| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 1.88 minutes | 32390414 |
| Predicted by Siyang on May 30, 2022 | 8.778 minutes | 33406817 |
| Predicted by Siyang using ReTip algorithm on June 8, 2022 | 8.47 minutes | 32390414 |
| AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid | 409.0 seconds | 40023050 |
| Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 439.4 seconds | 40023050 |
| Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 327.0 seconds | 40023050 |
| Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 44.3 seconds | 40023050 |
| Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 214.5 seconds | 40023050 |
| RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 80.1 seconds | 40023050 |
| Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 286.4 seconds | 40023050 |
| BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 224.8 seconds | 40023050 |
| HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 757.2 seconds | 40023050 |
| UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 561.3 seconds | 40023050 |
| BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 39.5 seconds | 40023050 |
| UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 617.3 seconds | 40023050 |
| SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 206.6 seconds | 40023050 |
| RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 339.3 seconds | 40023050 |
| MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 764.3 seconds | 40023050 |
| KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 383.5 seconds | 40023050 |
| Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 448.4 seconds | 40023050 |
| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Glyceraldehyde 3-phosphate,1TMS,isomer #1 | C[Si](C)(C)O[C@@H](C=O)COP(=O)(O)O | 1603.8 | Semi standard non polar | 33892256 |
| Glyceraldehyde 3-phosphate,1TMS,isomer #2 | C[Si](C)(C)OP(=O)(O)OC[C@@H](O)C=O | 1595.6 | Semi standard non polar | 33892256 |
| Glyceraldehyde 3-phosphate,1TMS,isomer #3 | C[Si](C)(C)OC=C(O)COP(=O)(O)O | 1689.7 | Semi standard non polar | 33892256 |
| Glyceraldehyde 3-phosphate,2TMS,isomer #1 | C[Si](C)(C)O[C@@H](C=O)COP(=O)(O)O[Si](C)(C)C | 1670.3 | Semi standard non polar | 33892256 |
| Glyceraldehyde 3-phosphate,2TMS,isomer #1 | C[Si](C)(C)O[C@@H](C=O)COP(=O)(O)O[Si](C)(C)C | 1570.8 | Standard non polar | 33892256 |
| Glyceraldehyde 3-phosphate,2TMS,isomer #1 | C[Si](C)(C)O[C@@H](C=O)COP(=O)(O)O[Si](C)(C)C | 2048.5 | Standard polar | 33892256 |
| Glyceraldehyde 3-phosphate,2TMS,isomer #2 | C[Si](C)(C)OC=C(COP(=O)(O)O)O[Si](C)(C)C | 1751.8 | Semi standard non polar | 33892256 |
| Glyceraldehyde 3-phosphate,2TMS,isomer #2 | C[Si](C)(C)OC=C(COP(=O)(O)O)O[Si](C)(C)C | 1715.5 | Standard non polar | 33892256 |
| Glyceraldehyde 3-phosphate,2TMS,isomer #2 | C[Si](C)(C)OC=C(COP(=O)(O)O)O[Si](C)(C)C | 2483.5 | Standard polar | 33892256 |
| Glyceraldehyde 3-phosphate,2TMS,isomer #3 | C[Si](C)(C)OP(=O)(OC[C@@H](O)C=O)O[Si](C)(C)C | 1635.3 | Semi standard non polar | 33892256 |
| Glyceraldehyde 3-phosphate,2TMS,isomer #3 | C[Si](C)(C)OP(=O)(OC[C@@H](O)C=O)O[Si](C)(C)C | 1587.8 | Standard non polar | 33892256 |
| Glyceraldehyde 3-phosphate,2TMS,isomer #3 | C[Si](C)(C)OP(=O)(OC[C@@H](O)C=O)O[Si](C)(C)C | 1945.7 | Standard polar | 33892256 |
| Glyceraldehyde 3-phosphate,2TMS,isomer #4 | C[Si](C)(C)OC=C(O)COP(=O)(O)O[Si](C)(C)C | 1752.3 | Semi standard non polar | 33892256 |
| Glyceraldehyde 3-phosphate,2TMS,isomer #4 | C[Si](C)(C)OC=C(O)COP(=O)(O)O[Si](C)(C)C | 1634.1 | Standard non polar | 33892256 |
| Glyceraldehyde 3-phosphate,2TMS,isomer #4 | C[Si](C)(C)OC=C(O)COP(=O)(O)O[Si](C)(C)C | 2203.5 | Standard polar | 33892256 |
| Glyceraldehyde 3-phosphate,3TMS,isomer #1 | C[Si](C)(C)O[C@@H](C=O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 1715.1 | Semi standard non polar | 33892256 |
| Glyceraldehyde 3-phosphate,3TMS,isomer #1 | C[Si](C)(C)O[C@@H](C=O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 1645.3 | Standard non polar | 33892256 |
| Glyceraldehyde 3-phosphate,3TMS,isomer #1 | C[Si](C)(C)O[C@@H](C=O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 1746.4 | Standard polar | 33892256 |
| Glyceraldehyde 3-phosphate,3TMS,isomer #2 | C[Si](C)(C)OC=C(COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C | 1792.8 | Semi standard non polar | 33892256 |
| Glyceraldehyde 3-phosphate,3TMS,isomer #2 | C[Si](C)(C)OC=C(COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C | 1686.2 | Standard non polar | 33892256 |
| Glyceraldehyde 3-phosphate,3TMS,isomer #2 | C[Si](C)(C)OC=C(COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C | 2059.2 | Standard polar | 33892256 |
| Glyceraldehyde 3-phosphate,3TMS,isomer #3 | C[Si](C)(C)OC=C(O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 1803.1 | Semi standard non polar | 33892256 |
| Glyceraldehyde 3-phosphate,3TMS,isomer #3 | C[Si](C)(C)OC=C(O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 1702.0 | Standard non polar | 33892256 |
| Glyceraldehyde 3-phosphate,3TMS,isomer #3 | C[Si](C)(C)OC=C(O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 1919.2 | Standard polar | 33892256 |
| Glyceraldehyde 3-phosphate,4TMS,isomer #1 | C[Si](C)(C)OC=C(COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C | 1833.6 | Semi standard non polar | 33892256 |
| Glyceraldehyde 3-phosphate,4TMS,isomer #1 | C[Si](C)(C)OC=C(COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C | 1740.3 | Standard non polar | 33892256 |
| Glyceraldehyde 3-phosphate,4TMS,isomer #1 | C[Si](C)(C)OC=C(COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C | 1843.8 | Standard polar | 33892256 |
| Glyceraldehyde 3-phosphate,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@@H](C=O)COP(=O)(O)O | 1843.7 | Semi standard non polar | 33892256 |
| Glyceraldehyde 3-phosphate,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OP(=O)(O)OC[C@@H](O)C=O | 1835.1 | Semi standard non polar | 33892256 |
| Glyceraldehyde 3-phosphate,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC=C(O)COP(=O)(O)O | 1919.6 | Semi standard non polar | 33892256 |
| Glyceraldehyde 3-phosphate,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@@H](C=O)COP(=O)(O)O[Si](C)(C)C(C)(C)C | 2088.0 | Semi standard non polar | 33892256 |
| Glyceraldehyde 3-phosphate,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@@H](C=O)COP(=O)(O)O[Si](C)(C)C(C)(C)C | 2008.5 | Standard non polar | 33892256 |
| Glyceraldehyde 3-phosphate,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@@H](C=O)COP(=O)(O)O[Si](C)(C)C(C)(C)C | 2265.9 | Standard polar | 33892256 |
| Glyceraldehyde 3-phosphate,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC=C(COP(=O)(O)O)O[Si](C)(C)C(C)(C)C | 2150.4 | Semi standard non polar | 33892256 |
| Glyceraldehyde 3-phosphate,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC=C(COP(=O)(O)O)O[Si](C)(C)C(C)(C)C | 2132.4 | Standard non polar | 33892256 |
| Glyceraldehyde 3-phosphate,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC=C(COP(=O)(O)O)O[Si](C)(C)C(C)(C)C | 2634.7 | Standard polar | 33892256 |
| Glyceraldehyde 3-phosphate,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OP(=O)(OC[C@@H](O)C=O)O[Si](C)(C)C(C)(C)C | 2059.6 | Semi standard non polar | 33892256 |
| Glyceraldehyde 3-phosphate,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OP(=O)(OC[C@@H](O)C=O)O[Si](C)(C)C(C)(C)C | 2013.5 | Standard non polar | 33892256 |
| Glyceraldehyde 3-phosphate,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OP(=O)(OC[C@@H](O)C=O)O[Si](C)(C)C(C)(C)C | 2153.6 | Standard polar | 33892256 |
| Glyceraldehyde 3-phosphate,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC=C(O)COP(=O)(O)O[Si](C)(C)C(C)(C)C | 2187.8 | Semi standard non polar | 33892256 |
| Glyceraldehyde 3-phosphate,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC=C(O)COP(=O)(O)O[Si](C)(C)C(C)(C)C | 2096.9 | Standard non polar | 33892256 |
| Glyceraldehyde 3-phosphate,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC=C(O)COP(=O)(O)O[Si](C)(C)C(C)(C)C | 2418.5 | Standard polar | 33892256 |
| Glyceraldehyde 3-phosphate,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@@H](C=O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2332.7 | Semi standard non polar | 33892256 |
| Glyceraldehyde 3-phosphate,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@@H](C=O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2210.1 | Standard non polar | 33892256 |
| Glyceraldehyde 3-phosphate,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@@H](C=O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2087.9 | Standard polar | 33892256 |
| Glyceraldehyde 3-phosphate,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC=C(COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2390.6 | Semi standard non polar | 33892256 |
| Glyceraldehyde 3-phosphate,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC=C(COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2274.9 | Standard non polar | 33892256 |
| Glyceraldehyde 3-phosphate,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC=C(COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2329.7 | Standard polar | 33892256 |
| Glyceraldehyde 3-phosphate,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC=C(O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2410.3 | Semi standard non polar | 33892256 |
| Glyceraldehyde 3-phosphate,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC=C(O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2294.0 | Standard non polar | 33892256 |
| Glyceraldehyde 3-phosphate,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC=C(O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2248.7 | Standard polar | 33892256 |
| Glyceraldehyde 3-phosphate,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC=C(COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2592.2 | Semi standard non polar | 33892256 |
| Glyceraldehyde 3-phosphate,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC=C(COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2402.3 | Standard non polar | 33892256 |
| Glyceraldehyde 3-phosphate,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC=C(COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2243.6 | Standard polar | 33892256 |