| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 1.11 minutes | 32390414 |
| Predicted by Siyang on May 30, 2022 | 10.3384 minutes | 33406817 |
| Predicted by Siyang using ReTip algorithm on June 8, 2022 | 8.5 minutes | 32390414 |
| AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid | 306.8 seconds | 40023050 |
| Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 1142.9 seconds | 40023050 |
| Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 311.2 seconds | 40023050 |
| Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 56.8 seconds | 40023050 |
| Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 174.4 seconds | 40023050 |
| RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 61.6 seconds | 40023050 |
| Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 280.7 seconds | 40023050 |
| BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 273.3 seconds | 40023050 |
| HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 775.3 seconds | 40023050 |
| UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 636.8 seconds | 40023050 |
| BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 47.4 seconds | 40023050 |
| UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 884.6 seconds | 40023050 |
| SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 187.5 seconds | 40023050 |
| RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 173.6 seconds | 40023050 |
| MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 598.9 seconds | 40023050 |
| KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 421.1 seconds | 40023050 |
| Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 311.5 seconds | 40023050 |
| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Cysteinyl-Alanine,1TMS,isomer #1 | CC(NC(=O)C(N)CS)C(=O)O[Si](C)(C)C | 1770.8 | Semi standard non polar | 33892256 |
| Cysteinyl-Alanine,1TMS,isomer #2 | CC(NC(=O)C(N)CS[Si](C)(C)C)C(=O)O | 1894.9 | Semi standard non polar | 33892256 |
| Cysteinyl-Alanine,1TMS,isomer #3 | CC(NC(=O)C(CS)N[Si](C)(C)C)C(=O)O | 1817.7 | Semi standard non polar | 33892256 |
| Cysteinyl-Alanine,1TMS,isomer #4 | CC(C(=O)O)N(C(=O)C(N)CS)[Si](C)(C)C | 1797.5 | Semi standard non polar | 33892256 |
| Cysteinyl-Alanine,2TMS,isomer #1 | CC(NC(=O)C(N)CS[Si](C)(C)C)C(=O)O[Si](C)(C)C | 1937.7 | Semi standard non polar | 33892256 |
| Cysteinyl-Alanine,2TMS,isomer #1 | CC(NC(=O)C(N)CS[Si](C)(C)C)C(=O)O[Si](C)(C)C | 1849.4 | Standard non polar | 33892256 |
| Cysteinyl-Alanine,2TMS,isomer #2 | CC(NC(=O)C(CS)N[Si](C)(C)C)C(=O)O[Si](C)(C)C | 1872.5 | Semi standard non polar | 33892256 |
| Cysteinyl-Alanine,2TMS,isomer #2 | CC(NC(=O)C(CS)N[Si](C)(C)C)C(=O)O[Si](C)(C)C | 1770.4 | Standard non polar | 33892256 |
| Cysteinyl-Alanine,2TMS,isomer #3 | CC(C(=O)O[Si](C)(C)C)N(C(=O)C(N)CS)[Si](C)(C)C | 1785.5 | Semi standard non polar | 33892256 |
| Cysteinyl-Alanine,2TMS,isomer #3 | CC(C(=O)O[Si](C)(C)C)N(C(=O)C(N)CS)[Si](C)(C)C | 1690.5 | Standard non polar | 33892256 |
| Cysteinyl-Alanine,2TMS,isomer #4 | CC(NC(=O)C(CS[Si](C)(C)C)N[Si](C)(C)C)C(=O)O | 1956.0 | Semi standard non polar | 33892256 |
| Cysteinyl-Alanine,2TMS,isomer #4 | CC(NC(=O)C(CS[Si](C)(C)C)N[Si](C)(C)C)C(=O)O | 1905.5 | Standard non polar | 33892256 |
| Cysteinyl-Alanine,2TMS,isomer #5 | CC(C(=O)O)N(C(=O)C(N)CS[Si](C)(C)C)[Si](C)(C)C | 1916.7 | Semi standard non polar | 33892256 |
| Cysteinyl-Alanine,2TMS,isomer #5 | CC(C(=O)O)N(C(=O)C(N)CS[Si](C)(C)C)[Si](C)(C)C | 1895.8 | Standard non polar | 33892256 |
| Cysteinyl-Alanine,2TMS,isomer #6 | CC(C(=O)O)N(C(=O)C(CS)N[Si](C)(C)C)[Si](C)(C)C | 1910.7 | Semi standard non polar | 33892256 |
| Cysteinyl-Alanine,2TMS,isomer #6 | CC(C(=O)O)N(C(=O)C(CS)N[Si](C)(C)C)[Si](C)(C)C | 1756.1 | Standard non polar | 33892256 |
| Cysteinyl-Alanine,2TMS,isomer #7 | CC(NC(=O)C(CS)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O | 1993.6 | Semi standard non polar | 33892256 |
| Cysteinyl-Alanine,2TMS,isomer #7 | CC(NC(=O)C(CS)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O | 1874.5 | Standard non polar | 33892256 |
| Cysteinyl-Alanine,3TMS,isomer #1 | CC(NC(=O)C(CS[Si](C)(C)C)N[Si](C)(C)C)C(=O)O[Si](C)(C)C | 1977.9 | Semi standard non polar | 33892256 |
| Cysteinyl-Alanine,3TMS,isomer #1 | CC(NC(=O)C(CS[Si](C)(C)C)N[Si](C)(C)C)C(=O)O[Si](C)(C)C | 1956.8 | Standard non polar | 33892256 |
| Cysteinyl-Alanine,3TMS,isomer #2 | CC(C(=O)O[Si](C)(C)C)N(C(=O)C(N)CS[Si](C)(C)C)[Si](C)(C)C | 1939.0 | Semi standard non polar | 33892256 |
| Cysteinyl-Alanine,3TMS,isomer #2 | CC(C(=O)O[Si](C)(C)C)N(C(=O)C(N)CS[Si](C)(C)C)[Si](C)(C)C | 1971.0 | Standard non polar | 33892256 |
| Cysteinyl-Alanine,3TMS,isomer #3 | CC(C(=O)O[Si](C)(C)C)N(C(=O)C(CS)N[Si](C)(C)C)[Si](C)(C)C | 1909.5 | Semi standard non polar | 33892256 |
| Cysteinyl-Alanine,3TMS,isomer #3 | CC(C(=O)O[Si](C)(C)C)N(C(=O)C(CS)N[Si](C)(C)C)[Si](C)(C)C | 1874.6 | Standard non polar | 33892256 |
| Cysteinyl-Alanine,3TMS,isomer #4 | CC(NC(=O)C(CS)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O[Si](C)(C)C | 2015.2 | Semi standard non polar | 33892256 |
| Cysteinyl-Alanine,3TMS,isomer #4 | CC(NC(=O)C(CS)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O[Si](C)(C)C | 1982.6 | Standard non polar | 33892256 |
| Cysteinyl-Alanine,3TMS,isomer #5 | CC(C(=O)O)N(C(=O)C(CS[Si](C)(C)C)N[Si](C)(C)C)[Si](C)(C)C | 2014.4 | Semi standard non polar | 33892256 |
| Cysteinyl-Alanine,3TMS,isomer #5 | CC(C(=O)O)N(C(=O)C(CS[Si](C)(C)C)N[Si](C)(C)C)[Si](C)(C)C | 1991.9 | Standard non polar | 33892256 |
| Cysteinyl-Alanine,3TMS,isomer #6 | CC(NC(=O)C(CS[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O | 2110.8 | Semi standard non polar | 33892256 |
| Cysteinyl-Alanine,3TMS,isomer #6 | CC(NC(=O)C(CS[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O | 2063.8 | Standard non polar | 33892256 |
| Cysteinyl-Alanine,3TMS,isomer #7 | CC(C(=O)O)N(C(=O)C(CS)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C | 2036.1 | Semi standard non polar | 33892256 |
| Cysteinyl-Alanine,3TMS,isomer #7 | CC(C(=O)O)N(C(=O)C(CS)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C | 1984.7 | Standard non polar | 33892256 |
| Cysteinyl-Alanine,4TMS,isomer #1 | CC(C(=O)O[Si](C)(C)C)N(C(=O)C(CS[Si](C)(C)C)N[Si](C)(C)C)[Si](C)(C)C | 2011.9 | Semi standard non polar | 33892256 |
| Cysteinyl-Alanine,4TMS,isomer #1 | CC(C(=O)O[Si](C)(C)C)N(C(=O)C(CS[Si](C)(C)C)N[Si](C)(C)C)[Si](C)(C)C | 2052.1 | Standard non polar | 33892256 |
| Cysteinyl-Alanine,4TMS,isomer #2 | CC(NC(=O)C(CS[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O[Si](C)(C)C | 2091.6 | Semi standard non polar | 33892256 |
| Cysteinyl-Alanine,4TMS,isomer #2 | CC(NC(=O)C(CS[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O[Si](C)(C)C | 2116.3 | Standard non polar | 33892256 |
| Cysteinyl-Alanine,4TMS,isomer #3 | CC(C(=O)O[Si](C)(C)C)N(C(=O)C(CS)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C | 2052.5 | Semi standard non polar | 33892256 |
| Cysteinyl-Alanine,4TMS,isomer #3 | CC(C(=O)O[Si](C)(C)C)N(C(=O)C(CS)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C | 2089.2 | Standard non polar | 33892256 |
| Cysteinyl-Alanine,4TMS,isomer #4 | CC(C(=O)O)N(C(=O)C(CS[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C | 2158.4 | Semi standard non polar | 33892256 |
| Cysteinyl-Alanine,4TMS,isomer #4 | CC(C(=O)O)N(C(=O)C(CS[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C | 2155.7 | Standard non polar | 33892256 |
| Cysteinyl-Alanine,5TMS,isomer #1 | CC(C(=O)O[Si](C)(C)C)N(C(=O)C(CS[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C | 2187.9 | Semi standard non polar | 33892256 |
| Cysteinyl-Alanine,5TMS,isomer #1 | CC(C(=O)O[Si](C)(C)C)N(C(=O)C(CS[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C | 2212.4 | Standard non polar | 33892256 |
| Cysteinyl-Alanine,1TBDMS,isomer #1 | CC(NC(=O)C(N)CS)C(=O)O[Si](C)(C)C(C)(C)C | 2029.6 | Semi standard non polar | 33892256 |
| Cysteinyl-Alanine,1TBDMS,isomer #2 | CC(NC(=O)C(N)CS[Si](C)(C)C(C)(C)C)C(=O)O | 2151.4 | Semi standard non polar | 33892256 |
| Cysteinyl-Alanine,1TBDMS,isomer #3 | CC(NC(=O)C(CS)N[Si](C)(C)C(C)(C)C)C(=O)O | 2088.5 | Semi standard non polar | 33892256 |
| Cysteinyl-Alanine,1TBDMS,isomer #4 | CC(C(=O)O)N(C(=O)C(N)CS)[Si](C)(C)C(C)(C)C | 2044.7 | Semi standard non polar | 33892256 |
| Cysteinyl-Alanine,2TBDMS,isomer #1 | CC(NC(=O)C(N)CS[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2421.7 | Semi standard non polar | 33892256 |
| Cysteinyl-Alanine,2TBDMS,isomer #1 | CC(NC(=O)C(N)CS[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2339.3 | Standard non polar | 33892256 |
| Cysteinyl-Alanine,2TBDMS,isomer #2 | CC(NC(=O)C(CS)N[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2348.1 | Semi standard non polar | 33892256 |
| Cysteinyl-Alanine,2TBDMS,isomer #2 | CC(NC(=O)C(CS)N[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2230.3 | Standard non polar | 33892256 |
| Cysteinyl-Alanine,2TBDMS,isomer #3 | CC(C(=O)O[Si](C)(C)C(C)(C)C)N(C(=O)C(N)CS)[Si](C)(C)C(C)(C)C | 2265.2 | Semi standard non polar | 33892256 |
| Cysteinyl-Alanine,2TBDMS,isomer #3 | CC(C(=O)O[Si](C)(C)C(C)(C)C)N(C(=O)C(N)CS)[Si](C)(C)C(C)(C)C | 2160.1 | Standard non polar | 33892256 |
| Cysteinyl-Alanine,2TBDMS,isomer #4 | CC(NC(=O)C(CS[Si](C)(C)C(C)(C)C)N[Si](C)(C)C(C)(C)C)C(=O)O | 2444.6 | Semi standard non polar | 33892256 |
| Cysteinyl-Alanine,2TBDMS,isomer #4 | CC(NC(=O)C(CS[Si](C)(C)C(C)(C)C)N[Si](C)(C)C(C)(C)C)C(=O)O | 2344.6 | Standard non polar | 33892256 |
| Cysteinyl-Alanine,2TBDMS,isomer #5 | CC(C(=O)O)N(C(=O)C(N)CS[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2425.8 | Semi standard non polar | 33892256 |
| Cysteinyl-Alanine,2TBDMS,isomer #5 | CC(C(=O)O)N(C(=O)C(N)CS[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2346.4 | Standard non polar | 33892256 |
| Cysteinyl-Alanine,2TBDMS,isomer #6 | CC(C(=O)O)N(C(=O)C(CS)N[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2378.7 | Semi standard non polar | 33892256 |
| Cysteinyl-Alanine,2TBDMS,isomer #6 | CC(C(=O)O)N(C(=O)C(CS)N[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2218.5 | Standard non polar | 33892256 |
| Cysteinyl-Alanine,2TBDMS,isomer #7 | CC(NC(=O)C(CS)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O | 2475.4 | Semi standard non polar | 33892256 |
| Cysteinyl-Alanine,2TBDMS,isomer #7 | CC(NC(=O)C(CS)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O | 2311.4 | Standard non polar | 33892256 |
| Cysteinyl-Alanine,3TBDMS,isomer #1 | CC(NC(=O)C(CS[Si](C)(C)C(C)(C)C)N[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2669.3 | Semi standard non polar | 33892256 |
| Cysteinyl-Alanine,3TBDMS,isomer #1 | CC(NC(=O)C(CS[Si](C)(C)C(C)(C)C)N[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2598.3 | Standard non polar | 33892256 |
| Cysteinyl-Alanine,3TBDMS,isomer #2 | CC(C(=O)O[Si](C)(C)C(C)(C)C)N(C(=O)C(N)CS[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2633.0 | Semi standard non polar | 33892256 |
| Cysteinyl-Alanine,3TBDMS,isomer #2 | CC(C(=O)O[Si](C)(C)C(C)(C)C)N(C(=O)C(N)CS[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2616.4 | Standard non polar | 33892256 |
| Cysteinyl-Alanine,3TBDMS,isomer #3 | CC(C(=O)O[Si](C)(C)C(C)(C)C)N(C(=O)C(CS)N[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2578.5 | Semi standard non polar | 33892256 |
| Cysteinyl-Alanine,3TBDMS,isomer #3 | CC(C(=O)O[Si](C)(C)C(C)(C)C)N(C(=O)C(CS)N[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2526.3 | Standard non polar | 33892256 |
| Cysteinyl-Alanine,3TBDMS,isomer #4 | CC(NC(=O)C(CS)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2688.5 | Semi standard non polar | 33892256 |
| Cysteinyl-Alanine,3TBDMS,isomer #4 | CC(NC(=O)C(CS)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2608.8 | Standard non polar | 33892256 |
| Cysteinyl-Alanine,3TBDMS,isomer #5 | CC(C(=O)O)N(C(=O)C(CS[Si](C)(C)C(C)(C)C)N[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2697.0 | Semi standard non polar | 33892256 |
| Cysteinyl-Alanine,3TBDMS,isomer #5 | CC(C(=O)O)N(C(=O)C(CS[Si](C)(C)C(C)(C)C)N[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2612.9 | Standard non polar | 33892256 |
| Cysteinyl-Alanine,3TBDMS,isomer #6 | CC(NC(=O)C(CS[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O | 2801.2 | Semi standard non polar | 33892256 |
| Cysteinyl-Alanine,3TBDMS,isomer #6 | CC(NC(=O)C(CS[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O | 2666.2 | Standard non polar | 33892256 |
| Cysteinyl-Alanine,3TBDMS,isomer #7 | CC(C(=O)O)N(C(=O)C(CS)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2693.4 | Semi standard non polar | 33892256 |
| Cysteinyl-Alanine,3TBDMS,isomer #7 | CC(C(=O)O)N(C(=O)C(CS)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2595.7 | Standard non polar | 33892256 |
| Cysteinyl-Alanine,4TBDMS,isomer #1 | CC(C(=O)O[Si](C)(C)C(C)(C)C)N(C(=O)C(CS[Si](C)(C)C(C)(C)C)N[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2896.6 | Semi standard non polar | 33892256 |
| Cysteinyl-Alanine,4TBDMS,isomer #1 | CC(C(=O)O[Si](C)(C)C(C)(C)C)N(C(=O)C(CS[Si](C)(C)C(C)(C)C)N[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2832.6 | Standard non polar | 33892256 |
| Cysteinyl-Alanine,4TBDMS,isomer #2 | CC(NC(=O)C(CS[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 3027.7 | Semi standard non polar | 33892256 |
| Cysteinyl-Alanine,4TBDMS,isomer #2 | CC(NC(=O)C(CS[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2879.4 | Standard non polar | 33892256 |
| Cysteinyl-Alanine,4TBDMS,isomer #3 | CC(C(=O)O[Si](C)(C)C(C)(C)C)N(C(=O)C(CS)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2904.8 | Semi standard non polar | 33892256 |
| Cysteinyl-Alanine,4TBDMS,isomer #3 | CC(C(=O)O[Si](C)(C)C(C)(C)C)N(C(=O)C(CS)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2873.6 | Standard non polar | 33892256 |
| Cysteinyl-Alanine,4TBDMS,isomer #4 | CC(C(=O)O)N(C(=O)C(CS[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3030.0 | Semi standard non polar | 33892256 |
| Cysteinyl-Alanine,4TBDMS,isomer #4 | CC(C(=O)O)N(C(=O)C(CS[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2900.1 | Standard non polar | 33892256 |
| Cysteinyl-Alanine,5TBDMS,isomer #1 | CC(C(=O)O[Si](C)(C)C(C)(C)C)N(C(=O)C(CS[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3244.7 | Semi standard non polar | 33892256 |
| Cysteinyl-Alanine,5TBDMS,isomer #1 | CC(C(=O)O[Si](C)(C)C(C)(C)C)N(C(=O)C(CS[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3102.2 | Standard non polar | 33892256 |