| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Expected but not Quantified |
|---|
| Creation Date | 2017-09-13 08:06:32 UTC |
|---|
| Update Date | 2020-03-31 21:50:08 UTC |
|---|
| HMDB ID | HMDB0126497 |
|---|
| Secondary Accession Numbers | None |
|---|
| Metabolite Identification |
|---|
| Common Name | Laricitrin |
|---|
| Description | Laricitrin, also known as 3'-O-methylmyricetin or 3,4',5,5',7-pentahydroxy-3'-methoxyflavone, belongs to the class of organic compounds known as flavonols. Flavonols are compounds that contain a flavone (2-phenyl-1-benzopyran-4-one) backbone carrying a hydroxyl group at the 3-position. Thus, laricitrin is considered to be a flavonoid lipid molecule. Laricitrin is a very hydrophobic molecule, practically insoluble (in water), and relatively neutral. BioTransformer predicts that laricitrin is a product of isorhamnetin metabolism via a hydroxylation-of-benzene-ortho-to-edg reaction catalyzed by the CYP1A2, CYP2C8, CYP2C9, and CYP3A4 enzymes (PMID: 30612223 ). |
|---|
| Structure | COC1=CC(=CC(O)=C1O)C1=C(O)C(=O)C2=C(O)C=C(O)C=C2O1 InChI=1S/C16H12O8/c1-23-11-3-6(2-9(19)13(11)20)16-15(22)14(21)12-8(18)4-7(17)5-10(12)24-16/h2-5,17-20,22H,1H3 |
|---|
| Synonyms | | Value | Source |
|---|
| 3'-O-Methylmyricetin | ChEBI | | 3,4',5,5',7-Pentahydroxy-3'-methoxyflavone | ChEBI | | 2-(3,4-Dihydroxy-5-methoxyphenyl)-3,5,7-trihydroxy-4H-1-benzopyran-4-one | HMDB | | 3'-Methylmyricetin | HMDB | | 3’-Methylmyricetin | HMDB | | 3’-O-Methylmyricetin | HMDB | | Laricetrin | HMDB | | Laricitrin | HMDB | | Laricytrin | HMDB | | Larycitrin | HMDB | | Myricetin 3'-methyl ether | HMDB | | Myricetin 3’-methyl ether | HMDB |
|
|---|
| Chemical Formula | C16H12O8 |
|---|
| Average Molecular Weight | 332.264 |
|---|
| Monoisotopic Molecular Weight | 332.053217346 |
|---|
| IUPAC Name | 2-(3,4-dihydroxy-5-methoxyphenyl)-3,5,7-trihydroxy-4H-chromen-4-one |
|---|
| Traditional Name | laricitrin |
|---|
| CAS Registry Number | 53472-37-0 |
|---|
| SMILES | COC1=CC(=CC(O)=C1O)C1=C(O)C(=O)C2=C(O)C=C(O)C=C2O1 |
|---|
| InChI Identifier | InChI=1S/C16H12O8/c1-23-11-3-6(2-9(19)13(11)20)16-15(22)14(21)12-8(18)4-7(17)5-10(12)24-16/h2-5,17-20,22H,1H3 |
|---|
| InChI Key | CFYMYCCYMJIYAB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as flavonols. Flavonols are compounds that contain a flavone (2-phenyl-1-benzopyran-4-one) backbone carrying a hydroxyl group at the 3-position. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Phenylpropanoids and polyketides |
|---|
| Class | Flavonoids |
|---|
| Sub Class | Flavones |
|---|
| Direct Parent | Flavonols |
|---|
| Alternative Parents | |
|---|
| Substituents | - 3p-methoxyflavonoid-skeleton
- 3-hydroxyflavone
- 3'-hydroxyflavonoid
- 3-hydroxyflavonoid
- 4'-hydroxyflavonoid
- 5-hydroxyflavonoid
- 7-hydroxyflavonoid
- Hydroxyflavonoid
- Chromone
- Benzopyran
- Methoxyphenol
- 1-benzopyran
- Phenoxy compound
- Anisole
- Catechol
- Methoxybenzene
- Phenol ether
- Pyranone
- Phenol
- Alkyl aryl ether
- 1-hydroxy-4-unsubstituted benzenoid
- 1-hydroxy-2-unsubstituted benzenoid
- Benzenoid
- Pyran
- Monocyclic benzene moiety
- Heteroaromatic compound
- Vinylogous acid
- Organoheterocyclic compound
- Polyol
- Oxacycle
- Ether
- Organic oxide
- Hydrocarbon derivative
- Organooxygen compound
- Organic oxygen compound
- Aromatic heteropolycyclic compound
|
|---|
| Molecular Framework | Aromatic heteropolycyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Physiological effect | Not Available |
|---|
| Disposition | |
|---|
| Process | Not Available |
|---|
| Role | Not Available |
|---|
| Physical Properties |
|---|
| State | Not Available |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 6.09 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 11.9543 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 2.74 minutes | 32390414 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 2043.3 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 239.2 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 108.3 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 149.6 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 265.3 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 612.2 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 489.5 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 218.8 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 803.4 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 382.9 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1489.1 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 293.7 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 412.9 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 532.7 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 253.6 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 251.7 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Laricitrin,1TMS,isomer #1 | COC1=CC(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O[Si](C)(C)C)=C1O | 3424.4 | Semi standard non polar | 33892256 | | Laricitrin,1TMS,isomer #2 | COC1=CC(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O)=C1O[Si](C)(C)C | 3384.7 | Semi standard non polar | 33892256 | | Laricitrin,1TMS,isomer #3 | COC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O)=C1O | 3370.9 | Semi standard non polar | 33892256 | | Laricitrin,1TMS,isomer #4 | COC1=CC(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(O)=C1O | 3388.2 | Semi standard non polar | 33892256 | | Laricitrin,1TMS,isomer #5 | COC1=CC(C2=C(O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC(O)=C1O | 3455.7 | Semi standard non polar | 33892256 | | Laricitrin,2TMS,isomer #1 | COC1=CC(C2=C(O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC(O[Si](C)(C)C)=C1O | 3352.9 | Semi standard non polar | 33892256 | | Laricitrin,2TMS,isomer #10 | COC1=CC(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3O2)=CC(O)=C1O | 3317.5 | Semi standard non polar | 33892256 | | Laricitrin,2TMS,isomer #2 | COC1=CC(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(O[Si](C)(C)C)=C1O | 3297.8 | Semi standard non polar | 33892256 | | Laricitrin,2TMS,isomer #3 | COC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O[Si](C)(C)C)=C1O | 3257.4 | Semi standard non polar | 33892256 | | Laricitrin,2TMS,isomer #4 | COC1=CC(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C | 3281.7 | Semi standard non polar | 33892256 | | Laricitrin,2TMS,isomer #5 | COC1=CC(C2=C(O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC(O)=C1O[Si](C)(C)C | 3321.7 | Semi standard non polar | 33892256 | | Laricitrin,2TMS,isomer #6 | COC1=CC(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(O)=C1O[Si](C)(C)C | 3271.6 | Semi standard non polar | 33892256 | | Laricitrin,2TMS,isomer #7 | COC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O)=C1O[Si](C)(C)C | 3232.5 | Semi standard non polar | 33892256 | | Laricitrin,2TMS,isomer #8 | COC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC(O)=C1O | 3284.0 | Semi standard non polar | 33892256 | | Laricitrin,2TMS,isomer #9 | COC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(O)=C1O | 3250.8 | Semi standard non polar | 33892256 | | Laricitrin,3TMS,isomer #1 | COC1=CC(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3O2)=CC(O[Si](C)(C)C)=C1O | 3276.3 | Semi standard non polar | 33892256 | | Laricitrin,3TMS,isomer #10 | COC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3O2)=CC(O)=C1O | 3202.3 | Semi standard non polar | 33892256 | | Laricitrin,3TMS,isomer #2 | COC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC(O[Si](C)(C)C)=C1O | 3176.6 | Semi standard non polar | 33892256 | | Laricitrin,3TMS,isomer #3 | COC1=CC(C2=C(O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C | 3220.3 | Semi standard non polar | 33892256 | | Laricitrin,3TMS,isomer #4 | COC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(O[Si](C)(C)C)=C1O | 3164.6 | Semi standard non polar | 33892256 | | Laricitrin,3TMS,isomer #5 | COC1=CC(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C | 3179.3 | Semi standard non polar | 33892256 | | Laricitrin,3TMS,isomer #6 | COC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C | 3172.1 | Semi standard non polar | 33892256 | | Laricitrin,3TMS,isomer #7 | COC1=CC(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3O2)=CC(O)=C1O[Si](C)(C)C | 3248.9 | Semi standard non polar | 33892256 | | Laricitrin,3TMS,isomer #8 | COC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC(O)=C1O[Si](C)(C)C | 3181.5 | Semi standard non polar | 33892256 | | Laricitrin,3TMS,isomer #9 | COC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(O)=C1O[Si](C)(C)C | 3158.1 | Semi standard non polar | 33892256 | | Laricitrin,4TMS,isomer #1 | COC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3O2)=CC(O[Si](C)(C)C)=C1O | 3256.5 | Semi standard non polar | 33892256 | | Laricitrin,4TMS,isomer #2 | COC1=CC(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3O2)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C | 3230.7 | Semi standard non polar | 33892256 | | Laricitrin,4TMS,isomer #3 | COC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C | 3162.2 | Semi standard non polar | 33892256 | | Laricitrin,4TMS,isomer #4 | COC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C | 3135.7 | Semi standard non polar | 33892256 | | Laricitrin,4TMS,isomer #5 | COC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3O2)=CC(O)=C1O[Si](C)(C)C | 3237.6 | Semi standard non polar | 33892256 | | Laricitrin,5TMS,isomer #1 | COC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3O2)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C | 3239.0 | Semi standard non polar | 33892256 | | Laricitrin,1TBDMS,isomer #1 | COC1=CC(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O[Si](C)(C)C(C)(C)C)=C1O | 3712.4 | Semi standard non polar | 33892256 | | Laricitrin,1TBDMS,isomer #2 | COC1=CC(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O)=C1O[Si](C)(C)C(C)(C)C | 3653.5 | Semi standard non polar | 33892256 | | Laricitrin,1TBDMS,isomer #3 | COC1=CC(C2=C(O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O)=C1O | 3673.8 | Semi standard non polar | 33892256 | | Laricitrin,1TBDMS,isomer #4 | COC1=CC(C2=C(O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O2)=CC(O)=C1O | 3682.6 | Semi standard non polar | 33892256 | | Laricitrin,1TBDMS,isomer #5 | COC1=CC(C2=C(O)C(=O)C3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C=C3O2)=CC(O)=C1O | 3731.9 | Semi standard non polar | 33892256 | | Laricitrin,2TBDMS,isomer #1 | COC1=CC(C2=C(O)C(=O)C3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C=C3O2)=CC(O[Si](C)(C)C(C)(C)C)=C1O | 3892.3 | Semi standard non polar | 33892256 | | Laricitrin,2TBDMS,isomer #10 | COC1=CC(C2=C(O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O[Si](C)(C)C(C)(C)C)C=C3O2)=CC(O)=C1O | 3866.2 | Semi standard non polar | 33892256 | | Laricitrin,2TBDMS,isomer #2 | COC1=CC(C2=C(O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O2)=CC(O[Si](C)(C)C(C)(C)C)=C1O | 3835.9 | Semi standard non polar | 33892256 | | Laricitrin,2TBDMS,isomer #3 | COC1=CC(C2=C(O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O[Si](C)(C)C(C)(C)C)=C1O | 3818.5 | Semi standard non polar | 33892256 | | Laricitrin,2TBDMS,isomer #4 | COC1=CC(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O[Si](C)(C)C(C)(C)C)=C1O[Si](C)(C)C(C)(C)C | 3819.8 | Semi standard non polar | 33892256 | | Laricitrin,2TBDMS,isomer #5 | COC1=CC(C2=C(O)C(=O)C3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C=C3O2)=CC(O)=C1O[Si](C)(C)C(C)(C)C | 3866.2 | Semi standard non polar | 33892256 | | Laricitrin,2TBDMS,isomer #6 | COC1=CC(C2=C(O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O2)=CC(O)=C1O[Si](C)(C)C(C)(C)C | 3811.2 | Semi standard non polar | 33892256 | | Laricitrin,2TBDMS,isomer #7 | COC1=CC(C2=C(O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O)=C1O[Si](C)(C)C(C)(C)C | 3785.9 | Semi standard non polar | 33892256 | | Laricitrin,2TBDMS,isomer #8 | COC1=CC(C2=C(O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C=C3O2)=CC(O)=C1O | 3822.6 | Semi standard non polar | 33892256 | | Laricitrin,2TBDMS,isomer #9 | COC1=CC(C2=C(O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O2)=CC(O)=C1O | 3798.1 | Semi standard non polar | 33892256 | | Laricitrin,3TBDMS,isomer #1 | COC1=CC(C2=C(O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O[Si](C)(C)C(C)(C)C)C=C3O2)=CC(O[Si](C)(C)C(C)(C)C)=C1O | 4063.3 | Semi standard non polar | 33892256 | | Laricitrin,3TBDMS,isomer #10 | COC1=CC(C2=C(O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O[Si](C)(C)C(C)(C)C)C=C3O2)=CC(O)=C1O | 3969.4 | Semi standard non polar | 33892256 | | Laricitrin,3TBDMS,isomer #2 | COC1=CC(C2=C(O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C=C3O2)=CC(O[Si](C)(C)C(C)(C)C)=C1O | 3957.4 | Semi standard non polar | 33892256 | | Laricitrin,3TBDMS,isomer #3 | COC1=CC(C2=C(O)C(=O)C3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C=C3O2)=CC(O[Si](C)(C)C(C)(C)C)=C1O[Si](C)(C)C(C)(C)C | 4021.2 | Semi standard non polar | 33892256 | | Laricitrin,3TBDMS,isomer #4 | COC1=CC(C2=C(O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O2)=CC(O[Si](C)(C)C(C)(C)C)=C1O | 3930.3 | Semi standard non polar | 33892256 | | Laricitrin,3TBDMS,isomer #5 | COC1=CC(C2=C(O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O2)=CC(O[Si](C)(C)C(C)(C)C)=C1O[Si](C)(C)C(C)(C)C | 3967.9 | Semi standard non polar | 33892256 | | Laricitrin,3TBDMS,isomer #6 | COC1=CC(C2=C(O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(O[Si](C)(C)C(C)(C)C)=C1O[Si](C)(C)C(C)(C)C | 3935.0 | Semi standard non polar | 33892256 | | Laricitrin,3TBDMS,isomer #7 | COC1=CC(C2=C(O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O[Si](C)(C)C(C)(C)C)C=C3O2)=CC(O)=C1O[Si](C)(C)C(C)(C)C | 4046.9 | Semi standard non polar | 33892256 | | Laricitrin,3TBDMS,isomer #8 | COC1=CC(C2=C(O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C=C3O2)=CC(O)=C1O[Si](C)(C)C(C)(C)C | 3955.9 | Semi standard non polar | 33892256 | | Laricitrin,3TBDMS,isomer #9 | COC1=CC(C2=C(O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O2)=CC(O)=C1O[Si](C)(C)C(C)(C)C | 3926.5 | Semi standard non polar | 33892256 | | Laricitrin,4TBDMS,isomer #1 | COC1=CC(C2=C(O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O[Si](C)(C)C(C)(C)C)C=C3O2)=CC(O[Si](C)(C)C(C)(C)C)=C1O | 4158.4 | Semi standard non polar | 33892256 | | Laricitrin,4TBDMS,isomer #2 | COC1=CC(C2=C(O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O[Si](C)(C)C(C)(C)C)C=C3O2)=CC(O[Si](C)(C)C(C)(C)C)=C1O[Si](C)(C)C(C)(C)C | 4188.5 | Semi standard non polar | 33892256 | | Laricitrin,4TBDMS,isomer #3 | COC1=CC(C2=C(O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C=C3O2)=CC(O[Si](C)(C)C(C)(C)C)=C1O[Si](C)(C)C(C)(C)C | 4059.6 | Semi standard non polar | 33892256 | | Laricitrin,4TBDMS,isomer #4 | COC1=CC(C2=C(O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O2)=CC(O[Si](C)(C)C(C)(C)C)=C1O[Si](C)(C)C(C)(C)C | 4031.2 | Semi standard non polar | 33892256 | | Laricitrin,4TBDMS,isomer #5 | COC1=CC(C2=C(O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O[Si](C)(C)C(C)(C)C)C=C3O2)=CC(O)=C1O[Si](C)(C)C(C)(C)C | 4143.9 | Semi standard non polar | 33892256 |
|
|---|
| GC-MS Spectra| Spectrum Type | Description | Splash Key | Deposition Date | Source | View |
|---|
| Predicted GC-MS | Predicted GC-MS Spectrum - Laricitrin GC-MS (5 TMS) - 70eV, Positive | splash10-0059-0033009000-057abb5132228c1326f1 | 2017-10-06 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Laricitrin GC-MS (Non-derivatized) - 70eV, Positive | splash10-0udr-0719000000-88f22f0e476bc7e374d5 | 2017-11-06 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Laricitrin GC-MS (Non-derivatized) - 70eV, Positive | Not Available | 2021-10-12 | Wishart Lab | View Spectrum |
MS/MS Spectra| Spectrum Type | Description | Splash Key | Deposition Date | Source | View |
|---|
| Experimental LC-MS/MS | LC-MS/MS Spectrum - Laricitrin LC-ESI-QTOF 6V, positive-QTOF | splash10-001i-0129000000-c7437a58de4eba08f9ca | 2020-07-21 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - Laricitrin LC-ESI-QFT , negative-QTOF | splash10-0ufr-0594000000-2f46849ff93230a66240 | 2020-07-21 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - Laricitrin LC-ESI-QTOF 35V, negative-QTOF | splash10-0ufr-0295000000-6220e7e45b57ebd4ec01 | 2020-07-21 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - Laricitrin LC-ESI-QTOF 6V, negative-QTOF | splash10-001i-0429000000-58b7179fe988343aaed2 | 2020-07-21 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - Laricitrin 6V, Positive-QTOF | splash10-001i-0429000000-a70c69053a9b8e1eadab | 2021-09-20 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - Laricitrin 6V, Positive-QTOF | splash10-001i-0129000000-53889ccd91d5af27171d | 2021-09-20 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - Laricitrin 6V, Negative-QTOF | splash10-001i-0429000000-5f0090acb6fba682afbb | 2021-09-20 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - Laricitrin 6V, Positive-QTOF | splash10-001i-0129000000-07b48d605c39b6754ccc | 2021-09-20 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - Laricitrin 35V, Negative-QTOF | splash10-0ufr-0295000000-1573f6fa500a0a058cfd | 2021-09-20 | HMDB team, MONA | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Laricitrin 10V, Positive-QTOF | splash10-001i-0009000000-4d7be96b6b48379501b4 | 2019-02-22 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Laricitrin 20V, Positive-QTOF | splash10-001i-0219000000-ebd92d1f3330250cdecb | 2019-02-22 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Laricitrin 40V, Positive-QTOF | splash10-0fe0-2921000000-5948d0474dc3c9b2b6d2 | 2019-02-22 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Laricitrin 10V, Negative-QTOF | splash10-001i-0009000000-4f93c0f9aa17df767c01 | 2019-02-23 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Laricitrin 20V, Negative-QTOF | splash10-001i-0129000000-7182a57be034615dffb7 | 2019-02-23 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Laricitrin 40V, Negative-QTOF | splash10-004i-2931000000-0907bea30a7bd218cd24 | 2019-02-23 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Laricitrin 10V, Negative-QTOF | splash10-001i-0009000000-31d7a3d9e9a14bce0c3e | 2021-09-23 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Laricitrin 20V, Negative-QTOF | splash10-001i-0619000000-40ed5ffa456c5397bb5e | 2021-09-23 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Laricitrin 40V, Negative-QTOF | splash10-0fz0-1930000000-8066e496543ff38984bc | 2021-09-23 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Laricitrin 10V, Positive-QTOF | splash10-001i-0009000000-9a57877c53466fab202c | 2021-09-24 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Laricitrin 20V, Positive-QTOF | splash10-001i-0009000000-5a5b84c2463dda4845e3 | 2021-09-24 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Laricitrin 40V, Positive-QTOF | splash10-0uyi-1912000000-9c4df784f8a752d3d1a7 | 2021-09-24 | Wishart Lab | View Spectrum |
|
|---|