You are using an unsupported browser. Please upgrade your browser to a newer version to get the best experience on Human Metabolome Database.

Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2012-09-11 19:10:54 UTC

Update Date

2022-03-07 02:54:04 UTC

HMDB ID

HMDB0034358

Secondary Accession Numbers

HMDB34358

Metabolite Identification

Common Name

Myricetin 3-galactoside

Description

Myricetin 3-galactoside belongs to the class of organic compounds known as flavonoid-3-o-glycosides. These are phenolic compounds containing a flavonoid moiety which is O-glycosidically linked to carbohydrate moiety at the C3-position. Myricetin 3-galactoside has been detected, but not quantified in, several different foods, such as herbal tea, allspices (Pimenta dioica), green tea, black tea, and red tea. This could make myricetin 3-galactoside a potential biomarker for the consumption of these foods. Myricetin 3-galactoside is a secondary metabolite. Secondary metabolites are metabolically or physiologically non-essential metabolites that may serve a role as defense or signalling molecules. In some cases they are simply molecules that arise from the incomplete metabolism of other secondary metabolites. Based on a literature review a significant number of articles have been published on Myricetin 3-galactoside.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI


  Mrv1652310251819542D          

 34 37  0  0  1  0            999 V2000
    5.1908   -5.2687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1908   -6.0937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9053   -4.8562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4764   -4.8562    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4764   -6.5062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9053   -6.5062    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9053   -4.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6198   -5.2687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7619   -5.2687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7619   -6.0937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4764   -7.3312    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9053   -7.3312    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
    6.6198   -3.6187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3343   -4.8562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0474   -4.8562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0474   -6.5062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6198   -7.7437    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
    5.1908   -7.7437    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3343   -4.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6198   -2.7937    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0487   -5.2687    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3330   -5.2687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3330   -6.0937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0474   -7.3312    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6198   -8.5687    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
    7.3343   -7.3312    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1908   -8.5687    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
    8.0487   -3.6187    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6185   -4.8562    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9053   -8.9812    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
    7.3343   -8.9812    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4764   -8.9812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9053   -9.8062    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7619   -8.5687    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0  0  0  0
  1  3  1  0  0  0  0
  1  4  1  0  0  0  0
  2  5  1  0  0  0  0
  2  6  1  0  0  0  0
  3  7  1  0  0  0  0
  3  8  2  0  0  0  0
  4  9  1  0  0  0  0
  5 10  1  0  0  0  0
  5 11  2  0  0  0  0
 12  6  1  1  0  0  0
  7 13  2  0  0  0  0
  8 14  1  0  0  0  0
  9 10  1  0  0  0  0
  9 15  2  0  0  0  0
 10 16  2  0  0  0  0
 12 17  1  0  0  0  0
 12 18  1  0  0  0  0
 13 19  1  0  0  0  0
 13 20  1  0  0  0  0
 14 19  2  0  0  0  0
 14 21  1  0  0  0  0
 15 22  1  0  0  0  0
 16 23  1  0  0  0  0
 16 24  1  0  0  0  0
 17 25  1  0  0  0  0
 17 26  1  6  0  0  0
 18 27  1  0  0  0  0
 19 28  1  0  0  0  0
 22 23  2  0  0  0  0
 22 29  1  0  0  0  0
 25 30  1  0  0  0  0
 25 31  1  1  0  0  0
 27 30  1  0  0  0  0
 27 32  1  1  0  0  0
 30 33  1  1  0  0  0
 32 34  1  0  0  0  0
M  END

HMDB0034358
     RDKit          3D
Myricetin 3-galactoside
 54 57  0  0  0  0  0  0  0  0999 V2000
    0.2029    3.2026   -0.0071 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8195    2.4773   -0.0755 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7519    1.1325    0.3454 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5094    0.7532    0.7966 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5137    0.3159   -0.1409 C   0  0  2  0  0  0  0  0  0  0  0  0
    1.9282   -0.9353    0.2047 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8942   -1.4737   -0.6201 C   0  0  2  0  0  0  0  0  0  0  0  0
    3.3314   -2.7960   -0.0137 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8392   -2.5027    1.2566 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0677   -0.5469   -0.8280 C   0  0  2  0  0  0  0  0  0  0  0  0
    5.2223   -1.2469   -0.4791 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9941    0.6563    0.0871 C   0  0  2  0  0  0  0  0  0  0  0  0
    4.1794    0.2631    1.4113 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6476    1.3266   -0.1212 C   0  0  1  0  0  0  0  0  0  0  0  0
    2.6692    1.9607   -1.3592 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7855    0.2883    0.3150 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7366   -1.0968    0.7515 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7991   -1.9002    0.3119 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9638   -3.2161    0.6632 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0492   -3.9768    0.1930 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0192   -3.7799    1.5040 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1688   -5.1156    1.8717 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9697   -3.0087    1.9469 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0539   -3.6105    2.7814 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8258   -1.6662    1.5730 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9379    0.7837   -0.1561 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0709    2.0176   -0.5645 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3005    2.4301   -1.0321 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4658    3.7227   -1.4668 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7218    4.1422   -1.9438 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4386    4.6216   -1.4498 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1599    4.2460   -0.9796 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1568    5.1673   -0.9761 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0326    2.9247   -0.5470 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0228    0.3635   -1.1412 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4503   -1.6794   -1.6135 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4186   -3.4056    0.1525 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0390   -3.3453   -0.6411 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7080   -3.2563    1.8954 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.1730   -0.2394   -1.8812 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.6442   -1.6960   -1.2530 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7987    1.3505   -0.1737 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.1369    0.2859    1.6753 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5695    2.0702    0.6817 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1325    2.8409   -1.3086 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5601   -1.4745   -0.3578 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7000   -3.5022   -0.4167 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9393   -5.6649    1.5394 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.7261   -3.0667    3.1213 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0177   -1.0848    1.9557 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1096    1.7128   -1.0428 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4863    3.4870   -1.9603 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5321    5.6494   -1.7849 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2458    5.0945   -0.6996 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  7 10  1  0
 10 11  1  0
 10 12  1  0
 12 13  1  0
 12 14  1  0
 14 15  1  0
  3 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  1  0
 19 21  2  0
 21 22  1  0
 21 23  1  0
 23 24  1  0
 23 25  2  0
 16 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  1  0
 29 31  2  0
 31 32  1  0
 32 33  1  0
 32 34  2  0
 34  2  1  0
 14  5  1  0
 25 17  1  0
 34 27  1  0
  5 35  1  6
  7 36  1  6
  8 37  1  0
  8 38  1  0
  9 39  1  0
 10 40  1  6
 11 41  1  0
 12 42  1  6
 13 43  1  0
 14 44  1  1
 15 45  1  0
 18 46  1  0
 20 47  1  0
 22 48  1  0
 24 49  1  0
 25 50  1  0
 28 51  1  0
 30 52  1  0
 31 53  1  0
 33 54  1  0
M  END


  Mrv1652310251819542D          

 34 37  0  0  1  0            999 V2000
    5.1908   -5.2687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1908   -6.0937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9053   -4.8562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4764   -4.8562    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4764   -6.5062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9053   -6.5062    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9053   -4.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6198   -5.2687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7619   -5.2687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7619   -6.0937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4764   -7.3312    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9053   -7.3312    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
    6.6198   -3.6187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3343   -4.8562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0474   -4.8562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0474   -6.5062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6198   -7.7437    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
    5.1908   -7.7437    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3343   -4.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6198   -2.7937    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0487   -5.2687    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3330   -5.2687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3330   -6.0937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0474   -7.3312    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6198   -8.5687    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
    7.3343   -7.3312    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1908   -8.5687    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
    8.0487   -3.6187    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6185   -4.8562    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9053   -8.9812    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
    7.3343   -8.9812    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4764   -8.9812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9053   -9.8062    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7619   -8.5687    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0  0  0  0
  1  3  1  0  0  0  0
  1  4  1  0  0  0  0
  2  5  1  0  0  0  0
  2  6  1  0  0  0  0
  3  7  1  0  0  0  0
  3  8  2  0  0  0  0
  4  9  1  0  0  0  0
  5 10  1  0  0  0  0
  5 11  2  0  0  0  0
 12  6  1  1  0  0  0
  7 13  2  0  0  0  0
  8 14  1  0  0  0  0
  9 10  1  0  0  0  0
  9 15  2  0  0  0  0
 10 16  2  0  0  0  0
 12 17  1  0  0  0  0
 12 18  1  0  0  0  0
 13 19  1  0  0  0  0
 13 20  1  0  0  0  0
 14 19  2  0  0  0  0
 14 21  1  0  0  0  0
 15 22  1  0  0  0  0
 16 23  1  0  0  0  0
 16 24  1  0  0  0  0
 17 25  1  0  0  0  0
 17 26  1  6  0  0  0
 18 27  1  0  0  0  0
 19 28  1  0  0  0  0
 22 23  2  0  0  0  0
 22 29  1  0  0  0  0
 25 30  1  0  0  0  0
 25 31  1  1  0  0  0
 27 30  1  0  0  0  0
 27 32  1  1  0  0  0
 30 33  1  1  0  0  0
 32 34  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0034358

> <DATABASE_NAME>
hmdb

> <SMILES>
OC[C@H]1O[C@@H](OC2=C(OC3=CC(O)=CC(O)=C3C2=O)C2=CC(O)=C(O)C(O)=C2)[C@H](O)[C@@H](O)[C@H]1O

> <INCHI_IDENTIFIER>
InChI=1S/C21H20O13/c22-5-12-15(28)17(30)18(31)21(33-12)34-20-16(29)13-8(24)3-7(23)4-11(13)32-19(20)6-1-9(25)14(27)10(26)2-6/h1-4,12,15,17-18,21-28,30-31H,5H2/t12-,15+,17+,18-,21+/m1/s1

> <INCHI_KEY>
FOHXFLPXBUAOJM-MGMURXEASA-N

> <FORMULA>
C21H20O13

> <MOLECULAR_WEIGHT>
480.3757

> <EXACT_MASS>
480.090390726

> <JCHEM_ACCEPTOR_COUNT>
13

> <JCHEM_ATOM_COUNT>
54

> <JCHEM_AVERAGE_POLARIZABILITY>
44.22427537673804

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
9

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
5,7-dihydroxy-3-{[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-2-(3,4,5-trihydroxyphenyl)-4H-chromen-4-one

> <ALOGPS_LOGP>
0.49

> <JCHEM_LOGP>
-0.44840061766666717

> <ALOGPS_LOGS>
-2.32

> <JCHEM_MDDR_LIKE_RULE>
0

> <JCHEM_NUMBER_OF_RINGS>
4

> <JCHEM_PHYSIOLOGICAL_CHARGE>
-1

> <JCHEM_PKA>
7.7412577353435

> <JCHEM_PKA_STRONGEST_ACIDIC>
6.367302414620619

> <JCHEM_PKA_STRONGEST_BASIC>
-3.648395395250552

> <JCHEM_POLAR_SURFACE_AREA>
226.82999999999996

> <JCHEM_REFRACTIVITY>
111.25639999999999

> <JCHEM_ROTATABLE_BOND_COUNT>
4

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
2.31e+00 g/l

> <JCHEM_TRADITIONAL_IUPAC>
5,7-dihydroxy-3-{[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-2-(3,4,5-trihydroxyphenyl)chromen-4-one

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0034358
     RDKit          3D
Myricetin 3-galactoside
 54 57  0  0  0  0  0  0  0  0999 V2000
    0.2029    3.2026   -0.0071 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8195    2.4773   -0.0755 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7519    1.1325    0.3454 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5094    0.7532    0.7966 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5137    0.3159   -0.1409 C   0  0  2  0  0  0  0  0  0  0  0  0
    1.9282   -0.9353    0.2047 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8942   -1.4737   -0.6201 C   0  0  2  0  0  0  0  0  0  0  0  0
    3.3314   -2.7960   -0.0137 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8392   -2.5027    1.2566 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0677   -0.5469   -0.8280 C   0  0  2  0  0  0  0  0  0  0  0  0
    5.2223   -1.2469   -0.4791 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9941    0.6563    0.0871 C   0  0  2  0  0  0  0  0  0  0  0  0
    4.1794    0.2631    1.4113 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6476    1.3266   -0.1212 C   0  0  1  0  0  0  0  0  0  0  0  0
    2.6692    1.9607   -1.3592 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7855    0.2883    0.3150 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7366   -1.0968    0.7515 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7991   -1.9002    0.3119 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9638   -3.2161    0.6632 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0492   -3.9768    0.1930 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0192   -3.7799    1.5040 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1688   -5.1156    1.8717 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9697   -3.0087    1.9469 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0539   -3.6105    2.7814 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8258   -1.6662    1.5730 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9379    0.7837   -0.1561 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0709    2.0176   -0.5645 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3005    2.4301   -1.0321 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4658    3.7227   -1.4668 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7218    4.1422   -1.9438 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4386    4.6216   -1.4498 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1599    4.2460   -0.9796 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1568    5.1673   -0.9761 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0326    2.9247   -0.5470 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0228    0.3635   -1.1412 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4503   -1.6794   -1.6135 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4186   -3.4056    0.1525 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0390   -3.3453   -0.6411 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7080   -3.2563    1.8954 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.1730   -0.2394   -1.8812 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.6442   -1.6960   -1.2530 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7987    1.3505   -0.1737 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.1369    0.2859    1.6753 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5695    2.0702    0.6817 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1325    2.8409   -1.3086 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5601   -1.4745   -0.3578 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7000   -3.5022   -0.4167 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9393   -5.6649    1.5394 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.7261   -3.0667    3.1213 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0177   -1.0848    1.9557 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1096    1.7128   -1.0428 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4863    3.4870   -1.9603 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5321    5.6494   -1.7849 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2458    5.0945   -0.6996 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  7 10  1  0
 10 11  1  0
 10 12  1  0
 12 13  1  0
 12 14  1  0
 14 15  1  0
  3 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  1  0
 19 21  2  0
 21 22  1  0
 21 23  1  0
 23 24  1  0
 23 25  2  0
 16 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  1  0
 29 31  2  0
 31 32  1  0
 32 33  1  0
 32 34  2  0
 34  2  1  0
 14  5  1  0
 25 17  1  0
 34 27  1  0
  5 35  1  6
  7 36  1  6
  8 37  1  0
  8 38  1  0
  9 39  1  0
 10 40  1  6
 11 41  1  0
 12 42  1  6
 13 43  1  0
 14 44  1  1
 15 45  1  0
 18 46  1  0
 20 47  1  0
 22 48  1  0
 24 49  1  0
 25 50  1  0
 28 51  1  0
 30 52  1  0
 31 53  1  0
 33 54  1  0
M  END

HEADER    PROTEIN                                 25-OCT-18   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   25-OCT-18         0                                  
HETATM    1  C   UNK     0       9.689  -9.835   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0       9.689 -11.375   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0      11.023  -9.065   0.000  0.00  0.00           C+0
HETATM    4  O   UNK     0       8.356  -9.065   0.000  0.00  0.00           O+0
HETATM    5  C   UNK     0       8.356 -12.145   0.000  0.00  0.00           C+0
HETATM    6  O   UNK     0      11.023 -12.145   0.000  0.00  0.00           O+0
HETATM    7  C   UNK     0      11.023  -7.525   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0      12.357  -9.835   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0       7.022  -9.835   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0       7.022 -11.375   0.000  0.00  0.00           C+0
HETATM   11  O   UNK     0       8.356 -13.685   0.000  0.00  0.00           O+0
HETATM   12  C   UNK     0      11.023 -13.685   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0      12.357  -6.755   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0      13.691  -9.065   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0       5.688  -9.065   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0       5.688 -12.145   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0      12.357 -14.455   0.000  0.00  0.00           C+0
HETATM   18  O   UNK     0       9.689 -14.455   0.000  0.00  0.00           O+0
HETATM   19  C   UNK     0      13.691  -7.525   0.000  0.00  0.00           C+0
HETATM   20  O   UNK     0      12.357  -5.215   0.000  0.00  0.00           O+0
HETATM   21  O   UNK     0      15.024  -9.835   0.000  0.00  0.00           O+0
HETATM   22  C   UNK     0       4.355  -9.835   0.000  0.00  0.00           C+0
HETATM   23  C   UNK     0       4.355 -11.375   0.000  0.00  0.00           C+0
HETATM   24  O   UNK     0       5.688 -13.685   0.000  0.00  0.00           O+0
HETATM   25  C   UNK     0      12.357 -15.995   0.000  0.00  0.00           C+0
HETATM   26  O   UNK     0      13.691 -13.685   0.000  0.00  0.00           O+0
HETATM   27  C   UNK     0       9.689 -15.995   0.000  0.00  0.00           C+0
HETATM   28  O   UNK     0      15.024  -6.755   0.000  0.00  0.00           O+0
HETATM   29  O   UNK     0       3.021  -9.065   0.000  0.00  0.00           O+0
HETATM   30  C   UNK     0      11.023 -16.765   0.000  0.00  0.00           C+0
HETATM   31  O   UNK     0      13.691 -16.765   0.000  0.00  0.00           O+0
HETATM   32  C   UNK     0       8.356 -16.765   0.000  0.00  0.00           C+0
HETATM   33  O   UNK     0      11.023 -18.305   0.000  0.00  0.00           O+0
HETATM   34  O   UNK     0       7.022 -15.995   0.000  0.00  0.00           O+0
CONECT    1    2    3    4                                                  
CONECT    2    1    5    6                                                  
CONECT    3    1    7    8                                                  
CONECT    4    1    9                                                       
CONECT    5    2   10   11                                                  
CONECT    6    2   12                                                       
CONECT    7    3   13                                                       
CONECT    8    3   14                                                       
CONECT    9    4   10   15                                                  
CONECT   10    5    9   16                                                  
CONECT   11    5                                                            
CONECT   12    6   17   18                                                  
CONECT   13    7   19   20                                                  
CONECT   14    8   19   21                                                  
CONECT   15    9   22                                                       
CONECT   16   10   23   24                                                  
CONECT   17   12   25   26                                                  
CONECT   18   12   27                                                       
CONECT   19   13   14   28                                                  
CONECT   20   13                                                            
CONECT   21   14                                                            
CONECT   22   15   23   29                                                  
CONECT   23   16   22                                                       
CONECT   24   16                                                            
CONECT   25   17   30   31                                                  
CONECT   26   17                                                            
CONECT   27   18   30   32                                                  
CONECT   28   19                                                            
CONECT   29   22                                                            
CONECT   30   25   27   33                                                  
CONECT   31   25                                                            
CONECT   32   27   34                                                       
CONECT   33   30                                                            
CONECT   34   32                                                            
MASTER        0    0    0    0    0    0    0    0   34    0   74    0
END

COMPND    HMDB0034358
HETATM    1  O1  UNL     1       0.203   3.203  -0.007  1.00  0.00           O  
HETATM    2  C1  UNL     1      -0.820   2.477  -0.076  1.00  0.00           C  
HETATM    3  C2  UNL     1      -0.752   1.133   0.345  1.00  0.00           C  
HETATM    4  O2  UNL     1       0.509   0.753   0.797  1.00  0.00           O  
HETATM    5  C3  UNL     1       1.514   0.316  -0.141  1.00  0.00           C  
HETATM    6  O3  UNL     1       1.928  -0.935   0.205  1.00  0.00           O  
HETATM    7  C4  UNL     1       2.894  -1.474  -0.620  1.00  0.00           C  
HETATM    8  C5  UNL     1       3.331  -2.796  -0.014  1.00  0.00           C  
HETATM    9  O4  UNL     1       3.839  -2.503   1.257  1.00  0.00           O  
HETATM   10  C6  UNL     1       4.068  -0.547  -0.828  1.00  0.00           C  
HETATM   11  O5  UNL     1       5.222  -1.247  -0.479  1.00  0.00           O  
HETATM   12  C7  UNL     1       3.994   0.656   0.087  1.00  0.00           C  
HETATM   13  O6  UNL     1       4.179   0.263   1.411  1.00  0.00           O  
HETATM   14  C8  UNL     1       2.648   1.327  -0.121  1.00  0.00           C  
HETATM   15  O7  UNL     1       2.669   1.961  -1.359  1.00  0.00           O  
HETATM   16  C9  UNL     1      -1.785   0.288   0.315  1.00  0.00           C  
HETATM   17  C10 UNL     1      -1.737  -1.097   0.752  1.00  0.00           C  
HETATM   18  C11 UNL     1      -2.799  -1.900   0.312  1.00  0.00           C  
HETATM   19  C12 UNL     1      -2.964  -3.216   0.663  1.00  0.00           C  
HETATM   20  O8  UNL     1      -4.049  -3.977   0.193  1.00  0.00           O  
HETATM   21  C13 UNL     1      -2.019  -3.780   1.504  1.00  0.00           C  
HETATM   22  O9  UNL     1      -2.169  -5.116   1.872  1.00  0.00           O  
HETATM   23  C14 UNL     1      -0.970  -3.009   1.947  1.00  0.00           C  
HETATM   24  O10 UNL     1      -0.054  -3.610   2.781  1.00  0.00           O  
HETATM   25  C15 UNL     1      -0.826  -1.666   1.573  1.00  0.00           C  
HETATM   26  O11 UNL     1      -2.938   0.784  -0.156  1.00  0.00           O  
HETATM   27  C16 UNL     1      -3.071   2.018  -0.564  1.00  0.00           C  
HETATM   28  C17 UNL     1      -4.300   2.430  -1.032  1.00  0.00           C  
HETATM   29  C18 UNL     1      -4.466   3.723  -1.467  1.00  0.00           C  
HETATM   30  O12 UNL     1      -5.722   4.142  -1.944  1.00  0.00           O  
HETATM   31  C19 UNL     1      -3.439   4.622  -1.450  1.00  0.00           C  
HETATM   32  C20 UNL     1      -2.160   4.246  -0.980  1.00  0.00           C  
HETATM   33  O13 UNL     1      -1.157   5.167  -0.976  1.00  0.00           O  
HETATM   34  C21 UNL     1      -2.033   2.925  -0.547  1.00  0.00           C  
HETATM   35  H1  UNL     1       1.023   0.364  -1.141  1.00  0.00           H  
HETATM   36  H2  UNL     1       2.450  -1.679  -1.613  1.00  0.00           H  
HETATM   37  H3  UNL     1       2.419  -3.406   0.152  1.00  0.00           H  
HETATM   38  H4  UNL     1       4.039  -3.345  -0.641  1.00  0.00           H  
HETATM   39  H5  UNL     1       3.708  -3.256   1.895  1.00  0.00           H  
HETATM   40  H6  UNL     1       4.173  -0.239  -1.881  1.00  0.00           H  
HETATM   41  H7  UNL     1       5.644  -1.696  -1.253  1.00  0.00           H  
HETATM   42  H8  UNL     1       4.799   1.351  -0.174  1.00  0.00           H  
HETATM   43  H9  UNL     1       5.137   0.286   1.675  1.00  0.00           H  
HETATM   44  H10 UNL     1       2.569   2.070   0.682  1.00  0.00           H  
HETATM   45  H11 UNL     1       3.132   2.841  -1.309  1.00  0.00           H  
HETATM   46  H12 UNL     1      -3.560  -1.475  -0.358  1.00  0.00           H  
HETATM   47  H13 UNL     1      -4.700  -3.502  -0.417  1.00  0.00           H  
HETATM   48  H14 UNL     1      -2.939  -5.665   1.539  1.00  0.00           H  
HETATM   49  H15 UNL     1       0.726  -3.067   3.121  1.00  0.00           H  
HETATM   50  H16 UNL     1      -0.018  -1.085   1.956  1.00  0.00           H  
HETATM   51  H17 UNL     1      -5.110   1.713  -1.043  1.00  0.00           H  
HETATM   52  H18 UNL     1      -6.486   3.487  -1.960  1.00  0.00           H  
HETATM   53  H19 UNL     1      -3.532   5.649  -1.785  1.00  0.00           H  
HETATM   54  H20 UNL     1      -0.246   5.095  -0.700  1.00  0.00           H  
CONECT    1    2    2
CONECT    2    3   34
CONECT    3    4   16   16
CONECT    4    5
CONECT    5    6   14   35
CONECT    6    7
CONECT    7    8   10   36
CONECT    8    9   37   38
CONECT    9   39
CONECT   10   11   12   40
CONECT   11   41
CONECT   12   13   14   42
CONECT   13   43
CONECT   14   15   44
CONECT   15   45
CONECT   16   17   26
CONECT   17   18   18   25
CONECT   18   19   46
CONECT   19   20   21   21
CONECT   20   47
CONECT   21   22   23
CONECT   22   48
CONECT   23   24   25   25
CONECT   24   49
CONECT   25   50
CONECT   26   27
CONECT   27   28   28   34
CONECT   28   29   51
CONECT   29   30   31   31
CONECT   30   52
CONECT   31   32   53
CONECT   32   33   34   34
CONECT   33   54
END

HMDB0034358
     RDKit          3D
Myricetin 3-galactoside
 54 57  0  0  0  0  0  0  0  0999 V2000
    0.2029    3.2026   -0.0071 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8195    2.4773   -0.0755 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7519    1.1325    0.3454 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5094    0.7532    0.7966 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5137    0.3159   -0.1409 C   0  0  2  0  0  0  0  0  0  0  0  0
    1.9282   -0.9353    0.2047 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8942   -1.4737   -0.6201 C   0  0  2  0  0  0  0  0  0  0  0  0
    3.3314   -2.7960   -0.0137 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8392   -2.5027    1.2566 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0677   -0.5469   -0.8280 C   0  0  2  0  0  0  0  0  0  0  0  0
    5.2223   -1.2469   -0.4791 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9941    0.6563    0.0871 C   0  0  2  0  0  0  0  0  0  0  0  0
    4.1794    0.2631    1.4113 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6476    1.3266   -0.1212 C   0  0  1  0  0  0  0  0  0  0  0  0
    2.6692    1.9607   -1.3592 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7855    0.2883    0.3150 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7366   -1.0968    0.7515 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7991   -1.9002    0.3119 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9638   -3.2161    0.6632 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0492   -3.9768    0.1930 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0192   -3.7799    1.5040 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1688   -5.1156    1.8717 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9697   -3.0087    1.9469 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0539   -3.6105    2.7814 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8258   -1.6662    1.5730 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9379    0.7837   -0.1561 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0709    2.0176   -0.5645 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3005    2.4301   -1.0321 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4658    3.7227   -1.4668 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7218    4.1422   -1.9438 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4386    4.6216   -1.4498 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1599    4.2460   -0.9796 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1568    5.1673   -0.9761 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0326    2.9247   -0.5470 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0228    0.3635   -1.1412 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4503   -1.6794   -1.6135 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4186   -3.4056    0.1525 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0390   -3.3453   -0.6411 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7080   -3.2563    1.8954 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.1730   -0.2394   -1.8812 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.6442   -1.6960   -1.2530 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7987    1.3505   -0.1737 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.1369    0.2859    1.6753 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5695    2.0702    0.6817 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1325    2.8409   -1.3086 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5601   -1.4745   -0.3578 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7000   -3.5022   -0.4167 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9393   -5.6649    1.5394 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.7261   -3.0667    3.1213 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0177   -1.0848    1.9557 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1096    1.7128   -1.0428 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4863    3.4870   -1.9603 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5321    5.6494   -1.7849 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2458    5.0945   -0.6996 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  7 10  1  0
 10 11  1  0
 10 12  1  0
 12 13  1  0
 12 14  1  0
 14 15  1  0
  3 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  1  0
 19 21  2  0
 21 22  1  0
 21 23  1  0
 23 24  1  0
 23 25  2  0
 16 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  1  0
 29 31  2  0
 31 32  1  0
 32 33  1  0
 32 34  2  0
 34  2  1  0
 14  5  1  0
 25 17  1  0
 34 27  1  0
  5 35  1  6
  7 36  1  6
  8 37  1  0
  8 38  1  0
  9 39  1  0
 10 40  1  6
 11 41  1  0
 12 42  1  6
 13 43  1  0
 14 44  1  1
 15 45  1  0
 18 46  1  0
 20 47  1  0
 22 48  1  0
 24 49  1  0
 25 50  1  0
 28 51  1  0
 30 52  1  0
 31 53  1  0
 33 54  1  0
M  END

View in JSmol View NMR Assignments View Stereo Labels

Synonyms

Value	Source
Myricetin-3-O-beta-D-galactoside	ChEBI
Myricetin-3-O-b-D-galactoside	Generator
Myricetin-3-O-β-D-galactoside	Generator
Myricetin 3-O-beta-D-galactopyranoside	HMDB
Myricetin 3-O-galactoside	HMDB
Myricetin 3-O-b-D-galactopyranoside	Generator
Myricetin 3-O-β-D-galactopyranoside	Generator
3,3',4',5,5',7-Hexahydroxyflavone 3-β-D-galactopyranoside	PhytoBank
3,3',4',5,5',7-Hexahydroxyflavone 3-beta-D-galactopyranoside	PhytoBank
Myricetin 3-O-galactopyranoside	PhytoBank
Myricetin 3-O-β-D-galactoside	PhytoBank
Myricetin 3-O-β-galactopyranoside	PhytoBank
Myricetin 3-β-D-galactoside	PhytoBank
Myricetin 3-O-beta-D-galactoside	PhytoBank
Myricetin 3-O-beta-galactopyranoside	PhytoBank
Myricetin 3-beta-D-galactoside	PhytoBank
Myricetin 3-galactoside	PhytoBank
Gmelinoside I	PhytoBank

Chemical Formula

C₂₁H₂₀O₁₃

Average Molecular Weight

480.3757

Monoisotopic Molecular Weight

480.090390726

IUPAC Name

5,7-dihydroxy-3-{[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-2-(3,4,5-trihydroxyphenyl)-4H-chromen-4-one

Traditional Name

5,7-dihydroxy-3-{[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-2-(3,4,5-trihydroxyphenyl)chromen-4-one

CAS Registry Number

15648-86-9

SMILES

OC[C@H]1O[C@@H](OC2=C(OC3=C(C(O)=CC(O)=C3)C2=O)C2=CC(O)=C(O)C(O)=C2)[C@H](O)[C@@H](O)[C@H]1O

InChI Identifier

InChI=1S/C21H20O13/c22-5-12-15(28)17(30)18(31)21(33-12)34-20-16(29)13-8(24)3-7(23)4-11(13)32-19(20)6-1-9(25)14(27)10(26)2-6/h1-4,12,15,17-18,21-28,30-31H,5H2/t12-,15+,17+,18-,21+/m1/s1

InChI Key

FOHXFLPXBUAOJM-MGMURXEASA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as flavonoid-3-o-glycosides. These are phenolic compounds containing a flavonoid moiety which is O-glycosidically linked to carbohydrate moiety at the C3-position.

Kingdom

Organic compounds

Super Class

Phenylpropanoids and polyketides

Class

Flavonoids

Sub Class

Flavonoid glycosides

Direct Parent

Flavonoid-3-O-glycosides

Alternative Parents

Substituents

Flavonoid-3-o-glycoside
3'-hydroxyflavonoid
4'-hydroxyflavonoid
5-hydroxyflavonoid
7-hydroxyflavonoid
Flavone
Hydroxyflavonoid
Hexose monosaccharide
Chromone
Glycosyl compound
O-glycosyl compound
Benzopyran
1-benzopyran
Benzenetriol
Pyrogallol derivative
1-hydroxy-4-unsubstituted benzenoid
1-hydroxy-2-unsubstituted benzenoid
Phenol
Pyranone
Oxane
Monocyclic benzene moiety
Pyran
Monosaccharide
Benzenoid
Heteroaromatic compound
Vinylogous acid
Secondary alcohol
Organoheterocyclic compound
Oxacycle
Acetal
Polyol
Organic oxide
Hydrocarbon derivative
Organooxygen compound
Alcohol
Organic oxygen compound
Primary alcohol
Aromatic heteropolycyclic compound

Molecular Framework

Aromatic heteropolycyclic compounds

External Descriptors

monosaccharide derivative (CHEBI:75815 )
beta-D-galactoside (CHEBI:75815 )
glycosyloxyflavone (CHEBI:75815 )
pentahydroxyflavone (CHEBI:75815 )

Ontology

Physiological effect

Not Available

Disposition

Biological location

Cellular substructure

Extracellular (HMDB: HMDB0034358)
Cytoplasm (HMDB: HMDB0034358)

Route of exposure

Enteral

Ingestion (HMDB: HMDB0034358)

Source

Exogenous

Food

Food (HMDB: HMDB0034358)

Vegetable

Fruit vegetable

Eggplant (FooDB: FOOD00174)

Tea

Herb and spice

Spice

Allspice (FooDB: FOOD00287)

Endogenous

Plant

Plant (HMDB: HMDB0034358)

Not Available

Nutrient (HMDB: HMDB0034358)

Physical Properties

State

Solid

Experimental Molecular Properties

Property	Value	Reference
Melting Point	198 - 201 °C	Not Available
Boiling Point	957.80 °C. @ 760.00 mm Hg (est)	The Good Scents Company Information System
Water Solubility	24690 mg/L @ 25 °C (est)	The Good Scents Company Information System
LogP	1.560 (est)	The Good Scents Company Information System

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	2.31 g/L	ALOGPS
logP	0.49	ALOGPS
logP	-0.45	ChemAxon
logS	-2.3	ALOGPS
pKa (Strongest Acidic)	6.37	ChemAxon
pKa (Strongest Basic)	-3.6	ChemAxon
Physiological Charge	-1	ChemAxon
Hydrogen Acceptor Count	13	ChemAxon
Hydrogen Donor Count	9	ChemAxon
Polar Surface Area	226.83 Å²	ChemAxon
Rotatable Bond Count	4	ChemAxon
Refractivity	111.26 m³·mol⁻¹	ChemAxon
Polarizability	44.22 Å³	ChemAxon
Number of Rings	4	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	No	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DeepCCS	[M+H]+	201.85	30932474
DeepCCS	[M-H]-	199.584	30932474
DeepCCS	[M-2H]-	232.838	30932474
DeepCCS	[M+Na]+	207.762	30932474
AllCCS	[M+H]+	207.2	32859911
AllCCS	[M+H-H2O]+	204.9	32859911
AllCCS	[M+NH4]+	209.3	32859911
AllCCS	[M+Na]+	209.8	32859911
AllCCS	[M-H]-	204.4	32859911
AllCCS	[M+Na-2H]-	204.8	32859911
AllCCS	[M+HCOO]-	205.5	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
Myricetin 3-galactoside	OC[C@H]1O[C@@H](OC2=C(OC3=C(C(O)=CC(O)=C3)C2=O)C2=CC(O)=C(O)C(O)=C2)[C@H](O)[C@@H](O)[C@H]1O	6540.1	Standard polar	33892256
Myricetin 3-galactoside	OC[C@H]1O[C@@H](OC2=C(OC3=C(C(O)=CC(O)=C3)C2=O)C2=CC(O)=C(O)C(O)=C2)[C@H](O)[C@@H](O)[C@H]1O	4356.9	Standard non polar	33892256
Myricetin 3-galactoside	OC[C@H]1O[C@@H](OC2=C(OC3=C(C(O)=CC(O)=C3)C2=O)C2=CC(O)=C(O)C(O)=C2)[C@H](O)[C@@H](O)[C@H]1O	4542.2	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
Myricetin 3-galactoside,1TMS,isomer #1	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O	4465.2	Semi standard non polar	33892256
Myricetin 3-galactoside,1TMS,isomer #2	C[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)=C(C1=CC(O)=C(O)C(O)=C1)O2	4525.7	Semi standard non polar	33892256
Myricetin 3-galactoside,1TMS,isomer #3	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)=C(C3=CC(O)=C(O)C(O)=C3)OC2=C1	4586.5	Semi standard non polar	33892256
Myricetin 3-galactoside,1TMS,isomer #4	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O)=C1O	4514.8	Semi standard non polar	33892256
Myricetin 3-galactoside,1TMS,isomer #5	C[Si](C)(C)OC1=C(O)C=C(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1O	4465.0	Semi standard non polar	33892256
Myricetin 3-galactoside,1TMS,isomer #6	C[Si](C)(C)O[C@H]1[C@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)O[C@H](CO)[C@H](O)[C@@H]1O	4523.6	Semi standard non polar	33892256
Myricetin 3-galactoside,1TMS,isomer #7	C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@@H]1O	4519.3	Semi standard non polar	33892256
Myricetin 3-galactoside,1TMS,isomer #8	C[Si](C)(C)O[C@H]1[C@@H](CO)O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O)[C@H]1O	4495.5	Semi standard non polar	33892256
Myricetin 3-galactoside,2TMS,isomer #1	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O	4337.9	Semi standard non polar	33892256
Myricetin 3-galactoside,2TMS,isomer #10	C[Si](C)(C)OC1=C(O)C=C(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)C=C1O	4373.9	Semi standard non polar	33892256
Myricetin 3-galactoside,2TMS,isomer #11	C[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]1O)=C(C1=CC(O)=C(O)C(O)=C1)O2	4375.5	Semi standard non polar	33892256
Myricetin 3-galactoside,2TMS,isomer #12	C[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]1O)=C(C1=CC(O)=C(O)C(O)=C1)O2	4404.4	Semi standard non polar	33892256
Myricetin 3-galactoside,2TMS,isomer #13	C[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O[Si](C)(C)C)=C(C1=CC(O)=C(O)C(O)=C1)O2	4401.5	Semi standard non polar	33892256
Myricetin 3-galactoside,2TMS,isomer #14	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)=C(C3=CC(O)=C(O)C(O)=C3)OC2=C1	4404.0	Semi standard non polar	33892256
Myricetin 3-galactoside,2TMS,isomer #15	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)=C(C3=CC(O)=C(O)C(O)=C3)OC2=C1	4429.7	Semi standard non polar	33892256
Myricetin 3-galactoside,2TMS,isomer #16	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)=C(C3=CC(O)=C(O)C(O)=C3)OC2=C1	4435.9	Semi standard non polar	33892256
Myricetin 3-galactoside,2TMS,isomer #17	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4409.9	Semi standard non polar	33892256
Myricetin 3-galactoside,2TMS,isomer #18	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC2=C1	4379.9	Semi standard non polar	33892256
Myricetin 3-galactoside,2TMS,isomer #19	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O)=C1O	4348.5	Semi standard non polar	33892256
Myricetin 3-galactoside,2TMS,isomer #2	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O	4314.4	Semi standard non polar	33892256
Myricetin 3-galactoside,2TMS,isomer #20	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O)=C1O	4370.4	Semi standard non polar	33892256
Myricetin 3-galactoside,2TMS,isomer #21	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O)=C1O	4374.5	Semi standard non polar	33892256
Myricetin 3-galactoside,2TMS,isomer #22	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O[Si](C)(C)C)=C1O	4384.1	Semi standard non polar	33892256
Myricetin 3-galactoside,2TMS,isomer #23	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O)=C1O[Si](C)(C)C	4338.7	Semi standard non polar	33892256
Myricetin 3-galactoside,2TMS,isomer #24	C[Si](C)(C)OC1=C(O)C=C(C2=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1O	4317.7	Semi standard non polar	33892256
Myricetin 3-galactoside,2TMS,isomer #25	C[Si](C)(C)OC1=C(O)C=C(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1O	4335.5	Semi standard non polar	33892256
Myricetin 3-galactoside,2TMS,isomer #26	C[Si](C)(C)OC1=C(O)C=C(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1O	4350.2	Semi standard non polar	33892256
Myricetin 3-galactoside,2TMS,isomer #27	C[Si](C)(C)O[C@H]1[C@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)O[C@H](CO)[C@H](O[Si](C)(C)C)[C@@H]1O	4390.5	Semi standard non polar	33892256
Myricetin 3-galactoside,2TMS,isomer #28	C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@@H]1O[Si](C)(C)C	4411.5	Semi standard non polar	33892256
Myricetin 3-galactoside,2TMS,isomer #29	C[Si](C)(C)O[C@H]1[C@@H](CO)O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O)[C@H]1O[Si](C)(C)C	4383.4	Semi standard non polar	33892256
Myricetin 3-galactoside,2TMS,isomer #3	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O	4412.7	Semi standard non polar	33892256
Myricetin 3-galactoside,2TMS,isomer #4	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O	4377.7	Semi standard non polar	33892256
Myricetin 3-galactoside,2TMS,isomer #5	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O	4401.2	Semi standard non polar	33892256
Myricetin 3-galactoside,2TMS,isomer #6	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O	4397.2	Semi standard non polar	33892256
Myricetin 3-galactoside,2TMS,isomer #7	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C	4409.9	Semi standard non polar	33892256
Myricetin 3-galactoside,2TMS,isomer #8	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)=C(C3=CC(O)=C(O)C(O)=C3)OC2=C1	4432.5	Semi standard non polar	33892256
Myricetin 3-galactoside,2TMS,isomer #9	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(O)=C1O	4403.7	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #1	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O	4230.0	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #10	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O	4249.6	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #11	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O	4230.5	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #12	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C	4256.1	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #13	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O	4291.8	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #14	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O	4317.3	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #15	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O	4306.4	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #16	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C	4320.6	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #17	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O	4293.7	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #18	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O	4284.7	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #19	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C	4295.8	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #2	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O	4204.0	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #20	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O	4322.5	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #21	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C	4356.2	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #22	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C	4321.7	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #23	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)=C(C3=CC(O)=C(O)C(O)=C3)OC2=C1	4297.8	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #24	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)=C(C3=CC(O)=C(O)C(O)=C3)OC2=C1	4308.2	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #25	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)=C(C3=CC(O)=C(O)C(O)=C3)OC2=C1	4315.5	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #26	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4241.8	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #27	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC2=C1	4244.5	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #28	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(O)=C1O	4236.2	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #29	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(O)=C1O	4251.4	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #3	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O	4251.0	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #30	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(O)=C1O	4257.2	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #31	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(O[Si](C)(C)C)=C1O	4235.0	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #32	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(O)=C1O[Si](C)(C)C	4208.3	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #33	C[Si](C)(C)OC1=C(O)C=C(C2=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)C=C1O	4194.8	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #34	C[Si](C)(C)OC1=C(O)C=C(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)C=C1O	4206.3	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #35	C[Si](C)(C)OC1=C(O)C=C(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)C=C1O	4215.9	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #36	C[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O)=C(C1=CC(O)=C(O)C(O)=C1)O2	4274.4	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #37	C[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C)=C(C1=CC(O)=C(O)C(O)=C1)O2	4279.0	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #38	C[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)=C(C1=CC(O)=C(O)C(O)=C1)O2	4289.6	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #39	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)=C(C3=CC(O)=C(O)C(O)=C3)OC2=C1	4297.4	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #4	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O	4242.3	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #40	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)=C(C3=CC(O)=C(O)C(O)=C3)OC2=C1	4303.9	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #41	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4246.9	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #42	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC2=C1	4196.7	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #43	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)=C(C3=CC(O)=C(O)C(O)=C3)OC2=C1	4318.1	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #44	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4255.1	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #45	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC2=C1	4206.7	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #46	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4271.0	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #47	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC2=C1	4222.4	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #48	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)=C(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4243.9	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #49	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)=C(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	4222.7	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #5	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O	4266.8	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #50	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O)=C1O	4246.8	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #51	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O)=C1O	4250.4	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #52	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O[Si](C)(C)C)=C1O	4224.4	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #53	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O)=C1O[Si](C)(C)C	4195.1	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #54	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O)=C1O	4265.2	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #55	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O[Si](C)(C)C)=C1O	4240.4	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #56	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O)=C1O[Si](C)(C)C	4208.1	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #57	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O[Si](C)(C)C)=C1O	4247.0	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #58	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O)=C1O[Si](C)(C)C	4214.1	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #59	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C	4245.8	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #6	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O	4255.3	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #60	C[Si](C)(C)OC1=C(O)C=C(C2=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1O	4215.5	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #61	C[Si](C)(C)OC1=C(O)C=C(C2=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1O	4223.8	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #62	C[Si](C)(C)OC1=C(O)C=C(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1O	4236.4	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #63	C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)O[C@@H]1CO	4291.7	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #7	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C	4272.7	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #8	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O	4218.3	Semi standard non polar	33892256
Myricetin 3-galactoside,3TMS,isomer #9	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O	4213.4	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #1	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O	4163.4	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #10	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O	4136.9	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #11	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C	4165.3	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #12	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O	4131.1	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #13	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O	4197.8	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #14	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O	4159.8	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #15	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C	4201.9	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #16	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O	4177.8	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #17	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O	4142.3	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #18	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C	4179.7	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #19	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O	4221.9	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #2	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O	4134.1	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #20	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C	4255.3	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #21	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C	4226.3	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #22	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O	4128.2	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #23	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O	4147.4	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #24	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O	4117.4	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #25	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C	4157.6	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #26	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O	4133.2	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #27	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O	4105.4	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #28	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C	4138.8	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #29	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O	4186.4	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #3	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O	4121.6	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #30	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C	4224.5	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #31	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C	4191.6	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #32	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O	4247.2	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #33	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O	4215.4	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #34	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C	4250.0	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #35	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O	4283.3	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #36	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C	4313.7	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #37	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C	4285.6	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #38	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O	4255.9	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #39	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C	4286.1	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #4	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O	4180.6	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #40	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C	4259.4	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #41	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C	4306.6	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #42	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)=C(C3=CC(O)=C(O)C(O)=C3)OC2=C1	4228.6	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #43	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)=C(C3=CC(O)=C(O)C(O)=C3)OC2=C1	4232.9	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #44	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4132.5	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #45	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC2=C1	4136.3	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #46	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)=C(C3=CC(O)=C(O)C(O)=C3)OC2=C1	4246.6	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #47	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4115.2	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #48	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC2=C1	4146.2	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #49	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4135.5	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #5	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O	4145.8	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #50	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC2=C1	4137.8	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #51	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)=C(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4141.4	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #52	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)=C(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	4137.9	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #53	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(O)=C1O	4156.2	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #54	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(O)=C1O	4159.1	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #55	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(O[Si](C)(C)C)=C1O	4120.8	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #56	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(O)=C1O[Si](C)(C)C	4108.3	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #57	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(O)=C1O	4167.7	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #58	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(O[Si](C)(C)C)=C1O	4106.0	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #59	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(O)=C1O[Si](C)(C)C	4096.2	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #6	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C	4183.1	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #60	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(O[Si](C)(C)C)=C1O	4129.6	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #61	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(O)=C1O[Si](C)(C)C	4117.0	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #62	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C	4144.3	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #63	C[Si](C)(C)OC1=C(O)C=C(C2=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)C=C1O	4115.1	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #64	C[Si](C)(C)OC1=C(O)C=C(C2=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)C=C1O	4116.2	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #65	C[Si](C)(C)OC1=C(O)C=C(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)C=C1O	4129.6	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #66	C[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)=C(C1=CC(O)=C(O)C(O)=C1)O2	4246.4	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #67	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)=C(C3=CC(O)=C(O)C(O)=C3)OC2=C1	4281.0	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #68	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4176.8	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #69	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC2=C1	4129.9	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #7	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O	4126.7	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #70	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4180.2	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #71	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC2=C1	4133.1	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #72	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)=C(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4135.8	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #73	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)=C(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	4127.5	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #74	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4191.6	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #75	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC2=C1	4144.2	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #76	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)=C(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4115.6	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #77	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)=C(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	4110.6	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #78	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)=C(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4139.9	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #79	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)=C(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	4134.1	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #8	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O	4108.6	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #80	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)=C(C3=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	4168.3	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #81	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O)=C1O	4211.9	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #82	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O[Si](C)(C)C)=C1O	4160.0	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #83	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O)=C1O[Si](C)(C)C	4146.8	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #84	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O[Si](C)(C)C)=C1O	4163.3	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #85	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O)=C1O[Si](C)(C)C	4152.2	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #86	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C	4171.7	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #87	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O[Si](C)(C)C)=C1O	4171.7	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #88	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O)=C1O[Si](C)(C)C	4158.9	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #89	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C	4162.6	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #9	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O	4165.7	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #90	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C	4177.7	Semi standard non polar	33892256
Myricetin 3-galactoside,4TMS,isomer #91	C[Si](C)(C)OC1=C(O)C=C(C2=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1O	4180.1	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #1	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O	4128.0	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #10	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O	4081.9	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #11	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O	4052.1	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #12	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C	4086.4	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #13	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O	4129.6	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #14	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C	4141.6	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #15	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C	4129.8	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #16	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O	4086.5	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #17	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O	4102.9	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #18	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O	4078.6	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #19	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C	4111.1	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #2	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O	4097.7	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #20	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O	4080.8	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #21	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O	4055.3	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #22	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C	4086.0	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #23	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O	4128.4	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #24	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C	4147.8	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #25	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C	4131.5	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #26	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O	4091.4	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #27	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O	4062.8	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #28	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C	4100.1	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #29	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O	4138.6	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #3	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O	4148.7	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #30	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C	4155.1	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #31	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C	4139.0	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #32	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O	4122.8	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #33	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C	4136.4	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #34	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C	4121.8	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #35	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C	4211.9	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #36	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O	4098.4	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #37	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O	4089.0	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #38	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C	4107.3	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #39	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O	4112.3	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #4	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O	4113.8	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #40	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C	4131.8	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #41	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C	4121.4	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #42	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O	4091.3	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #43	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C	4110.4	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #44	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C	4099.5	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #45	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C	4173.4	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #46	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O	4185.5	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #47	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C	4196.1	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #48	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C	4182.5	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #49	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C	4279.1	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #5	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C	4150.8	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #50	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C	4253.7	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #51	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)=C(C3=CC(O)=C(O)C(O)=C3)OC2=C1	4198.0	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #52	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4091.0	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #53	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC2=C1	4120.8	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #54	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4084.9	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #55	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC2=C1	4118.3	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #56	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)=C(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4097.9	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #57	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)=C(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	4098.4	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #58	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4091.0	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #59	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC2=C1	4116.1	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #6	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O	4087.7	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #60	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)=C(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4087.1	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #61	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)=C(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	4095.9	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #62	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)=C(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4089.4	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #63	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)=C(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	4088.3	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #64	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)=C(C3=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	4123.1	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #65	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(O)=C1O	4127.2	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #66	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(O[Si](C)(C)C)=C1O	4074.9	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #67	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(O)=C1O[Si](C)(C)C	4079.1	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #68	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(O[Si](C)(C)C)=C1O	4072.0	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #69	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(O)=C1O[Si](C)(C)C	4075.8	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #7	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O	4105.8	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #70	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C	4106.5	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #71	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(O[Si](C)(C)C)=C1O	4075.7	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #72	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(O)=C1O[Si](C)(C)C	4079.9	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #73	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C	4087.9	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #74	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C	4102.5	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #75	C[Si](C)(C)OC1=C(O)C=C(C2=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)C=C1O	4104.5	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #76	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4146.6	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #77	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC2=C1	4129.1	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #78	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)=C(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4099.6	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #79	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)=C(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	4100.6	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #8	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O	4073.9	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #80	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)=C(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4096.0	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #81	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)=C(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	4096.2	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #82	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)=C(C3=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	4132.2	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #83	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)=C(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4101.5	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #84	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)=C(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	4103.3	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #85	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)=C(C3=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	4109.4	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #86	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)=C(C3=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	4127.3	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #87	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O[Si](C)(C)C)=C1O	4134.1	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #88	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O)=C1O[Si](C)(C)C	4135.2	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #89	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C	4135.4	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #9	C[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C	4113.7	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #90	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C	4142.5	Semi standard non polar	33892256
Myricetin 3-galactoside,5TMS,isomer #91	C[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C	4144.4	Semi standard non polar	33892256
Myricetin 3-galactoside,1TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O	4744.0	Semi standard non polar	33892256
Myricetin 3-galactoside,1TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)=C(C1=CC(O)=C(O)C(O)=C1)O2	4777.6	Semi standard non polar	33892256
Myricetin 3-galactoside,1TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)=C(C3=CC(O)=C(O)C(O)=C3)OC2=C1	4801.3	Semi standard non polar	33892256
Myricetin 3-galactoside,1TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O)=C1O	4764.1	Semi standard non polar	33892256
Myricetin 3-galactoside,1TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1O	4760.4	Semi standard non polar	33892256
Myricetin 3-galactoside,1TBDMS,isomer #6	CC(C)(C)[Si](C)(C)O[C@H]1[C@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)O[C@H](CO)[C@H](O)[C@@H]1O	4754.0	Semi standard non polar	33892256
Myricetin 3-galactoside,1TBDMS,isomer #7	CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@@H]1O	4757.8	Semi standard non polar	33892256
Myricetin 3-galactoside,1TBDMS,isomer #8	CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](CO)O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O)[C@H]1O	4741.8	Semi standard non polar	33892256
Myricetin 3-galactoside,2TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O	4803.3	Semi standard non polar	33892256
Myricetin 3-galactoside,2TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O2)C=C1O	4832.5	Semi standard non polar	33892256
Myricetin 3-galactoside,2TBDMS,isomer #11	CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O)=C(C1=CC(O)=C(O)C(O)=C1)O2	4840.6	Semi standard non polar	33892256
Myricetin 3-galactoside,2TBDMS,isomer #12	CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O)=C(C1=CC(O)=C(O)C(O)=C1)O2	4854.2	Semi standard non polar	33892256
Myricetin 3-galactoside,2TBDMS,isomer #13	CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C)=C(C1=CC(O)=C(O)C(O)=C1)O2	4853.1	Semi standard non polar	33892256
Myricetin 3-galactoside,2TBDMS,isomer #14	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)=C(C3=CC(O)=C(O)C(O)=C3)OC2=C1	4857.2	Semi standard non polar	33892256
Myricetin 3-galactoside,2TBDMS,isomer #15	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)=C(C3=CC(O)=C(O)C(O)=C3)OC2=C1	4876.5	Semi standard non polar	33892256
Myricetin 3-galactoside,2TBDMS,isomer #16	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)=C(C3=CC(O)=C(O)C(O)=C3)OC2=C1	4879.7	Semi standard non polar	33892256
Myricetin 3-galactoside,2TBDMS,isomer #17	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)=C(C3=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)OC2=C1	4835.6	Semi standard non polar	33892256
Myricetin 3-galactoside,2TBDMS,isomer #18	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)=C(C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)OC2=C1	4844.9	Semi standard non polar	33892256
Myricetin 3-galactoside,2TBDMS,isomer #19	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O)=C1O	4802.9	Semi standard non polar	33892256
Myricetin 3-galactoside,2TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O	4808.0	Semi standard non polar	33892256
Myricetin 3-galactoside,2TBDMS,isomer #20	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O)=C1O	4816.3	Semi standard non polar	33892256
Myricetin 3-galactoside,2TBDMS,isomer #21	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O)=C1O	4818.0	Semi standard non polar	33892256
Myricetin 3-galactoside,2TBDMS,isomer #22	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O[Si](C)(C)C(C)(C)C)=C1O	4818.2	Semi standard non polar	33892256
Myricetin 3-galactoside,2TBDMS,isomer #23	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O)=C1O[Si](C)(C)C(C)(C)C	4799.2	Semi standard non polar	33892256
Myricetin 3-galactoside,2TBDMS,isomer #24	CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C2=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1O	4798.1	Semi standard non polar	33892256
Myricetin 3-galactoside,2TBDMS,isomer #25	CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1O	4812.4	Semi standard non polar	33892256
Myricetin 3-galactoside,2TBDMS,isomer #26	CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1O	4817.7	Semi standard non polar	33892256
Myricetin 3-galactoside,2TBDMS,isomer #27	CC(C)(C)[Si](C)(C)O[C@H]1[C@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O	4848.8	Semi standard non polar	33892256
Myricetin 3-galactoside,2TBDMS,isomer #28	CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@@H]1O[Si](C)(C)C(C)(C)C	4871.1	Semi standard non polar	33892256
Myricetin 3-galactoside,2TBDMS,isomer #29	CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](CO)O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C	4851.7	Semi standard non polar	33892256
Myricetin 3-galactoside,2TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O	4858.6	Semi standard non polar	33892256
Myricetin 3-galactoside,2TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O	4831.7	Semi standard non polar	33892256
Myricetin 3-galactoside,2TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O	4848.5	Semi standard non polar	33892256
Myricetin 3-galactoside,2TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O	4837.3	Semi standard non polar	33892256
Myricetin 3-galactoside,2TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C	4848.4	Semi standard non polar	33892256
Myricetin 3-galactoside,2TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)=C(C3=CC(O)=C(O)C(O)=C3)OC2=C1	4860.0	Semi standard non polar	33892256
Myricetin 3-galactoside,2TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O2)=CC(O)=C1O	4820.5	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O[Si](C)(C)C(C)(C)C)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O	4867.8	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O	4877.0	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #11	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O	4851.8	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #12	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C	4870.3	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #13	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C(C)(C)C)=CC(O[Si](C)(C)C(C)(C)C)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O	4926.5	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #14	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C2=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O	4960.0	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #15	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C2=O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O	4930.1	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #16	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C	4951.5	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #17	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C2=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O	4932.5	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #18	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C2=O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O	4906.2	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #19	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C	4926.5	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O	4860.4	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #20	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O	4941.5	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #21	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C	4956.3	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #22	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C	4944.8	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #23	CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)=C(C3=CC(O)=C(O)C(O)=C3)OC2=C1	4935.4	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #24	CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)=C(C3=CC(O)=C(O)C(O)=C3)OC2=C1	4939.0	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #25	CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)=C(C3=CC(O)=C(O)C(O)=C3)OC2=C1	4939.6	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #26	CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)=C(C3=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)OC2=C1	4928.7	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #27	CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)=C(C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)OC2=C1	4985.7	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #28	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O2)=CC(O)=C1O	4884.4	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #29	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O2)=CC(O)=C1O	4881.6	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)OC3=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O	4890.7	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #30	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O2)=CC(O)=C1O	4886.2	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #31	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O2)=CC(O[Si](C)(C)C(C)(C)C)=C1O	4909.0	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #32	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O2)=CC(O)=C1O[Si](C)(C)C(C)(C)C	4903.1	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #33	CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C2=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O2)C=C1O	4908.4	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #34	CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O2)C=C1O	4918.9	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #35	CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O2)C=C1O	4913.0	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #36	CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O)=C(C1=CC(O)=C(O)C(O)=C1)O2	4915.6	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #37	CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C)=C(C1=CC(O)=C(O)C(O)=C1)O2	4914.1	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #38	CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C)=C(C1=CC(O)=C(O)C(O)=C1)O2	4935.1	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #39	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)=C(C3=CC(O)=C(O)C(O)=C3)OC2=C1	4941.6	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)OC3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O	4869.3	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #40	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)=C(C3=CC(O)=C(O)C(O)=C3)OC2=C1	4941.5	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #41	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)=C(C3=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)OC2=C1	4902.1	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #42	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)=C(C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)OC2=C1	4919.5	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #43	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O[Si](C)(C)C(C)(C)C)=C(C3=CC(O)=C(O)C(O)=C3)OC2=C1	4962.8	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #44	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)=C(C3=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)OC2=C1	4898.6	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #45	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)=C(C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)OC2=C1	4928.7	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #46	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)=C(C3=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)OC2=C1	4907.4	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #47	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)=C(C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)OC2=C1	4927.3	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #48	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)=C(C3=CC(O[Si](C)(C)C(C)(C)C)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)OC2=C1	4923.8	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #49	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)=C(C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C3)OC2=C1	4917.9	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O	4893.8	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #50	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O)=C1O	4874.7	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #51	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O)=C1O	4875.3	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #52	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O[Si](C)(C)C(C)(C)C)=C1O	4882.0	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #53	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O)=C1O[Si](C)(C)C(C)(C)C	4874.2	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #54	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O)=C1O	4894.6	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #55	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O[Si](C)(C)C(C)(C)C)=C1O	4876.5	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #56	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O)=C1O[Si](C)(C)C(C)(C)C	4870.7	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #57	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O[Si](C)(C)C(C)(C)C)=C1O	4887.3	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #58	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O)=C1O[Si](C)(C)C(C)(C)C	4881.2	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #59	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O[Si](C)(C)C(C)(C)C)=C1O[Si](C)(C)C(C)(C)C	4901.4	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O	4860.7	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #60	CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C2=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1O	4861.9	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #61	CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C2=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1O	4864.2	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #62	CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C2=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1O	4885.1	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #63	CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)O[C@@H]1CO	4934.1	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C	4886.5	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)OC3=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O	4907.3	Semi standard non polar	33892256
Myricetin 3-galactoside,3TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=C(C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)OC3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C2=O)[C@H](O)[C@@H](O)[C@H]1O	4889.6	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - Myricetin 3-galactoside GC-MS (Non-derivatized) - 70eV, Positive	splash10-0ik9-7903800000-ce0fa31e5db2936cf9c0	2017-09-01	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Myricetin 3-galactoside GC-MS (3 TMS) - 70eV, Positive	splash10-0089-9310017000-6f1a7da9e8d4be372d7f	2017-10-06	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Myricetin 3-galactoside GC-MS (Non-derivatized) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Experimental LC-MS/MS	LC-MS/MS Spectrum - Myricetin 3-galactoside Linear Ion Trap , negative-QTOF	splash10-014i-0009000000-14e44e007d92a9c6e511	2017-09-14	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Myricetin 3-galactoside Linear Ion Trap , negative-QTOF	splash10-014i-0009000000-9e9deea556536bd35c0e	2017-09-14	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Myricetin 3-galactoside , negative-QTOF	splash10-014i-0029400000-98e2ee5718ad2ad2a327	2017-09-14	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Myricetin 3-galactoside Linear Ion Trap , positive-QTOF	splash10-014i-0009000000-690dc87f4d5a02d48048	2017-09-14	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Myricetin 3-galactoside Linear Ion Trap , positive-QTOF	splash10-014i-0009000000-b45b15f5bfc6ef2775b1	2017-09-14	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Myricetin 3-galactoside Linear Ion Trap , positive-QTOF	splash10-000x-0609400000-f26decec9de101a02363	2017-09-14	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Myricetin 3-galactoside Linear Ion Trap , positive-QTOF	splash10-000x-0609400000-051837da25c5fea72d32	2017-09-14	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Myricetin 3-galactoside Linear Ion Trap , positive-QTOF	splash10-0a4i-0009810000-b7cdc6bf05acb13fcdb6	2017-09-14	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Myricetin 3-galactoside Linear Ion Trap , positive-QTOF	splash10-0a4i-0009810000-94df02b9c5823c04d120	2017-09-14	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Myricetin 3-galactoside , positive-QTOF	splash10-014i-0219000000-6ce35cfa022fae8003f0	2017-09-14	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Myricetin 3-galactoside , positive-QTOF	splash10-0ik9-0244950000-6522087cb37d9f4b0777	2017-09-14	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Myricetin 3-galactoside 20V, Positive-QTOF	splash10-014i-0009000000-41210856c10e18f192d2	2021-09-20	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Myricetin 3-galactoside 10V, Positive-QTOF	splash10-014i-0009000000-bf04b434359343227168	2021-09-20	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Myricetin 3-galactoside 40V, Positive-QTOF	splash10-014i-2229000000-48be2fb669d12dc14ebe	2021-09-20	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Myricetin 3-galactoside 10V, Negative-QTOF	splash10-004i-0002900000-e49debd65b5b4031c094	2021-09-20	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Myricetin 3-galactoside 20V, Negative-QTOF	splash10-014i-0009400000-d2fd5c5c4afa03739d9e	2021-09-20	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Myricetin 3-galactoside 40V, Negative-QTOF	splash10-01b9-0195000000-11c0fd88b4cc3afc6a5f	2021-09-20	HMDB team, MONA	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Myricetin 3-galactoside 10V, Positive-QTOF	splash10-0159-0109600000-53ccb46525c72e380175	2016-08-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Myricetin 3-galactoside 20V, Positive-QTOF	splash10-014i-0109100000-4de2686c4f511b177e6d	2016-08-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Myricetin 3-galactoside 40V, Positive-QTOF	splash10-0udi-2927000000-5272046eca620550e34e	2016-08-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Myricetin 3-galactoside 10V, Negative-QTOF	splash10-00or-1306900000-1c4e69acf7ab411aaf2d	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Myricetin 3-galactoside 20V, Negative-QTOF	splash10-014i-1429200000-52abbd45f20f41ec13de	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Myricetin 3-galactoside 40V, Negative-QTOF	splash10-0670-6954000000-e890b34f0058d0b985ee	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Myricetin 3-galactoside 10V, Positive-QTOF	splash10-014i-0009200000-3912be94ff194b41c8e3	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Myricetin 3-galactoside 20V, Positive-QTOF	splash10-0160-0009900000-6c30136a0de4443fdcf3	2021-09-22	Wishart Lab	View Spectrum

NMR Spectra

Spectrum Type	Description	Deposition Date	Source	View
Predicted 1D NMR	¹³C NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Cytoplasm
Extracellular

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

FooDB ID

KNApSAcK ID

Chemspider ID

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

5491408

PDB ID

Not Available

ChEBI ID

75815

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

rw1630001

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

(). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .

Showing metabocard for Myricetin 3-galactoside (HMDB0034358)

MOL for HMDB0034358 (Myricetin 3-galactoside)

3D MOL for HMDB0034358 (Myricetin 3-galactoside)

3D SDF for HMDB0034358 (Myricetin 3-galactoside)

3D-SDF for HMDB0034358 (Myricetin 3-galactoside)

PDB for HMDB0034358 (Myricetin 3-galactoside)

3D PDB for HMDB0034358 (Myricetin 3-galactoside)

SMILES for HMDB0034358 (Myricetin 3-galactoside)

INCHI for HMDB0034358 (Myricetin 3-galactoside)

Structure for HMDB0034358 (Myricetin 3-galactoside)

3D Structure for HMDB0034358 (Myricetin 3-galactoside)

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra

NMR Spectra