Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2012-09-11 21:25:56 UTC

Update Date

2022-03-07 02:54:51 UTC

HMDB ID

HMDB0036303

Secondary Accession Numbers

HMDB36303

Metabolite Identification

Common Name

Epicatechin-(4beta->8)-gallocatechin

Description

Epicatechin-(4beta->8)-gallocatechin belongs to the class of organic compounds known as biflavonoids and polyflavonoids. These are organic compounds containing at least two flavan/flavone units. These units are usually linked through CC or C-O-C bonds. Some examples include C2-O-C3, C2-O-C4, C3'-C3''', and C6-C8''. Epicatechin-(4beta->8)-gallocatechin has been detected, but not quantified in, fruits. This could make epicatechin-(4beta->8)-gallocatechin a potential biomarker for the consumption of these foods. Based on a literature review very few articles have been published on Epicatechin-(4beta->8)-gallocatechin.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI


  Mrv0541 02241208012D          

 43 48  0  0  0  0            999 V2000
    1.7616    3.1236    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0412    2.6426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3194    3.1236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4006    2.6426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1210    3.1236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1210    3.9251    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4832    1.8426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2049    1.4427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2049    0.5601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9251    0.1614    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4832   -0.7210    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4832    0.1614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7616    0.5601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7616    1.4427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0412    1.8426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3194    1.3614    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4006    1.8426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1210    1.4427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0413   -0.0804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3196   -0.5615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4819   -0.0804    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8426    2.6426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8426    1.8426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5630    1.4427    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4832    0.7209    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0413   -1.7616    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3196   -1.3615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4819   -1.7616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4819   -2.6440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2006   -3.0427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2006   -3.9251    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2035   -0.5615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4832   -0.0804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7616   -0.5615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7616   -1.3615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4832   -1.7616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2035   -1.3615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9251   -1.7616    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2006   -1.3615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9209   -1.7616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9209   -2.6440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6426   -3.0427    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9155    1.8618    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  2  3  1  0  0  0  0
  2 15  1  0  0  0  0
  3  4  1  0  0  0  0
  4  5  2  0  0  0  0
  4 17  1  0  0  0  0
  5  6  1  0  0  0  0
  5 22  1  0  0  0  0
  7  8  1  0  0  0  0
  7 14  2  0  0  0  0
  8  9  2  0  0  0  0
  8 43  1  0  0  0  0
  9 10  1  0  0  0  0
  9 12  1  0  0  0  0
 11 12  1  0  0  0  0
 12 13  2  0  0  0  0
 13 14  1  0  0  0  0
 14 15  1  0  0  0  0
 15 16  1  0  0  0  0
 16 17  1  0  0  0  0
 17 18  2  0  0  0  0
 18 19  1  0  0  0  0
 18 23  1  0  0  0  0
 19 20  1  0  0  0  0
 19 34  1  0  0  0  0
 20 21  1  0  0  0  0
 20 27  1  0  0  0  0
 22 23  2  0  0  0  0
 23 24  1  0  0  0  0
 25 33  1  0  0  0  0
 26 27  1  0  0  0  0
 26 35  1  0  0  0  0
 27 28  1  0  0  0  0
 28 29  1  0  0  0  0
 28 39  2  0  0  0  0
 29 30  2  0  0  0  0
 30 31  1  0  0  0  0
 30 41  1  0  0  0  0
 32 33  1  0  0  0  0
 32 37  2  0  0  0  0
 33 34  2  0  0  0  0
 34 35  1  0  0  0  0
 35 36  2  0  0  0  0
 36 37  1  0  0  0  0
 37 38  1  0  0  0  0
 39 40  1  0  0  0  0
 40 41  2  0  0  0  0
 41 42  1  0  0  0  0
M  END

HMDB0036303
     RDKit          3D
Epicatechin-(4beta->8)-gallocatechin
 69 74  0  0  0  0  0  0  0  0999 V2000
    4.7066   -2.5712   -3.5079 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7790   -2.1285   -2.5716 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4357   -2.0113   -2.8357 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5737   -1.5652   -1.8582 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2091   -1.4667   -2.1903 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0283   -1.2277   -0.6020 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3709   -1.3390   -0.3197 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2229   -1.7865   -1.3065 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9017   -1.0156    0.9279 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1803   -0.0893    1.7258 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6851    1.2990    1.5331 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9469    1.7670    0.2656 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4200    3.0629    0.0412 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6220    3.8752    1.1361 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0973    5.1830    0.9372 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3711    3.4419    2.4208 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5834    4.2833    3.5142 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9078    2.1619    2.5891 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7120   -0.2153    1.6742 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3027   -1.0334    2.7575 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0713   -0.7425    0.4550 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0667   -1.8125    0.7033 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4596   -3.0338    1.2031 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8107   -3.2220    1.4476 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4819   -4.0065    1.4372 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8475   -3.8077    1.1855 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7564   -4.8172    1.4366 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2481   -2.5910    0.6864 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2816   -1.6235    0.4576 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7458   -0.4057   -0.0501 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9768    0.1529    0.3716 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5867    1.0053   -0.6762 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1107    2.2271   -0.3287 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7032    3.0823   -1.2781 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2146    4.2989   -0.8775 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7754    2.7141   -2.5991 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3481    3.5177   -3.5747 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2420    1.4711   -2.9511 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3162    1.1045   -4.2786 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6688    0.6571   -1.9984 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9773   -0.8441    0.8110 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2470   -0.4974    0.3639 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6765   -2.2590    0.3800 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9537   -3.5445   -3.6207 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.0644   -2.2696   -3.8078 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1284   -1.7091   -3.0972 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2954   -1.8792   -1.0926 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.5065   -0.3412    2.7816 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7698    1.0835   -0.5558 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6172    3.4061   -0.9542 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2957    5.5501    0.0335 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.9205    5.2206    3.4165 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7069    1.8140    3.6136 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2983    0.8267    1.8488 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.9961   -1.0205    3.4743 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.4792    0.0788   -0.0699 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1692   -4.0953    1.8150 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1616   -4.9516    1.8265 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7303   -4.7534    1.2825 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7092    0.8075    1.2412 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0802    2.5691    0.7059 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6456    4.9471   -1.5010 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7503    4.4170   -3.4046 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7404    1.7198   -4.9511 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2514   -0.3149   -2.2722 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0171   -0.8637    1.9195 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9399   -0.6553    1.0793 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7800   -2.2683   -0.7412 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3984   -2.9658    0.7741 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  4  6  2  0
  6  7  1  0
  7  8  2  0
  7  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 14 16  1  0
 16 17  1  0
 16 18  2  0
 10 19  1  0
 19 20  1  0
 19 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 23 25  1  0
 25 26  2  0
 26 27  1  0
 26 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  1  0
 34 36  2  0
 36 37  1  0
 36 38  1  0
 38 39  1  0
 38 40  2  0
 31 41  1  0
 41 42  1  0
 41 43  1  0
  8  2  1  0
 18 11  1  0
 29 22  1  0
 40 32  1  0
 21  6  1  0
 43 28  1  0
  1 44  1  0
  3 45  1  0
  5 46  1  0
  8 47  1  0
 10 48  1  0
 12 49  1  0
 13 50  1  0
 15 51  1  0
 17 52  1  0
 18 53  1  0
 19 54  1  0
 20 55  1  0
 21 56  1  0
 24 57  1  0
 25 58  1  0
 27 59  1  0
 31 60  1  0
 33 61  1  0
 35 62  1  0
 37 63  1  0
 39 64  1  0
 40 65  1  0
 41 66  1  0
 42 67  1  0
 43 68  1  0
 43 69  1  0
M  END


  Mrv0541 02241208012D          

 43 48  0  0  0  0            999 V2000
    1.7616    3.1236    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0412    2.6426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3194    3.1236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4006    2.6426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1210    3.1236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1210    3.9251    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4832    1.8426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2049    1.4427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2049    0.5601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9251    0.1614    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4832   -0.7210    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4832    0.1614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7616    0.5601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7616    1.4427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0412    1.8426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3194    1.3614    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4006    1.8426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1210    1.4427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0413   -0.0804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3196   -0.5615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4819   -0.0804    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8426    2.6426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8426    1.8426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5630    1.4427    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4832    0.7209    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0413   -1.7616    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3196   -1.3615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4819   -1.7616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4819   -2.6440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2006   -3.0427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2006   -3.9251    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2035   -0.5615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4832   -0.0804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7616   -0.5615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7616   -1.3615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4832   -1.7616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2035   -1.3615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9251   -1.7616    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2006   -1.3615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9209   -1.7616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9209   -2.6440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6426   -3.0427    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9155    1.8618    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  2  3  1  0  0  0  0
  2 15  1  0  0  0  0
  3  4  1  0  0  0  0
  4  5  2  0  0  0  0
  4 17  1  0  0  0  0
  5  6  1  0  0  0  0
  5 22  1  0  0  0  0
  7  8  1  0  0  0  0
  7 14  2  0  0  0  0
  8  9  2  0  0  0  0
  8 43  1  0  0  0  0
  9 10  1  0  0  0  0
  9 12  1  0  0  0  0
 11 12  1  0  0  0  0
 12 13  2  0  0  0  0
 13 14  1  0  0  0  0
 14 15  1  0  0  0  0
 15 16  1  0  0  0  0
 16 17  1  0  0  0  0
 17 18  2  0  0  0  0
 18 19  1  0  0  0  0
 18 23  1  0  0  0  0
 19 20  1  0  0  0  0
 19 34  1  0  0  0  0
 20 21  1  0  0  0  0
 20 27  1  0  0  0  0
 22 23  2  0  0  0  0
 23 24  1  0  0  0  0
 25 33  1  0  0  0  0
 26 27  1  0  0  0  0
 26 35  1  0  0  0  0
 27 28  1  0  0  0  0
 28 29  1  0  0  0  0
 28 39  2  0  0  0  0
 29 30  2  0  0  0  0
 30 31  1  0  0  0  0
 30 41  1  0  0  0  0
 32 33  1  0  0  0  0
 32 37  2  0  0  0  0
 33 34  2  0  0  0  0
 34 35  1  0  0  0  0
 35 36  2  0  0  0  0
 36 37  1  0  0  0  0
 37 38  1  0  0  0  0
 39 40  1  0  0  0  0
 40 41  2  0  0  0  0
 41 42  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0036303

> <DATABASE_NAME>
hmdb

> <SMILES>
OC1CC2=C(O)C=C(O)C(C3C(O)C(OC4=CC(O)=CC(O)=C34)C3=CC=C(O)C(O)=C3)=C2OC1C1=CC(O)=C(O)C(O)=C1

> <INCHI_IDENTIFIER>
InChI=1S/C30H26O13/c31-12-6-17(35)23-22(7-12)42-29(10-1-2-14(32)16(34)3-10)27(41)25(23)24-18(36)9-15(33)13-8-21(39)28(43-30(13)24)11-4-19(37)26(40)20(38)5-11/h1-7,9,21,25,27-29,31-41H,8H2

> <INCHI_KEY>
YJMNEZANCYQLJR-UHFFFAOYSA-N

> <FORMULA>
C30H26O13

> <MOLECULAR_WEIGHT>
594.5196

> <EXACT_MASS>
594.137340918

> <JCHEM_ACCEPTOR_COUNT>
13

> <JCHEM_AVERAGE_POLARIZABILITY>
56.67916773198367

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
11

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
8-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-1-benzopyran-4-yl]-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-1-benzopyran-3,5,7-triol

> <ALOGPS_LOGP>
2.22

> <JCHEM_LOGP>
2.812179691999999

> <ALOGPS_LOGS>
-3.53

> <JCHEM_MDDR_LIKE_RULE>
0

> <JCHEM_NUMBER_OF_RINGS>
6

> <JCHEM_PHYSIOLOGICAL_CHARGE>
0

> <JCHEM_PKA>
9.074300346062271

> <JCHEM_PKA_STRONGEST_ACIDIC>
8.564194211518075

> <JCHEM_PKA_STRONGEST_BASIC>
-5.176560435613788

> <JCHEM_POLAR_SURFACE_AREA>
240.98999999999995

> <JCHEM_REFRACTIVITY>
148.4889

> <JCHEM_ROTATABLE_BOND_COUNT>
3

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
1.75e-01 g/l

> <JCHEM_TRADITIONAL_IUPAC>
8-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-1-benzopyran-4-yl]-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-1-benzopyran-3,5,7-triol

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0036303
     RDKit          3D
Epicatechin-(4beta->8)-gallocatechin
 69 74  0  0  0  0  0  0  0  0999 V2000
    4.7066   -2.5712   -3.5079 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7790   -2.1285   -2.5716 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4357   -2.0113   -2.8357 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5737   -1.5652   -1.8582 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2091   -1.4667   -2.1903 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0283   -1.2277   -0.6020 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3709   -1.3390   -0.3197 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2229   -1.7865   -1.3065 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9017   -1.0156    0.9279 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1803   -0.0893    1.7258 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6851    1.2990    1.5331 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9469    1.7670    0.2656 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4200    3.0629    0.0412 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6220    3.8752    1.1361 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0973    5.1830    0.9372 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3711    3.4419    2.4208 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5834    4.2833    3.5142 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9078    2.1619    2.5891 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7120   -0.2153    1.6742 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3027   -1.0334    2.7575 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0713   -0.7425    0.4550 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0667   -1.8125    0.7033 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4596   -3.0338    1.2031 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8107   -3.2220    1.4476 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4819   -4.0065    1.4372 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8475   -3.8077    1.1855 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7564   -4.8172    1.4366 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2481   -2.5910    0.6864 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2816   -1.6235    0.4576 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7458   -0.4057   -0.0501 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9768    0.1529    0.3716 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5867    1.0053   -0.6762 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1107    2.2271   -0.3287 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7032    3.0823   -1.2781 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2146    4.2989   -0.8775 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7754    2.7141   -2.5991 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3481    3.5177   -3.5747 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2420    1.4711   -2.9511 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3162    1.1045   -4.2786 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6688    0.6571   -1.9984 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9773   -0.8441    0.8110 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2470   -0.4974    0.3639 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6765   -2.2590    0.3800 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9537   -3.5445   -3.6207 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.0644   -2.2696   -3.8078 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1284   -1.7091   -3.0972 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2954   -1.8792   -1.0926 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.5065   -0.3412    2.7816 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7698    1.0835   -0.5558 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6172    3.4061   -0.9542 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2957    5.5501    0.0335 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.9205    5.2206    3.4165 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7069    1.8140    3.6136 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2983    0.8267    1.8488 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.9961   -1.0205    3.4743 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.4792    0.0788   -0.0699 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1692   -4.0953    1.8150 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1616   -4.9516    1.8265 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7303   -4.7534    1.2825 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7092    0.8075    1.2412 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0802    2.5691    0.7059 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6456    4.9471   -1.5010 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7503    4.4170   -3.4046 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7404    1.7198   -4.9511 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2514   -0.3149   -2.2722 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0171   -0.8637    1.9195 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9399   -0.6553    1.0793 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7800   -2.2683   -0.7412 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3984   -2.9658    0.7741 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  4  6  2  0
  6  7  1  0
  7  8  2  0
  7  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 14 16  1  0
 16 17  1  0
 16 18  2  0
 10 19  1  0
 19 20  1  0
 19 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 23 25  1  0
 25 26  2  0
 26 27  1  0
 26 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  1  0
 34 36  2  0
 36 37  1  0
 36 38  1  0
 38 39  1  0
 38 40  2  0
 31 41  1  0
 41 42  1  0
 41 43  1  0
  8  2  1  0
 18 11  1  0
 29 22  1  0
 40 32  1  0
 21  6  1  0
 43 28  1  0
  1 44  1  0
  3 45  1  0
  5 46  1  0
  8 47  1  0
 10 48  1  0
 12 49  1  0
 13 50  1  0
 15 51  1  0
 17 52  1  0
 18 53  1  0
 19 54  1  0
 20 55  1  0
 21 56  1  0
 24 57  1  0
 25 58  1  0
 27 59  1  0
 31 60  1  0
 33 61  1  0
 35 62  1  0
 37 63  1  0
 39 64  1  0
 40 65  1  0
 41 66  1  0
 42 67  1  0
 43 68  1  0
 43 69  1  0
M  END

HEADER    PROTEIN                                 24-FEB-12   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   24-FEB-12         0                                  
HETATM    1  O   UNK     0       3.288   5.831   0.000  0.00  0.00           O+0
HETATM    2  C   UNK     0       1.944   4.933   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0       0.596   5.831   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0      -0.748   4.933   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0      -2.093   5.831   0.000  0.00  0.00           C+0
HETATM    6  O   UNK     0      -2.093   7.327   0.000  0.00  0.00           O+0
HETATM    7  C   UNK     0       4.635   3.440   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0       5.983   2.693   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0       5.983   1.045   0.000  0.00  0.00           C+0
HETATM   10  O   UNK     0       7.327   0.301   0.000  0.00  0.00           O+0
HETATM   11  O   UNK     0       4.635  -1.346   0.000  0.00  0.00           O+0
HETATM   12  C   UNK     0       4.635   0.301   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0       3.288   1.045   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0       3.288   2.693   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0       1.944   3.440   0.000  0.00  0.00           C+0
HETATM   16  O   UNK     0       0.596   2.541   0.000  0.00  0.00           O+0
HETATM   17  C   UNK     0      -0.748   3.440   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0      -2.093   2.693   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0      -1.944  -0.150   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0      -0.597  -1.048   0.000  0.00  0.00           C+0
HETATM   21  O   UNK     0       0.899  -0.150   0.000  0.00  0.00           O+0
HETATM   22  C   UNK     0      -3.440   4.933   0.000  0.00  0.00           C+0
HETATM   23  C   UNK     0      -3.440   3.440   0.000  0.00  0.00           C+0
HETATM   24  O   UNK     0      -4.784   2.693   0.000  0.00  0.00           O+0
HETATM   25  O   UNK     0      -4.635   1.346   0.000  0.00  0.00           O+0
HETATM   26  O   UNK     0      -1.944  -3.288   0.000  0.00  0.00           O+0
HETATM   27  C   UNK     0      -0.597  -2.542   0.000  0.00  0.00           C+0
HETATM   28  C   UNK     0       0.899  -3.288   0.000  0.00  0.00           C+0
HETATM   29  C   UNK     0       0.899  -4.935   0.000  0.00  0.00           C+0
HETATM   30  C   UNK     0       2.241  -5.680   0.000  0.00  0.00           C+0
HETATM   31  O   UNK     0       2.241  -7.327   0.000  0.00  0.00           O+0
HETATM   32  C   UNK     0      -5.980  -1.048   0.000  0.00  0.00           C+0
HETATM   33  C   UNK     0      -4.635  -0.150   0.000  0.00  0.00           C+0
HETATM   34  C   UNK     0      -3.288  -1.048   0.000  0.00  0.00           C+0
HETATM   35  C   UNK     0      -3.288  -2.542   0.000  0.00  0.00           C+0
HETATM   36  C   UNK     0      -4.635  -3.288   0.000  0.00  0.00           C+0
HETATM   37  C   UNK     0      -5.980  -2.542   0.000  0.00  0.00           C+0
HETATM   38  O   UNK     0      -7.327  -3.288   0.000  0.00  0.00           O+0
HETATM   39  C   UNK     0       2.241  -2.542   0.000  0.00  0.00           C+0
HETATM   40  C   UNK     0       3.586  -3.288   0.000  0.00  0.00           C+0
HETATM   41  C   UNK     0       3.586  -4.935   0.000  0.00  0.00           C+0
HETATM   42  O   UNK     0       4.933  -5.680   0.000  0.00  0.00           O+0
HETATM   43  O   UNK     0       7.309   3.475   0.000  0.00  0.00           O+0
CONECT    1    2                                                            
CONECT    2    1    3   15                                                  
CONECT    3    2    4                                                       
CONECT    4    3    5   17                                                  
CONECT    5    4    6   22                                                  
CONECT    6    5                                                            
CONECT    7    8   14                                                       
CONECT    8    7    9   43                                                  
CONECT    9    8   10   12                                                  
CONECT   10    9                                                            
CONECT   11   12                                                            
CONECT   12    9   11   13                                                  
CONECT   13   12   14                                                       
CONECT   14    7   13   15                                                  
CONECT   15    2   14   16                                                  
CONECT   16   15   17                                                       
CONECT   17    4   16   18                                                  
CONECT   18   17   19   23                                                  
CONECT   19   18   20   34                                                  
CONECT   20   19   21   27                                                  
CONECT   21   20                                                            
CONECT   22    5   23                                                       
CONECT   23   18   22   24                                                  
CONECT   24   23                                                            
CONECT   25   33                                                            
CONECT   26   27   35                                                       
CONECT   27   20   26   28                                                  
CONECT   28   27   29   39                                                  
CONECT   29   28   30                                                       
CONECT   30   29   31   41                                                  
CONECT   31   30                                                            
CONECT   32   33   37                                                       
CONECT   33   25   32   34                                                  
CONECT   34   19   33   35                                                  
CONECT   35   26   34   36                                                  
CONECT   36   35   37                                                       
CONECT   37   32   36   38                                                  
CONECT   38   37                                                            
CONECT   39   28   40                                                       
CONECT   40   39   41                                                       
CONECT   41   30   40   42                                                  
CONECT   42   41                                                            
CONECT   43    8                                                            
MASTER        0    0    0    0    0    0    0    0   43    0   96    0
END

COMPND    HMDB0036303
HETATM    1  O1  UNL     1       4.707  -2.571  -3.508  1.00  0.00           O  
HETATM    2  C1  UNL     1       3.779  -2.129  -2.572  1.00  0.00           C  
HETATM    3  C2  UNL     1       2.436  -2.011  -2.836  1.00  0.00           C  
HETATM    4  C3  UNL     1       1.574  -1.565  -1.858  1.00  0.00           C  
HETATM    5  O2  UNL     1       0.209  -1.467  -2.190  1.00  0.00           O  
HETATM    6  C4  UNL     1       2.028  -1.228  -0.602  1.00  0.00           C  
HETATM    7  C5  UNL     1       3.371  -1.339  -0.320  1.00  0.00           C  
HETATM    8  C6  UNL     1       4.223  -1.787  -1.306  1.00  0.00           C  
HETATM    9  O3  UNL     1       3.902  -1.016   0.928  1.00  0.00           O  
HETATM   10  C7  UNL     1       3.180  -0.089   1.726  1.00  0.00           C  
HETATM   11  C8  UNL     1       3.685   1.299   1.533  1.00  0.00           C  
HETATM   12  C9  UNL     1       3.947   1.767   0.266  1.00  0.00           C  
HETATM   13  C10 UNL     1       4.420   3.063   0.041  1.00  0.00           C  
HETATM   14  C11 UNL     1       4.622   3.875   1.136  1.00  0.00           C  
HETATM   15  O4  UNL     1       5.097   5.183   0.937  1.00  0.00           O  
HETATM   16  C12 UNL     1       4.371   3.442   2.421  1.00  0.00           C  
HETATM   17  O5  UNL     1       4.583   4.283   3.514  1.00  0.00           O  
HETATM   18  C13 UNL     1       3.908   2.162   2.589  1.00  0.00           C  
HETATM   19  C14 UNL     1       1.712  -0.215   1.674  1.00  0.00           C  
HETATM   20  O6  UNL     1       1.303  -1.033   2.757  1.00  0.00           O  
HETATM   21  C15 UNL     1       1.071  -0.743   0.455  1.00  0.00           C  
HETATM   22  C16 UNL     1       0.067  -1.813   0.703  1.00  0.00           C  
HETATM   23  C17 UNL     1       0.460  -3.034   1.203  1.00  0.00           C  
HETATM   24  O7  UNL     1       1.811  -3.222   1.448  1.00  0.00           O  
HETATM   25  C18 UNL     1      -0.482  -4.006   1.437  1.00  0.00           C  
HETATM   26  C19 UNL     1      -1.847  -3.808   1.186  1.00  0.00           C  
HETATM   27  O8  UNL     1      -2.756  -4.817   1.437  1.00  0.00           O  
HETATM   28  C20 UNL     1      -2.248  -2.591   0.686  1.00  0.00           C  
HETATM   29  C21 UNL     1      -1.282  -1.623   0.458  1.00  0.00           C  
HETATM   30  O9  UNL     1      -1.746  -0.406  -0.050  1.00  0.00           O  
HETATM   31  C22 UNL     1      -2.977   0.153   0.372  1.00  0.00           C  
HETATM   32  C23 UNL     1      -3.587   1.005  -0.676  1.00  0.00           C  
HETATM   33  C24 UNL     1      -4.111   2.227  -0.329  1.00  0.00           C  
HETATM   34  C25 UNL     1      -4.703   3.082  -1.278  1.00  0.00           C  
HETATM   35  O10 UNL     1      -5.215   4.299  -0.878  1.00  0.00           O  
HETATM   36  C26 UNL     1      -4.775   2.714  -2.599  1.00  0.00           C  
HETATM   37  O11 UNL     1      -5.348   3.518  -3.575  1.00  0.00           O  
HETATM   38  C27 UNL     1      -4.242   1.471  -2.951  1.00  0.00           C  
HETATM   39  O12 UNL     1      -4.316   1.104  -4.279  1.00  0.00           O  
HETATM   40  C28 UNL     1      -3.669   0.657  -1.998  1.00  0.00           C  
HETATM   41  C29 UNL     1      -3.977  -0.844   0.811  1.00  0.00           C  
HETATM   42  O13 UNL     1      -5.247  -0.497   0.364  1.00  0.00           O  
HETATM   43  C30 UNL     1      -3.677  -2.259   0.380  1.00  0.00           C  
HETATM   44  H1  UNL     1       4.954  -3.545  -3.621  1.00  0.00           H  
HETATM   45  H2  UNL     1       2.064  -2.270  -3.808  1.00  0.00           H  
HETATM   46  H3  UNL     1      -0.128  -1.709  -3.097  1.00  0.00           H  
HETATM   47  H4  UNL     1       5.295  -1.879  -1.093  1.00  0.00           H  
HETATM   48  H5  UNL     1       3.506  -0.341   2.782  1.00  0.00           H  
HETATM   49  H6  UNL     1       3.770   1.083  -0.556  1.00  0.00           H  
HETATM   50  H7  UNL     1       4.617   3.406  -0.954  1.00  0.00           H  
HETATM   51  H8  UNL     1       5.296   5.550   0.034  1.00  0.00           H  
HETATM   52  H9  UNL     1       4.920   5.221   3.417  1.00  0.00           H  
HETATM   53  H10 UNL     1       3.707   1.814   3.614  1.00  0.00           H  
HETATM   54  H11 UNL     1       1.298   0.827   1.849  1.00  0.00           H  
HETATM   55  H12 UNL     1       1.996  -1.021   3.474  1.00  0.00           H  
HETATM   56  H13 UNL     1       0.479   0.079  -0.070  1.00  0.00           H  
HETATM   57  H14 UNL     1       2.169  -4.095   1.815  1.00  0.00           H  
HETATM   58  H15 UNL     1      -0.162  -4.952   1.827  1.00  0.00           H  
HETATM   59  H16 UNL     1      -3.730  -4.753   1.282  1.00  0.00           H  
HETATM   60  H17 UNL     1      -2.709   0.807   1.241  1.00  0.00           H  
HETATM   61  H18 UNL     1      -4.080   2.569   0.706  1.00  0.00           H  
HETATM   62  H19 UNL     1      -5.646   4.947  -1.501  1.00  0.00           H  
HETATM   63  H20 UNL     1      -5.750   4.417  -3.405  1.00  0.00           H  
HETATM   64  H21 UNL     1      -4.740   1.720  -4.951  1.00  0.00           H  
HETATM   65  H22 UNL     1      -3.251  -0.315  -2.272  1.00  0.00           H  
HETATM   66  H23 UNL     1      -4.017  -0.864   1.919  1.00  0.00           H  
HETATM   67  H24 UNL     1      -5.940  -0.655   1.079  1.00  0.00           H  
HETATM   68  H25 UNL     1      -3.780  -2.268  -0.741  1.00  0.00           H  
HETATM   69  H26 UNL     1      -4.398  -2.966   0.774  1.00  0.00           H  
CONECT    1    2   44
CONECT    2    3    3    8
CONECT    3    4   45
CONECT    4    5    6    6
CONECT    5   46
CONECT    6    7   21
CONECT    7    8    8    9
CONECT    8   47
CONECT    9   10
CONECT   10   11   19   48
CONECT   11   12   12   18
CONECT   12   13   49
CONECT   13   14   14   50
CONECT   14   15   16
CONECT   15   51
CONECT   16   17   18   18
CONECT   17   52
CONECT   18   53
CONECT   19   20   21   54
CONECT   20   55
CONECT   21   22   56
CONECT   22   23   23   29
CONECT   23   24   25
CONECT   24   57
CONECT   25   26   26   58
CONECT   26   27   28
CONECT   27   59
CONECT   28   29   29   43
CONECT   29   30
CONECT   30   31
CONECT   31   32   41   60
CONECT   32   33   33   40
CONECT   33   34   61
CONECT   34   35   36   36
CONECT   35   62
CONECT   36   37   38
CONECT   37   63
CONECT   38   39   40   40
CONECT   39   64
CONECT   40   65
CONECT   41   42   43   66
CONECT   42   67
CONECT   43   68   69
END

HMDB0036303
     RDKit          3D
Epicatechin-(4beta->8)-gallocatechin
 69 74  0  0  0  0  0  0  0  0999 V2000
    4.7066   -2.5712   -3.5079 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7790   -2.1285   -2.5716 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4357   -2.0113   -2.8357 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5737   -1.5652   -1.8582 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2091   -1.4667   -2.1903 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0283   -1.2277   -0.6020 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3709   -1.3390   -0.3197 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2229   -1.7865   -1.3065 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9017   -1.0156    0.9279 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1803   -0.0893    1.7258 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6851    1.2990    1.5331 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9469    1.7670    0.2656 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4200    3.0629    0.0412 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6220    3.8752    1.1361 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0973    5.1830    0.9372 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3711    3.4419    2.4208 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5834    4.2833    3.5142 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9078    2.1619    2.5891 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7120   -0.2153    1.6742 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3027   -1.0334    2.7575 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0713   -0.7425    0.4550 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0667   -1.8125    0.7033 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4596   -3.0338    1.2031 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8107   -3.2220    1.4476 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4819   -4.0065    1.4372 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8475   -3.8077    1.1855 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7564   -4.8172    1.4366 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2481   -2.5910    0.6864 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2816   -1.6235    0.4576 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7458   -0.4057   -0.0501 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9768    0.1529    0.3716 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5867    1.0053   -0.6762 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1107    2.2271   -0.3287 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7032    3.0823   -1.2781 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2146    4.2989   -0.8775 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7754    2.7141   -2.5991 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3481    3.5177   -3.5747 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2420    1.4711   -2.9511 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3162    1.1045   -4.2786 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6688    0.6571   -1.9984 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9773   -0.8441    0.8110 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2470   -0.4974    0.3639 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6765   -2.2590    0.3800 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9537   -3.5445   -3.6207 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.0644   -2.2696   -3.8078 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1284   -1.7091   -3.0972 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2954   -1.8792   -1.0926 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.5065   -0.3412    2.7816 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7698    1.0835   -0.5558 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6172    3.4061   -0.9542 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2957    5.5501    0.0335 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.9205    5.2206    3.4165 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7069    1.8140    3.6136 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2983    0.8267    1.8488 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.9961   -1.0205    3.4743 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.4792    0.0788   -0.0699 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1692   -4.0953    1.8150 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1616   -4.9516    1.8265 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7303   -4.7534    1.2825 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7092    0.8075    1.2412 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0802    2.5691    0.7059 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6456    4.9471   -1.5010 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7503    4.4170   -3.4046 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7404    1.7198   -4.9511 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2514   -0.3149   -2.2722 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0171   -0.8637    1.9195 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9399   -0.6553    1.0793 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7800   -2.2683   -0.7412 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3984   -2.9658    0.7741 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  4  6  2  0
  6  7  1  0
  7  8  2  0
  7  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 14 16  1  0
 16 17  1  0
 16 18  2  0
 10 19  1  0
 19 20  1  0
 19 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 23 25  1  0
 25 26  2  0
 26 27  1  0
 26 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  1  0
 34 36  2  0
 36 37  1  0
 36 38  1  0
 38 39  1  0
 38 40  2  0
 31 41  1  0
 41 42  1  0
 41 43  1  0
  8  2  1  0
 18 11  1  0
 29 22  1  0
 40 32  1  0
 21  6  1  0
 43 28  1  0
  1 44  1  0
  3 45  1  0
  5 46  1  0
  8 47  1  0
 10 48  1  0
 12 49  1  0
 13 50  1  0
 15 51  1  0
 17 52  1  0
 18 53  1  0
 19 54  1  0
 20 55  1  0
 21 56  1  0
 24 57  1  0
 25 58  1  0
 27 59  1  0
 31 60  1  0
 33 61  1  0
 35 62  1  0
 37 63  1  0
 39 64  1  0
 40 65  1  0
 41 66  1  0
 42 67  1  0
 43 68  1  0
 43 69  1  0
M  END

View in JSmol View Stereo Labels

Synonyms

Value	Source
Epicatechin-(4b->8)-gallocatechin	Generator
Epicatechin-(4β->8)-gallocatechin	Generator
Epicatechin(4b->8)gallocatechin	HMDB

Chemical Formula

C₃₀H₂₆O₁₃

Average Molecular Weight

594.5196

Monoisotopic Molecular Weight

594.137340918

IUPAC Name

8-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-1-benzopyran-4-yl]-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-1-benzopyran-3,5,7-triol

Traditional Name

8-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-1-benzopyran-4-yl]-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-1-benzopyran-3,5,7-triol

CAS Registry Number

Not Available

SMILES

OC1CC2=C(O)C=C(O)C(C3C(O)C(OC4=CC(O)=CC(O)=C34)C3=CC=C(O)C(O)=C3)=C2OC1C1=CC(O)=C(O)C(O)=C1

InChI Identifier

InChI=1S/C30H26O13/c31-12-6-17(35)23-22(7-12)42-29(10-1-2-14(32)16(34)3-10)27(41)25(23)24-18(36)9-15(33)13-8-21(39)28(43-30(13)24)11-4-19(37)26(40)20(38)5-11/h1-7,9,21,25,27-29,31-41H,8H2

InChI Key

YJMNEZANCYQLJR-UHFFFAOYSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as biflavonoids and polyflavonoids. These are organic compounds containing at least two flavan/flavone units. These units are usually linked through CC or C-O-C bonds. Some examples include C2-O-C3, C2-O-C4, C3'-C3''', and C6-C8''.

Kingdom

Organic compounds

Super Class

Phenylpropanoids and polyketides

Class

Flavonoids

Sub Class

Biflavonoids and polyflavonoids

Direct Parent

Biflavonoids and polyflavonoids

Alternative Parents

Substituents

B-type proanthocyanidin
Bi- and polyflavonoid skeleton
Proanthocyanidin
Epigallocatechin
Catechin
3'-hydroxyflavonoid
Flavan-3-ol
Hydroxyflavonoid
3-hydroxyflavonoid
7-hydroxyflavonoid
5-hydroxyflavonoid
4'-hydroxyflavonoid
Flavan
Chromane
1-benzopyran
Benzopyran
Benzenetriol
Pyrogallol derivative
Catechol
Phenol
1-hydroxy-4-unsubstituted benzenoid
Alkyl aryl ether
1-hydroxy-2-unsubstituted benzenoid
Benzenoid
Monocyclic benzene moiety
Secondary alcohol
Polyol
Organoheterocyclic compound
Oxacycle
Ether
Hydrocarbon derivative
Alcohol
Organic oxygen compound
Organooxygen compound
Aromatic heteropolycyclic compound

Molecular Framework

Aromatic heteropolycyclic compounds

External Descriptors

Not Available

Ontology

Physiological effect

Not Available

Disposition

Biological location

Cellular substructure

Extracellular (HMDB: HMDB0036303)
Cytoplasm (HMDB: HMDB0036303)

Cytoplasm (HMDB: HMDB0036303)
Extracellular (HMDB: HMDB0036303)

Route of exposure

Enteral

Ingestion (HMDB: HMDB0036303)

Source

Exogenous

Food

Food (HMDB: HMDB0036303)

Fruit

Fruits (FooDB: FOOD00871)

Endogenous

Plant

Plant (HMDB: HMDB0036303)

Not Available

Nutrient (HMDB: HMDB0036303)

Physical Properties

State

Not Available

Experimental Molecular Properties

Property	Value	Reference
Melting Point	Not Available	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	Not Available	Not Available
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	0.18 g/L	ALOGPS
logP	2.22	ALOGPS
logP	2.81	ChemAxon
logS	-3.5	ALOGPS
pKa (Strongest Acidic)	8.56	ChemAxon
pKa (Strongest Basic)	-5.2	ChemAxon
Physiological Charge	0	ChemAxon
Hydrogen Acceptor Count	13	ChemAxon
Hydrogen Donor Count	11	ChemAxon
Polar Surface Area	240.99 Å²	ChemAxon
Rotatable Bond Count	3	ChemAxon
Refractivity	148.49 m³·mol⁻¹	ChemAxon
Polarizability	56.68 Å³	ChemAxon
Number of Rings	6	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	No	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DarkChem	[M+H]+	234.314	31661259
DarkChem	[M-H]-	224.081	31661259
DeepCCS	[M-2H]-	257.333	30932474
DeepCCS	[M+Na]+	231.566	30932474
AllCCS	[M+H]+	238.6	32859911
AllCCS	[M+H-H2O]+	237.1	32859911
AllCCS	[M+NH4]+	240.0	32859911
AllCCS	[M+Na]+	240.4	32859911
AllCCS	[M-H]-	234.2	32859911
AllCCS	[M+Na-2H]-	236.0	32859911
AllCCS	[M+HCOO]-	238.1	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
Epicatechin-(4beta->8)-gallocatechin	OC1CC2=C(O)C=C(O)C(C3C(O)C(OC4=CC(O)=CC(O)=C34)C3=CC=C(O)C(O)=C3)=C2OC1C1=CC(O)=C(O)C(O)=C1	7495.7	Standard polar	33892256
Epicatechin-(4beta->8)-gallocatechin	OC1CC2=C(O)C=C(O)C(C3C(O)C(OC4=CC(O)=CC(O)=C34)C3=CC=C(O)C(O)=C3)=C2OC1C1=CC(O)=C(O)C(O)=C1	5177.3	Standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin	OC1CC2=C(O)C=C(O)C(C3C(O)C(OC4=CC(O)=CC(O)=C34)C3=CC=C(O)C(O)=C3)=C2OC1C1=CC(O)=C(O)C(O)=C1	6280.5	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
Epicatechin-(4beta->8)-gallocatechin,1TMS,isomer #1	C[Si](C)(C)OC1CC2=C(O)C=C(O)C(C3C4=C(O)C=C(O)C=C4OC(C4=CC=C(O)C(O)=C4)C3O)=C2OC1C1=CC(O)=C(O)C(O)=C1	5929.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,1TMS,isomer #10	C[Si](C)(C)OC1=C(O)C=C(C2OC3=C(CC2O)C(O)=CC(O)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)C=C1O	5973.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,1TMS,isomer #2	C[Si](C)(C)OC1=CC(O)=C(C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)C2=C1CC(O)C(C1=CC(O)=C(O)C(O)=C1)O2	5971.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,1TMS,isomer #3	C[Si](C)(C)OC1=CC(O)=C2CC(O)C(C3=CC(O)=C(O)C(O)=C3)OC2=C1C1C2=C(O)C=C(O)C=C2OC(C2=CC=C(O)C(O)=C2)C1O	5970.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,1TMS,isomer #4	C[Si](C)(C)OC1C(C2=CC=C(O)C(O)=C2)OC2=CC(O)=CC(O)=C2C1C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C2	5937.8	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,1TMS,isomer #5	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C2	5994.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,1TMS,isomer #6	C[Si](C)(C)OC1=CC(O)=CC2=C1C(C1=C(O)C=C(O)C3=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C3)C(O)C(C1=CC=C(O)C(O)=C1)O2	5986.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,1TMS,isomer #7	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O)C=C1O	6016.6	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,1TMS,isomer #8	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O)=CC=C1O	5997.4	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,1TMS,isomer #9	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)=CC(O)=C1O	5964.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TMS,isomer #1	C[Si](C)(C)OC1=CC(O)=C(C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)C2=C1CC(O[Si](C)(C)C)C(C1=CC(O)=C(O)C(O)=C1)O2	5792.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TMS,isomer #10	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C(C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)C2=C1CC(O)C(C1=CC(O)=C(O)C(O)=C1)O2	5794.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TMS,isomer #11	C[Si](C)(C)OC1=CC(O)=C(C2C3=C(O[Si](C)(C)C)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)C2=C1CC(O)C(C1=CC(O)=C(O)C(O)=C1)O2	5813.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TMS,isomer #12	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O)C=C(O[Si](C)(C)C)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C2	5837.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TMS,isomer #13	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O)C=C1O	5856.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TMS,isomer #14	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O)=CC=C1O	5837.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TMS,isomer #15	C[Si](C)(C)OC1=CC(O)=C(C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O[Si](C)(C)C)C2=C1CC(O)C(C1=CC(O)=C(O)C(O)=C1)O2	5796.6	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TMS,isomer #16	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)=CC(O)=C1O	5807.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TMS,isomer #17	C[Si](C)(C)OC1=CC(O)=C(C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)C2=C1CC(O)C(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)O2	5857.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TMS,isomer #18	C[Si](C)(C)OC1=CC(O)=CC2=C1C(C1=C(O[Si](C)(C)C)C=C(O)C3=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C3)C(O)C(C1=CC=C(O)C(O)=C1)O2	5826.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TMS,isomer #19	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O[Si](C)(C)C)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C2	5837.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TMS,isomer #2	C[Si](C)(C)OC1=CC(O)=C2CC(O[Si](C)(C)C)C(C3=CC(O)=C(O)C(O)=C3)OC2=C1C1C2=C(O)C=C(O)C=C2OC(C2=CC=C(O)C(O)=C2)C1O	5799.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TMS,isomer #20	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O)C=C1O	5862.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TMS,isomer #21	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O)=CC=C1O	5837.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TMS,isomer #22	C[Si](C)(C)OC1=CC(O)=C2CC(O)C(C3=CC(O)=C(O)C(O)=C3)OC2=C1C1C2=C(O)C=C(O)C=C2OC(C2=CC=C(O)C(O)=C2)C1O[Si](C)(C)C	5806.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TMS,isomer #23	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O[Si](C)(C)C)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)=CC(O)=C1O	5807.6	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TMS,isomer #24	C[Si](C)(C)OC1=CC(O)=C2CC(O)C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC2=C1C1C2=C(O)C=C(O)C=C2OC(C2=CC=C(O)C(O)=C2)C1O	5857.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TMS,isomer #25	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O[Si](C)(C)C)C=C1O	5838.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TMS,isomer #26	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O[Si](C)(C)C)=CC=C1O	5822.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TMS,isomer #27	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O[Si](C)(C)C)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C2	5827.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TMS,isomer #28	C[Si](C)(C)OC1=CC(O)=CC2=C1C(C1=C(O)C=C(O)C3=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C3)C(O[Si](C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	5814.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TMS,isomer #29	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O[Si](C)(C)C)=CC(O)=C1O	5791.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TMS,isomer #3	C[Si](C)(C)OC1=CC(O)=CC2=C1C(C1=C(O)C=C(O)C3=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O[Si](C)(C)C)C3)C(O)C(C1=CC=C(O)C(O)=C1)O2	5816.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TMS,isomer #30	C[Si](C)(C)OC1=C(O)C=C(C2OC3=C(CC2O)C(O)=CC(O)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O[Si](C)(C)C)C=C1O	5839.4	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TMS,isomer #31	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C(O)C3=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C3)C(O)C(C1=CC=C(O)C(O)=C1)O2	5815.6	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TMS,isomer #32	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O)=C1)C(O)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C2	5888.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TMS,isomer #33	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C)=C1)C(O)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C2	5864.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TMS,isomer #34	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O[Si](C)(C)C)=C1)C(O)C2	5844.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TMS,isomer #35	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)C(O)C2	5886.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TMS,isomer #36	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O)=C3C2C3=C(O[Si](C)(C)C)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)=CC(O)=C1O	5803.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TMS,isomer #37	C[Si](C)(C)OC1=CC(O)=CC2=C1C(C1=C(O)C=C(O)C3=C1OC(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)C(O)C3)C(O)C(C1=CC=C(O)C(O)=C1)O2	5853.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TMS,isomer #38	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O)C=C1O	5857.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TMS,isomer #39	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O)=CC=C1O	5828.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TMS,isomer #4	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O[Si](C)(C)C)C2	5829.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TMS,isomer #40	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)C(O)C4)C2O)C=C1O	5857.8	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TMS,isomer #41	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)C(O)C4)C2O)C=C1O	5899.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TMS,isomer #42	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O)C=C1O[Si](C)(C)C	5819.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TMS,isomer #43	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)C(O)C4)C2O)=CC=C1O	5841.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TMS,isomer #44	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)C(O)C4)C2O)=CC=C1O	5881.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TMS,isomer #45	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)=CC(O[Si](C)(C)C)=C1O	5801.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TMS,isomer #46	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)=CC(O)=C1O[Si](C)(C)C	5808.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TMS,isomer #5	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O[Si](C)(C)C)C4)C2O)C=C1O	5841.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TMS,isomer #6	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O[Si](C)(C)C)C4)C2O)=CC=C1O	5826.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TMS,isomer #7	C[Si](C)(C)OC1CC2=C(O)C=C(O)C(C3C4=C(O)C=C(O)C=C4OC(C4=CC=C(O)C(O)=C4)C3O[Si](C)(C)C)=C2OC1C1=CC(O)=C(O)C(O)=C1	5768.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TMS,isomer #8	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)=CC(O)=C1O	5795.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TMS,isomer #9	C[Si](C)(C)OC1=C(O)C=C(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)C=C1O	5843.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #1	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C(C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)C2=C1CC(O[Si](C)(C)C)C(C1=CC(O)=C(O)C(O)=C1)O2	5681.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #10	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O[Si](C)(C)C)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O[Si](C)(C)C)C2	5716.4	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #100	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O[Si](C)(C)C)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)C(O)C2	5707.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #101	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O)=C3C2C3=C(O[Si](C)(C)C)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O[Si](C)(C)C)=CC(O)=C1O	5640.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #102	C[Si](C)(C)OC1=CC(O)=CC2=C1C(C1=C(O)C=C(O)C3=C1OC(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)C(O)C3)C(O[Si](C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	5667.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #103	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C1O	5670.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #104	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O[Si](C)(C)C)=CC(O)=C1O[Si](C)(C)C	5672.4	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #105	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C(O)C3=C1OC(C1=CC(O)=C(O)C(O[Si](C)(C)C)=C1)C(O)C3)C(O)C(C1=CC=C(O)C(O)=C1)O2	5695.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #106	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C(O)C3=C1OC(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)C(O)C3)C(O)C(C1=CC=C(O)C(O)=C1)O2	5682.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #107	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C(O)C3=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C3)C(O)C(C1=CC=C(O[Si](C)(C)C)C(O)=C1)O2	5728.6	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #108	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C(O)C3=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C3)C(O)C(C1=CC=C(O)C(O[Si](C)(C)C)=C1)O2	5703.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #109	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)C(O)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C2	5770.6	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #11	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O[Si](C)(C)C)C4)C2O)C=C1O	5727.8	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #110	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O)=C1)C(O)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O[Si](C)(C)C)=C1)C(O)C2	5739.8	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #111	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O)=C1)C(O)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)C(O)C2	5717.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #112	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C)=C1)C(O)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O[Si](C)(C)C)=C1)C(O)C2	5714.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #113	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C)=C1)C(O)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)C(O)C2	5688.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #114	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C1)C(O)C2	5738.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #115	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)C(O)C2	5714.8	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #116	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)C(O)C4)C2O)C=C1O	5700.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #117	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)C(O)C4)C2O)=CC=C1O	5673.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #118	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O)=C3C2C3=C(O[Si](C)(C)C)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)=CC(O[Si](C)(C)C)=C1O	5683.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #119	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O)=C3C2C3=C(O[Si](C)(C)C)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)=CC(O)=C1O[Si](C)(C)C	5663.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #12	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O[Si](C)(C)C)C4)C2O)=CC=C1O	5710.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #120	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)C(O)C4)C2O)C=C1O	5679.4	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #121	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)C(O)C4)C2O)=CC=C1O	5645.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #122	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O)C=C1O[Si](C)(C)C	5726.6	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #123	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)C(O)C4)C2O)C=C1O	5749.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #124	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)C(O)C4)C2O)C=C1O	5729.6	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #125	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)C(O)C4)C2O)C=C1O[Si](C)(C)C	5741.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #126	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)C(O)C4)C2O)C=C1O[Si](C)(C)C	5746.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #127	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)C(O)C4)C2O)=CC=C1O	5725.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #128	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)C(O)C4)C2O)=CC=C1O	5699.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #129	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C	5704.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #13	C[Si](C)(C)OC1=CC(O)=C2CC(O[Si](C)(C)C)C(C3=CC(O)=C(O)C(O)=C3)OC2=C1C1C2=C(O)C=C(O)C=C2OC(C2=CC=C(O)C(O)=C2)C1O[Si](C)(C)C	5660.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #14	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O[Si](C)(C)C)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)=CC(O)=C1O	5678.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #15	C[Si](C)(C)OC1=CC(O)=C2CC(O[Si](C)(C)C)C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC2=C1C1C2=C(O)C=C(O)C=C2OC(C2=CC=C(O)C(O)=C2)C1O	5695.4	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #16	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C(O)C3=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O[Si](C)(C)C)C3)C(O)C(C1=CC=C(O)C(O)=C1)O2	5696.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #17	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O)=C3C2C3=C(O[Si](C)(C)C)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)=CC(O)=C1O	5662.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #18	C[Si](C)(C)OC1=CC(O)=CC2=C1C(C1=C(O)C=C(O)C3=C1OC(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)C(O[Si](C)(C)C)C3)C(O)C(C1=CC=C(O)C(O)=C1)O2	5685.8	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #19	C[Si](C)(C)OC1=CC(O)=CC2=C1C(C1=C(O)C=C(O)C3=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O[Si](C)(C)C)C3)C(O[Si](C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	5666.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #2	C[Si](C)(C)OC1=CC(O)=C(C2C3=C(O[Si](C)(C)C)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)C2=C1CC(O[Si](C)(C)C)C(C1=CC(O)=C(O)C(O)=C1)O2	5678.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #20	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O[Si](C)(C)C)C4)C2O)C=C1O	5708.8	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #21	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O[Si](C)(C)C)C4)C2O)=CC=C1O	5689.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #22	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O)=C1)C(O)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O[Si](C)(C)C)C2	5759.6	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #23	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C)=C1)C(O)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O[Si](C)(C)C)C2	5738.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #24	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O[Si](C)(C)C)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O[Si](C)(C)C)C2	5694.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #25	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O[Si](C)(C)C)=C1)C(O[Si](C)(C)C)C2	5722.8	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #26	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)C(O[Si](C)(C)C)C2	5735.6	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #27	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)C(O[Si](C)(C)C)C4)C2O)C=C1O	5741.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #28	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)C(O[Si](C)(C)C)C4)C2O)C=C1O	5763.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #29	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O[Si](C)(C)C)C4)C2O[Si](C)(C)C)C=C1O	5699.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #3	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O)C=C(O[Si](C)(C)C)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O[Si](C)(C)C)C2	5728.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #30	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O[Si](C)(C)C)C4)C2O)C=C1O[Si](C)(C)C	5722.4	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #31	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)C(O[Si](C)(C)C)C4)C2O)=CC=C1O	5719.8	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #32	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)C(O[Si](C)(C)C)C4)C2O)=CC=C1O	5737.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #33	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O[Si](C)(C)C)C4)C2O[Si](C)(C)C)=CC=C1O	5687.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #34	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O[Si](C)(C)C)=CC(O)=C1O	5659.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #35	C[Si](C)(C)OC1=C(O)C=C(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O[Si](C)(C)C)C=C1O	5697.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #36	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)=CC(O[Si](C)(C)C)=C1O	5698.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #37	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)=CC(O)=C1O[Si](C)(C)C	5701.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #38	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C(C2C3=C(O[Si](C)(C)C)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)C2=C1CC(O)C(C1=CC(O)=C(O)C(O)=C1)O2	5677.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #39	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C2	5709.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #4	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O[Si](C)(C)C)C4)C2O)C=C1O	5734.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #40	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O)C=C1O	5724.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #41	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O)=CC=C1O	5706.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #42	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C(C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O[Si](C)(C)C)C2=C1CC(O)C(C1=CC(O)=C(O)C(O)=C1)O2	5663.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #43	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)=CC(O)=C1O	5686.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #44	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C(C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)C2=C1CC(O)C(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)O2	5683.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #45	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C(O[Si](C)(C)C)C3=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C3)C(O)C(C1=CC=C(O)C(O)=C1)O2	5708.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #46	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O)C=C1O	5722.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #47	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O)=CC=C1O	5702.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #48	C[Si](C)(C)OC1=CC(O)=C(C2C3=C(O[Si](C)(C)C)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O[Si](C)(C)C)C2=C1CC(O)C(C1=CC(O)=C(O)C(O)=C1)O2	5665.6	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #49	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O)=C3C2C3=C(O[Si](C)(C)C)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)=CC(O)=C1O	5679.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #5	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O[Si](C)(C)C)C4)C2O)=CC=C1O	5715.6	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #50	C[Si](C)(C)OC1=CC(O)=C(C2C3=C(O[Si](C)(C)C)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)C2=C1CC(O)C(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)O2	5680.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #51	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O)=C1)C(O)C2C1=C(O)C=C(O[Si](C)(C)C)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C2	5758.4	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #52	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C)=C1)C(O)C2C1=C(O)C=C(O[Si](C)(C)C)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C2	5739.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #53	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O[Si](C)(C)C)C2C1=C(O)C=C(O[Si](C)(C)C)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C2	5703.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #54	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O)C=C(O[Si](C)(C)C)C2=C1OC(C1=CC(O)=C(O)C(O[Si](C)(C)C)=C1)C(O)C2	5733.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #55	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O)C=C(O[Si](C)(C)C)C2=C1OC(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)C(O)C2	5723.6	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #56	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)C(O)C4)C2O)C=C1O	5739.6	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #57	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)C(O)C4)C2O)C=C1O	5721.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #58	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O[Si](C)(C)C)C=C1O	5712.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #59	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O)C=C1O[Si](C)(C)C	5750.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #6	C[Si](C)(C)OC1=CC(O)=C(C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O[Si](C)(C)C)C2=C1CC(O[Si](C)(C)C)C(C1=CC(O)=C(O)C(O)=C1)O2	5658.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #60	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)C(O)C4)C2O)=CC=C1O	5719.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #61	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)C(O)C4)C2O)=CC=C1O	5691.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #62	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O[Si](C)(C)C)=CC=C1O	5694.6	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #63	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O[Si](C)(C)C)=CC(O)=C1O	5664.6	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #64	C[Si](C)(C)OC1=CC(O)=C(C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O[Si](C)(C)C)C2=C1CC(O)C(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)O2	5685.8	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #65	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)=CC(O[Si](C)(C)C)=C1O	5716.8	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #66	C[Si](C)(C)OC1=CC(O)=C(C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)C2=C1CC(O)C(C1=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)O2	5697.6	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #67	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O[Si](C)(C)C)C=C(O)C3=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C3)C(O)C(C1=CC=C(O)C(O)=C1)O2	5694.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #68	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O[Si](C)(C)C)=C3C2C3=C(O[Si](C)(C)C)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)=CC(O)=C1O	5668.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #69	C[Si](C)(C)OC1=CC(O)=CC2=C1C(C1=C(O[Si](C)(C)C)C=C(O)C3=C1OC(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)C(O)C3)C(O)C(C1=CC=C(O)C(O)=C1)O2	5676.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #7	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)=CC(O)=C1O	5686.8	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #70	C[Si](C)(C)OC1=CC(O)=CC2=C1C(C1=C(O[Si](C)(C)C)C=C(O)C3=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C3)C(O[Si](C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	5665.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #71	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O[Si](C)(C)C)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O)C=C1O	5714.6	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #72	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O[Si](C)(C)C)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O)=CC=C1O	5691.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #73	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O)=C1)C(O)C2C1=C(O[Si](C)(C)C)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C2	5741.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #74	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C)=C1)C(O)C2C1=C(O[Si](C)(C)C)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C2	5718.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #75	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O[Si](C)(C)C)C2C1=C(O[Si](C)(C)C)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C2	5693.4	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #76	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O[Si](C)(C)C)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O[Si](C)(C)C)=C1)C(O)C2	5711.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #77	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O[Si](C)(C)C)C=C(O)C2=C1OC(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)C(O)C2	5704.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #78	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)C(O)C4)C2O)C=C1O	5726.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #79	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C(O)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)C(O)C4)C2O)C=C1O	5719.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #8	C[Si](C)(C)OC1=CC(O)=C(C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)C2=C1CC(O[Si](C)(C)C)C(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)O2	5709.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #80	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O[Si](C)(C)C)C=C1O	5705.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #81	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O)C=C1O[Si](C)(C)C	5740.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #82	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)C(O)C4)C2O)=CC=C1O	5700.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #83	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C(O)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)C(O)C4)C2O)=CC=C1O	5683.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #84	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O[Si](C)(C)C)=CC=C1O	5686.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #85	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O[Si](C)(C)C)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O[Si](C)(C)C)=CC(O)=C1O	5653.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #86	C[Si](C)(C)OC1=CC(O)=C2CC(O)C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC2=C1C1C2=C(O)C=C(O)C=C2OC(C2=CC=C(O)C(O)=C2)C1O[Si](C)(C)C	5671.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #87	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O[Si](C)(C)C)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)=CC(O[Si](C)(C)C)=C1O	5701.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #88	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O[Si](C)(C)C)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)=CC(O)=C1O[Si](C)(C)C	5677.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #89	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O)=C1)C(O[Si](C)(C)C)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C2	5734.6	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #9	C[Si](C)(C)OC1=CC(O)=CC2=C1C(C1=C(O[Si](C)(C)C)C=C(O)C3=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O[Si](C)(C)C)C3)C(O)C(C1=CC=C(O)C(O)=C1)O2	5678.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #90	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O[Si](C)(C)C)C=C1O	5691.8	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #91	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)C(O)C4)C2O[Si](C)(C)C)C=C1O	5708.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #92	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)C(O)C4)C2O[Si](C)(C)C)C=C1O	5730.8	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #93	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O[Si](C)(C)C)C=C1O[Si](C)(C)C	5709.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #94	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C)=C1)C(O[Si](C)(C)C)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C2	5714.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #95	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O[Si](C)(C)C)=CC=C1O	5673.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #96	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)C(O)C4)C2O[Si](C)(C)C)=CC=C1O	5689.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #97	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)C(O)C4)C2O[Si](C)(C)C)=CC=C1O	5706.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #98	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C(O)C3=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C3)C(O[Si](C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	5681.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,3TMS,isomer #99	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O[Si](C)(C)C)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O[Si](C)(C)C)=C1)C(O)C2	5693.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #1	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C(C2C3=C(O[Si](C)(C)C)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)C2=C1CC(O[Si](C)(C)C)C(C1=CC(O)=C(O)C(O)=C1)O2	5565.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #10	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O[Si](C)(C)C)C4)C2O)=CC=C1O	5578.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #100	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C)=C1)C(O)C2C1=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C2	5544.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #101	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O[Si](C)(C)C)C2C1=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C2	5571.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #102	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C2=C1OC(C1=CC(O)=C(O)C(O[Si](C)(C)C)=C1)C(O)C2	5546.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #103	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C2=C1OC(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)C(O)C2	5515.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #104	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)C(O)C4)C2O)C=C1O	5522.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #105	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)C(O)C4)C2O)C=C1O	5476.4	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #106	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O[Si](C)(C)C)C=C1O	5567.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #107	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O)C=C1O[Si](C)(C)C	5621.6	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #108	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)C(O)C4)C2O)=CC=C1O	5496.8	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #109	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)C(O)C4)C2O)=CC=C1O	5457.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #11	C[Si](C)(C)OC1=CC(O)=C(C2C3=C(O[Si](C)(C)C)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O[Si](C)(C)C)C2=C1CC(O[Si](C)(C)C)C(C1=CC(O)=C(O)C(O)=C1)O2	5552.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #110	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O[Si](C)(C)C)=CC=C1O	5554.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #111	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O[Si](C)(C)C)=CC(O)=C1O	5527.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #112	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C(C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O[Si](C)(C)C)C2=C1CC(O)C(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)O2	5521.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #113	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)=CC(O[Si](C)(C)C)=C1O	5554.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #114	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C(C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)C2=C1CC(O)C(C1=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)O2	5555.6	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #115	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C(O[Si](C)(C)C)C3=C1OC(C1=CC(O)=C(O)C(O[Si](C)(C)C)=C1)C(O)C3)C(O)C(C1=CC=C(O)C(O)=C1)O2	5549.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #116	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C(O[Si](C)(C)C)C3=C1OC(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)C(O)C3)C(O)C(C1=CC=C(O)C(O)=C1)O2	5519.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #117	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C(O[Si](C)(C)C)C3=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C3)C(O[Si](C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	5570.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #118	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C(O[Si](C)(C)C)C3=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C3)C(O)C(C1=CC=C(O[Si](C)(C)C)C(O)=C1)O2	5567.6	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #119	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C(O[Si](C)(C)C)C3=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C3)C(O)C(C1=CC=C(O)C(O[Si](C)(C)C)=C1)O2	5542.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #12	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O)=C3C2C3=C(O[Si](C)(C)C)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)=CC(O)=C1O	5561.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #120	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)C(O)C4)C2O)C=C1O	5518.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #121	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)C(O)C4)C2O)C=C1O	5477.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #122	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O[Si](C)(C)C)C=C1O	5568.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #123	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O)C=C1O[Si](C)(C)C	5622.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #124	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)C(O)C4)C2O)=CC=C1O	5494.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #125	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)C(O)C4)C2O)=CC=C1O	5459.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #126	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O[Si](C)(C)C)=CC=C1O	5554.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #127	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O)=C3C2C3=C(O[Si](C)(C)C)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O[Si](C)(C)C)=CC(O)=C1O	5524.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #128	C[Si](C)(C)OC1=CC(O)=C(C2C3=C(O[Si](C)(C)C)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O[Si](C)(C)C)C2=C1CC(O)C(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)O2	5513.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #129	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O)=C3C2C3=C(O[Si](C)(C)C)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)=CC(O[Si](C)(C)C)=C1O	5550.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #13	C[Si](C)(C)OC1=CC(O)=C(C2C3=C(O[Si](C)(C)C)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)C2=C1CC(O[Si](C)(C)C)C(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)O2	5549.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #130	C[Si](C)(C)OC1=CC(O)=C(C2C3=C(O[Si](C)(C)C)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)C2=C1CC(O)C(C1=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)O2	5555.8	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #131	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)C(O)C2C1=C(O)C=C(O[Si](C)(C)C)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C2	5647.8	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #132	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O)=C1)C(O[Si](C)(C)C)C2C1=C(O)C=C(O[Si](C)(C)C)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C2	5594.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #133	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O)=C1)C(O)C2C1=C(O)C=C(O[Si](C)(C)C)C2=C1OC(C1=CC(O)=C(O)C(O[Si](C)(C)C)=C1)C(O)C2	5547.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #134	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O)=C1)C(O)C2C1=C(O)C=C(O[Si](C)(C)C)C2=C1OC(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)C(O)C2	5509.8	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #135	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C)=C1)C(O[Si](C)(C)C)C2C1=C(O)C=C(O[Si](C)(C)C)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C2	5580.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #136	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C)=C1)C(O)C2C1=C(O)C=C(O[Si](C)(C)C)C2=C1OC(C1=CC(O)=C(O)C(O[Si](C)(C)C)=C1)C(O)C2	5525.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #137	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C)=C1)C(O)C2C1=C(O)C=C(O[Si](C)(C)C)C2=C1OC(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)C(O)C2	5490.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #138	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O[Si](C)(C)C)C2C1=C(O)C=C(O[Si](C)(C)C)C2=C1OC(C1=CC(O)=C(O)C(O[Si](C)(C)C)=C1)C(O)C2	5563.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #139	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O[Si](C)(C)C)C2C1=C(O)C=C(O[Si](C)(C)C)C2=C1OC(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)C(O)C2	5547.6	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #14	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O)=C1)C(O)C2C1=C(O)C=C(O[Si](C)(C)C)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O[Si](C)(C)C)C2	5637.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #140	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O)C=C(O[Si](C)(C)C)C2=C1OC(C1=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C1)C(O)C2	5594.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #141	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O)C=C(O[Si](C)(C)C)C2=C1OC(C1=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)C(O)C2	5589.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #142	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)C(O)C4)C2O)C=C1O	5562.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #143	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)C(O)C4)C2O)C=C1O	5551.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #144	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)C(O)C4)C2O[Si](C)(C)C)C=C1O	5548.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #145	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)C(O)C4)C2O)C=C1O[Si](C)(C)C	5606.4	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #146	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)C(O)C4)C2O[Si](C)(C)C)C=C1O	5515.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #147	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)C(O)C4)C2O)C=C1O[Si](C)(C)C	5569.8	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #148	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O[Si](C)(C)C)C=C1O[Si](C)(C)C	5629.4	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #149	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)C(O)C4)C2O)=CC=C1O	5537.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #15	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C)=C1)C(O)C2C1=C(O)C=C(O[Si](C)(C)C)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O[Si](C)(C)C)C2	5612.6	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #150	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)C(O)C4)C2O)=CC=C1O	5527.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #151	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)C(O)C4)C2O[Si](C)(C)C)=CC=C1O	5531.8	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #152	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)C(O)C4)C2O[Si](C)(C)C)=CC=C1O	5498.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #153	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C1O	5562.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #154	C[Si](C)(C)OC1=CC(O)=C(C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O[Si](C)(C)C)C2=C1CC(O)C(C1=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)O2	5555.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #155	C[Si](C)(C)OC1=CC(O)=C(C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)C2=C1CC(O)C(C1=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)O2	5616.8	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #156	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O[Si](C)(C)C)C=C(O)C3=C1OC(C1=CC(O)=C(O)C(O[Si](C)(C)C)=C1)C(O)C3)C(O)C(C1=CC=C(O)C(O)=C1)O2	5533.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #157	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O[Si](C)(C)C)C=C(O)C3=C1OC(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)C(O)C3)C(O)C(C1=CC=C(O)C(O)=C1)O2	5507.6	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #158	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O[Si](C)(C)C)C=C(O)C3=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C3)C(O[Si](C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	5563.6	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #159	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O[Si](C)(C)C)C=C(O)C3=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C3)C(O)C(C1=CC=C(O[Si](C)(C)C)C(O)=C1)O2	5556.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #16	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O[Si](C)(C)C)C2C1=C(O)C=C(O[Si](C)(C)C)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O[Si](C)(C)C)C2	5596.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #160	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O[Si](C)(C)C)C=C(O)C3=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C3)C(O)C(C1=CC=C(O)C(O[Si](C)(C)C)=C1)O2	5530.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #161	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O[Si](C)(C)C)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)C(O)C4)C2O)C=C1O	5507.8	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #162	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O[Si](C)(C)C)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)C(O)C4)C2O)=CC=C1O	5481.4	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #163	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O[Si](C)(C)C)=C3C2C3=C(O[Si](C)(C)C)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O[Si](C)(C)C)=CC(O)=C1O	5517.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #164	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O[Si](C)(C)C)=C3C2C3=C(O[Si](C)(C)C)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)=CC(O[Si](C)(C)C)=C1O	5538.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #165	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O[Si](C)(C)C)=C3C2C3=C(O[Si](C)(C)C)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)=CC(O)=C1O[Si](C)(C)C	5541.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #166	C[Si](C)(C)OC1=CC(O)=CC2=C1C(C1=C(O[Si](C)(C)C)C=C(O)C3=C1OC(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)C(O)C3)C(O[Si](C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	5521.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #167	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O[Si](C)(C)C)C=C(O)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)C(O)C4)C2O)C=C1O	5459.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #168	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O[Si](C)(C)C)C=C(O)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)C(O)C4)C2O)=CC=C1O	5440.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #169	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O[Si](C)(C)C)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O[Si](C)(C)C)C=C1O	5565.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #17	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O)C=C(O[Si](C)(C)C)C2=C1OC(C1=CC(O)=C(O)C(O[Si](C)(C)C)=C1)C(O[Si](C)(C)C)C2	5609.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #170	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O[Si](C)(C)C)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O[Si](C)(C)C)=CC=C1O	5548.8	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #171	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O[Si](C)(C)C)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O)C=C1O[Si](C)(C)C	5616.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #172	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)C(O)C2C1=C(O[Si](C)(C)C)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C2	5635.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #173	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O)=C1)C(O[Si](C)(C)C)C2C1=C(O[Si](C)(C)C)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C2	5583.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #174	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O)=C1)C(O)C2C1=C(O[Si](C)(C)C)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O[Si](C)(C)C)=C1)C(O)C2	5527.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #175	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O)=C1)C(O)C2C1=C(O[Si](C)(C)C)C=C(O)C2=C1OC(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)C(O)C2	5477.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #176	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C)=C1)C(O[Si](C)(C)C)C2C1=C(O[Si](C)(C)C)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C2	5567.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #177	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C)=C1)C(O)C2C1=C(O[Si](C)(C)C)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O[Si](C)(C)C)=C1)C(O)C2	5506.4	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #178	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C)=C1)C(O)C2C1=C(O[Si](C)(C)C)C=C(O)C2=C1OC(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)C(O)C2	5460.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #179	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O[Si](C)(C)C)C2C1=C(O[Si](C)(C)C)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O[Si](C)(C)C)=C1)C(O)C2	5549.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #18	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O)C=C(O[Si](C)(C)C)C2=C1OC(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)C(O[Si](C)(C)C)C2	5594.8	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #180	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O[Si](C)(C)C)C2C1=C(O[Si](C)(C)C)C=C(O)C2=C1OC(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)C(O)C2	5544.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #181	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O[Si](C)(C)C)C=C(O)C2=C1OC(C1=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C1)C(O)C2	5573.4	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #182	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O[Si](C)(C)C)C=C(O)C2=C1OC(C1=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)C(O)C2	5571.6	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #183	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C(O)C4=C3OC(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)C(O)C4)C2O)C=C1O	5555.6	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #184	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C(O)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)C(O)C4)C2O)C=C1O	5547.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #185	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)C(O)C4)C2O[Si](C)(C)C)C=C1O	5546.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #186	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)C(O)C4)C2O)C=C1O[Si](C)(C)C	5602.6	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #187	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C(O)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)C(O)C4)C2O[Si](C)(C)C)C=C1O	5517.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #188	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C(O)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)C(O)C4)C2O)C=C1O[Si](C)(C)C	5571.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #189	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O[Si](C)(C)C)C=C1O[Si](C)(C)C	5624.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #19	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)C(O[Si](C)(C)C)C4)C2O)C=C1O	5605.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #190	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C(O)C4=C3OC(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)C(O)C4)C2O)=CC=C1O	5527.8	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #191	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C(O)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)C(O)C4)C2O)=CC=C1O	5519.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #192	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)C(O)C4)C2O[Si](C)(C)C)=CC=C1O	5525.6	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #193	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C(O)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)C(O)C4)C2O[Si](C)(C)C)=CC=C1O	5493.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #194	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O[Si](C)(C)C)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C1O	5549.4	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #195	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O[Si](C)(C)C)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O[Si](C)(C)C)=CC(O)=C1O[Si](C)(C)C	5546.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #196	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O[Si](C)(C)C)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C	5598.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #197	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C(O)C3=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C3)C(O[Si](C)(C)C)C(C1=CC=C(O[Si](C)(C)C)C(O)=C1)O2	5575.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #198	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)C(O[Si](C)(C)C)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C2	5650.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #199	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O)=C1)C(O[Si](C)(C)C)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O[Si](C)(C)C)=C1)C(O)C2	5557.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #2	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O[Si](C)(C)C)C2	5607.6	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #20	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)C(O[Si](C)(C)C)C4)C2O)C=C1O	5571.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #200	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O)=C1)C(O[Si](C)(C)C)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)C(O)C2	5521.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #201	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)C(O)C4)C2O[Si](C)(C)C)C=C1O	5526.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #202	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)C(O)C4)C2O[Si](C)(C)C)C=C1O	5496.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #203	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O[Si](C)(C)C)C=C1O[Si](C)(C)C	5623.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #204	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)C(O)C4)C2O[Si](C)(C)C)C=C1O	5574.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #205	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)C(O)C4)C2O[Si](C)(C)C)C=C1O	5573.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #206	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)C(O)C4)C2O[Si](C)(C)C)C=C1O[Si](C)(C)C	5604.6	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #207	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)C(O)C4)C2O[Si](C)(C)C)C=C1O[Si](C)(C)C	5604.8	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #208	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C(O)C3=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C3)C(O[Si](C)(C)C)C(C1=CC=C(O)C(O[Si](C)(C)C)=C1)O2	5558.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #209	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C)=C1)C(O[Si](C)(C)C)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O[Si](C)(C)C)=C1)C(O)C2	5537.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #21	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O[Si](C)(C)C)C4)C2O[Si](C)(C)C)C=C1O	5600.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #210	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C)=C1)C(O[Si](C)(C)C)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)C(O)C2	5502.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #211	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)C(O)C4)C2O[Si](C)(C)C)=CC=C1O	5506.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #212	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)C(O)C4)C2O[Si](C)(C)C)=CC=C1O	5475.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #213	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)C(O)C4)C2O[Si](C)(C)C)=CC=C1O	5551.8	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #214	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)C(O)C4)C2O[Si](C)(C)C)=CC=C1O	5550.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #215	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C(O)C3=C1OC(C1=CC(O)=C(O)C(O[Si](C)(C)C)=C1)C(O)C3)C(O[Si](C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	5539.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #216	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C(O)C3=C1OC(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)C(O)C3)C(O[Si](C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	5526.8	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #217	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O[Si](C)(C)C)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C1)C(O)C2	5579.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #218	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O[Si](C)(C)C)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)C(O)C2	5573.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #219	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O)=C3C2C3=C(O[Si](C)(C)C)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C1O	5539.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #22	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O[Si](C)(C)C)C4)C2O)C=C1O[Si](C)(C)C	5661.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #220	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O)=C3C2C3=C(O[Si](C)(C)C)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O[Si](C)(C)C)=CC(O)=C1O[Si](C)(C)C	5535.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #221	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C	5588.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #222	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C(O)C3=C1OC(C1=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C1)C(O)C3)C(O)C(C1=CC=C(O)C(O)=C1)O2	5558.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #223	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C(O)C3=C1OC(C1=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)C(O)C3)C(O)C(C1=CC=C(O)C(O)=C1)O2	5564.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #224	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C(O)C3=C1OC(C1=CC(O)=C(O)C(O[Si](C)(C)C)=C1)C(O)C3)C(O)C(C1=CC=C(O[Si](C)(C)C)C(O)=C1)O2	5509.8	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #225	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C(O)C3=C1OC(C1=CC(O)=C(O)C(O[Si](C)(C)C)=C1)C(O)C3)C(O)C(C1=CC=C(O)C(O[Si](C)(C)C)=C1)O2	5486.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #226	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C(O)C3=C1OC(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)C(O)C3)C(O)C(C1=CC=C(O[Si](C)(C)C)C(O)=C1)O2	5465.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #227	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C(O)C3=C1OC(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)C(O)C3)C(O)C(C1=CC=C(O)C(O[Si](C)(C)C)=C1)O2	5449.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #228	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C(O)C3=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C3)C(O)C(C1=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)O2	5631.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #229	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)C(O)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O[Si](C)(C)C)=C1)C(O)C2	5616.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #23	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)C(O[Si](C)(C)C)C4)C2O)=CC=C1O	5579.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #230	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)C(O)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)C(O)C2	5578.6	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #231	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O)=C1)C(O)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C1)C(O)C2	5566.8	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #232	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O)=C1)C(O)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)C(O)C2	5556.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #233	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C)=C1)C(O)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C1)C(O)C2	5541.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #234	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C)=C1)C(O)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)C(O)C2	5530.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #235	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)C(O)C2	5637.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #236	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)C(O)C4)C2O)C=C1O	5535.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #237	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)C(O)C4)C2O)C=C1O	5530.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #238	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)C(O)C4)C2O)C=C1O[Si](C)(C)C	5589.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #239	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)C(O)C4)C2O)=CC=C1O	5505.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #24	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)C(O[Si](C)(C)C)C4)C2O)=CC=C1O	5545.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #240	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)C(O)C4)C2O)=CC=C1O	5504.4	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #241	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O)=C3C2C3=C(O[Si](C)(C)C)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C	5593.6	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #242	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)C(O)C4)C2O)C=C1O[Si](C)(C)C	5556.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #243	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)C(O)C4)C2O)C=C1O	5639.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #244	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)C(O)C4)C2O)C=C1O[Si](C)(C)C	5628.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #245	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)C(O)C4)C2O)C=C1O[Si](C)(C)C	5625.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #246	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)C(O)C4)C2O)=CC=C1O	5608.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #25	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O[Si](C)(C)C)C4)C2O[Si](C)(C)C)=CC=C1O	5587.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #26	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O[Si](C)(C)C)=CC(O)=C1O	5558.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #27	C[Si](C)(C)OC1=CC(O)=C(C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O[Si](C)(C)C)C2=C1CC(O[Si](C)(C)C)C(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)O2	5555.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #28	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)=CC(O[Si](C)(C)C)=C1O	5613.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #29	C[Si](C)(C)OC1=CC(O)=C(C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)C2=C1CC(O[Si](C)(C)C)C(C1=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)O2	5592.6	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #3	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O[Si](C)(C)C)C4)C2O)C=C1O	5608.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #30	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O[Si](C)(C)C)C=C(O)C3=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O[Si](C)(C)C)C3)C(O)C(C1=CC=C(O)C(O)=C1)O2	5591.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #31	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O[Si](C)(C)C)=C3C2C3=C(O[Si](C)(C)C)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)=CC(O)=C1O	5555.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #32	C[Si](C)(C)OC1=CC(O)=CC2=C1C(C1=C(O[Si](C)(C)C)C=C(O)C3=C1OC(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)C(O[Si](C)(C)C)C3)C(O)C(C1=CC=C(O)C(O)=C1)O2	5558.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #33	C[Si](C)(C)OC1=CC(O)=CC2=C1C(C1=C(O[Si](C)(C)C)C=C(O)C3=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O[Si](C)(C)C)C3)C(O[Si](C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	5557.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #34	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O[Si](C)(C)C)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O[Si](C)(C)C)C4)C2O)C=C1O	5597.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #35	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O[Si](C)(C)C)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O[Si](C)(C)C)C4)C2O)=CC=C1O	5572.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #36	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O)=C1)C(O)C2C1=C(O[Si](C)(C)C)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O[Si](C)(C)C)C2	5626.8	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #37	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C)=C1)C(O)C2C1=C(O[Si](C)(C)C)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O[Si](C)(C)C)C2	5600.8	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #38	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O[Si](C)(C)C)C2C1=C(O[Si](C)(C)C)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O[Si](C)(C)C)C2	5588.4	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #39	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O[Si](C)(C)C)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O[Si](C)(C)C)=C1)C(O[Si](C)(C)C)C2	5596.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #4	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O[Si](C)(C)C)C4)C2O)=CC=C1O	5584.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #40	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O[Si](C)(C)C)C=C(O)C2=C1OC(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)C(O[Si](C)(C)C)C2	5587.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #41	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)C(O[Si](C)(C)C)C4)C2O)C=C1O	5598.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #42	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C(O)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)C(O[Si](C)(C)C)C4)C2O)C=C1O	5564.4	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #43	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O[Si](C)(C)C)C4)C2O[Si](C)(C)C)C=C1O	5601.4	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #44	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O[Si](C)(C)C)C4)C2O)C=C1O[Si](C)(C)C	5657.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #45	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)C(O[Si](C)(C)C)C4)C2O)=CC=C1O	5569.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #46	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C(O)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)C(O[Si](C)(C)C)C4)C2O)=CC=C1O	5535.4	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #47	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O[Si](C)(C)C)C4)C2O[Si](C)(C)C)=CC=C1O	5588.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #48	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O[Si](C)(C)C)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O[Si](C)(C)C)=CC(O)=C1O	5551.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #49	C[Si](C)(C)OC1=CC(O)=C2CC(O[Si](C)(C)C)C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC2=C1C1C2=C(O)C=C(O)C=C2OC(C2=CC=C(O)C(O)=C2)C1O[Si](C)(C)C	5552.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #5	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C(C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O[Si](C)(C)C)C2=C1CC(O[Si](C)(C)C)C(C1=CC(O)=C(O)C(O)=C1)O2	5558.6	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #50	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O[Si](C)(C)C)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)=CC(O[Si](C)(C)C)=C1O	5603.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #51	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O[Si](C)(C)C)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)=CC(O)=C1O[Si](C)(C)C	5588.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #52	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C(O)C3=C1OC(C1=CC(O)=C(O)C(O[Si](C)(C)C)=C1)C(O[Si](C)(C)C)C3)C(O)C(C1=CC=C(O)C(O)=C1)O2	5583.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #53	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C(O)C3=C1OC(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)C(O[Si](C)(C)C)C3)C(O)C(C1=CC=C(O)C(O)=C1)O2	5566.4	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #54	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C(O)C3=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O[Si](C)(C)C)C3)C(O[Si](C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	5570.4	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #55	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C(O)C3=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O[Si](C)(C)C)C3)C(O)C(C1=CC=C(O[Si](C)(C)C)C(O)=C1)O2	5611.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #56	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C(O)C3=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O[Si](C)(C)C)C3)C(O)C(C1=CC=C(O)C(O[Si](C)(C)C)=C1)O2	5586.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #57	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)C(O[Si](C)(C)C)C4)C2O)C=C1O	5574.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #58	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)C(O[Si](C)(C)C)C4)C2O)=CC=C1O	5545.4	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #59	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O)=C3C2C3=C(O[Si](C)(C)C)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O[Si](C)(C)C)=CC(O)=C1O	5535.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #6	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)=CC(O)=C1O	5566.6	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #60	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O)=C3C2C3=C(O[Si](C)(C)C)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)=CC(O[Si](C)(C)C)=C1O	5590.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #61	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O)=C3C2C3=C(O[Si](C)(C)C)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)=CC(O)=C1O[Si](C)(C)C	5578.6	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #62	C[Si](C)(C)OC1=CC(O)=CC2=C1C(C1=C(O)C=C(O)C3=C1OC(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)C(O[Si](C)(C)C)C3)C(O[Si](C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	5546.8	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #63	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)C(O[Si](C)(C)C)C4)C2O)C=C1O	5535.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #64	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)C(O[Si](C)(C)C)C4)C2O)=CC=C1O	5512.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #65	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O[Si](C)(C)C)C4)C2O[Si](C)(C)C)C=C1O	5585.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #66	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O[Si](C)(C)C)C4)C2O[Si](C)(C)C)=CC=C1O	5573.4	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #67	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O[Si](C)(C)C)C4)C2O)C=C1O[Si](C)(C)C	5645.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #68	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)C(O)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O[Si](C)(C)C)C2	5683.4	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #69	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O)=C1)C(O[Si](C)(C)C)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O[Si](C)(C)C)C2	5621.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #7	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C(C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)C2=C1CC(O[Si](C)(C)C)C(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)O2	5557.8	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #70	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O)=C1)C(O)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O[Si](C)(C)C)=C1)C(O[Si](C)(C)C)C2	5610.8	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #71	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O)=C1)C(O)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)C(O[Si](C)(C)C)C2	5574.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #72	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C)=C1)C(O[Si](C)(C)C)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O[Si](C)(C)C)C2	5606.8	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #73	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C)=C1)C(O)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O[Si](C)(C)C)=C1)C(O[Si](C)(C)C)C2	5583.8	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #74	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C)=C1)C(O)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)C(O[Si](C)(C)C)C2	5549.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #75	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O[Si](C)(C)C)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O[Si](C)(C)C)=C1)C(O[Si](C)(C)C)C2	5580.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #76	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O[Si](C)(C)C)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)C(O[Si](C)(C)C)C2	5579.8	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #77	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C1)C(O[Si](C)(C)C)C2	5639.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #78	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)C(O[Si](C)(C)C)C2	5624.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #79	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)C(O[Si](C)(C)C)C4)C2O)C=C1O	5636.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #8	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C(O[Si](C)(C)C)C3=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O[Si](C)(C)C)C3)C(O)C(C1=CC=C(O)C(O)=C1)O2	5599.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #80	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)C(O[Si](C)(C)C)C4)C2O)C=C1O	5629.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #81	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)C(O[Si](C)(C)C)C4)C2O[Si](C)(C)C)C=C1O	5593.6	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #82	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)C(O[Si](C)(C)C)C4)C2O)C=C1O[Si](C)(C)C	5649.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #83	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)C(O[Si](C)(C)C)C4)C2O[Si](C)(C)C)C=C1O	5595.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #84	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)C(O[Si](C)(C)C)C4)C2O)C=C1O[Si](C)(C)C	5647.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #85	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O[Si](C)(C)C)C4)C2O[Si](C)(C)C)C=C1O[Si](C)(C)C	5628.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #86	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)C(O[Si](C)(C)C)C4)C2O)=CC=C1O	5608.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #87	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)C(O[Si](C)(C)C)C4)C2O)=CC=C1O	5600.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #88	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)C(O[Si](C)(C)C)C4)C2O[Si](C)(C)C)=CC=C1O	5576.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #89	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)C(O[Si](C)(C)C)C4)C2O[Si](C)(C)C)=CC=C1O	5571.4	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #9	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O[Si](C)(C)C)C4)C2O)C=C1O	5602.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #90	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C1O	5579.8	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #91	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O[Si](C)(C)C)=CC(O)=C1O[Si](C)(C)C	5566.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #92	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C)C(O)=CC(O)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C	5641.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #93	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C3=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C3)C(O)C(C1=CC=C(O)C(O)=C1)O2	5554.4	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #94	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O)C=C1O	5549.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #95	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O)=CC=C1O	5522.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #96	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C(C2C3=C(O[Si](C)(C)C)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O[Si](C)(C)C)C2=C1CC(O)C(C1=CC(O)=C(O)C(O)=C1)O2	5539.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #97	C[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2C3=C(O[Si](C)(C)C)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)=CC(O)=C1O	5515.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #98	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C(C2C3=C(O[Si](C)(C)C)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)C2=C1CC(O)C(C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)O2	5496.4	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,4TMS,isomer #99	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O)=C1)C(O)C2C1=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C2	5567.6	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,1TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OC1CC2=C(O)C=C(O)C(C3C4=C(O)C=C(O)C=C4OC(C4=CC=C(O)C(O)=C4)C3O)=C2OC1C1=CC(O)=C(O)C(O)=C1	6160.6	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,1TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C2OC3=C(CC2O)C(O)=CC(O)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)C=C1O	6208.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,1TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OC1=CC(O)=C(C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)C2=C1CC(O)C(C1=CC(O)=C(O)C(O)=C1)O2	6154.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,1TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2CC(O)C(C3=CC(O)=C(O)C(O)=C3)OC2=C1C1C2=C(O)C=C(O)C=C2OC(C2=CC=C(O)C(O)=C2)C1O	6161.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,1TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OC1C(C2=CC=C(O)C(O)=C2)OC2=CC(O)=CC(O)=C2C1C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C2	6179.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,1TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C2	6181.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,1TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=C1C(C1=C(O)C=C(O)C3=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C3)C(O)C(C1=CC=C(O)C(O)=C1)O2	6173.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,1TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O)C=C1O	6217.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,1TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O)=CC=C1O	6210.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,1TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)=CC(O)=C1O	6165.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OC1=CC(O)=C(C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)C2=C1CC(O[Si](C)(C)C(C)(C)C)C(C1=CC(O)=C(O)C(O)=C1)O2	6337.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C(C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)C2=C1CC(O)C(C1=CC(O)=C(O)C(O)=C1)O2	6333.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TBDMS,isomer #11	CC(C)(C)[Si](C)(C)OC1=CC(O)=C(C2C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)C2=C1CC(O)C(C1=CC(O)=C(O)C(O)=C1)O2	6351.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TBDMS,isomer #12	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O)C=C(O[Si](C)(C)C(C)(C)C)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C2	6362.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TBDMS,isomer #13	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O)C=C1O	6390.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TBDMS,isomer #14	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O)=CC=C1O	6381.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TBDMS,isomer #15	CC(C)(C)[Si](C)(C)OC1=CC(O)=C(C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O[Si](C)(C)C(C)(C)C)C2=C1CC(O)C(C1=CC(O)=C(O)C(O)=C1)O2	6333.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TBDMS,isomer #16	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)=CC(O)=C1O	6343.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TBDMS,isomer #17	CC(C)(C)[Si](C)(C)OC1=CC(O)=C(C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)C2=C1CC(O)C(C1=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C1)O2	6385.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TBDMS,isomer #18	CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=C1C(C1=C(O[Si](C)(C)C(C)(C)C)C=C(O)C3=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C3)C(O)C(C1=CC=C(O)C(O)=C1)O2	6363.8	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TBDMS,isomer #19	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O[Si](C)(C)C(C)(C)C)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C2	6360.8	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2CC(O[Si](C)(C)C(C)(C)C)C(C3=CC(O)=C(O)C(O)=C3)OC2=C1C1C2=C(O)C=C(O)C=C2OC(C2=CC=C(O)C(O)=C2)C1O	6339.4	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TBDMS,isomer #20	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O)C=C1O	6394.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TBDMS,isomer #21	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O)=CC=C1O	6386.8	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TBDMS,isomer #22	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2CC(O)C(C3=CC(O)=C(O)C(O)=C3)OC2=C1C1C2=C(O)C=C(O)C=C2OC(C2=CC=C(O)C(O)=C2)C1O[Si](C)(C)C(C)(C)C	6335.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TBDMS,isomer #23	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)=CC(O)=C1O	6349.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TBDMS,isomer #24	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2CC(O)C(C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)OC2=C1C1C2=C(O)C=C(O)C=C2OC(C2=CC=C(O)C(O)=C2)C1O	6386.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TBDMS,isomer #25	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O[Si](C)(C)C(C)(C)C)C=C1O	6375.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TBDMS,isomer #26	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O[Si](C)(C)C(C)(C)C)=CC=C1O	6366.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TBDMS,isomer #27	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O[Si](C)(C)C(C)(C)C)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C2	6349.4	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TBDMS,isomer #28	CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=C1C(C1=C(O)C=C(O)C3=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C3)C(O[Si](C)(C)C(C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	6346.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TBDMS,isomer #29	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O[Si](C)(C)C(C)(C)C)=CC(O)=C1O	6333.7	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=C1C(C1=C(O)C=C(O)C3=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O[Si](C)(C)C(C)(C)C)C3)C(O)C(C1=CC=C(O)C(O)=C1)O2	6352.8	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TBDMS,isomer #30	CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C2OC3=C(CC2O)C(O)=CC(O)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O[Si](C)(C)C(C)(C)C)C=C1O	6370.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TBDMS,isomer #31	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C(C)(C)C)=C1)C(C1=C(O)C=C(O)C3=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C3)C(O)C(C1=CC=C(O)C(O)=C1)O2	6350.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TBDMS,isomer #32	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C1)C(O)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C2	6401.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TBDMS,isomer #33	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C1)C(O)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O)C2	6391.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TBDMS,isomer #34	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C1)C(O)C2	6365.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TBDMS,isomer #35	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C1)C(O)C2	6402.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TBDMS,isomer #36	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O)=C3C2C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)=CC(O)=C1O	6347.4	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TBDMS,isomer #37	CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=C1C(C1=C(O)C=C(O)C3=C1OC(C1=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C1)C(O)C3)C(O)C(C1=CC=C(O)C(O)=C1)O2	6384.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TBDMS,isomer #38	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O)C=C1O	6388.6	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TBDMS,isomer #39	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O)=CC=C1O	6380.1	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O)C=C(O)C2=C1OC(C1=CC(O)=C(O)C(O)=C1)C(O[Si](C)(C)C(C)(C)C)C2	6354.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TBDMS,isomer #40	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)C(O)C4)C2O)C=C1O	6388.2	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TBDMS,isomer #41	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)C(O)C4)C2O)C=C1O	6420.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TBDMS,isomer #42	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O)C4)C2O)C=C1O[Si](C)(C)C(C)(C)C	6367.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TBDMS,isomer #43	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)C(O)C4)C2O)=CC=C1O	6381.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TBDMS,isomer #44	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)C(O)C4)C2O)=CC=C1O	6409.3	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TBDMS,isomer #45	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)=CC(O[Si](C)(C)C(C)(C)C)=C1O	6349.9	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TBDMS,isomer #46	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=C(CC2O)C(O)=CC(O)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)=CC(O)=C1O[Si](C)(C)C(C)(C)C	6346.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O[Si](C)(C)C(C)(C)C)C4)C2O)C=C1O	6381.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C(O)C4=C3OC(C3=CC(O)=C(O)C(O)=C3)C(O[Si](C)(C)C(C)(C)C)C4)C2O)=CC=C1O	6375.5	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OC1CC2=C(O)C=C(O)C(C3C4=C(O)C=C(O)C=C4OC(C4=CC=C(O)C(O)=C4)C3O[Si](C)(C)C(C)(C)C)=C2OC1C1=CC(O)=C(O)C(O)=C1	6323.4	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=C(CC2O[Si](C)(C)C(C)(C)C)C(O)=CC(O)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)=CC(O)=C1O	6341.0	Semi standard non polar	33892256
Epicatechin-(4beta->8)-gallocatechin,2TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C2OC3=C(CC2O[Si](C)(C)C(C)(C)C)C(O)=CC(O)=C3C2C3=C(O)C=C(O)C=C3OC(C3=CC=C(O)C(O)=C3)C2O)C=C1O	6375.7	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - Epicatechin-(4beta->8)-gallocatechin GC-MS (Non-derivatized) - 70eV, Positive	splash10-004r-0900370000-9e9db92cf462ca7e41f2	2017-09-01	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Epicatechin-(4beta->8)-gallocatechin GC-MS (1 TMS) - 70eV, Positive	splash10-00di-9700033000-af04bcd423c58edc3b23	2017-10-06	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Epicatechin-(4beta->8)-gallocatechin GC-MS ("Epicatechin-(4beta->8)-gallocatechin,1TMS,#1" TMS) - 70eV, Positive	Not Available	2021-10-14	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Epicatechin-(4beta->8)-gallocatechin GC-MS (TMS_1_2) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Epicatechin-(4beta->8)-gallocatechin GC-MS (TMS_1_3) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Epicatechin-(4beta->8)-gallocatechin GC-MS (TMS_1_4) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Epicatechin-(4beta->8)-gallocatechin GC-MS (TMS_1_5) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Epicatechin-(4beta->8)-gallocatechin GC-MS (TMS_1_6) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Epicatechin-(4beta->8)-gallocatechin GC-MS (TMS_1_7) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Epicatechin-(4beta->8)-gallocatechin GC-MS (TMS_1_8) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Epicatechin-(4beta->8)-gallocatechin GC-MS (TMS_1_9) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Epicatechin-(4beta->8)-gallocatechin GC-MS (TMS_1_10) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Epicatechin-(4beta->8)-gallocatechin GC-MS (TMS_2_1) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Epicatechin-(4beta->8)-gallocatechin GC-MS (TMS_2_2) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Epicatechin-(4beta->8)-gallocatechin GC-MS (TMS_2_3) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Epicatechin-(4beta->8)-gallocatechin GC-MS (TMS_2_4) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Epicatechin-(4beta->8)-gallocatechin GC-MS (TMS_2_5) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Epicatechin-(4beta->8)-gallocatechin GC-MS (TMS_2_6) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Epicatechin-(4beta->8)-gallocatechin GC-MS (TMS_2_7) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Epicatechin-(4beta->8)-gallocatechin GC-MS (TMS_2_8) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Epicatechin-(4beta->8)-gallocatechin GC-MS (TMS_2_9) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Epicatechin-(4beta->8)-gallocatechin GC-MS (TMS_2_10) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Epicatechin-(4beta->8)-gallocatechin GC-MS (TMS_2_11) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Epicatechin-(4beta->8)-gallocatechin GC-MS (TMS_2_12) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Epicatechin-(4beta->8)-gallocatechin GC-MS (TMS_2_13) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Epicatechin-(4beta->8)-gallocatechin 10V, Positive-QTOF	splash10-004j-0210980000-a414d119e9bbb0cc7f8e	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Epicatechin-(4beta->8)-gallocatechin 20V, Positive-QTOF	splash10-0a4i-0655920000-ddd8b115a71fdae8a17a	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Epicatechin-(4beta->8)-gallocatechin 40V, Positive-QTOF	splash10-054x-0792110000-f80014e0f76e926d119a	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Epicatechin-(4beta->8)-gallocatechin 10V, Negative-QTOF	splash10-0006-0100290000-710bd123a64f2ff65488	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Epicatechin-(4beta->8)-gallocatechin 20V, Negative-QTOF	splash10-002r-0912120000-559dbcef1431ccf99932	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Epicatechin-(4beta->8)-gallocatechin 40V, Negative-QTOF	splash10-004i-0910000000-a80b39f3b9af161110d4	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Epicatechin-(4beta->8)-gallocatechin 10V, Positive-QTOF	splash10-0002-0010090000-c7a26dee44854c77f2b5	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Epicatechin-(4beta->8)-gallocatechin 20V, Positive-QTOF	splash10-052b-0525490000-531488b8a3885145a81c	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Epicatechin-(4beta->8)-gallocatechin 40V, Positive-QTOF	splash10-00y0-0922130000-043497dc4bedfb606a22	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Epicatechin-(4beta->8)-gallocatechin 10V, Negative-QTOF	splash10-0006-0000090000-3a0090cf4f0e04f987cb	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Epicatechin-(4beta->8)-gallocatechin 20V, Negative-QTOF	splash10-0006-0010690000-c58566da7c79fc7f6e59	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Epicatechin-(4beta->8)-gallocatechin 40V, Negative-QTOF	splash10-002o-2210390000-185618f2dadb3833a052	2021-09-25	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Cytoplasm
Extracellular

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

FDB015171

KNApSAcK ID

C00009082

Chemspider ID

35014114

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

14284599

PDB ID

Not Available

ChEBI ID

Not Available

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

Not Available

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

(). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .

Showing metabocard for Epicatechin-(4beta->8)-gallocatechin (HMDB0036303)

MOL for HMDB0036303 (Epicatechin-(4beta->8)-gallocatechin)

3D MOL for HMDB0036303 (Epicatechin-(4beta->8)-gallocatechin)

3D SDF for HMDB0036303 (Epicatechin-(4beta->8)-gallocatechin)

3D-SDF for HMDB0036303 (Epicatechin-(4beta->8)-gallocatechin)

PDB for HMDB0036303 (Epicatechin-(4beta->8)-gallocatechin)

3D PDB for HMDB0036303 (Epicatechin-(4beta->8)-gallocatechin)

SMILES for HMDB0036303 (Epicatechin-(4beta->8)-gallocatechin)

INCHI for HMDB0036303 (Epicatechin-(4beta->8)-gallocatechin)

Structure for HMDB0036303 (Epicatechin-(4beta->8)-gallocatechin)

3D Structure for HMDB0036303 (Epicatechin-(4beta->8)-gallocatechin)

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra