracenes |
|---|
| Alternative Parents | |
|---|
| Substituents | - Anthracene
- Aryl ketone
- 1-hydroxy-4-unsubstituted benzenoid
- 1-hydroxy-2-unsubstituted benzenoid
- Vinylogous acid
- Ketone
- Organic oxygen compound
- Organic oxide
- Hydrocarbon derivative
- Aromatic alcohol
- Primary alcohol
- Organooxygen compound
- Alcohol
- Aromatic homopolycyclic compound
|
|---|
| Molecular Framework | Aromatic homopolycyclic compounds |
|---|
| External Descriptors | Not Available |
|---|
| Ontology |
|---|
| Physiological effect | Not Available |
|---|
| Disposition | |
|---|
| Process | Not Available |
|---|
| Role | |
|---|
| Physical Properties |
|---|
| State | Not Available |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | 0.00037 mg/L @ 25 °C (est) | The Good Scents Company Information System | | LogP | Not Available | Not Available |
|
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 5.93 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 14.626 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 2.65 minutes | 32390414 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 3030.4 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 225.0 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 199.5 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 161.3 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 200.1 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 841.9 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 761.5 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 79.6 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 1337.6 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 566.6 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1909.5 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 526.6 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 484.8 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 252.6 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 110.9 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 82.3 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Palmidin B,1TMS,isomer #1 | CC1=CC(O[Si](C)(C)C)=C2C(=O)C3=C(O)C=CC=C3C(C3C4=CC=CC(O)=C4C(=O)C4=C(O)C=C(CO)C=C43)C2=C1 | 4409.1 | Semi standard non polar | 33892256 | | Palmidin B,1TMS,isomer #2 | CC1=CC(O)=C2C(=O)C3=C(O[Si](C)(C)C)C=CC=C3C(C3C4=CC=CC(O)=C4C(=O)C4=C(O)C=C(CO)C=C43)C2=C1 | 4468.3 | Semi standard non polar | 33892256 | | Palmidin B,1TMS,isomer #3 | CC1=CC(O)=C2C(=O)C3=C(O)C=CC=C3C(C3C4=CC(CO)=CC(O)=C4C(=O)C4=C(O[Si](C)(C)C)C=CC=C43)C2=C1 | 4472.9 | Semi standard non polar | 33892256 | | Palmidin B,1TMS,isomer #4 | CC1=CC(O)=C2C(=O)C3=C(O)C=CC=C3C(C3C4=CC=CC(O)=C4C(=O)C4=C(O)C=C(CO[Si](C)(C)C)C=C43)C2=C1 | 4407.4 | Semi standard non polar | 33892256 | | Palmidin B,1TMS,isomer #5 | CC1=CC(O)=C2C(=O)C3=C(O)C=CC=C3C(C3C4=CC=CC(O)=C4C(=O)C4=C(O[Si](C)(C)C)C=C(CO)C=C43)C2=C1 | 4405.2 | Semi standard non polar | 33892256 | | Palmidin B,2TMS,isomer #1 | CC1=CC(O[Si](C)(C)C)=C2C(=O)C3=C(O)C=CC=C3C(C3C4=CC(CO)=CC(O)=C4C(=O)C4=C(O[Si](C)(C)C)C=CC=C43)C2=C1 | 4335.9 | Semi standard non polar | 33892256 | | Palmidin B,2TMS,isomer #10 | CC1=CC(O)=C2C(=O)C3=C(O)C=CC=C3C(C3C4=CC=CC(O)=C4C(=O)C4=C(O[Si](C)(C)C)C=C(CO[Si](C)(C)C)C=C43)C2=C1 | 4277.5 | Semi standard non polar | 33892256 | | Palmidin B,2TMS,isomer #2 | CC1=CC(O[Si](C)(C)C)=C2C(=O)C3=C(O)C=CC=C3C(C3C4=CC=CC(O)=C4C(=O)C4=C(O[Si](C)(C)C)C=C(CO)C=C43)C2=C1 | 4274.4 | Semi standard non polar | 33892256 | | Palmidin B,2TMS,isomer #3 | CC1=CC(O[Si](C)(C)C)=C2C(=O)C3=C(O)C=CC=C3C(C3C4=CC=CC(O)=C4C(=O)C4=C(O)C=C(CO[Si](C)(C)C)C=C43)C2=C1 | 4282.1 | Semi standard non polar | 33892256 | | Palmidin B,2TMS,isomer #4 | CC1=CC(O[Si](C)(C)C)=C2C(=O)C3=C(O[Si](C)(C)C)C=CC=C3C(C3C4=CC=CC(O)=C4C(=O)C4=C(O)C=C(CO)C=C43)C2=C1 | 4369.1 | Semi standard non polar | 33892256 | | Palmidin B,2TMS,isomer #5 | CC1=CC(O)=C2C(=O)C3=C(O[Si](C)(C)C)C=CC=C3C(C3C4=CC(CO)=CC(O)=C4C(=O)C4=C(O[Si](C)(C)C)C=CC=C43)C2=C1 | 4380.7 | Semi standard non polar | 33892256 | | Palmidin B,2TMS,isomer #6 | CC1=CC(O)=C2C(=O)C3=C(O[Si](C)(C)C)C=CC=C3C(C3C4=CC=CC(O)=C4C(=O)C4=C(O[Si](C)(C)C)C=C(CO)C=C43)C2=C1 | 4324.6 | Semi standard non polar | 33892256 | | Palmidin B,2TMS,isomer #7 | CC1=CC(O)=C2C(=O)C3=C(O[Si](C)(C)C)C=CC=C3C(C3C4=CC=CC(O)=C4C(=O)C4=C(O)C=C(CO[Si](C)(C)C)C=C43)C2=C1 | 4334.4 | Semi standard non polar | 33892256 | | Palmidin B,2TMS,isomer #8 | CC1=CC(O)=C2C(=O)C3=C(O)C=CC=C3C(C3C4=CC(CO[Si](C)(C)C)=CC(O)=C4C(=O)C4=C(O[Si](C)(C)C)C=CC=C43)C2=C1 | 4335.4 | Semi standard non polar | 33892256 | | Palmidin B,2TMS,isomer #9 | CC1=CC(O)=C2C(=O)C3=C(O)C=CC=C3C(C3C4=CC=CC(O[Si](C)(C)C)=C4C(=O)C4=C(O[Si](C)(C)C)C=C(CO)C=C43)C2=C1 | 4368.8 | Semi standard non polar | 33892256 | | Palmidin B,3TMS,isomer #1 | CC1=CC(O[Si](C)(C)C)=C2C(=O)C3=C(O)C=CC=C3C(C3C4=CC(CO[Si](C)(C)C)=CC(O)=C4C(=O)C4=C(O[Si](C)(C)C)C=CC=C43)C2=C1 | 4220.1 | Semi standard non polar | 33892256 | | Palmidin B,3TMS,isomer #10 | CC1=CC(O)=C2C(=O)C3=C(O)C=CC=C3C(C3C4=CC=CC(O[Si](C)(C)C)=C4C(=O)C4=C(O[Si](C)(C)C)C=C(CO[Si](C)(C)C)C=C43)C2=C1 | 4250.1 | Semi standard non polar | 33892256 | | Palmidin B,3TMS,isomer #2 | CC1=CC(O[Si](C)(C)C)=C2C(=O)C3=C(O)C=CC=C3C(C3C4=CC=CC(O[Si](C)(C)C)=C4C(=O)C4=C(O[Si](C)(C)C)C=C(CO)C=C43)C2=C1 | 4250.0 | Semi standard non polar | 33892256 | | Palmidin B,3TMS,isomer #3 | CC1=CC(O[Si](C)(C)C)=C2C(=O)C3=C(O[Si](C)(C)C)C=CC=C3C(C3C4=CC(CO)=CC(O)=C4C(=O)C4=C(O[Si](C)(C)C)C=CC=C43)C2=C1 | 4300.0 | Semi standard non polar | 33892256 | | Palmidin B,3TMS,isomer #4 | CC1=CC(O[Si](C)(C)C)=C2C(=O)C3=C(O)C=CC=C3C(C3C4=CC=CC(O)=C4C(=O)C4=C(O[Si](C)(C)C)C=C(CO[Si](C)(C)C)C=C43)C2=C1 | 4171.8 | Semi standard non polar | 33892256 | | Palmidin B,3TMS,isomer #5 | CC1=CC(O[Si](C)(C)C)=C2C(=O)C3=C(O[Si](C)(C)C)C=CC=C3C(C3C4=CC=CC(O)=C4C(=O)C4=C(O[Si](C)(C)C)C=C(CO)C=C43)C2=C1 | 4240.5 | Semi standard non polar | 33892256 | | Palmidin B,3TMS,isomer #6 | CC1=CC(O[Si](C)(C)C)=C2C(=O)C3=C(O[Si](C)(C)C)C=CC=C3C(C3C4=CC=CC(O)=C4C(=O)C4=C(O)C=C(CO[Si](C)(C)C)C=C43)C2=C1 | 4250.8 | Semi standard non polar | 33892256 | | Palmidin B,3TMS,isomer #7 | CC1=CC(O)=C2C(=O)C3=C(O[Si](C)(C)C)C=CC=C3C(C3C4=CC(CO[Si](C)(C)C)=CC(O)=C4C(=O)C4=C(O[Si](C)(C)C)C=CC=C43)C2=C1 | 4271.9 | Semi standard non polar | 33892256 | | Palmidin B,3TMS,isomer #8 | CC1=CC(O)=C2C(=O)C3=C(O[Si](C)(C)C)C=CC=C3C(C3C4=CC=CC(O[Si](C)(C)C)=C4C(=O)C4=C(O[Si](C)(C)C)C=C(CO)C=C43)C2=C1 | 4303.6 | Semi standard non polar | 33892256 | | Palmidin B,3TMS,isomer #9 | CC1=CC(O)=C2C(=O)C3=C(O[Si](C)(C)C)C=CC=C3C(C3C4=CC=CC(O)=C4C(=O)C4=C(O[Si](C)(C)C)C=C(CO[Si](C)(C)C)C=C43)C2=C1 | 4218.5 | Semi standard non polar | 33892256 | | Palmidin B,4TMS,isomer #1 | CC1=CC(O[Si](C)(C)C)=C2C(=O)C3=C(O)C=CC=C3C(C3C4=CC=CC(O[Si](C)(C)C)=C4C(=O)C4=C(O[Si](C)(C)C)C=C(CO[Si](C)(C)C)C=C43)C2=C1 | 4164.8 | Semi standard non polar | 33892256 | | Palmidin B,4TMS,isomer #2 | CC1=CC(O[Si](C)(C)C)=C2C(=O)C3=C(O[Si](C)(C)C)C=CC=C3C(C3C4=CC(CO[Si](C)(C)C)=CC(O)=C4C(=O)C4=C(O[Si](C)(C)C)C=CC=C43)C2=C1 | 4211.4 | Semi standard non polar | 33892256 | | Palmidin B,4TMS,isomer #3 | CC1=CC(O[Si](C)(C)C)=C2C(=O)C3=C(O[Si](C)(C)C)C=CC=C3C(C3C4=CC=CC(O[Si](C)(C)C)=C4C(=O)C4=C(O[Si](C)(C)C)C=C(CO)C=C43)C2=C1 | 4214.5 | Semi standard non polar | 33892256 | | Palmidin B,4TMS,isomer #4 | CC1=CC(O[Si](C)(C)C)=C2C(=O)C3=C(O[Si](C)(C)C)C=CC=C3C(C3C4=CC=CC(O)=C4C(=O)C4=C(O[Si](C)(C)C)C=C(CO[Si](C)(C)C)C=C43)C2=C1 | 4157.6 | Semi standard non polar | 33892256 | | Palmidin B,4TMS,isomer #5 | CC1=CC(O)=C2C(=O)C3=C(O[Si](C)(C)C)C=CC=C3C(C3C4=CC=CC(O[Si](C)(C)C)=C4C(=O)C4=C(O[Si](C)(C)C)C=C(CO[Si](C)(C)C)C=C43)C2=C1 | 4220.1 | Semi standard non polar | 33892256 | | Palmidin B,5TMS,isomer #1 | CC1=CC(O[Si](C)(C)C)=C2C(=O)C3=C(O[Si](C)(C)C)C=CC=C3C(C3C4=CC=CC(O[Si](C)(C)C)=C4C(=O)C4=C(O[Si](C)(C)C)C=C(CO[Si](C)(C)C)C=C43)C2=C1 | 4161.0 | Semi standard non polar | 33892256 | | Palmidin B,1TBDMS,isomer #1 | CC1=CC(O[Si](C)(C)C(C)(C)C)=C2C(=O)C3=C(O)C=CC=C3C(C3C4=CC=CC(O)=C4C(=O)C4=C(O)C=C(CO)C=C43)C2=C1 | 4602.8 | Semi standard non polar | 33892256 | | Palmidin B,1TBDMS,isomer #2 | CC1=CC(O)=C2C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=CC=C3C(C3C4=CC=CC(O)=C4C(=O)C4=C(O)C=C(CO)C=C43)C2=C1 | 4659.4 | Semi standard non polar | 33892256 | | Palmidin B,1TBDMS,isomer #3 | CC1=CC(O)=C2C(=O)C3=C(O)C=CC=C3C(C3C4=CC(CO)=CC(O)=C4C(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=CC=C43)C2=C1 | 4661.9 | Semi standard non polar | 33892256 | | Palmidin B,1TBDMS,isomer #4 | CC1=CC(O)=C2C(=O)C3=C(O)C=CC=C3C(C3C4=CC=CC(O)=C4C(=O)C4=C(O)C=C(CO[Si](C)(C)C(C)(C)C)C=C43)C2=C1 | 4602.6 | Semi standard non polar | 33892256 | | Palmidin B,1TBDMS,isomer #5 | CC1=CC(O)=C2C(=O)C3=C(O)C=CC=C3C(C3C4=CC=CC(O)=C4C(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=C(CO)C=C43)C2=C1 | 4596.5 | Semi standard non polar | 33892256 | | Palmidin B,2TBDMS,isomer #1 | CC1=CC(O[Si](C)(C)C(C)(C)C)=C2C(=O)C3=C(O)C=CC=C3C(C3C4=CC(CO)=CC(O)=C4C(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=CC=C43)C2=C1 | 4717.7 | Semi standard non polar | 33892256 | | Palmidin B,2TBDMS,isomer #10 | CC1=CC(O)=C2C(=O)C3=C(O)C=CC=C3C(C3C4=CC=CC(O)=C4C(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=C(CO[Si](C)(C)C(C)(C)C)C=C43)C2=C1 | 4664.3 | Semi standard non polar | 33892256 | | Palmidin B,2TBDMS,isomer #2 | CC1=CC(O[Si](C)(C)C(C)(C)C)=C2C(=O)C3=C(O)C=CC=C3C(C3C4=CC=CC(O)=C4C(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=C(CO)C=C43)C2=C1 | 4642.2 | Semi standard non polar | 33892256 | | Palmidin B,2TBDMS,isomer #3 | CC1=CC(O[Si](C)(C)C(C)(C)C)=C2C(=O)C3=C(O)C=CC=C3C(C3C4=CC=CC(O)=C4C(=O)C4=C(O)C=C(CO[Si](C)(C)C(C)(C)C)C=C43)C2=C1 | 4666.7 | Semi standard non polar | 33892256 | | Palmidin B,2TBDMS,isomer #4 | CC1=CC(O[Si](C)(C)C(C)(C)C)=C2C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=CC=C3C(C3C4=CC=CC(O)=C4C(=O)C4=C(O)C=C(CO)C=C43)C2=C1 | 4764.5 | Semi standard non polar | 33892256 | | Palmidin B,2TBDMS,isomer #5 | CC1=CC(O)=C2C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=CC=C3C(C3C4=CC(CO)=CC(O)=C4C(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=CC=C43)C2=C1 | 4780.5 | Semi standard non polar | 33892256 | | Palmidin B,2TBDMS,isomer #6 | CC1=CC(O)=C2C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=CC=C3C(C3C4=CC=CC(O)=C4C(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=C(CO)C=C43)C2=C1 | 4710.3 | Semi standard non polar | 33892256 | | Palmidin B,2TBDMS,isomer #7 | CC1=CC(O)=C2C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=CC=C3C(C3C4=CC=CC(O)=C4C(=O)C4=C(O)C=C(CO[Si](C)(C)C(C)(C)C)C=C43)C2=C1 | 4730.1 | Semi standard non polar | 33892256 | | Palmidin B,2TBDMS,isomer #8 | CC1=CC(O)=C2C(=O)C3=C(O)C=CC=C3C(C3C4=CC(CO[Si](C)(C)C(C)(C)C)=CC(O)=C4C(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=CC=C43)C2=C1 | 4731.8 | Semi standard non polar | 33892256 | | Palmidin B,2TBDMS,isomer #9 | CC1=CC(O)=C2C(=O)C3=C(O)C=CC=C3C(C3C4=CC=CC(O[Si](C)(C)C(C)(C)C)=C4C(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=C(CO)C=C43)C2=C1 | 4761.9 | Semi standard non polar | 33892256 | | Palmidin B,3TBDMS,isomer #1 | CC1=CC(O[Si](C)(C)C(C)(C)C)=C2C(=O)C3=C(O)C=CC=C3C(C3C4=CC(CO[Si](C)(C)C(C)(C)C)=CC(O)=C4C(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=CC=C43)C2=C1 | 4755.6 | Semi standard non polar | 33892256 | | Palmidin B,3TBDMS,isomer #10 | CC1=CC(O)=C2C(=O)C3=C(O)C=CC=C3C(C3C4=CC=CC(O[Si](C)(C)C(C)(C)C)=C4C(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=C(CO[Si](C)(C)C(C)(C)C)C=C43)C2=C1 | 4796.6 | Semi standard non polar | 33892256 | | Palmidin B,3TBDMS,isomer #2 | CC1=CC(O[Si](C)(C)C(C)(C)C)=C2C(=O)C3=C(O)C=CC=C3C(C3C4=CC=CC(O[Si](C)(C)C(C)(C)C)=C4C(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=C(CO)C=C43)C2=C1 | 4768.4 | Semi standard non polar | 33892256 | | Palmidin B,3TBDMS,isomer #3 | CC1=CC(O[Si](C)(C)C(C)(C)C)=C2C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=CC=C3C(C3C4=CC(CO)=CC(O)=C4C(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=CC=C43)C2=C1 | 4824.6 | Semi standard non polar | 33892256 | | Palmidin B,3TBDMS,isomer #4 | CC1=CC(O[Si](C)(C)C(C)(C)C)=C2C(=O)C3=C(O)C=CC=C3C(C3C4=CC=CC(O)=C4C(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=C(CO[Si](C)(C)C(C)(C)C)C=C43)C2=C1 | 4699.4 | Semi standard non polar | 33892256 | | Palmidin B,3TBDMS,isomer #5 | CC1=CC(O[Si](C)(C)C(C)(C)C)=C2C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=CC=C3C(C3C4=CC=CC(O)=C4C(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=C(CO)C=C43)C2=C1 | 4760.7 | Semi standard non polar | 33892256 | | Palmidin B,3TBDMS,isomer #6 | CC1=CC(O[Si](C)(C)C(C)(C)C)=C2C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=CC=C3C(C3C4=CC=CC(O)=C4C(=O)C4=C(O)C=C(CO[Si](C)(C)C(C)(C)C)C=C43)C2=C1 | 4798.4 | Semi standard non polar | 33892256 | | Palmidin B,3TBDMS,isomer #7 | CC1=CC(O)=C2C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=CC=C3C(C3C4=CC(CO[Si](C)(C)C(C)(C)C)=CC(O)=C4C(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=CC=C43)C2=C1 | 4811.5 | Semi standard non polar | 33892256 | | Palmidin B,3TBDMS,isomer #8 | CC1=CC(O)=C2C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=CC=C3C(C3C4=CC=CC(O[Si](C)(C)C(C)(C)C)=C4C(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=C(CO)C=C43)C2=C1 | 4829.4 | Semi standard non polar | 33892256 | | Palmidin B,3TBDMS,isomer #9 | CC1=CC(O)=C2C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=CC=C3C(C3C4=CC=CC(O)=C4C(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=C(CO[Si](C)(C)C(C)(C)C)C=C43)C2=C1 | 4753.2 | Semi standard non polar | 33892256 |
|
|---|
| GC-MS Spectra| Spectrum Type | Description | Splash Key | Deposition Date | Source | View |
|---|
| Predicted GC-MS | Predicted GC-MS Spectrum - Palmidin B GC-MS (Non-derivatized) - 70eV, Positive | splash10-03y0-0240900000-3ef5e032eb2ae8a244b2 | 2017-09-01 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Palmidin B GC-MS (2 TMS) - 70eV, Positive | splash10-00di-1111029000-a86ed7a83bc2941feea0 | 2017-10-06 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Palmidin B GC-MS (Non-derivatized) - 70eV, Positive | Not Available | 2021-10-12 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Palmidin B GC-MS (Non-derivatized) - 70eV, Positive | Not Available | 2021-10-12 | Wishart Lab | View Spectrum |
MS/MS Spectra| Spectrum Type | Description | Splash Key | Deposition Date | Source | View |
|---|
| Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Palmidin B 10V, Positive-QTOF | splash10-004j-0000900000-92006d8647725337d3bb | 2016-08-01 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Palmidin B 20V, Positive-QTOF | splash10-004i-0231900000-3d1439348ad8442c9f09 | 2016-08-01 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Palmidin B 40V, Positive-QTOF | splash10-06fr-0785900000-88760bc5f36f5f0e134b | 2016-08-01 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Palmidin B 10V, Negative-QTOF | splash10-0006-0000900000-c53c43d1e7b21abe8e67 | 2016-08-03 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Palmidin B 20V, Negative-QTOF | splash10-01r6-0000900000-0cff28335db17e039858 | 2016-08-03 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Palmidin B 40V, Negative-QTOF | splash10-01rg-1136900000-f1b481feabf76480aa81 | 2016-08-03 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Palmidin B 10V, Positive-QTOF | splash10-0002-0000900000-49c39a353574943f4a85 | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Palmidin B 20V, Positive-QTOF | splash10-002b-0000900000-ca695a36108a775533c2 | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Palmidin B 40V, Positive-QTOF | splash10-0gds-0132900000-81965cb217a0b6ac7966 | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Palmidin B 10V, Negative-QTOF | splash10-0006-0000900000-7c8023388dce204d5cc3 | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Palmidin B 20V, Negative-QTOF | splash10-002f-0000900000-e372e964ceddcf13695a | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Palmidin B 40V, Negative-QTOF | splash10-002b-0000900000-242129b31ad0d0f9a82e | 2021-09-25 | Wishart Lab | View Spectrum |
|
|---|