Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References enzymes (9) Show 9 proteins XML

enzymes (9) Show 9 proteins

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2005-11-16 15:48:42 UTC

Update Date

2021-09-14 15:48:15 UTC

HMDB ID

HMDB0001163

Secondary Accession Numbers

HMDB0062759
HMDB01163
HMDB62759

Metabolite Identification

Common Name

Guanosine diphosphate mannose

Description

GDP-mannose is a nucleoside diphosphate sugar that is important in the production of fucosylated oligosaccharides. In particular, GDP-mannose is converted to GDP-fucose, which is the fucose donor in the construction of all mammalian fucosylated glycans. GDP-mannose is transformed to GDP-fucose via three enzymatic reactions carried out by two proteins, GDP-mannose 4,6-dehydratase (GMD) and a second enzyme, GDP-keto-6-deoxymannose 3,5-epimerase, 4-reductase. GDP-mannose 4,6-dehydratase (EC 4.2.1.47) catalyzes the chemical reaction: GDP-mannose <--> GDP-4-dehydro-6-deoxy-D-mannose + H2O. The epimerase converts the GDP-4-dehydro-6-deoxy-D-mannose to GDP-fucose (PMID: 12651883 ). GDP-mannose is also synthesized from mannose 1-phosphate via the enzyme ATP-mannose-1-phosphate-guanyltransferase and GTP.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI


  Mrv1652309042000182D          

 39 42  0  0  1  0            999 V2000
    3.7694    1.4268    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9784    1.6803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7656   -0.2119    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
    4.2538    2.0891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9784    2.5091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2593    1.2564    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.0843    0.2801    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5158   -0.9878    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
    3.7731    2.7665    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.2593    2.9217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5441    1.6803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4221   -0.2006    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
    2.6908   -0.9878    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
    4.0041   -1.6501    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5441    2.5091    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.2556    3.7467    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8288    1.2716    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.6387    0.0492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2177   -1.6576    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.9234   -0.3557    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0984   -0.3557    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7228   -0.3557    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0909   -1.2678    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.1060    0.4655    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5478   -0.3557    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3691   -0.3595    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5554   -1.2073    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5402    0.4655    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0843   -0.7683    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   -3.7997   -0.3595    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0843   -1.5895    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   -4.5149   -0.7683    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   -3.7997   -2.0058    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   -2.3691   -2.0058    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5149   -1.5895    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   -5.2189   -0.3595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7997   -2.8271    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2189   -2.0058    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8508   -0.8893    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  3  1  1  1  0  0  0
  1  4  1  0  0  0  0
  2  5  2  0  0  0  0
  2  6  1  0  0  0  0
  3  7  1  0  0  0  0
  3  8  1  0  0  0  0
  4  9  2  0  0  0  0
  5 10  1  0  0  0  0
  6 11  2  0  0  0  0
  7 12  1  0  0  0  0
  8 13  1  0  0  0  0
  8 14  1  6  0  0  0
 10 15  1  0  0  0  0
 10 16  2  0  0  0  0
 11 17  1  0  0  0  0
 12 18  1  1  0  0  0
 13 19  1  6  0  0  0
 18 20  1  0  0  0  0
 20 21  1  0  0  0  0
 21 22  1  0  0  0  0
 21 23  1  0  0  0  0
 21 24  2  0  0  0  0
 22 25  1  0  0  0  0
 25 26  1  0  0  0  0
 25 27  1  0  0  0  0
 25 28  2  0  0  0  0
 29 26  1  6  0  0  0
 29 30  1  0  0  0  0
 29 31  1  0  0  0  0
 30 32  1  0  0  0  0
 31 33  1  0  0  0  0
 31 34  1  1  0  0  0
 32 35  1  0  0  0  0
 32 36  1  1  0  0  0
 33 37  1  1  0  0  0
 35 38  1  6  0  0  0
 36 39  1  0  0  0  0
  5  9  1  0  0  0  0
 11 15  1  0  0  0  0
 12 13  1  0  0  0  0
 33 35  1  0  0  0  0
M  END

HMDB0001163
     RDKit          3D
Guanosine diphosphate mannose
 64 67  0  0  0  0  0  0  0  0999 V2000
    7.3990    4.1261    0.0313 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3519    2.8567    0.6629 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4716    1.9250    0.2478 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4051    0.7139    0.8280 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2692    0.4509    1.8666 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9868   -0.8224    2.2559 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.9929   -1.2921    1.4751 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6227   -0.3621    0.5919 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6077   -0.3998   -0.4424 C   0  0  2  0  0  0  0  0  0  0  0  0
    3.4020    0.1533   -0.0327 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5636   -0.1426   -1.1091 C   0  0  2  0  0  0  0  0  0  0  0  0
    1.1184    0.1157   -0.7907 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7304   -0.6750    0.2887 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8684   -0.4524    0.7139 P   0  0  0  0  0  5  0  0  0  0  0  0
   -0.8839    0.0903    2.1458 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6260    0.7290   -0.2391 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7700   -1.8666    0.6941 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7671   -1.9635   -0.6699 P   0  0  0  0  0  5  0  0  0  0  0  0
   -3.2214   -3.3828   -0.8829 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7997   -1.5424   -2.0118 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0095   -0.8715   -0.5606 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1431   -1.3567    0.0819 C   0  0  1  0  0  0  0  0  0  0  0  0
   -5.2836   -0.5470    1.2306 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5036    0.7438    0.7524 C   0  0  2  0  0  0  0  0  0  0  0  0
   -4.9452    1.7943    1.6779 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5097    1.7412    2.9419 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9925    0.8941    0.5474 C   0  0  1  0  0  0  0  0  0  0  0  0
   -7.3020    1.8380   -0.4279 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4951   -0.4741    0.0692 C   0  0  2  0  0  0  0  0  0  0  0  0
   -7.8680   -1.1898    1.1940 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3963   -1.1881   -0.7216 C   0  0  2  0  0  0  0  0  0  0  0  0
   -6.9532   -2.4029   -1.1280 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8001   -1.6229   -1.2985 C   0  0  1  0  0  0  0  0  0  0  0  0
    2.6432   -1.9691   -2.6186 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2486   -1.7990   -0.8247 C   0  0  1  0  0  0  0  0  0  0  0  0
    5.0472   -2.2940   -1.8759 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1652    1.4048    2.2861 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9543    1.1789    3.2270 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.2085    2.6049    1.6877 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5550    4.7676    0.0675 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.2291    4.4899   -0.4843 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.5730   -2.2740    1.5653 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.9926    0.1037   -1.3729 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.8890    0.4483   -1.9808 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.5236   -0.1018   -1.6891 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.9787    1.1982   -0.5733 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0384    1.0093   -0.9773 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0709   -0.6666   -2.3833 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0198   -2.4092    0.4169 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0321    0.9067   -0.2465 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8426    1.6834    1.6809 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1744    2.7975    1.2644 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3402    2.2828    2.9419 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4929    1.1851    1.4901 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7767    1.6881   -1.2548 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.3600   -0.3851   -0.5897 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5678   -2.1301    1.1888 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2056   -0.5627   -1.6056 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4334   -3.1787   -0.8345 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.0988   -2.1579   -0.6226 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.7950   -2.4782   -2.6946 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3023   -2.5310   -0.0083 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.8903   -1.7865   -2.6991 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.8775    3.3573    1.9794 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 14 16  1  0
 14 17  1  0
 17 18  1  0
 18 19  2  0
 18 20  1  0
 18 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 24 27  1  0
 27 28  1  0
 27 29  1  0
 29 30  1  0
 29 31  1  0
 31 32  1  0
 11 33  1  0
 33 34  1  0
 33 35  1  0
 35 36  1  0
  5 37  1  0
 37 38  2  0
 37 39  1  0
 39  2  1  0
  8  4  1  0
 35  9  1  0
 31 22  1  0
  1 40  1  0
  1 41  1  0
  7 42  1  0
  9 43  1  6
 11 44  1  6
 12 45  1  0
 12 46  1  0
 16 47  1  0
 20 48  1  0
 22 49  1  1
 24 50  1  6
 25 51  1  0
 25 52  1  0
 26 53  1  0
 27 54  1  1
 28 55  1  0
 29 56  1  6
 30 57  1  0
 31 58  1  6
 32 59  1  0
 33 60  1  1
 34 61  1  0
 35 62  1  1
 36 63  1  0
 39 64  1  0
M  END


  Mrv1652309042000182D          

 39 42  0  0  1  0            999 V2000
    3.7694    1.4268    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9784    1.6803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7656   -0.2119    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
    4.2538    2.0891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9784    2.5091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2593    1.2564    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.0843    0.2801    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5158   -0.9878    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
    3.7731    2.7665    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.2593    2.9217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5441    1.6803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4221   -0.2006    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
    2.6908   -0.9878    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
    4.0041   -1.6501    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5441    2.5091    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.2556    3.7467    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8288    1.2716    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.6387    0.0492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2177   -1.6576    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.9234   -0.3557    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0984   -0.3557    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7228   -0.3557    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0909   -1.2678    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.1060    0.4655    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5478   -0.3557    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3691   -0.3595    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5554   -1.2073    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5402    0.4655    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0843   -0.7683    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   -3.7997   -0.3595    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0843   -1.5895    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   -4.5149   -0.7683    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   -3.7997   -2.0058    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   -2.3691   -2.0058    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5149   -1.5895    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   -5.2189   -0.3595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7997   -2.8271    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2189   -2.0058    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8508   -0.8893    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  3  1  1  1  0  0  0
  1  4  1  0  0  0  0
  2  5  2  0  0  0  0
  2  6  1  0  0  0  0
  3  7  1  0  0  0  0
  3  8  1  0  0  0  0
  4  9  2  0  0  0  0
  5 10  1  0  0  0  0
  6 11  2  0  0  0  0
  7 12  1  0  0  0  0
  8 13  1  0  0  0  0
  8 14  1  6  0  0  0
 10 15  1  0  0  0  0
 10 16  2  0  0  0  0
 11 17  1  0  0  0  0
 12 18  1  1  0  0  0
 13 19  1  6  0  0  0
 18 20  1  0  0  0  0
 20 21  1  0  0  0  0
 21 22  1  0  0  0  0
 21 23  1  0  0  0  0
 21 24  2  0  0  0  0
 22 25  1  0  0  0  0
 25 26  1  0  0  0  0
 25 27  1  0  0  0  0
 25 28  2  0  0  0  0
 29 26  1  6  0  0  0
 29 30  1  0  0  0  0
 29 31  1  0  0  0  0
 30 32  1  0  0  0  0
 31 33  1  0  0  0  0
 31 34  1  1  0  0  0
 32 35  1  0  0  0  0
 32 36  1  1  0  0  0
 33 37  1  1  0  0  0
 35 38  1  6  0  0  0
 36 39  1  0  0  0  0
  5  9  1  0  0  0  0
 11 15  1  0  0  0  0
 12 13  1  0  0  0  0
 33 35  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0001163

> <DATABASE_NAME>
hmdb

> <SMILES>
NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(O)(=O)OP(O)(=O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)C(=O)N1

> <INCHI_IDENTIFIER>
InChI=1S/C16H25N5O16P2/c17-16-19-12-6(13(28)20-16)18-3-21(12)14-10(26)8(24)5(34-14)2-33-38(29,30)37-39(31,32)36-15-11(27)9(25)7(23)4(1-22)35-15/h3-5,7-11,14-15,22-27H,1-2H2,(H,29,30)(H,31,32)(H3,17,19,20,28)/t4-,5-,7-,8-,9+,10-,11+,14-,15-/m1/s1

> <INCHI_KEY>
MVMSCBBUIHUTGJ-GDJBGNAASA-N

> <FORMULA>
C16H25N5O16P2

> <MOLECULAR_WEIGHT>
605.3411

> <EXACT_MASS>
605.077152801

> <JCHEM_ACCEPTOR_COUNT>
16

> <JCHEM_ATOM_COUNT>
64

> <JCHEM_AVERAGE_POLARIZABILITY>
48.721178469097254

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
10

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
[({[(2R,3S,4R,5R)-5-(2-amino-6-oxo-6,9-dihydro-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy]({[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy})phosphinic acid

> <ALOGPS_LOGP>
-1.76

> <JCHEM_LOGP>
-5.287584132999999

> <ALOGPS_LOGS>
-1.89

> <JCHEM_MDDR_LIKE_RULE>
1

> <JCHEM_NUMBER_OF_RINGS>
4

> <JCHEM_PHYSIOLOGICAL_CHARGE>
-2

> <JCHEM_PKA>
3.176324364365109

> <JCHEM_PKA_STRONGEST_ACIDIC>
1.7325998238285534

> <JCHEM_PKA_STRONGEST_BASIC>
-3.6484093801081894

> <JCHEM_POLAR_SURFACE_AREA>
327.43

> <JCHEM_REFRACTIVITY>
118.51129999999996

> <JCHEM_ROTATABLE_BOND_COUNT>
9

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
7.77e+00 g/l

> <JCHEM_TRADITIONAL_IUPAC>
guanosine diphosphomannose

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0001163
     RDKit          3D
Guanosine diphosphate mannose
 64 67  0  0  0  0  0  0  0  0999 V2000
    7.3990    4.1261    0.0313 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3519    2.8567    0.6629 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4716    1.9250    0.2478 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4051    0.7139    0.8280 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2692    0.4509    1.8666 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9868   -0.8224    2.2559 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.9929   -1.2921    1.4751 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6227   -0.3621    0.5919 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6077   -0.3998   -0.4424 C   0  0  2  0  0  0  0  0  0  0  0  0
    3.4020    0.1533   -0.0327 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5636   -0.1426   -1.1091 C   0  0  2  0  0  0  0  0  0  0  0  0
    1.1184    0.1157   -0.7907 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7304   -0.6750    0.2887 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8684   -0.4524    0.7139 P   0  0  0  0  0  5  0  0  0  0  0  0
   -0.8839    0.0903    2.1458 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6260    0.7290   -0.2391 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7700   -1.8666    0.6941 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7671   -1.9635   -0.6699 P   0  0  0  0  0  5  0  0  0  0  0  0
   -3.2214   -3.3828   -0.8829 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7997   -1.5424   -2.0118 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0095   -0.8715   -0.5606 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1431   -1.3567    0.0819 C   0  0  1  0  0  0  0  0  0  0  0  0
   -5.2836   -0.5470    1.2306 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5036    0.7438    0.7524 C   0  0  2  0  0  0  0  0  0  0  0  0
   -4.9452    1.7943    1.6779 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5097    1.7412    2.9419 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9925    0.8941    0.5474 C   0  0  1  0  0  0  0  0  0  0  0  0
   -7.3020    1.8380   -0.4279 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4951   -0.4741    0.0692 C   0  0  2  0  0  0  0  0  0  0  0  0
   -7.8680   -1.1898    1.1940 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3963   -1.1881   -0.7216 C   0  0  2  0  0  0  0  0  0  0  0  0
   -6.9532   -2.4029   -1.1280 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8001   -1.6229   -1.2985 C   0  0  1  0  0  0  0  0  0  0  0  0
    2.6432   -1.9691   -2.6186 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2486   -1.7990   -0.8247 C   0  0  1  0  0  0  0  0  0  0  0  0
    5.0472   -2.2940   -1.8759 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1652    1.4048    2.2861 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9543    1.1789    3.2270 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.2085    2.6049    1.6877 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5550    4.7676    0.0675 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.2291    4.4899   -0.4843 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.5730   -2.2740    1.5653 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.9926    0.1037   -1.3729 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.8890    0.4483   -1.9808 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.5236   -0.1018   -1.6891 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.9787    1.1982   -0.5733 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0384    1.0093   -0.9773 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0709   -0.6666   -2.3833 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0198   -2.4092    0.4169 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0321    0.9067   -0.2465 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8426    1.6834    1.6809 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1744    2.7975    1.2644 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3402    2.2828    2.9419 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4929    1.1851    1.4901 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7767    1.6881   -1.2548 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.3600   -0.3851   -0.5897 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5678   -2.1301    1.1888 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2056   -0.5627   -1.6056 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4334   -3.1787   -0.8345 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.0988   -2.1579   -0.6226 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.7950   -2.4782   -2.6946 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3023   -2.5310   -0.0083 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.8903   -1.7865   -2.6991 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.8775    3.3573    1.9794 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 14 16  1  0
 14 17  1  0
 17 18  1  0
 18 19  2  0
 18 20  1  0
 18 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 24 27  1  0
 27 28  1  0
 27 29  1  0
 29 30  1  0
 29 31  1  0
 31 32  1  0
 11 33  1  0
 33 34  1  0
 33 35  1  0
 35 36  1  0
  5 37  1  0
 37 38  2  0
 37 39  1  0
 39  2  1  0
  8  4  1  0
 35  9  1  0
 31 22  1  0
  1 40  1  0
  1 41  1  0
  7 42  1  0
  9 43  1  6
 11 44  1  6
 12 45  1  0
 12 46  1  0
 16 47  1  0
 20 48  1  0
 22 49  1  1
 24 50  1  6
 25 51  1  0
 25 52  1  0
 26 53  1  0
 27 54  1  1
 28 55  1  0
 29 56  1  6
 30 57  1  0
 31 58  1  6
 32 59  1  0
 33 60  1  1
 34 61  1  0
 35 62  1  1
 36 63  1  0
 39 64  1  0
M  END

HEADER    PROTEIN                                 04-SEP-20   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   04-SEP-20         0                                  
HETATM    1  N   UNK     0       7.036   2.663   0.000  0.00  0.00           N+0
HETATM    2  C   UNK     0       5.560   3.137   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0       7.029  -0.396   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0       7.940   3.900   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0       5.560   4.684   0.000  0.00  0.00           C+0
HETATM    6  N   UNK     0       4.217   2.345   0.000  0.00  0.00           N+0
HETATM    7  O   UNK     0       5.757   0.523   0.000  0.00  0.00           O+0
HETATM    8  C   UNK     0       6.563  -1.844   0.000  0.00  0.00           C+0
HETATM    9  N   UNK     0       7.043   5.164   0.000  0.00  0.00           N+0
HETATM   10  C   UNK     0       4.217   5.454   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0       2.882   3.137   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0       4.521  -0.374   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0       5.023  -1.844   0.000  0.00  0.00           C+0
HETATM   14  O   UNK     0       7.474  -3.080   0.000  0.00  0.00           O+0
HETATM   15  N   UNK     0       2.882   4.684   0.000  0.00  0.00           N+0
HETATM   16  O   UNK     0       4.210   6.994   0.000  0.00  0.00           O+0
HETATM   17  N   UNK     0       1.547   2.374   0.000  0.00  0.00           N+0
HETATM   18  C   UNK     0       3.059   0.092   0.000  0.00  0.00           C+0
HETATM   19  O   UNK     0       4.140  -3.094   0.000  0.00  0.00           O+0
HETATM   20  O   UNK     0       1.724  -0.664   0.000  0.00  0.00           O+0
HETATM   21  P   UNK     0       0.184  -0.664   0.000  0.00  0.00           P+0
HETATM   22  O   UNK     0      -1.349  -0.664   0.000  0.00  0.00           O+0
HETATM   23  O   UNK     0       0.170  -2.367   0.000  0.00  0.00           O+0
HETATM   24  O   UNK     0       0.198   0.869   0.000  0.00  0.00           O+0
HETATM   25  P   UNK     0      -2.889  -0.664   0.000  0.00  0.00           P+0
HETATM   26  O   UNK     0      -4.422  -0.671   0.000  0.00  0.00           O+0
HETATM   27  O   UNK     0      -2.903  -2.254   0.000  0.00  0.00           O+0
HETATM   28  O   UNK     0      -2.875   0.869   0.000  0.00  0.00           O+0
HETATM   29  C   UNK     0      -5.757  -1.434   0.000  0.00  0.00           C+0
HETATM   30  O   UNK     0      -7.093  -0.671   0.000  0.00  0.00           O+0
HETATM   31  C   UNK     0      -5.757  -2.967   0.000  0.00  0.00           C+0
HETATM   32  C   UNK     0      -8.428  -1.434   0.000  0.00  0.00           C+0
HETATM   33  C   UNK     0      -7.093  -3.744   0.000  0.00  0.00           C+0
HETATM   34  O   UNK     0      -4.422  -3.744   0.000  0.00  0.00           O+0
HETATM   35  C   UNK     0      -8.428  -2.967   0.000  0.00  0.00           C+0
HETATM   36  C   UNK     0      -9.742  -0.671   0.000  0.00  0.00           C+0
HETATM   37  O   UNK     0      -7.093  -5.277   0.000  0.00  0.00           O+0
HETATM   38  O   UNK     0      -9.742  -3.744   0.000  0.00  0.00           O+0
HETATM   39  O   UNK     0     -10.921  -1.660   0.000  0.00  0.00           O+0
CONECT    1    2    3    4                                                  
CONECT    2    1    5    6                                                  
CONECT    3    1    7    8                                                  
CONECT    4    1    9                                                       
CONECT    5    2   10    9                                                  
CONECT    6    2   11                                                       
CONECT    7    3   12                                                       
CONECT    8    3   13   14                                                  
CONECT    9    4    5                                                       
CONECT   10    5   15   16                                                  
CONECT   11    6   17   15                                                  
CONECT   12    7   18   13                                                  
CONECT   13    8   19   12                                                  
CONECT   14    8                                                            
CONECT   15   10   11                                                       
CONECT   16   10                                                            
CONECT   17   11                                                            
CONECT   18   12   20                                                       
CONECT   19   13                                                            
CONECT   20   18   21                                                       
CONECT   21   20   22   23   24                                             
CONECT   22   21   25                                                       
CONECT   23   21                                                            
CONECT   24   21                                                            
CONECT   25   22   26   27   28                                             
CONECT   26   25   29                                                       
CONECT   27   25                                                            
CONECT   28   25                                                            
CONECT   29   26   30   31                                                  
CONECT   30   29   32                                                       
CONECT   31   29   33   34                                                  
CONECT   32   30   35   36                                                  
CONECT   33   31   37   35                                                  
CONECT   34   31                                                            
CONECT   35   32   38   33                                                  
CONECT   36   32   39                                                       
CONECT   37   33                                                            
CONECT   38   35                                                            
CONECT   39   36                                                            
MASTER        0    0    0    0    0    0    0    0   39    0   84    0
END

COMPND    HMDB0001163
HETATM    1  N1  UNL     1       7.399   4.126   0.031  1.00  0.00           N  
HETATM    2  C1  UNL     1       7.352   2.857   0.663  1.00  0.00           C  
HETATM    3  N2  UNL     1       6.472   1.925   0.248  1.00  0.00           N  
HETATM    4  C2  UNL     1       6.405   0.714   0.828  1.00  0.00           C  
HETATM    5  C3  UNL     1       7.269   0.451   1.867  1.00  0.00           C  
HETATM    6  N3  UNL     1       6.987  -0.822   2.256  1.00  0.00           N  
HETATM    7  C4  UNL     1       5.993  -1.292   1.475  1.00  0.00           C  
HETATM    8  N4  UNL     1       5.623  -0.362   0.592  1.00  0.00           N  
HETATM    9  C5  UNL     1       4.608  -0.400  -0.442  1.00  0.00           C  
HETATM   10  O1  UNL     1       3.402   0.153  -0.033  1.00  0.00           O  
HETATM   11  C6  UNL     1       2.564  -0.143  -1.109  1.00  0.00           C  
HETATM   12  C7  UNL     1       1.118   0.116  -0.791  1.00  0.00           C  
HETATM   13  O2  UNL     1       0.730  -0.675   0.289  1.00  0.00           O  
HETATM   14  P1  UNL     1      -0.868  -0.452   0.714  1.00  0.00           P  
HETATM   15  O3  UNL     1      -0.884   0.090   2.146  1.00  0.00           O  
HETATM   16  O4  UNL     1      -1.626   0.729  -0.239  1.00  0.00           O  
HETATM   17  O5  UNL     1      -1.770  -1.867   0.694  1.00  0.00           O  
HETATM   18  P2  UNL     1      -2.767  -1.964  -0.670  1.00  0.00           P  
HETATM   19  O6  UNL     1      -3.221  -3.383  -0.883  1.00  0.00           O  
HETATM   20  O7  UNL     1      -1.800  -1.542  -2.012  1.00  0.00           O  
HETATM   21  O8  UNL     1      -4.009  -0.871  -0.561  1.00  0.00           O  
HETATM   22  C8  UNL     1      -5.143  -1.357   0.082  1.00  0.00           C  
HETATM   23  O9  UNL     1      -5.284  -0.547   1.231  1.00  0.00           O  
HETATM   24  C9  UNL     1      -5.504   0.744   0.752  1.00  0.00           C  
HETATM   25  C10 UNL     1      -4.945   1.794   1.678  1.00  0.00           C  
HETATM   26  O10 UNL     1      -5.510   1.741   2.942  1.00  0.00           O  
HETATM   27  C11 UNL     1      -6.993   0.894   0.547  1.00  0.00           C  
HETATM   28  O11 UNL     1      -7.302   1.838  -0.428  1.00  0.00           O  
HETATM   29  C12 UNL     1      -7.495  -0.474   0.069  1.00  0.00           C  
HETATM   30  O12 UNL     1      -7.868  -1.190   1.194  1.00  0.00           O  
HETATM   31  C13 UNL     1      -6.396  -1.188  -0.722  1.00  0.00           C  
HETATM   32  O13 UNL     1      -6.953  -2.403  -1.128  1.00  0.00           O  
HETATM   33  C14 UNL     1       2.800  -1.623  -1.298  1.00  0.00           C  
HETATM   34  O14 UNL     1       2.643  -1.969  -2.619  1.00  0.00           O  
HETATM   35  C15 UNL     1       4.249  -1.799  -0.825  1.00  0.00           C  
HETATM   36  O15 UNL     1       5.047  -2.294  -1.876  1.00  0.00           O  
HETATM   37  C16 UNL     1       8.165   1.405   2.286  1.00  0.00           C  
HETATM   38  O16 UNL     1       8.954   1.179   3.227  1.00  0.00           O  
HETATM   39  N5  UNL     1       8.208   2.605   1.688  1.00  0.00           N  
HETATM   40  H1  UNL     1       6.555   4.768   0.068  1.00  0.00           H  
HETATM   41  H2  UNL     1       8.229   4.490  -0.484  1.00  0.00           H  
HETATM   42  H3  UNL     1       5.573  -2.274   1.565  1.00  0.00           H  
HETATM   43  H4  UNL     1       4.993   0.104  -1.373  1.00  0.00           H  
HETATM   44  H5  UNL     1       2.889   0.448  -1.981  1.00  0.00           H  
HETATM   45  H6  UNL     1       0.524  -0.102  -1.689  1.00  0.00           H  
HETATM   46  H7  UNL     1       0.979   1.198  -0.573  1.00  0.00           H  
HETATM   47  H8  UNL     1      -1.038   1.009  -0.977  1.00  0.00           H  
HETATM   48  H9  UNL     1      -2.071  -0.667  -2.383  1.00  0.00           H  
HETATM   49  H10 UNL     1      -5.020  -2.409   0.417  1.00  0.00           H  
HETATM   50  H11 UNL     1      -5.032   0.907  -0.246  1.00  0.00           H  
HETATM   51  H12 UNL     1      -3.843   1.683   1.681  1.00  0.00           H  
HETATM   52  H13 UNL     1      -5.174   2.797   1.264  1.00  0.00           H  
HETATM   53  H14 UNL     1      -6.340   2.283   2.942  1.00  0.00           H  
HETATM   54  H15 UNL     1      -7.493   1.185   1.490  1.00  0.00           H  
HETATM   55  H16 UNL     1      -6.777   1.688  -1.255  1.00  0.00           H  
HETATM   56  H17 UNL     1      -8.360  -0.385  -0.590  1.00  0.00           H  
HETATM   57  H18 UNL     1      -7.568  -2.130   1.189  1.00  0.00           H  
HETATM   58  H19 UNL     1      -6.206  -0.563  -1.606  1.00  0.00           H  
HETATM   59  H20 UNL     1      -6.433  -3.179  -0.834  1.00  0.00           H  
HETATM   60  H21 UNL     1       2.099  -2.158  -0.623  1.00  0.00           H  
HETATM   61  H22 UNL     1       1.795  -2.478  -2.695  1.00  0.00           H  
HETATM   62  H23 UNL     1       4.302  -2.531  -0.008  1.00  0.00           H  
HETATM   63  H24 UNL     1       4.890  -1.786  -2.699  1.00  0.00           H  
HETATM   64  H25 UNL     1       8.877   3.357   1.979  1.00  0.00           H  
CONECT    1    2   40   41
CONECT    2    3    3   39
CONECT    3    4
CONECT    4    5    5    8
CONECT    5    6   37
CONECT    6    7    7
CONECT    7    8   42
CONECT    8    9
CONECT    9   10   35   43
CONECT   10   11
CONECT   11   12   33   44
CONECT   12   13   45   46
CONECT   13   14
CONECT   14   15   15   16   17
CONECT   16   47
CONECT   17   18
CONECT   18   19   19   20   21
CONECT   20   48
CONECT   21   22
CONECT   22   23   31   49
CONECT   23   24
CONECT   24   25   27   50
CONECT   25   26   51   52
CONECT   26   53
CONECT   27   28   29   54
CONECT   28   55
CONECT   29   30   31   56
CONECT   30   57
CONECT   31   32   58
CONECT   32   59
CONECT   33   34   35   60
CONECT   34   61
CONECT   35   36   62
CONECT   36   63
CONECT   37   38   38   39
CONECT   39   64
END

HMDB0001163
     RDKit          3D
Guanosine diphosphate mannose
 64 67  0  0  0  0  0  0  0  0999 V2000
    7.3990    4.1261    0.0313 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3519    2.8567    0.6629 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4716    1.9250    0.2478 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4051    0.7139    0.8280 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2692    0.4509    1.8666 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9868   -0.8224    2.2559 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.9929   -1.2921    1.4751 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6227   -0.3621    0.5919 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6077   -0.3998   -0.4424 C   0  0  2  0  0  0  0  0  0  0  0  0
    3.4020    0.1533   -0.0327 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5636   -0.1426   -1.1091 C   0  0  2  0  0  0  0  0  0  0  0  0
    1.1184    0.1157   -0.7907 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7304   -0.6750    0.2887 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8684   -0.4524    0.7139 P   0  0  0  0  0  5  0  0  0  0  0  0
   -0.8839    0.0903    2.1458 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6260    0.7290   -0.2391 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7700   -1.8666    0.6941 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7671   -1.9635   -0.6699 P   0  0  0  0  0  5  0  0  0  0  0  0
   -3.2214   -3.3828   -0.8829 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7997   -1.5424   -2.0118 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0095   -0.8715   -0.5606 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1431   -1.3567    0.0819 C   0  0  1  0  0  0  0  0  0  0  0  0
   -5.2836   -0.5470    1.2306 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5036    0.7438    0.7524 C   0  0  2  0  0  0  0  0  0  0  0  0
   -4.9452    1.7943    1.6779 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5097    1.7412    2.9419 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9925    0.8941    0.5474 C   0  0  1  0  0  0  0  0  0  0  0  0
   -7.3020    1.8380   -0.4279 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4951   -0.4741    0.0692 C   0  0  2  0  0  0  0  0  0  0  0  0
   -7.8680   -1.1898    1.1940 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3963   -1.1881   -0.7216 C   0  0  2  0  0  0  0  0  0  0  0  0
   -6.9532   -2.4029   -1.1280 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8001   -1.6229   -1.2985 C   0  0  1  0  0  0  0  0  0  0  0  0
    2.6432   -1.9691   -2.6186 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2486   -1.7990   -0.8247 C   0  0  1  0  0  0  0  0  0  0  0  0
    5.0472   -2.2940   -1.8759 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1652    1.4048    2.2861 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9543    1.1789    3.2270 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.2085    2.6049    1.6877 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5550    4.7676    0.0675 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.2291    4.4899   -0.4843 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.5730   -2.2740    1.5653 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.9926    0.1037   -1.3729 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.8890    0.4483   -1.9808 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.5236   -0.1018   -1.6891 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.9787    1.1982   -0.5733 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0384    1.0093   -0.9773 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0709   -0.6666   -2.3833 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0198   -2.4092    0.4169 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0321    0.9067   -0.2465 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8426    1.6834    1.6809 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1744    2.7975    1.2644 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3402    2.2828    2.9419 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4929    1.1851    1.4901 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7767    1.6881   -1.2548 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.3600   -0.3851   -0.5897 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5678   -2.1301    1.1888 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2056   -0.5627   -1.6056 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4334   -3.1787   -0.8345 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.0988   -2.1579   -0.6226 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.7950   -2.4782   -2.6946 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3023   -2.5310   -0.0083 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.8903   -1.7865   -2.6991 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.8775    3.3573    1.9794 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 14 16  1  0
 14 17  1  0
 17 18  1  0
 18 19  2  0
 18 20  1  0
 18 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 24 27  1  0
 27 28  1  0
 27 29  1  0
 29 30  1  0
 29 31  1  0
 31 32  1  0
 11 33  1  0
 33 34  1  0
 33 35  1  0
 35 36  1  0
  5 37  1  0
 37 38  2  0
 37 39  1  0
 39  2  1  0
  8  4  1  0
 35  9  1  0
 31 22  1  0
  1 40  1  0
  1 41  1  0
  7 42  1  0
  9 43  1  6
 11 44  1  6
 12 45  1  0
 12 46  1  0
 16 47  1  0
 20 48  1  0
 22 49  1  1
 24 50  1  6
 25 51  1  0
 25 52  1  0
 26 53  1  0
 27 54  1  1
 28 55  1  0
 29 56  1  6
 30 57  1  0
 31 58  1  6
 32 59  1  0
 33 60  1  1
 34 61  1  0
 35 62  1  1
 36 63  1  0
 39 64  1  0
M  END

View in JSmol View NMR Assignments View Stereo Labels

Synonyms

Value	Source
GDP-D-Mannose	ChEBI
GDPmannose	ChEBI
Guanosine 5'-(trihydrogen diphosphate), mono-alpha-D-mannopyranosyl ester	ChEBI
Guanosine diphosphomannose	ChEBI
Guanosine pyrophosphate mannose	ChEBI
GDP-alpha-D-Mannose	Kegg
Guanosine 5'-(trihydrogen diphosphate), mono-a-D-mannopyranosyl ester	Generator
Guanosine 5'-(trihydrogen diphosphate), mono-α-D-mannopyranosyl ester	Generator
Guanosine 5'-(trihydrogen diphosphoric acid), mono-a-D-mannopyranosyl ester	Generator
Guanosine 5'-(trihydrogen diphosphoric acid), mono-alpha-D-mannopyranosyl ester	Generator
Guanosine 5'-(trihydrogen diphosphoric acid), mono-α-D-mannopyranosyl ester	Generator
Guanosine pyrophosphoric acid mannose	Generator
GDP-a-D-Mannose	Generator
GDP-Α-D-mannose	Generator
Guanosine diphosphoric acid mannose	Generator
GDP Mannose	HMDB
GDP-Glucose	HMDB
GDP-Mannose	HMDB
Pyrophosphate mannose, guanosine	HMDB
Diphosphomannose, guanosine	HMDB
Mannose, guanosine diphosphate	HMDB
Diphosphate mannose, guanosine	HMDB
Mannose, guanosine pyrophosphate	HMDB
Mannose, GDP	HMDB
Guanosine 5'-(trihydrogen diphosphate) p'-mannosyl ester	HMDB
Guanosine 5'-(trihydrogen pyrophosphate) mono-D-mannosyl ester	HMDB
Guanosine 5'-(trihydrogen pyrophosphate) monomannopyranosyl ester	HMDB
Guanosine 5'-(trihydrogen pyrophosphate) monomannosyl ester	HMDB
Guanosine 5'-diphosphate D-mannose	HMDB
Guanosine 5'-pyrophosphate D-mannosyl ester	HMDB
Guanosine 5'-pyrophosphate alpha-D-mannosyl ester	HMDB
Guanosine 5'-pyrophosphate α-D-mannosyl ester	HMDB
Guanosine 5’-(trihydrogen diphosphate) p’-mannosyl ester	HMDB
Guanosine 5’-(trihydrogen pyrophosphate) mono-D-mannosyl ester	HMDB
Guanosine 5’-(trihydrogen pyrophosphate) monomannopyranosyl ester	HMDB
Guanosine 5’-(trihydrogen pyrophosphate) monomannosyl ester	HMDB
Guanosine 5’-diphosphate D-mannose	HMDB
Guanosine 5’-pyrophosphate D-mannosyl ester	HMDB
Guanosine 5’-pyrophosphate α-D-mannosyl ester	HMDB
Guanosine diphosphate mannose	HMDB

Chemical Formula

C₁₆H₂₅N₅O₁₆P₂

Average Molecular Weight

605.3411

Monoisotopic Molecular Weight

605.077152801

IUPAC Name

[({[(2R,3S,4R,5R)-5-(2-amino-6-oxo-6,9-dihydro-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy]({[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy})phosphinic acid

Traditional Name

guanosine diphosphomannose

CAS Registry Number

3123-67-9

SMILES

NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(O)(=O)OP(O)(=O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)C(=O)N1

InChI Identifier

InChI=1S/C16H25N5O16P2/c17-16-19-12-6(13(28)20-16)18-3-21(12)14-10(26)8(24)5(34-14)2-33-38(29,30)37-39(31,32)36-15-11(27)9(25)7(23)4(1-22)35-15/h3-5,7-11,14-15,22-27H,1-2H2,(H,29,30)(H,31,32)(H3,17,19,20,28)/t4-,5-,7-,8-,9+,10-,11+,14-,15-/m1/s1

InChI Key

MVMSCBBUIHUTGJ-GDJBGNAASA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as purine nucleotide sugars. These are purine nucleotides bound to a saccharide derivative through the terminal phosphate group.

Kingdom

Organic compounds

Super Class

Nucleosides, nucleotides, and analogues

Class

Purine nucleotides

Sub Class

Purine nucleotide sugars

Direct Parent

Purine nucleotide sugars

Alternative Parents

Substituents

Purine nucleotide sugar
Purine ribonucleoside diphosphate
Purine ribonucleoside monophosphate
Pentose phosphate
Pentose-5-phosphate
Glycosyl compound
N-glycosyl compound
Monosaccharide phosphate
Organic pyrophosphate
Imidazopyrimidine
Purine
Hydroxypyrimidine
Monoalkyl phosphate
Monosaccharide
N-substituted imidazole
Organic phosphoric acid derivative
Oxane
Phosphoric acid ester
Alkyl phosphate
Pyrimidine
Heteroaromatic compound
Tetrahydrofuran
Imidazole
Azole
Secondary alcohol
Polyol
Oxacycle
Organoheterocyclic compound
Azacycle
Organic oxygen compound
Alcohol
Organic oxide
Primary alcohol
Hydrocarbon derivative
Organonitrogen compound
Organooxygen compound
Organic nitrogen compound
Organopnictogen compound
Aromatic heteropolycyclic compound

Molecular Framework

Aromatic heteropolycyclic compounds

External Descriptors

GDP-D-mannose (CHEBI:15820 )

Ontology

Physiological effect

Not Available

Disposition

Biological location

Cellular substructure

Cytoplasm (HMDB: HMDB0001163)

Eggs (FooDB: FOOD00619)

Pulse

Pulses (FooDB: FOOD00867)

Process

Naturally occurring process

Biological process

Biochemical pathway

Metabolic pathway

Fructose and Mannose Degradation (HMDB: HMDB0001163)
Mannose Metabolism (PathBank: SMP0000842)
Amino Sugar and Nucleotide Sugar Metabolism II (PathBank: SMP0000906)
Colanic Acid Building Blocks Biosynthesis (PathBank: SMP0000967)
Amino Sugar and Nucleotide Sugar Metabolism (PathBank: SMP0002331)
N-Glycan Biosynthesis (PathBank: SMP0002400)
Ascorbate Metabolism (PathBank: SMP0012446)

Disease pathway

Fructosuria (PathBank: SMP0000561)
Fructose Intolerance, Hereditary (PathBank: SMP0000725)

Role

Not Available

Physical Properties

State

Solid

Experimental Molecular Properties

Property	Value	Reference
Melting Point	Not Available	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	Not Available	Not Available
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Experimental Collision Cross Sections

Adduct Type	Data Source	CCS Value (Å²)	Reference
[M-H]-	MetCCS_train_neg	207.347	30932474
[M-H]-	Not Available	209.1	http://allccs.zhulab.cn/database/detail?ID=AllCCS00000117
[M+H]+	Not Available	227.9	http://allccs.zhulab.cn/database/detail?ID=AllCCS00000117

Predicted Molecular Properties

Property	Value	Source
Water Solubility	7.77 g/L	ALOGPS
logP	-1.8	ALOGPS
logP	-5.3	ChemAxon
logS	-1.9	ALOGPS
pKa (Strongest Acidic)	1.73	ChemAxon
pKa (Strongest Basic)	-3.6	ChemAxon
Physiological Charge	-2	ChemAxon
Hydrogen Acceptor Count	16	ChemAxon
Hydrogen Donor Count	10	ChemAxon
Polar Surface Area	327.43 Å²	ChemAxon
Rotatable Bond Count	9	ChemAxon
Refractivity	118.51 m³·mol⁻¹	ChemAxon
Polarizability	48.72 Å³	ChemAxon
Number of Rings	4	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	Yes	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
AllCCS	[M+H]+	218.564	32859911
AllCCS	[M-H]-	214.204	32859911
DeepCCS	[M+H]+	192.047	30932474
DeepCCS	[M-H]-	190.222	30932474
DeepCCS	[M-2H]-	224.029	30932474
DeepCCS	[M+Na]+	197.806	30932474
AllCCS	[M+H]+	218.6	32859911
AllCCS	[M+H-H2O]+	217.4	32859911
AllCCS	[M+NH4]+	219.6	32859911
AllCCS	[M+Na]+	219.8	32859911
AllCCS	[M-H]-	214.2	32859911
AllCCS	[M+Na-2H]-	215.4	32859911
AllCCS	[M+HCOO]-	216.8	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
Guanosine diphosphate mannose	NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(O)(=O)OP(O)(=O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)C(=O)N1	4599.0	Standard polar	33892256
Guanosine diphosphate mannose	NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(O)(=O)OP(O)(=O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)C(=O)N1	3306.1	Standard non polar	33892256
Guanosine diphosphate mannose	NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(O)(=O)OP(O)(=O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)C(=O)N1	5350.0	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
Guanosine diphosphate mannose,1TMS,isomer #1	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O	4734.7	Semi standard non polar	33892256
Guanosine diphosphate mannose,1TMS,isomer #10	C[Si](C)(C)N1C(N)=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)C1=O	4740.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,1TMS,isomer #2	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@H]1O	4710.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,1TMS,isomer #3	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[C@H](CO)[C@H]1O	4690.1	Semi standard non polar	33892256
Guanosine diphosphate mannose,1TMS,isomer #4	C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O	4714.7	Semi standard non polar	33892256
Guanosine diphosphate mannose,1TMS,isomer #5	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@@H]1O	4739.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,1TMS,isomer #6	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)O[C@H]1N1C=NC2=C1N=C(N)[NH]C2=O	4734.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,1TMS,isomer #7	C[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O)OP(=O)(O)O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O	4804.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,1TMS,isomer #8	C[Si](C)(C)OP(=O)(O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O	4814.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,1TMS,isomer #9	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)C(=O)[NH]1	4756.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TMS,isomer #1	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O	4566.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TMS,isomer #10	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H]1O	4525.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TMS,isomer #11	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H]1O	4528.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TMS,isomer #12	C[Si](C)(C)O[C@H]1[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[C@@H]1CO	4508.1	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TMS,isomer #13	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[C@H](CO)[C@H]1O[Si](C)(C)C	4500.1	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TMS,isomer #14	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@H]1O	4606.4	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TMS,isomer #15	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@H]1O	4600.4	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TMS,isomer #16	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)C(=O)[NH]1	4619.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TMS,isomer #17	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@H]1O	4602.4	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TMS,isomer #18	C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O	4531.1	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TMS,isomer #19	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO)[C@H]1O	4487.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TMS,isomer #2	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O	4570.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TMS,isomer #20	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O	4492.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TMS,isomer #21	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[C@H](CO)[C@H]1O	4575.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TMS,isomer #22	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)O[C@H](CO)[C@H]1O	4562.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TMS,isomer #23	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]3O)[C@@H](O)[C@H]2O)C(=O)[NH]1	4589.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TMS,isomer #24	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[C@H](CO)[C@H]1O	4580.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TMS,isomer #25	C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O	4525.7	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TMS,isomer #26	C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O[Si](C)(C)C	4528.7	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TMS,isomer #27	C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O	4600.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TMS,isomer #28	C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O)O[Si](C)(C)C	4596.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TMS,isomer #29	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4625.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TMS,isomer #3	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	4565.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TMS,isomer #30	C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@H](O)[C@@H]1O	4604.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TMS,isomer #31	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@@H]1O[Si](C)(C)C	4574.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TMS,isomer #32	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@@H]1O	4614.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TMS,isomer #33	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@@H]1O	4622.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TMS,isomer #34	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)[NH]1	4630.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TMS,isomer #35	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@@H]1O	4624.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TMS,isomer #36	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)O[C@H]1N1C=NC2=C1N=C(N)[NH]C2=O	4610.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TMS,isomer #37	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)O[C@H]1N1C=NC2=C1N=C(N)[NH]C2=O	4616.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TMS,isomer #38	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4633.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TMS,isomer #39	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)O[C@H]1N1C=NC2=C1N=C(N)N([Si](C)(C)C)C2=O	4621.1	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TMS,isomer #4	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	4519.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TMS,isomer #40	C[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O)OP(=O)(O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O)O[Si](C)(C)C	4675.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TMS,isomer #41	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)C(=O)[NH]1	4690.7	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TMS,isomer #42	C[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@H](O)[C@@H]1O)OP(=O)(O)O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O	4673.4	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TMS,isomer #43	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4698.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TMS,isomer #44	C[Si](C)(C)OP(=O)(O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@H](O)[C@@H]1O	4692.1	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TMS,isomer #45	C[Si](C)(C)N(C1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)C(=O)[NH]1)[Si](C)(C)C	4720.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TMS,isomer #46	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C	4721.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TMS,isomer #5	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	4573.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TMS,isomer #6	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O	4639.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TMS,isomer #7	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O	4630.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TMS,isomer #8	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)C(=O)[NH]1	4634.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TMS,isomer #9	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O	4629.1	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #1	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O	4401.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #10	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	4332.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #100	C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@H](O)[C@@H]1O	4502.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #101	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4505.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #102	C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@H](O)[C@@H]1O)O[Si](C)(C)C	4489.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #103	C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C3=O)[C@H](O)[C@@H]1O	4536.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #104	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C	4579.7	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #105	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@@H]1O[Si](C)(C)C	4433.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #106	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@@H]1O[Si](C)(C)C	4439.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #107	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4490.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #108	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@@H]1O[Si](C)(C)C	4485.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #109	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@@H]1O	4471.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #11	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	4375.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #110	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)[NH]1	4516.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #111	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@@H]1O	4509.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #112	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)[NH]1	4523.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #113	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@@H]1O	4519.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #114	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C3=O)[C@@H]1O	4548.4	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #115	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)N1[Si](C)(C)C	4586.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #116	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)O[C@H]1N1C=NC2=C1N=C(N)[NH]C2=O	4468.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #117	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4517.1	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #118	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)O[C@H]1N1C=NC2=C1N=C(N)N([Si](C)(C)C)C2=O	4502.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #119	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4524.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #12	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O	4436.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #120	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)O[C@H]1N1C=NC2=C1N=C(N)N([Si](C)(C)C)C2=O	4512.7	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #121	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)O[C@H]1N1C=NC2=C1N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C2=O	4546.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #122	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)N1[Si](C)(C)C	4585.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #123	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4572.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #124	C[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@H](O)[C@@H]1O)OP(=O)(O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O)O[Si](C)(C)C	4562.4	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #125	C[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C3=O)[C@H](O)[C@@H]1O)OP(=O)(O)O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O	4605.7	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #126	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C	4638.7	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #127	C[Si](C)(C)OP(=O)(O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C3=O)[C@H](O)[C@@H]1O	4616.4	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #128	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C	4650.7	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #129	C[Si](C)(C)N(C1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C)[Si](C)(C)C	4695.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #13	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O	4422.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #14	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)[NH]1	4469.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #15	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O	4476.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #16	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O	4374.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #17	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C	4378.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #18	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	4434.4	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #19	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	4422.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #2	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	4372.1	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #20	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]3O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4476.1	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #21	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	4476.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #22	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	4364.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #23	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	4398.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #24	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	4382.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #25	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]3O)[C@@H](O)[C@H]2O)C(=O)[NH]1	4431.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #26	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	4441.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #27	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	4441.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #28	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	4426.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #29	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)C(=O)[NH]1	4479.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #3	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	4328.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #30	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	4480.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #31	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O	4477.4	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #32	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]3O)O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4532.4	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #33	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O	4536.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #34	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)C(=O)[NH]1	4522.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #35	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O	4521.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #36	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O	4563.1	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #37	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C	4590.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #38	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H]1O	4360.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #39	C[Si](C)(C)O[C@H]1[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[C@@H]1CO	4320.1	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #4	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	4371.7	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #40	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO)[C@H]1O[Si](C)(C)C	4308.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #41	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H]1O	4398.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #42	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@H]1O	4391.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #43	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4446.1	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #44	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H]1O	4440.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #45	C[Si](C)(C)O[C@H]1[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[C@@H]1CO	4326.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #46	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O)O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@@H]1O	4315.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #47	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H]1O	4403.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #48	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]1O	4395.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #49	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]3O)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)[NH]1	4446.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #5	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O	4432.4	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #50	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H]1O	4447.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #51	C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O	4361.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #52	C[Si](C)(C)O[C@H]1[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[C@@H]1CO	4390.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #53	C[Si](C)(C)O[C@H]1[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)O[C@@H]1CO	4380.1	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #54	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]3O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4430.7	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #55	C[Si](C)(C)O[C@H]1[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[C@@H]1CO	4430.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #56	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[C@H](CO)[C@H]1O[Si](C)(C)C	4381.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #57	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)O[C@H](CO)[C@H]1O[Si](C)(C)C	4369.7	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #58	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]3O)[C@@H](O)[C@H]2O)C(=O)[NH]1	4421.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #59	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[C@H](CO)[C@H]1O[Si](C)(C)C	4425.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #6	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O	4419.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #60	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@H]1O	4461.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #61	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]3O)O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4514.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #62	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@H]1O	4502.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #63	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)C(=O)[NH]1	4507.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #64	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@H]1O	4492.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #65	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@H]1O	4537.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #66	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C	4579.7	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #67	C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O	4334.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #68	C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O[Si](C)(C)C	4341.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #69	C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O	4406.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #7	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4468.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #70	C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O)O[Si](C)(C)C	4392.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #71	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4445.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #72	C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@H](O)[C@@H]1O	4443.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #73	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O	4326.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #74	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO)[C@H]1O	4366.1	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #75	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)O[C@H](CO)[C@H]1O	4357.7	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #76	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]3O)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4412.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #77	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO)[C@H]1O	4417.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #78	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O	4372.4	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #79	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)O[C@H](CO)[C@H]1O	4363.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #8	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O	4468.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #80	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]3O)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)[NH]1	4411.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #81	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O	4423.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #82	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)O[C@H](CO)[C@H]1O	4428.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #83	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]3O)O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4478.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #84	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[C@H](CO)[C@H]1O	4478.1	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #85	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]3O)[C@@H](O)[C@H]2O)C(=O)[NH]1	4467.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #86	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)O[C@H](CO)[C@H]1O	4466.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #87	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)O[C@H](CO)[C@H]1O	4500.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #88	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]3O)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C	4554.7	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #89	C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	4370.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #9	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	4375.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #90	C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O	4399.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #91	C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O)O[Si](C)(C)C	4391.7	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #92	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4447.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #93	C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O	4439.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #94	C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O[Si](C)(C)C	4404.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #95	C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O[Si](C)(C)C)O[Si](C)(C)C	4395.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #96	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)[NH]1	4448.1	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #97	C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@H](O)[C@@H]1O[Si](C)(C)C	4446.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #98	C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O)O[Si](C)(C)C	4456.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,3TMS,isomer #99	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4513.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #1	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	4273.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #10	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	4290.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #100	C[Si](C)(C)O[C@H]1[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[C@@H]1CO	4265.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #101	C[Si](C)(C)O[C@H]1[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)O[C@@H]1CO	4255.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #102	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]3O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4310.7	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #103	C[Si](C)(C)O[C@H]1[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[C@@H]1CO	4338.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #104	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO)[C@H]1O[Si](C)(C)C	4262.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #105	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)O[C@H](CO)[C@H]1O[Si](C)(C)C	4252.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #106	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]3O)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4308.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #107	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO)[C@H]1O[Si](C)(C)C	4330.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #108	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@H]1O	4302.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #109	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]3O)O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4374.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #11	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	4276.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #110	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H]1O	4393.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #111	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4365.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #112	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@H]1O	4383.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #113	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H]1O	4399.4	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #114	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)N1[Si](C)(C)C	4452.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #115	C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O[Si](C)(C)C	4268.4	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #116	C[Si](C)(C)O[C@H]1[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[C@@H]1CO	4270.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #117	C[Si](C)(C)O[C@H]1[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)O[C@@H]1CO	4261.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #118	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)[NH]1	4314.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #119	C[Si](C)(C)O[C@H]1[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[C@@H]1CO	4351.4	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #12	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]3O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4334.7	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #120	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O)O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@@H]1O	4258.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #121	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@@H]1O	4267.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #122	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]3O)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)[NH]1	4312.1	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #123	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O)O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@@H]1O	4343.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #124	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]1O	4312.4	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #125	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]3O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)[NH]1	4378.7	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #126	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H]1O	4408.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #127	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]3O)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)[NH]1	4368.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #128	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]1O	4397.7	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #129	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H]1O	4405.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #13	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	4358.1	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #130	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]3O)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)N1[Si](C)(C)C	4454.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #131	C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H]1OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O	4304.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #132	C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O)O[Si](C)(C)C	4294.1	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #133	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4348.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #134	C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@H](O)[C@@H]1O	4365.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #135	C[Si](C)(C)O[C@H]1[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)O[C@@H]1CO	4303.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #136	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]3O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4362.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #137	C[Si](C)(C)O[C@H]1[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[C@@H]1CO	4393.1	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #138	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]3O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4353.7	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #139	C[Si](C)(C)O[C@H]1[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)O[C@@H]1CO	4381.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #14	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	4252.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #140	C[Si](C)(C)O[C@H]1[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)O[C@@H]1CO	4392.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #141	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]3O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C	4437.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #142	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)O[C@H](CO)[C@H]1O[Si](C)(C)C	4301.1	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #143	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]3O)O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4363.4	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #144	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[C@H](CO)[C@H]1O[Si](C)(C)C	4386.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #145	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]3O)[C@@H](O)[C@H]2O)C(=O)[NH]1	4351.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #146	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)O[C@H](CO)[C@H]1O[Si](C)(C)C	4375.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #147	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)O[C@H](CO)[C@H]1O[Si](C)(C)C	4390.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #148	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]3O)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C	4434.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #149	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]3O)O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4422.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #15	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	4267.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #150	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@H]1O	4434.7	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #151	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@H]1O	4459.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #152	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]3O)O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C	4505.4	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #153	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@H]1O	4446.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #154	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C	4495.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #155	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@H]1O	4523.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #156	C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	4265.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #157	C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O	4280.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #158	C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O)O[Si](C)(C)C	4269.7	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #159	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4322.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #16	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	4254.7	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #160	C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O	4349.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #161	C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O[Si](C)(C)C	4286.1	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #162	C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O[Si](C)(C)C)O[Si](C)(C)C	4275.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #163	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)[NH]1	4326.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #164	C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@H](O)[C@@H]1O[Si](C)(C)C	4361.4	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #165	C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O)O[Si](C)(C)C	4314.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #166	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4374.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #167	C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@H](O)[C@@H]1O	4403.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #168	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4364.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #169	C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@H](O)[C@@H]1O)O[Si](C)(C)C	4392.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #17	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]3O)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4311.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #170	C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C3=O)[C@H](O)[C@@H]1O	4400.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #171	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C	4451.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #172	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O	4276.7	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #173	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)O[C@H](CO)[C@H]1O	4263.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #174	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]3O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4323.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #175	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O	4364.1	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #176	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)O[C@H](CO)[C@H]1O	4288.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #177	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]3O)O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4357.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #178	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO)[C@H]1O	4384.1	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #179	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]3O)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4343.7	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #18	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	4347.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #180	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)O[C@H](CO)[C@H]1O	4372.7	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #181	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO)[C@H]1O	4374.4	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #182	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]3O)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)N1[Si](C)(C)C	4434.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #183	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)O[C@H](CO)[C@H]1O	4298.4	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #184	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]3O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)[NH]1	4361.4	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #185	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O	4398.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #186	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]3O)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)[NH]1	4347.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #187	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)O[C@H](CO)[C@H]1O	4387.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #188	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O	4381.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #189	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]3O)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)N1[Si](C)(C)C	4436.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #19	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	4288.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #190	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]3O)O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4402.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #191	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)O[C@H](CO)[C@H]1O	4424.1	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #192	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)O[C@H](CO)[C@H]1O	4437.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #193	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]3O)O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C	4489.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #194	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)O[C@H](CO)[C@H]1O	4423.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #195	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]3O)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C	4478.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #196	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[C@H](CO)[C@H]1O	4504.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #197	C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	4295.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #198	C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)O[Si](C)(C)C	4286.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #199	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4344.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #2	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	4246.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #20	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	4276.1	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #200	C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	4373.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #201	C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O)O[Si](C)(C)C	4304.1	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #202	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4371.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #203	C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O	4392.4	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #204	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4360.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #205	C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O)O[Si](C)(C)C	4381.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #206	C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O	4399.7	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #207	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)N1[Si](C)(C)C	4451.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #208	C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O[Si](C)(C)C)O[Si](C)(C)C	4313.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #209	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)[NH]1	4375.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #21	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4338.4	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #210	C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@H](O)[C@@H]1O[Si](C)(C)C	4407.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #211	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)[NH]1	4365.1	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #212	C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@H](O)[C@@H]1O[Si](C)(C)C)O[Si](C)(C)C	4395.1	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #213	C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C3=O)[C@H](O)[C@@H]1O[Si](C)(C)C	4405.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #214	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)N1[Si](C)(C)C	4453.7	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #215	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4417.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #216	C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@H](O)[C@@H]1O)O[Si](C)(C)C	4432.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #217	C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C3=O)[C@H](O)[C@@H]1O	4458.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #218	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C	4502.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #219	C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C3=O)[C@H](O)[C@@H]1O)O[Si](C)(C)C	4444.7	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #22	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	4364.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #220	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C	4491.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #221	C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C3=O)[C@H](O)[C@@H]1O	4523.7	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #222	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@@H]1O[Si](C)(C)C	4333.1	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #223	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4398.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #224	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@@H]1O[Si](C)(C)C	4421.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #225	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4407.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #226	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@@H]1O[Si](C)(C)C	4428.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #227	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C3=O)[C@@H]1O[Si](C)(C)C	4437.1	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #228	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C(=O)N1[Si](C)(C)C	4488.1	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #229	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)[NH]1	4434.4	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #23	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O	4312.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #230	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@@H]1O	4451.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #231	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C3=O)[C@@H]1O	4461.4	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #232	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)N1[Si](C)(C)C	4503.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #233	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C3=O)[C@@H]1O	4469.4	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #234	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)N1[Si](C)(C)C	4510.4	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #235	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C3=O)[C@@H]1O	4538.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #236	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4428.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #237	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)O[C@H]1N1C=NC2=C1N=C(N)N([Si](C)(C)C)C2=O	4438.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #238	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)O[C@H]1N1C=NC2=C1N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C2=O	4456.7	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #239	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)N1[Si](C)(C)C	4501.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #24	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]3O)O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4380.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #240	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)O[C@H]1N1C=NC2=C1N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C2=O	4465.4	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #241	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)N1[Si](C)(C)C	4509.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #242	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)O[C@H]1N1C=NC2=C1N=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C2=O	4536.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #243	C[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C3=O)[C@H](O)[C@@H]1O)OP(=O)(O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O)O[Si](C)(C)C	4506.7	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #244	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C	4545.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #245	C[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C3=O)[C@H](O)[C@@H]1O)OP(=O)(O)O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O	4578.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #246	C[Si](C)(C)OP(=O)(O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C3=O)[C@H](O)[C@@H]1O	4589.7	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #25	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O	4401.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #26	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4369.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #27	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O	4392.1	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #28	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O	4417.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #29	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)N1[Si](C)(C)C	4465.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #3	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	4272.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #30	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O	4266.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #31	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C	4258.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #32	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	4298.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #33	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	4285.1	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #34	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)[NH]1	4338.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #35	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	4370.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #36	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	4257.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #37	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	4275.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #38	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	4262.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #39	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]3O)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)[NH]1	4314.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #4	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O	4308.4	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #40	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	4361.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #41	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	4295.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #42	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	4284.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #43	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]3O)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)[NH]1	4341.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #44	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	4378.4	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #45	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O	4323.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #46	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]3O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)[NH]1	4384.1	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #47	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O	4415.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #48	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)[NH]1	4371.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #49	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O	4406.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #5	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O	4297.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #50	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O	4421.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #51	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)N1[Si](C)(C)C	4467.4	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #52	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	4303.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #53	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O	4302.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #54	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O	4291.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #55	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4347.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #56	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O	4377.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #57	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C	4303.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #58	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C	4287.1	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #59	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]3O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4346.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #6	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4357.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #60	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C	4373.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #61	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	4321.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #62	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]3O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4383.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #63	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	4413.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #64	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]3O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4370.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #65	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	4401.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #66	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	4418.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #67	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]3O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C	4469.4	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #68	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	4298.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #69	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	4282.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #7	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O	4387.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #70	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]3O)[C@@H](O)[C@H]2O)C(=O)[NH]1	4342.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #71	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	4369.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #72	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	4299.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #73	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]3O)O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4363.1	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #74	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	4401.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #75	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]3O)[C@@H](O)[C@H]2O)C(=O)[NH]1	4347.4	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #76	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	4389.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #77	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	4390.4	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #78	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]3O)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C	4451.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #79	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	4324.7	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #8	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O	4260.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #80	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]3O)O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4392.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #81	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	4420.4	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #82	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)C(=O)[NH]1	4379.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #83	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	4408.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #84	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	4424.4	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #85	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C	4476.7	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #86	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]3O)O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4418.1	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #87	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O	4441.1	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #88	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O	4467.1	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #89	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]3O)O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C	4510.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #9	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C	4253.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #90	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O	4456.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #91	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C	4501.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #92	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O	4547.4	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #93	C[Si](C)(C)O[C@H]1[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@@H]1CO	4245.4	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #94	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O[Si](C)(C)C	4242.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #95	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H]1O	4290.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #96	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]1O	4281.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #97	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]3O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4341.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #98	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H]1O	4373.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,4TMS,isomer #99	C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O	4263.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,1TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O	4918.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,1TBDMS,isomer #10	CC(C)(C)[Si](C)(C)N1C(N)=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)C1=O	4934.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,1TBDMS,isomer #2	CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@H]1O	4904.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,1TBDMS,isomer #3	CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[C@H](CO)[C@H]1O	4884.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,1TBDMS,isomer #4	CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O	4900.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,1TBDMS,isomer #5	CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@@H]1O	4941.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,1TBDMS,isomer #6	CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)O[C@H]1N1C=NC2=C1N=C(N)[NH]C2=O	4936.1	Semi standard non polar	33892256
Guanosine diphosphate mannose,1TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O)OP(=O)(O)O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O	4987.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,1TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OP(=O)(O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O	4997.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,1TBDMS,isomer #9	CC(C)(C)[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)C(=O)[NH]1	4943.1	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O	4906.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TBDMS,isomer #10	CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H](O)[C@H]1O	4863.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TBDMS,isomer #11	CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O	4861.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TBDMS,isomer #12	CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[C@@H]1CO	4821.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TBDMS,isomer #13	CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[C@H](CO)[C@H]1O[Si](C)(C)C(C)(C)C	4806.1	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TBDMS,isomer #14	CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@H]1O	4918.4	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TBDMS,isomer #15	CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O	4913.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TBDMS,isomer #16	CC(C)(C)[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)C(=O)[NH]1	4890.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TBDMS,isomer #17	CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C(C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@H]1O	4917.4	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TBDMS,isomer #18	CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O	4841.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TBDMS,isomer #19	CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)O[C@H](CO)[C@H]1O	4831.4	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O	4906.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TBDMS,isomer #20	CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@H]1O	4829.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TBDMS,isomer #21	CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[C@H](CO)[C@H]1O	4897.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TBDMS,isomer #22	CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@H]1O	4884.4	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TBDMS,isomer #23	CC(C)(C)[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]3O)[C@@H](O)[C@H]2O)C(=O)[NH]1	4865.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TBDMS,isomer #24	CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C(C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[C@H](CO)[C@H]1O	4907.3	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TBDMS,isomer #25	CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O	4856.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TBDMS,isomer #26	CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C	4855.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TBDMS,isomer #27	CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O	4912.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TBDMS,isomer #28	CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O)O[Si](C)(C)C(C)(C)C	4906.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TBDMS,isomer #29	CC(C)(C)[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4889.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O	4889.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TBDMS,isomer #30	CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C(C)(C)C)C3=O)[C@H](O)[C@@H]1O	4914.1	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TBDMS,isomer #31	CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@@H]1O[Si](C)(C)C(C)(C)C	4910.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TBDMS,isomer #32	CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@@H]1O	4943.1	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TBDMS,isomer #33	CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)O[Si](C)(C)C(C)(C)C)O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@@H]1O	4947.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TBDMS,isomer #34	CC(C)(C)[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)C(=O)[NH]1	4920.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TBDMS,isomer #35	CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C(C)(C)C)C3=O)[C@@H]1O	4953.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TBDMS,isomer #36	CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)O[C@H]1N1C=NC2=C1N=C(N)[NH]C2=O	4944.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TBDMS,isomer #37	CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)O[Si](C)(C)C(C)(C)C)O[C@H]1N1C=NC2=C1N=C(N)[NH]C2=O	4946.7	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TBDMS,isomer #38	CC(C)(C)[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)C(=O)[NH]1	4926.4	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TBDMS,isomer #39	CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)O[C@H]1N1C=NC2=C1N=C(N)N([Si](C)(C)C(C)(C)C)C2=O	4955.7	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O	4853.7	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TBDMS,isomer #40	CC(C)(C)[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O)OP(=O)(O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O)O[Si](C)(C)C(C)(C)C	4990.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TBDMS,isomer #41	CC(C)(C)[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)C(=O)[NH]1	4986.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TBDMS,isomer #42	CC(C)(C)[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C(C)(C)C)C3=O)[C@H](O)[C@@H]1O)OP(=O)(O)O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O	4993.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TBDMS,isomer #43	CC(C)(C)[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4994.5	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TBDMS,isomer #44	CC(C)(C)[Si](C)(C)OP(=O)(O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C(C)(C)C)C3=O)[C@H](O)[C@@H]1O	5004.6	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TBDMS,isomer #45	CC(C)(C)[Si](C)(C)N(C1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)C(=O)[NH]1)[Si](C)(C)C(C)(C)C	5016.8	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TBDMS,isomer #46	CC(C)(C)[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C(C)(C)C	5040.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C	4884.7	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O	4951.9	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O	4944.2	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TBDMS,isomer #8	CC(C)(C)[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)C(=O)[NH]1	4915.0	Semi standard non polar	33892256
Guanosine diphosphate mannose,2TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C(C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O	4939.0	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - Guanosine diphosphate mannose GC-MS (Non-derivatized) - 70eV, Positive	splash10-05bu-5842490000-d73f755e03b8ad234b29	2017-09-01	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Guanosine diphosphate mannose GC-MS (1 TMS) - 70eV, Positive	splash10-01r6-7882509000-02adbc06a0f79e803d88	2017-10-06	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Guanosine diphosphate mannose GC-MS (TMS_1_2) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Guanosine diphosphate mannose GC-MS (TMS_1_3) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Guanosine diphosphate mannose GC-MS (TMS_1_4) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Guanosine diphosphate mannose GC-MS (TMS_1_5) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Guanosine diphosphate mannose GC-MS (TMS_1_6) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Guanosine diphosphate mannose GC-MS (TMS_1_7) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Guanosine diphosphate mannose GC-MS (TMS_1_8) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Guanosine diphosphate mannose GC-MS (TMS_1_9) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Guanosine diphosphate mannose GC-MS (TMS_1_10) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Guanosine diphosphate mannose GC-MS (TMS_2_1) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Guanosine diphosphate mannose GC-MS (TMS_2_2) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Guanosine diphosphate mannose GC-MS (TMS_2_3) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Guanosine diphosphate mannose GC-MS (TMS_2_4) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Guanosine diphosphate mannose GC-MS (TMS_2_5) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Guanosine diphosphate mannose GC-MS (TMS_2_6) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Guanosine diphosphate mannose GC-MS (TMS_2_7) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Guanosine diphosphate mannose GC-MS (TMS_2_8) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Guanosine diphosphate mannose GC-MS (TMS_2_9) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Guanosine diphosphate mannose GC-MS (TMS_2_10) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Guanosine diphosphate mannose GC-MS (TMS_2_11) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Guanosine diphosphate mannose GC-MS (TMS_2_12) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Guanosine diphosphate mannose GC-MS (TMS_2_13) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Guanosine diphosphate mannose GC-MS (TMS_2_14) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Experimental LC-MS/MS	LC-MS/MS Spectrum - Guanosine diphosphate mannose LC-ESI-QTOF 32V, positive-QTOF	splash10-0a4i-0000209000-fa2b35ba4f2fbdff74a3	2020-07-21	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Guanosine diphosphate mannose LC-ESI-QTOF 32V, negative-QTOF	splash10-0udi-3401309000-93213e14894fde4ba5c2	2020-07-21	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Guanosine diphosphate mannose 20V, Negative-QTOF	splash10-0udi-0001309000-586a7f020650fe518e5f	2021-09-20	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Guanosine diphosphate mannose 40V, Positive-QTOF	splash10-0udi-0900000000-bba5489b865ff8d5ba78	2021-09-20	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Guanosine diphosphate mannose 10V, Positive-QTOF	splash10-0006-0100900000-d5b51af9c9e096503197	2021-09-20	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Guanosine diphosphate mannose 20V, Positive-QTOF	splash10-0udi-0900400000-3410bfae1c82b5e08999	2021-09-20	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Guanosine diphosphate mannose 40V, Negative-QTOF	splash10-00b9-9434300000-661dad8f3e9cd9b10a38	2021-09-20	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Guanosine diphosphate mannose 10V, Negative-QTOF	splash10-0udi-0000009000-c84788b57e1d68c3a299	2021-09-20	HMDB team, MONA	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Guanosine diphosphate mannose 10V, Positive-QTOF	splash10-0udi-0910510000-30a5518df6f0f53ad7b7	2015-09-14	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Guanosine diphosphate mannose 20V, Positive-QTOF	splash10-0udi-0910000000-48aef418f3aa94cc35f8	2015-09-14	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Guanosine diphosphate mannose 40V, Positive-QTOF	splash10-0udi-1900000000-438261daf883fac47d6c	2015-09-14	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Guanosine diphosphate mannose 10V, Negative-QTOF	splash10-0udi-1901325000-e5d0bcd5db4a59b606f8	2015-09-15	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Guanosine diphosphate mannose 20V, Negative-QTOF	splash10-0udi-1901100000-a8c00836fd0ca5a71ad1	2015-09-15	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Guanosine diphosphate mannose 40V, Negative-QTOF	splash10-0pdl-3900000000-358726d071759c859d9e	2015-09-15	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Guanosine diphosphate mannose 10V, Negative-QTOF	splash10-0udi-0000009000-3f663b5fce4f431e1e25	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Guanosine diphosphate mannose 20V, Negative-QTOF	splash10-0udi-4701986000-bb5e3a66be23d7de55e6	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Guanosine diphosphate mannose 40V, Negative-QTOF	splash10-05i0-3911810000-ee275d8a12bcf1e5065c	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Guanosine diphosphate mannose 10V, Positive-QTOF	splash10-0udi-0900002000-37d2f661727ecc1c915a	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Guanosine diphosphate mannose 20V, Positive-QTOF	splash10-0udi-0900001000-de8f3c7c7e6a620f0e90	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Guanosine diphosphate mannose 40V, Positive-QTOF	splash10-0udr-2930000000-7a0fc600f843201b86c4	2021-09-24	Wishart Lab	View Spectrum

NMR Spectra

Spectrum Type	Description	Deposition Date	Source	View
Predicted 1D NMR	¹³C NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Cytoplasm

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Name	SMPDB/PathBank	KEGG
Fructose and mannose metabolism	Not Available
Fructosuria		Not Available
Fructose intolerance, hereditary		Not Available

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

KNApSAcK ID

Chemspider ID

KEGG Compound ID

BioCyc ID

BiGG ID

Wikipedia Link

Guanosine diphosphate mannose

METLIN ID

6045

PubChem Compound

18396

PDB ID

Not Available

ChEBI ID

15820

Food Biomarker Ontology

Not Available

VMH ID

GDPMANN

MarkerDB ID

Not Available

Good Scents ID

Not Available

References

Synthesis Reference

Huang, Gang-Liang; Liu, Xiang; Zhang, Hou-Cheng; Wang, Peng-George. A facile two-step chemo-enzymatic synthesis of GDP-mannose. Letters in Organic Chemistry (2006), 3(9), 668-669.

Material Safety Data Sheet (MSDS)

Not Available

General References

Becker DJ, Lowe JB: Fucose: biosynthesis and biological function in mammals. Glycobiology. 2003 Jul;13(7):41R-53R. Epub 2003 Mar 19. [PubMed:12651883 ]

Enzymes

Enzyme Details

1. Alpha-1,3/1,6-mannosyltransferase ALG2

General function:: Involved in biosynthetic process
Specific function:: Mannosylates Man(2)GlcNAc(2)-dolichol diphosphate and Man(1)GlcNAc(2)-dolichol diphosphate to form Man(3)GlcNAc(2)-dolichol diphosphate.
Gene Name:: ALG2
Uniprot ID:: Q9H553
Molecular weight:: 47091.075

Reactions

Guanosine diphosphate mannose + D-Man-beta-(1->4)-D-GlcNAc-beta-(1->4)-D-GlcNAc-diphosphodolichol → Guanosine diphosphate + D-Man-alpha-(1->3)-D-Man-beta-(1->4)-D-GlcNAc-beta-(1->4)-GlcNAc-diphosphodolichol	details
Guanosine diphosphate mannose + D-Man-alpha-(1->3)-D-Man-beta-(1->4)-D-GlcNAc-beta-(1->4)-D-GlcNAc-diphosphodolichol → Guanosine diphosphate + D-Man-alpha-(1->3)-(D-Man-alpha-(1->6))-D-Man-beta-(1->4)-D-GlcNAc-beta-(1->4)-D-GlcNAc-diphosphodolichol	details

Enzyme Details

2. Dolichol-phosphate mannosyltransferase

General function:: Cell wall/membrane/envelope biogenesis
Specific function:: Transfers mannose from GDP-mannose to dolichol monophosphate to form dolichol phosphate mannose (Dol-P-Man) which is the mannosyl donor in pathways leading to N-glycosylation, glycosyl phosphatidylinositol membrane anchoring, and O-mannosylation of proteins.
Gene Name:: DPM1
Uniprot ID:: O60762
Molecular weight:: 29633.995

Reactions

Guanosine diphosphate mannose + Dolichol-20 → Guanosine diphosphate + Dolichyl beta-D-mannosyl phosphate	details
Guanosine diphosphate mannose + Dolichol-20 → Guanosine diphosphate + Dolichyl phosphate D-mannose	details

Enzyme Details

3. GDP-mannose 4,6 dehydratase

General function:: Involved in catalytic activity
Specific function:: Conversion of GDP-D-mannose to GDP-4-keto-6-D-deoxymannose.
Gene Name:: GMDS
Uniprot ID:: O60547
Molecular weight:: 39053.295

Reactions

Guanosine diphosphate mannose → GDP-4-Dehydro-6-deoxy-D-mannose + Water	details

Enzyme Details

4. Chitobiosyldiphosphodolichol beta-mannosyltransferase

General function:: Involved in biosynthetic process
Specific function:: Participates in the formation of the lipid-linked precursor oligosaccharide for N-glycosylation. Involved in assembling the dolichol-pyrophosphate-GlcNAc(2)-Man(5) intermediate on the cytoplasmic surface of the ER.
Gene Name:: ALG1
Uniprot ID:: Q9BT22
Molecular weight:: 52517.685

Reactions

Guanosine diphosphate mannose + (N-Acetylglucosaminyl)2-diphosphodolichol → Guanosine diphosphate + beta-1,4-D-mannosylchitobiosyldiphosphodolichol	details

Enzyme Details

5. Mannose-1-phosphate guanyltransferase beta

General function:: Involved in transferase activity
Specific function:: Not Available
Gene Name:: GMPPB
Uniprot ID:: Q9Y5P6
Molecular weight:: 42649.34

Reactions

Guanosine triphosphate + D-Mannose 1-phosphate → Pyrophosphate + Guanosine diphosphate mannose	details

Enzyme Details

6. Mannose-1-phosphate guanyltransferase alpha

General function:: Involved in transferase activity
Specific function:: Not Available
Gene Name:: GMPPA
Uniprot ID:: Q96IJ6
Molecular weight:: 46290.785

Reactions

Guanosine triphosphate + D-Mannose 1-phosphate → Pyrophosphate + Guanosine diphosphate mannose	details

Enzyme Details

7. GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase

General function:: Not Available
Specific function:: Mannosyltransferase involved in the last steps of the synthesis of Man5GlcNAc(2)-PP-dolichol core oligosaccharide on the cytoplasmic face of the endoplasmic reticulum. Catalyzes the addition of the 4th and 5th mannose residues to the dolichol-linked oligosaccharide chain.
Gene Name:: ALG11
Uniprot ID:: Q2TAA5
Molecular weight:: 55650.595

Reactions

Guanosine diphosphate mannose + D-Man-alpha-(1->3)-(D-Man-alpha-(1->6))-D-Man-beta-(1->4)-D-GlcNAc-beta-(1->4)-D-GlcNAc-diphosphodolichol → Guanosine diphosphate + D-Man-alpha-(1->2)-D-Man-alpha-(1->2)-D-Man-alpha-(1->3)-(D-Man-alpha-(1->6))-D-Man-beta-(1->4)-D-GlcNAc-beta-(1->4)-D-GlcNAc-diphosphodolichol	details

Enzyme Details

8. Dolichol phosphate-mannose biosynthesis regulatory protein

General function:: Not Available
Specific function:: Regulates the biosynthesis of dolichol phosphate-mannose. Essential for the ER localization and stable expression of DPM1.
Gene Name:: DPM2
Uniprot ID:: O94777
Molecular weight:: Not Available

Reactions

Guanosine diphosphate mannose + Dolichol-20 → Guanosine diphosphate + Dolichyl phosphate D-mannose	details

Enzyme Details

9. Dolichol-phosphate mannosyltransferase subunit 3

General function:: Not Available
Specific function:: Stabilizer subunit of the dolichol-phosphate-mannose synthase complex.
Gene Name:: DPM3
Uniprot ID:: Q9P2X0
Molecular weight:: Not Available

Reactions

Guanosine diphosphate mannose + Dolichol-20 → Guanosine diphosphate + Dolichyl phosphate D-mannose	details

Showing metabocard for Guanosine diphosphate mannose (HMDB0001163)

MOL for HMDB0001163 (Guanosine diphosphate mannose)

3D MOL for HMDB0001163 (Guanosine diphosphate mannose)

3D SDF for HMDB0001163 (Guanosine diphosphate mannose)

3D-SDF for HMDB0001163 (Guanosine diphosphate mannose)

PDB for HMDB0001163 (Guanosine diphosphate mannose)

3D PDB for HMDB0001163 (Guanosine diphosphate mannose)

SMILES for HMDB0001163 (Guanosine diphosphate mannose)

INCHI for HMDB0001163 (Guanosine diphosphate mannose)

Structure for HMDB0001163 (Guanosine diphosphate mannose)

3D Structure for HMDB0001163 (Guanosine diphosphate mannose)

Experimental Collision Cross Sections

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra

NMR Spectra

Enzymes

Reactions

Reactions

Reactions

Reactions

Reactions

Reactions

Reactions

Reactions

Reactions