Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2012-09-11 21:34:38 UTC

Update Date

2022-03-07 02:54:55 UTC

HMDB ID

HMDB0036438

Secondary Accession Numbers

HMDB36438

Metabolite Identification

Common Name

Fasciculic acid B

Description

Fasciculic acid B, also known as fasciculate b, belongs to the class of organic compounds known as triterpenoids. These are terpene molecules containing six isoprene units. Based on a literature review a small amount of articles have been published on Fasciculic acid B.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI


  Mrv0541 05061309082D          

 45 48  0  0  0  0            999 V2000
   -2.6962    0.7909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5685    4.3109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5660    3.9506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1607   -0.1732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0030   -0.0283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6467    1.9709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4798    1.8393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1983    3.7565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0361    1.4372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8244    1.6679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3035    3.8766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5086    4.0219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3307    1.0166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7301    2.9989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0473    3.4619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3323    1.6941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2920    1.9845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6041    1.3040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9798    1.0135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0071    1.5551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5008    2.2064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5838    3.1007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0520    2.4700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1041    2.1297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0404    3.3912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1480    1.1294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1444    1.5489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1359    0.6733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4480    1.6442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3844    2.9057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8526    3.5364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6543    0.4781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7920    1.1587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7601    2.6152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3959    2.9555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6762    2.1796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4589    1.8936    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4247    0.7729    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9480    0.8185    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8556   -0.1027    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7283    2.4202    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1965    3.0509    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3057    0.9845    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9372    0.3466    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6359    1.4990    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 12 11  1  0  0  0  0
 13 10  1  0  0  0  0
 15 14  1  0  0  0  0
 20  1  1  0  0  0  0
 20 10  1  0  0  0  0
 21 14  1  0  0  0  0
 21 20  1  0  0  0  0
 22 11  1  0  0  0  0
 23 16  1  0  0  0  0
 23 22  2  0  0  0  0
 24 17  1  0  0  0  0
 25 12  1  0  0  0  0
 26 13  1  0  0  0  0
 27 16  1  0  0  0  0
 28 18  1  0  0  0  0
 29 19  1  0  0  0  0
 30 24  1  0  0  0  0
 31  2  1  0  0  0  0
 31  3  1  0  0  0  0
 31 25  1  0  0  0  0
 31 30  1  0  0  0  0
 32  4  1  0  0  0  0
 32  5  1  0  0  0  0
 32 26  1  0  0  0  0
 33  6  1  0  0  0  0
 33 18  1  0  0  0  0
 33 19  1  0  0  0  0
 34  7  1  0  0  0  0
 34 17  1  0  0  0  0
 34 23  1  0  0  0  0
 34 25  1  0  0  0  0
 35  8  1  0  0  0  0
 35 15  1  0  0  0  0
 35 22  1  0  0  0  0
 36  9  1  0  0  0  0
 36 21  1  0  0  0  0
 36 27  1  0  0  0  0
 36 35  1  0  0  0  0
 37 26  1  0  0  0  0
 38 27  1  0  0  0  0
 39 28  2  0  0  0  0
 40 28  1  0  0  0  0
 41 29  2  0  0  0  0
 42 30  1  0  0  0  0
 43 32  1  0  0  0  0
 44 33  1  0  0  0  0
 45 24  1  0  0  0  0
 45 29  1  0  0  0  0
M  END

HMDB0036438
     RDKit          3D
Fasciculic acid B
105108  0  0  0  0  0  0  0  0999 V2000
    5.0037   -0.2314    2.4087 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7529   -0.4169    0.9511 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7871   -1.9055    0.5659 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1104   -2.4818    0.8742 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3037   -1.9522    0.1772 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4036   -2.6971    0.7523 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4008   -2.3244   -1.2932 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4755   -1.5921   -2.2030 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8275   -2.0241   -1.7974 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2344   -3.7121   -1.4608 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6995    0.3664    0.3025 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0267    1.8461    0.4465 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6920    2.5285    0.2234 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7731    1.5643    0.9692 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8884    1.8946    2.4358 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3923    1.8415    0.5513 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4708    0.8991    0.1936 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0254   -0.3730   -0.3395 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4949   -0.2142   -0.6488 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9960   -1.3286   -1.2677 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2815    0.1845    0.6126 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8923   -0.7567    1.6807 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9198    1.2544    0.3737 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1865    1.4034    1.8057 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8283    0.1375   -0.1677 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2325    0.6210    0.1308 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2154   -0.3523   -0.0363 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0330   -0.8457    0.9382 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9096   -0.3990    2.1045 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0346   -1.8893    0.5822 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9843   -2.2195   -0.8709 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2829   -0.9578   -1.6887 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6520   -2.5784   -1.1663 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9320   -3.2817   -1.3192 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7568   -4.5931   -0.6887 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8491   -4.7979    0.1458 O   0  0  0  0  0  0  0  0  0  0  0  0
   -8.6090   -5.6327   -1.0172 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5277    1.8250   -0.6905 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8419    2.2333   -0.4269 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5634    2.9571   -0.5422 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8890    3.9196    0.5481 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6626    3.7570   -1.8590 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1511    2.4318   -0.5214 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1044    3.4875   -0.4611 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0230    3.2972    0.5494 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0801   -0.0328    2.6256 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.4601    0.6299    2.7834 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.8074   -1.1651    3.0031 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.7134   -0.0356    0.4690 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.5187   -2.0153   -0.4864 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0324   -2.4728    1.1504 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.2560   -2.4638    1.9883 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622   -3.5864    0.6374 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.5646   -0.9174    0.2926 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.2121   -2.2357    0.4182 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.6305   -2.2361   -2.5547 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.0760   -0.6877   -1.7161 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.0037   -1.1992   -3.1183 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.4744   -2.9194   -1.6649 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.7848   -1.8202   -2.8865 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.2273   -1.1196   -1.3054 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.6321   -3.9616   -2.3445 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8456    0.1819   -0.8106 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7378    2.1909   -0.3539 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.4166    2.1168    1.4241 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7701    3.5022    0.7542 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4471    2.6165   -0.8451 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.6328    1.0513    3.1032 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.1178    2.6746    2.6535 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.8505    2.3882    2.6953 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1940   -1.2536    0.2907 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4797   -0.5521   -1.3124 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.5916    0.6476   -1.3408 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.2375   -1.1716   -2.2355 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.7429   -1.8090    1.3282 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8499   -0.4667    2.0177 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4876   -0.7206    2.6140 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5476    0.4115    2.2174 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2495    1.5936    2.4115 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9058    2.1393    2.1361 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5860   -0.7658    0.4161 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6125    0.0617   -1.2371 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2469    0.9179    1.2100 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.0410   -1.4338    0.7794 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9418   -2.7637    1.2211 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3467   -0.4960   -2.0735 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8610   -1.2439   -2.5900 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9025   -0.2579   -1.1026 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6919   -3.2913   -1.8675 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.9986   -2.9203   -1.2289 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7954   -3.3594   -2.4398 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.3626   -6.2838   -1.7341 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5376    1.5034   -1.7705 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0242    1.9846    0.5158 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6827    3.4351    1.1920 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0420    4.3004    1.1172 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4222    4.8406    0.1588 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7503    4.3987   -1.8876 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6733    3.0944   -2.7297 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5479    4.4054   -1.7599 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0490    1.9667   -1.5587 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5866    3.6604   -1.4548 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5419    4.5119   -0.2495 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3009    3.6407    1.5646 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8569    3.8996    0.2476 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  5  7  1  0
  7  8  1  0
  7  9  1  0
  7 10  1  0
  2 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 19 21  1  0
 21 22  1  0
 17 23  1  0
 23 24  1  0
 23 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  2  0
 28 30  1  0
 30 31  1  0
 31 32  1  0
 31 33  1  0
 31 34  1  0
 34 35  1  0
 35 36  2  0
 35 37  1  0
 26 38  1  0
 38 39  1  0
 38 40  1  0
 40 41  1  0
 40 42  1  0
 40 43  1  0
 43 44  1  0
 44 45  1  0
 21 11  1  0
 43 23  1  0
 21 14  1  0
 45 16  1  0
  1 46  1  0
  1 47  1  0
  1 48  1  0
  2 49  1  0
  3 50  1  0
  3 51  1  0
  4 52  1  0
  4 53  1  0
  5 54  1  0
  6 55  1  0
  8 56  1  0
  8 57  1  0
  8 58  1  0
  9 59  1  0
  9 60  1  0
  9 61  1  0
 10 62  1  0
 11 63  1  0
 12 64  1  0
 12 65  1  0
 13 66  1  0
 13 67  1  0
 15 68  1  0
 15 69  1  0
 15 70  1  0
 18 71  1  0
 18 72  1  0
 19 73  1  0
 20 74  1  0
 22 75  1  0
 22 76  1  0
 22 77  1  0
 24 78  1  0
 24 79  1  0
 24 80  1  0
 25 81  1  0
 25 82  1  0
 26 83  1  0
 30 84  1  0
 30 85  1  0
 32 86  1  0
 32 87  1  0
 32 88  1  0
 33 89  1  0
 34 90  1  0
 34 91  1  0
 37 92  1  0
 38 93  1  0
 39 94  1  0
 41 95  1  0
 41 96  1  0
 41 97  1  0
 42 98  1  0
 42 99  1  0
 42100  1  0
 43101  1  0
 44102  1  0
 44103  1  0
 45104  1  0
 45105  1  0
M  END


  Mrv0541 05061309082D          

 45 48  0  0  0  0            999 V2000
   -2.6962    0.7909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5685    4.3109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5660    3.9506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1607   -0.1732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0030   -0.0283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6467    1.9709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4798    1.8393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1983    3.7565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0361    1.4372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8244    1.6679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3035    3.8766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5086    4.0219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3307    1.0166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7301    2.9989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0473    3.4619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3323    1.6941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2920    1.9845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6041    1.3040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9798    1.0135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0071    1.5551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5008    2.2064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5838    3.1007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0520    2.4700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1041    2.1297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0404    3.3912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1480    1.1294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1444    1.5489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1359    0.6733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4480    1.6442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3844    2.9057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8526    3.5364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6543    0.4781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7920    1.1587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7601    2.6152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3959    2.9555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6762    2.1796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4589    1.8936    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4247    0.7729    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9480    0.8185    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8556   -0.1027    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7283    2.4202    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1965    3.0509    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3057    0.9845    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9372    0.3466    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6359    1.4990    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 12 11  1  0  0  0  0
 13 10  1  0  0  0  0
 15 14  1  0  0  0  0
 20  1  1  0  0  0  0
 20 10  1  0  0  0  0
 21 14  1  0  0  0  0
 21 20  1  0  0  0  0
 22 11  1  0  0  0  0
 23 16  1  0  0  0  0
 23 22  2  0  0  0  0
 24 17  1  0  0  0  0
 25 12  1  0  0  0  0
 26 13  1  0  0  0  0
 27 16  1  0  0  0  0
 28 18  1  0  0  0  0
 29 19  1  0  0  0  0
 30 24  1  0  0  0  0
 31  2  1  0  0  0  0
 31  3  1  0  0  0  0
 31 25  1  0  0  0  0
 31 30  1  0  0  0  0
 32  4  1  0  0  0  0
 32  5  1  0  0  0  0
 32 26  1  0  0  0  0
 33  6  1  0  0  0  0
 33 18  1  0  0  0  0
 33 19  1  0  0  0  0
 34  7  1  0  0  0  0
 34 17  1  0  0  0  0
 34 23  1  0  0  0  0
 34 25  1  0  0  0  0
 35  8  1  0  0  0  0
 35 15  1  0  0  0  0
 35 22  1  0  0  0  0
 36  9  1  0  0  0  0
 36 21  1  0  0  0  0
 36 27  1  0  0  0  0
 36 35  1  0  0  0  0
 37 26  1  0  0  0  0
 38 27  1  0  0  0  0
 39 28  2  0  0  0  0
 40 28  1  0  0  0  0
 41 29  2  0  0  0  0
 42 30  1  0  0  0  0
 43 32  1  0  0  0  0
 44 33  1  0  0  0  0
 45 24  1  0  0  0  0
 45 29  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0036438

> <DATABASE_NAME>
hmdb

> <SMILES>
CC(CCC(O)C(C)(C)O)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(OC(=O)CC(C)(O)CC(O)=O)C(O)C(C)(C)C1CC3

> <INCHI_IDENTIFIER>
InChI=1S/C36H60O9/c1-20(10-13-26(37)32(4,5)43)21-14-15-35(8)22-11-12-25-31(2,3)30(42)24(45-29(41)19-33(6,44)18-28(39)40)17-34(25,7)23(22)16-27(38)36(21,35)9/h20-21,24-27,30,37-38,42-44H,10-19H2,1-9H3,(H,39,40)

> <INCHI_KEY>
SWRXIGFQDQTNKP-UHFFFAOYSA-N

> <FORMULA>
C36H60O9

> <MOLECULAR_WEIGHT>
636.8562

> <EXACT_MASS>
636.423733518

> <JCHEM_ACCEPTOR_COUNT>
8

> <JCHEM_AVERAGE_POLARIZABILITY>
72.9488486873696

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
6

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
5-{[14-(5,6-dihydroxy-6-methylheptan-2-yl)-5,16-dihydroxy-2,6,6,11,15-pentamethyltetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadec-1(10)-en-4-yl]oxy}-3-hydroxy-3-methyl-5-oxopentanoic acid

> <ALOGPS_LOGP>
3.78

> <JCHEM_LOGP>
3.1767489199999965

> <ALOGPS_LOGS>
-5.36

> <JCHEM_MDDR_LIKE_RULE>
1

> <JCHEM_NUMBER_OF_RINGS>
4

> <JCHEM_PHYSIOLOGICAL_CHARGE>
-1

> <JCHEM_PKA>
13.46851841454431

> <JCHEM_PKA_STRONGEST_ACIDIC>
3.7990745165389077

> <JCHEM_PKA_STRONGEST_BASIC>
-0.29498582711192156

> <JCHEM_POLAR_SURFACE_AREA>
164.75

> <JCHEM_REFRACTIVITY>
170.41480000000004

> <JCHEM_ROTATABLE_BOND_COUNT>
11

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
2.80e-03 g/l

> <JCHEM_TRADITIONAL_IUPAC>
5-{[14-(5,6-dihydroxy-6-methylheptan-2-yl)-5,16-dihydroxy-2,6,6,11,15-pentamethyltetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadec-1(10)-en-4-yl]oxy}-3-hydroxy-3-methyl-5-oxopentanoic acid

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0036438
     RDKit          3D
Fasciculic acid B
105108  0  0  0  0  0  0  0  0999 V2000
    5.0037   -0.2314    2.4087 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7529   -0.4169    0.9511 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7871   -1.9055    0.5659 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1104   -2.4818    0.8742 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3037   -1.9522    0.1772 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4036   -2.6971    0.7523 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4008   -2.3244   -1.2932 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4755   -1.5921   -2.2030 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8275   -2.0241   -1.7974 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2344   -3.7121   -1.4608 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6995    0.3664    0.3025 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0267    1.8461    0.4465 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6920    2.5285    0.2234 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7731    1.5643    0.9692 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8884    1.8946    2.4358 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3923    1.8415    0.5513 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4708    0.8991    0.1936 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0254   -0.3730   -0.3395 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4949   -0.2142   -0.6488 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9960   -1.3286   -1.2677 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2815    0.1845    0.6126 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8923   -0.7567    1.6807 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9198    1.2544    0.3737 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1865    1.4034    1.8057 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8283    0.1375   -0.1677 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2325    0.6210    0.1308 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2154   -0.3523   -0.0363 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0330   -0.8457    0.9382 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9096   -0.3990    2.1045 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0346   -1.8893    0.5822 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9843   -2.2195   -0.8709 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2829   -0.9578   -1.6887 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6520   -2.5784   -1.1663 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9320   -3.2817   -1.3192 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7568   -4.5931   -0.6887 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8491   -4.7979    0.1458 O   0  0  0  0  0  0  0  0  0  0  0  0
   -8.6090   -5.6327   -1.0172 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5277    1.8250   -0.6905 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8419    2.2333   -0.4269 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5634    2.9571   -0.5422 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8890    3.9196    0.5481 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6626    3.7570   -1.8590 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1511    2.4318   -0.5214 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1044    3.4875   -0.4611 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0230    3.2972    0.5494 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0801   -0.0328    2.6256 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.4601    0.6299    2.7834 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.8074   -1.1651    3.0031 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.7134   -0.0356    0.4690 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.5187   -2.0153   -0.4864 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0324   -2.4728    1.1504 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.2560   -2.4638    1.9883 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622   -3.5864    0.6374 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.5646   -0.9174    0.2926 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.2121   -2.2357    0.4182 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.6305   -2.2361   -2.5547 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.0760   -0.6877   -1.7161 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.0037   -1.1992   -3.1183 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.4744   -2.9194   -1.6649 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.7848   -1.8202   -2.8865 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.2273   -1.1196   -1.3054 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.6321   -3.9616   -2.3445 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8456    0.1819   -0.8106 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7378    2.1909   -0.3539 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.4166    2.1168    1.4241 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7701    3.5022    0.7542 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4471    2.6165   -0.8451 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.6328    1.0513    3.1032 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.1178    2.6746    2.6535 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.8505    2.3882    2.6953 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1940   -1.2536    0.2907 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4797   -0.5521   -1.3124 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.5916    0.6476   -1.3408 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.2375   -1.1716   -2.2355 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.7429   -1.8090    1.3282 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8499   -0.4667    2.0177 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4876   -0.7206    2.6140 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5476    0.4115    2.2174 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2495    1.5936    2.4115 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9058    2.1393    2.1361 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5860   -0.7658    0.4161 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6125    0.0617   -1.2371 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2469    0.9179    1.2100 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.0410   -1.4338    0.7794 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9418   -2.7637    1.2211 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3467   -0.4960   -2.0735 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8610   -1.2439   -2.5900 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9025   -0.2579   -1.1026 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6919   -3.2913   -1.8675 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.9986   -2.9203   -1.2289 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7954   -3.3594   -2.4398 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.3626   -6.2838   -1.7341 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5376    1.5034   -1.7705 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0242    1.9846    0.5158 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6827    3.4351    1.1920 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0420    4.3004    1.1172 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4222    4.8406    0.1588 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7503    4.3987   -1.8876 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6733    3.0944   -2.7297 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5479    4.4054   -1.7599 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0490    1.9667   -1.5587 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5866    3.6604   -1.4548 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5419    4.5119   -0.2495 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3009    3.6407    1.5646 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8569    3.8996    0.2476 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  5  7  1  0
  7  8  1  0
  7  9  1  0
  7 10  1  0
  2 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 19 21  1  0
 21 22  1  0
 17 23  1  0
 23 24  1  0
 23 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  2  0
 28 30  1  0
 30 31  1  0
 31 32  1  0
 31 33  1  0
 31 34  1  0
 34 35  1  0
 35 36  2  0
 35 37  1  0
 26 38  1  0
 38 39  1  0
 38 40  1  0
 40 41  1  0
 40 42  1  0
 40 43  1  0
 43 44  1  0
 44 45  1  0
 21 11  1  0
 43 23  1  0
 21 14  1  0
 45 16  1  0
  1 46  1  0
  1 47  1  0
  1 48  1  0
  2 49  1  0
  3 50  1  0
  3 51  1  0
  4 52  1  0
  4 53  1  0
  5 54  1  0
  6 55  1  0
  8 56  1  0
  8 57  1  0
  8 58  1  0
  9 59  1  0
  9 60  1  0
  9 61  1  0
 10 62  1  0
 11 63  1  0
 12 64  1  0
 12 65  1  0
 13 66  1  0
 13 67  1  0
 15 68  1  0
 15 69  1  0
 15 70  1  0
 18 71  1  0
 18 72  1  0
 19 73  1  0
 20 74  1  0
 22 75  1  0
 22 76  1  0
 22 77  1  0
 24 78  1  0
 24 79  1  0
 24 80  1  0
 25 81  1  0
 25 82  1  0
 26 83  1  0
 30 84  1  0
 30 85  1  0
 32 86  1  0
 32 87  1  0
 32 88  1  0
 33 89  1  0
 34 90  1  0
 34 91  1  0
 37 92  1  0
 38 93  1  0
 39 94  1  0
 41 95  1  0
 41 96  1  0
 41 97  1  0
 42 98  1  0
 42 99  1  0
 42100  1  0
 43101  1  0
 44102  1  0
 44103  1  0
 45104  1  0
 45105  1  0
M  END

HEADER    PROTEIN                                 06-MAY-13   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   06-MAY-13         0                                  
HETATM    1  C   UNK     0      -5.033   1.476   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0       2.928   8.047   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0       4.790   7.374   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0     -11.500  -0.323   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0      -9.339  -0.053   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0       8.674   3.679   0.000  0.00  0.00           C+0
HETATM    7  C   UNK     0       0.896   3.433   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0      -2.237   7.012   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0      -3.801   2.683   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0      -7.139   3.113   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0      -0.567   7.236   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0       0.949   7.508   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0      -8.084   1.898   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0      -5.096   5.598   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0      -3.822   6.462   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0      -0.620   3.162   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0       2.412   3.704   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0      10.461   2.434   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0       7.429   1.892   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0      -5.613   2.903   0.000  0.00  0.00           C+0
HETATM   21  C   UNK     0      -4.668   4.119   0.000  0.00  0.00           C+0
HETATM   22  C   UNK     0      -1.090   5.788   0.000  0.00  0.00           C+0
HETATM   23  C   UNK     0      -0.097   4.611   0.000  0.00  0.00           C+0
HETATM   24  C   UNK     0       3.928   3.975   0.000  0.00  0.00           C+0
HETATM   25  C   UNK     0       1.942   6.330   0.000  0.00  0.00           C+0
HETATM   26  C   UNK     0      -9.610   2.108   0.000  0.00  0.00           C+0
HETATM   27  C   UNK     0      -2.136   2.891   0.000  0.00  0.00           C+0
HETATM   28  C   UNK     0      11.454   1.257   0.000  0.00  0.00           C+0
HETATM   29  C   UNK     0       6.436   3.069   0.000  0.00  0.00           C+0
HETATM   30  C   UNK     0       4.451   5.424   0.000  0.00  0.00           C+0
HETATM   31  C   UNK     0       3.458   6.601   0.000  0.00  0.00           C+0
HETATM   32  C   UNK     0     -10.555   0.892   0.000  0.00  0.00           C+0
HETATM   33  C   UNK     0       8.945   2.163   0.000  0.00  0.00           C+0
HETATM   34  C   UNK     0       1.419   4.882   0.000  0.00  0.00           C+0
HETATM   35  C   UNK     0      -2.606   5.517   0.000  0.00  0.00           C+0
HETATM   36  C   UNK     0      -3.129   4.069   0.000  0.00  0.00           C+0
HETATM   37  O   UNK     0     -10.190   3.535   0.000  0.00  0.00           O+0
HETATM   38  O   UNK     0      -2.659   1.443   0.000  0.00  0.00           O+0
HETATM   39  O   UNK     0      12.970   1.528   0.000  0.00  0.00           O+0
HETATM   40  O   UNK     0      10.930  -0.192   0.000  0.00  0.00           O+0
HETATM   41  O   UNK     0       6.959   4.518   0.000  0.00  0.00           O+0
HETATM   42  O   UNK     0       5.967   5.695   0.000  0.00  0.00           O+0
HETATM   43  O   UNK     0     -11.771   1.838   0.000  0.00  0.00           O+0
HETATM   44  O   UNK     0       9.216   0.647   0.000  0.00  0.00           O+0
HETATM   45  O   UNK     0       4.920   2.798   0.000  0.00  0.00           O+0
CONECT    1   20                                                            
CONECT    2   31                                                            
CONECT    3   31                                                            
CONECT    4   32                                                            
CONECT    5   32                                                            
CONECT    6   33                                                            
CONECT    7   34                                                            
CONECT    8   35                                                            
CONECT    9   36                                                            
CONECT   10   13   20                                                       
CONECT   11   12   22                                                       
CONECT   12   11   25                                                       
CONECT   13   10   26                                                       
CONECT   14   15   21                                                       
CONECT   15   14   35                                                       
CONECT   16   23   27                                                       
CONECT   17   24   34                                                       
CONECT   18   28   33                                                       
CONECT   19   29   33                                                       
CONECT   20    1   10   21                                                  
CONECT   21   14   20   36                                                  
CONECT   22   11   23   35                                                  
CONECT   23   16   22   34                                                  
CONECT   24   17   30   45                                                  
CONECT   25   12   31   34                                                  
CONECT   26   13   32   37                                                  
CONECT   27   16   36   38                                                  
CONECT   28   18   39   40                                                  
CONECT   29   19   41   45                                                  
CONECT   30   24   31   42                                                  
CONECT   31    2    3   25   30                                             
CONECT   32    4    5   26   43                                             
CONECT   33    6   18   19   44                                             
CONECT   34    7   17   23   25                                             
CONECT   35    8   15   22   36                                             
CONECT   36    9   21   27   35                                             
CONECT   37   26                                                            
CONECT   38   27                                                            
CONECT   39   28                                                            
CONECT   40   28                                                            
CONECT   41   29                                                            
CONECT   42   30                                                            
CONECT   43   32                                                            
CONECT   44   33                                                            
CONECT   45   24   29                                                       
MASTER        0    0    0    0    0    0    0    0   45    0   96    0
END

COMPND    HMDB0036438
HETATM    1  C1  UNL     1       5.004  -0.231   2.409  1.00  0.00           C  
HETATM    2  C2  UNL     1       4.753  -0.417   0.951  1.00  0.00           C  
HETATM    3  C3  UNL     1       4.787  -1.905   0.566  1.00  0.00           C  
HETATM    4  C4  UNL     1       6.110  -2.482   0.874  1.00  0.00           C  
HETATM    5  C5  UNL     1       7.304  -1.952   0.177  1.00  0.00           C  
HETATM    6  O1  UNL     1       8.404  -2.697   0.752  1.00  0.00           O  
HETATM    7  C6  UNL     1       7.401  -2.324  -1.293  1.00  0.00           C  
HETATM    8  C7  UNL     1       6.475  -1.592  -2.203  1.00  0.00           C  
HETATM    9  C8  UNL     1       8.827  -2.024  -1.797  1.00  0.00           C  
HETATM   10  O2  UNL     1       7.234  -3.712  -1.461  1.00  0.00           O  
HETATM   11  C9  UNL     1       3.699   0.366   0.302  1.00  0.00           C  
HETATM   12  C10 UNL     1       4.027   1.846   0.446  1.00  0.00           C  
HETATM   13  C11 UNL     1       2.692   2.529   0.223  1.00  0.00           C  
HETATM   14  C12 UNL     1       1.773   1.564   0.969  1.00  0.00           C  
HETATM   15  C13 UNL     1       1.888   1.895   2.436  1.00  0.00           C  
HETATM   16  C14 UNL     1       0.392   1.841   0.551  1.00  0.00           C  
HETATM   17  C15 UNL     1      -0.471   0.899   0.194  1.00  0.00           C  
HETATM   18  C16 UNL     1       0.025  -0.373  -0.339  1.00  0.00           C  
HETATM   19  C17 UNL     1       1.495  -0.214  -0.649  1.00  0.00           C  
HETATM   20  O3  UNL     1       1.996  -1.329  -1.268  1.00  0.00           O  
HETATM   21  C18 UNL     1       2.281   0.184   0.613  1.00  0.00           C  
HETATM   22  C19 UNL     1       1.892  -0.757   1.681  1.00  0.00           C  
HETATM   23  C20 UNL     1      -1.920   1.254   0.374  1.00  0.00           C  
HETATM   24  C21 UNL     1      -2.187   1.403   1.806  1.00  0.00           C  
HETATM   25  C22 UNL     1      -2.828   0.137  -0.168  1.00  0.00           C  
HETATM   26  C23 UNL     1      -4.233   0.621   0.131  1.00  0.00           C  
HETATM   27  O4  UNL     1      -5.215  -0.352  -0.036  1.00  0.00           O  
HETATM   28  C24 UNL     1      -6.033  -0.846   0.938  1.00  0.00           C  
HETATM   29  O5  UNL     1      -5.910  -0.399   2.104  1.00  0.00           O  
HETATM   30  C25 UNL     1      -7.035  -1.889   0.582  1.00  0.00           C  
HETATM   31  C26 UNL     1      -6.984  -2.220  -0.871  1.00  0.00           C  
HETATM   32  C27 UNL     1      -7.283  -0.958  -1.689  1.00  0.00           C  
HETATM   33  O6  UNL     1      -5.652  -2.578  -1.166  1.00  0.00           O  
HETATM   34  C28 UNL     1      -7.932  -3.282  -1.319  1.00  0.00           C  
HETATM   35  C29 UNL     1      -7.757  -4.593  -0.689  1.00  0.00           C  
HETATM   36  O7  UNL     1      -6.849  -4.798   0.146  1.00  0.00           O  
HETATM   37  O8  UNL     1      -8.609  -5.633  -1.017  1.00  0.00           O  
HETATM   38  C30 UNL     1      -4.528   1.825  -0.691  1.00  0.00           C  
HETATM   39  O9  UNL     1      -5.842   2.233  -0.427  1.00  0.00           O  
HETATM   40  C31 UNL     1      -3.563   2.957  -0.542  1.00  0.00           C  
HETATM   41  C32 UNL     1      -3.889   3.920   0.548  1.00  0.00           C  
HETATM   42  C33 UNL     1      -3.663   3.757  -1.859  1.00  0.00           C  
HETATM   43  C34 UNL     1      -2.151   2.432  -0.521  1.00  0.00           C  
HETATM   44  C35 UNL     1      -1.104   3.488  -0.461  1.00  0.00           C  
HETATM   45  C36 UNL     1      -0.023   3.297   0.549  1.00  0.00           C  
HETATM   46  H1  UNL     1       6.080  -0.033   2.626  1.00  0.00           H  
HETATM   47  H2  UNL     1       4.460   0.630   2.783  1.00  0.00           H  
HETATM   48  H3  UNL     1       4.807  -1.165   3.003  1.00  0.00           H  
HETATM   49  H4  UNL     1       5.713  -0.036   0.469  1.00  0.00           H  
HETATM   50  H5  UNL     1       4.519  -2.015  -0.486  1.00  0.00           H  
HETATM   51  H6  UNL     1       4.032  -2.473   1.150  1.00  0.00           H  
HETATM   52  H7  UNL     1       6.256  -2.464   1.988  1.00  0.00           H  
HETATM   53  H8  UNL     1       6.062  -3.586   0.637  1.00  0.00           H  
HETATM   54  H9  UNL     1       7.565  -0.917   0.293  1.00  0.00           H  
HETATM   55  H10 UNL     1       9.212  -2.236   0.418  1.00  0.00           H  
HETATM   56  H11 UNL     1       5.631  -2.236  -2.555  1.00  0.00           H  
HETATM   57  H12 UNL     1       6.076  -0.688  -1.716  1.00  0.00           H  
HETATM   58  H13 UNL     1       7.004  -1.199  -3.118  1.00  0.00           H  
HETATM   59  H14 UNL     1       9.474  -2.919  -1.665  1.00  0.00           H  
HETATM   60  H15 UNL     1       8.785  -1.820  -2.887  1.00  0.00           H  
HETATM   61  H16 UNL     1       9.227  -1.120  -1.305  1.00  0.00           H  
HETATM   62  H17 UNL     1       7.632  -3.962  -2.345  1.00  0.00           H  
HETATM   63  H18 UNL     1       3.846   0.182  -0.811  1.00  0.00           H  
HETATM   64  H19 UNL     1       4.738   2.191  -0.354  1.00  0.00           H  
HETATM   65  H20 UNL     1       4.417   2.117   1.424  1.00  0.00           H  
HETATM   66  H21 UNL     1       2.770   3.502   0.754  1.00  0.00           H  
HETATM   67  H22 UNL     1       2.447   2.616  -0.845  1.00  0.00           H  
HETATM   68  H23 UNL     1       1.633   1.051   3.103  1.00  0.00           H  
HETATM   69  H24 UNL     1       1.118   2.675   2.653  1.00  0.00           H  
HETATM   70  H25 UNL     1       2.850   2.388   2.695  1.00  0.00           H  
HETATM   71  H26 UNL     1      -0.194  -1.254   0.291  1.00  0.00           H  
HETATM   72  H27 UNL     1      -0.480  -0.552  -1.312  1.00  0.00           H  
HETATM   73  H28 UNL     1       1.592   0.648  -1.341  1.00  0.00           H  
HETATM   74  H29 UNL     1       2.237  -1.172  -2.236  1.00  0.00           H  
HETATM   75  H30 UNL     1       1.743  -1.809   1.328  1.00  0.00           H  
HETATM   76  H31 UNL     1       0.850  -0.467   2.018  1.00  0.00           H  
HETATM   77  H32 UNL     1       2.488  -0.721   2.614  1.00  0.00           H  
HETATM   78  H33 UNL     1      -2.548   0.411   2.217  1.00  0.00           H  
HETATM   79  H34 UNL     1      -1.249   1.594   2.412  1.00  0.00           H  
HETATM   80  H35 UNL     1      -2.906   2.139   2.136  1.00  0.00           H  
HETATM   81  H36 UNL     1      -2.586  -0.766   0.416  1.00  0.00           H  
HETATM   82  H37 UNL     1      -2.613   0.062  -1.237  1.00  0.00           H  
HETATM   83  H38 UNL     1      -4.247   0.918   1.210  1.00  0.00           H  
HETATM   84  H39 UNL     1      -8.041  -1.434   0.779  1.00  0.00           H  
HETATM   85  H40 UNL     1      -6.942  -2.764   1.221  1.00  0.00           H  
HETATM   86  H41 UNL     1      -6.347  -0.496  -2.073  1.00  0.00           H  
HETATM   87  H42 UNL     1      -7.861  -1.244  -2.590  1.00  0.00           H  
HETATM   88  H43 UNL     1      -7.902  -0.258  -1.103  1.00  0.00           H  
HETATM   89  H44 UNL     1      -5.692  -3.291  -1.867  1.00  0.00           H  
HETATM   90  H45 UNL     1      -8.999  -2.920  -1.229  1.00  0.00           H  
HETATM   91  H46 UNL     1      -7.795  -3.359  -2.440  1.00  0.00           H  
HETATM   92  H47 UNL     1      -8.363  -6.284  -1.734  1.00  0.00           H  
HETATM   93  H48 UNL     1      -4.538   1.503  -1.770  1.00  0.00           H  
HETATM   94  H49 UNL     1      -6.024   1.985   0.516  1.00  0.00           H  
HETATM   95  H50 UNL     1      -4.683   3.435   1.192  1.00  0.00           H  
HETATM   96  H51 UNL     1      -3.042   4.300   1.117  1.00  0.00           H  
HETATM   97  H52 UNL     1      -4.422   4.841   0.159  1.00  0.00           H  
HETATM   98  H53 UNL     1      -2.750   4.399  -1.888  1.00  0.00           H  
HETATM   99  H54 UNL     1      -3.673   3.094  -2.730  1.00  0.00           H  
HETATM  100  H55 UNL     1      -4.548   4.405  -1.760  1.00  0.00           H  
HETATM  101  H56 UNL     1      -2.049   1.967  -1.559  1.00  0.00           H  
HETATM  102  H57 UNL     1      -0.587   3.660  -1.455  1.00  0.00           H  
HETATM  103  H58 UNL     1      -1.542   4.512  -0.250  1.00  0.00           H  
HETATM  104  H59 UNL     1      -0.301   3.641   1.565  1.00  0.00           H  
HETATM  105  H60 UNL     1       0.857   3.900   0.248  1.00  0.00           H  
CONECT    1    2   46   47   48
CONECT    2    3   11   49
CONECT    3    4   50   51
CONECT    4    5   52   53
CONECT    5    6    7   54
CONECT    6   55
CONECT    7    8    9   10
CONECT    8   56   57   58
CONECT    9   59   60   61
CONECT   10   62
CONECT   11   12   21   63
CONECT   12   13   64   65
CONECT   13   14   66   67
CONECT   14   15   16   21
CONECT   15   68   69   70
CONECT   16   17   17   45
CONECT   17   18   23
CONECT   18   19   71   72
CONECT   19   20   21   73
CONECT   20   74
CONECT   21   22
CONECT   22   75   76   77
CONECT   23   24   25   43
CONECT   24   78   79   80
CONECT   25   26   81   82
CONECT   26   27   38   83
CONECT   27   28
CONECT   28   29   29   30
CONECT   30   31   84   85
CONECT   31   32   33   34
CONECT   32   86   87   88
CONECT   33   89
CONECT   34   35   90   91
CONECT   35   36   36   37
CONECT   37   92
CONECT   38   39   40   93
CONECT   39   94
CONECT   40   41   42   43
CONECT   41   95   96   97
CONECT   42   98   99  100
CONECT   43   44  101
CONECT   44   45  102  103
CONECT   45  104  105
END

HMDB0036438
     RDKit          3D
Fasciculic acid B
105108  0  0  0  0  0  0  0  0999 V2000
    5.0037   -0.2314    2.4087 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7529   -0.4169    0.9511 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7871   -1.9055    0.5659 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1104   -2.4818    0.8742 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3037   -1.9522    0.1772 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4036   -2.6971    0.7523 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4008   -2.3244   -1.2932 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4755   -1.5921   -2.2030 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8275   -2.0241   -1.7974 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2344   -3.7121   -1.4608 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6995    0.3664    0.3025 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0267    1.8461    0.4465 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6920    2.5285    0.2234 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7731    1.5643    0.9692 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8884    1.8946    2.4358 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3923    1.8415    0.5513 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4708    0.8991    0.1936 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0254   -0.3730   -0.3395 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4949   -0.2142   -0.6488 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9960   -1.3286   -1.2677 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2815    0.1845    0.6126 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8923   -0.7567    1.6807 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9198    1.2544    0.3737 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1865    1.4034    1.8057 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8283    0.1375   -0.1677 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2325    0.6210    0.1308 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2154   -0.3523   -0.0363 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0330   -0.8457    0.9382 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9096   -0.3990    2.1045 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0346   -1.8893    0.5822 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9843   -2.2195   -0.8709 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2829   -0.9578   -1.6887 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6520   -2.5784   -1.1663 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9320   -3.2817   -1.3192 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7568   -4.5931   -0.6887 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8491   -4.7979    0.1458 O   0  0  0  0  0  0  0  0  0  0  0  0
   -8.6090   -5.6327   -1.0172 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5277    1.8250   -0.6905 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8419    2.2333   -0.4269 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5634    2.9571   -0.5422 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8890    3.9196    0.5481 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6626    3.7570   -1.8590 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1511    2.4318   -0.5214 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1044    3.4875   -0.4611 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0230    3.2972    0.5494 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0801   -0.0328    2.6256 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.4601    0.6299    2.7834 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.8074   -1.1651    3.0031 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.7134   -0.0356    0.4690 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.5187   -2.0153   -0.4864 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0324   -2.4728    1.1504 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.2560   -2.4638    1.9883 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622   -3.5864    0.6374 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.5646   -0.9174    0.2926 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.2121   -2.2357    0.4182 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.6305   -2.2361   -2.5547 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.0760   -0.6877   -1.7161 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.0037   -1.1992   -3.1183 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.4744   -2.9194   -1.6649 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.7848   -1.8202   -2.8865 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.2273   -1.1196   -1.3054 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.6321   -3.9616   -2.3445 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8456    0.1819   -0.8106 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7378    2.1909   -0.3539 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.4166    2.1168    1.4241 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7701    3.5022    0.7542 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4471    2.6165   -0.8451 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.6328    1.0513    3.1032 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.1178    2.6746    2.6535 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.8505    2.3882    2.6953 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1940   -1.2536    0.2907 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4797   -0.5521   -1.3124 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.5916    0.6476   -1.3408 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.2375   -1.1716   -2.2355 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.7429   -1.8090    1.3282 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8499   -0.4667    2.0177 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4876   -0.7206    2.6140 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5476    0.4115    2.2174 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2495    1.5936    2.4115 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9058    2.1393    2.1361 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5860   -0.7658    0.4161 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6125    0.0617   -1.2371 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2469    0.9179    1.2100 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.0410   -1.4338    0.7794 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9418   -2.7637    1.2211 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3467   -0.4960   -2.0735 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8610   -1.2439   -2.5900 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9025   -0.2579   -1.1026 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6919   -3.2913   -1.8675 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.9986   -2.9203   -1.2289 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7954   -3.3594   -2.4398 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.3626   -6.2838   -1.7341 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5376    1.5034   -1.7705 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0242    1.9846    0.5158 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6827    3.4351    1.1920 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0420    4.3004    1.1172 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4222    4.8406    0.1588 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7503    4.3987   -1.8876 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6733    3.0944   -2.7297 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5479    4.4054   -1.7599 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0490    1.9667   -1.5587 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5866    3.6604   -1.4548 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5419    4.5119   -0.2495 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3009    3.6407    1.5646 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8569    3.8996    0.2476 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  5  7  1  0
  7  8  1  0
  7  9  1  0
  7 10  1  0
  2 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 19 21  1  0
 21 22  1  0
 17 23  1  0
 23 24  1  0
 23 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  2  0
 28 30  1  0
 30 31  1  0
 31 32  1  0
 31 33  1  0
 31 34  1  0
 34 35  1  0
 35 36  2  0
 35 37  1  0
 26 38  1  0
 38 39  1  0
 38 40  1  0
 40 41  1  0
 40 42  1  0
 40 43  1  0
 43 44  1  0
 44 45  1  0
 21 11  1  0
 43 23  1  0
 21 14  1  0
 45 16  1  0
  1 46  1  0
  1 47  1  0
  1 48  1  0
  2 49  1  0
  3 50  1  0
  3 51  1  0
  4 52  1  0
  4 53  1  0
  5 54  1  0
  6 55  1  0
  8 56  1  0
  8 57  1  0
  8 58  1  0
  9 59  1  0
  9 60  1  0
  9 61  1  0
 10 62  1  0
 11 63  1  0
 12 64  1  0
 12 65  1  0
 13 66  1  0
 13 67  1  0
 15 68  1  0
 15 69  1  0
 15 70  1  0
 18 71  1  0
 18 72  1  0
 19 73  1  0
 20 74  1  0
 22 75  1  0
 22 76  1  0
 22 77  1  0
 24 78  1  0
 24 79  1  0
 24 80  1  0
 25 81  1  0
 25 82  1  0
 26 83  1  0
 30 84  1  0
 30 85  1  0
 32 86  1  0
 32 87  1  0
 32 88  1  0
 33 89  1  0
 34 90  1  0
 34 91  1  0
 37 92  1  0
 38 93  1  0
 39 94  1  0
 41 95  1  0
 41 96  1  0
 41 97  1  0
 42 98  1  0
 42 99  1  0
 42100  1  0
 43101  1  0
 44102  1  0
 44103  1  0
 45104  1  0
 45105  1  0
M  END

View in JSmol View Stereo Labels

Synonyms

Value	Source
Fasciculate b	Generator
2-O-(3-Hydroxy-3-methylglutaryl) fasciculol b	MeSH
(+)-Fasciculic acid b	HMDB
5-{[14-(5,6-dihydroxy-6-methylheptan-2-yl)-5,16-dihydroxy-2,6,6,11,15-pentamethyltetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadec-1(10)-en-4-yl]oxy}-3-hydroxy-3-methyl-5-oxopentanoate	Generator
Fasciculic acid b	MeSH

Chemical Formula

C₃₆H₆₀O₉

Average Molecular Weight

636.8562

Monoisotopic Molecular Weight

636.423733518

IUPAC Name

5-{[14-(5,6-dihydroxy-6-methylheptan-2-yl)-5,16-dihydroxy-2,6,6,11,15-pentamethyltetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadec-1(10)-en-4-yl]oxy}-3-hydroxy-3-methyl-5-oxopentanoic acid

Traditional Name

5-{[14-(5,6-dihydroxy-6-methylheptan-2-yl)-5,16-dihydroxy-2,6,6,11,15-pentamethyltetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadec-1(10)-en-4-yl]oxy}-3-hydroxy-3-methyl-5-oxopentanoic acid

CAS Registry Number

126882-55-1

SMILES

CC(CCC(O)C(C)(C)O)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(OC(=O)CC(C)(O)CC(O)=O)C(O)C(C)(C)C1CC3

InChI Identifier

InChI=1S/C36H60O9/c1-20(10-13-26(37)32(4,5)43)21-14-15-35(8)22-11-12-25-31(2,3)30(42)24(45-29(41)19-33(6,44)18-28(39)40)17-34(25,7)23(22)16-27(38)36(21,35)9/h20-21,24-27,30,37-38,42-44H,10-19H2,1-9H3,(H,39,40)

InChI Key

SWRXIGFQDQTNKP-UHFFFAOYSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as triterpenoids. These are terpene molecules containing six isoprene units.

Kingdom

Organic compounds

Super Class

Lipids and lipid-like molecules

Class

Prenol lipids

Sub Class

Triterpenoids

Direct Parent

Triterpenoids

Alternative Parents

Substituents

Triterpenoid
Tetrahydroxy bile acid, alcohol, or derivatives
25-hydroxysteroid
24-hydroxysteroid
Hydroxy bile acid, alcohol, or derivatives
Bile acid, alcohol, or derivatives
Steroid ester
3-hydroxysteroid
12-hydroxysteroid
Hydroxysteroid
Steroid
Dicarboxylic acid or derivatives
Tertiary alcohol
Cyclic alcohol
Secondary alcohol
Carboxylic acid ester
Carboxylic acid
Carboxylic acid derivative
Organic oxygen compound
Hydrocarbon derivative
Carbonyl group
Organic oxide
Alcohol
Organooxygen compound
Aliphatic homopolycyclic compound

Molecular Framework

Aliphatic homopolycyclic compounds

External Descriptors

Not Available

Ontology

Physiological effect

Not Available

Disposition

Biological location

Cellular substructure

Route of exposure

Enteral

Ingestion (HMDB: HMDB0036438)

Source

Endogenous

Endogenous (HMDB: HMDB0036438)

Plant

Plant (HMDB: HMDB0036438)

Animal

Animal (HMDB: HMDB0036438)

Exogenous

Food

Food (HMDB: HMDB0036438)

Vegetable

Mushroom

Exogenous (HMDB: HMDB0036438)

Process

Naturally occurring process

Biological process

Chemical reaction

Lipid Peroxidation (HMDB: HMDB0036438)

Biochemical pathway

Metabolic pathway

Fatty Acid Metabolism (HMDB: HMDB0036438)

Lipid metabolism pathway (HMDB: HMDB0036438)

Cellular process

Cell signaling (HMDB: HMDB0036438)

Biochemical process

Lipid transport (HMDB: HMDB0036438)

Role

Biological role

Energy source (HMDB: HMDB0036438)

Industrial application

Manufacturing industry

Material processing agent

Fluid processing agent

Surfactant

Surfactant (HMDB: HMDB0036438)

Physical Properties

State

Solid

Experimental Molecular Properties

Property	Value	Reference
Melting Point	98 - 103 °C	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	Not Available	Not Available
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	0.0028 g/L	ALOGPS
logP	3.78	ALOGPS
logP	3.18	ChemAxon
logS	-5.4	ALOGPS
pKa (Strongest Acidic)	3.8	ChemAxon
pKa (Strongest Basic)	-0.29	ChemAxon
Physiological Charge	-1	ChemAxon
Hydrogen Acceptor Count	8	ChemAxon
Hydrogen Donor Count	6	ChemAxon
Polar Surface Area	164.75 Å²	ChemAxon
Rotatable Bond Count	11	ChemAxon
Refractivity	170.41 m³·mol⁻¹	ChemAxon
Polarizability	72.95 Å³	ChemAxon
Number of Rings	4	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	Yes	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DarkChem	[M+H]+	244.187	31661259
DarkChem	[M-H]-	235.274	31661259
DeepCCS	[M-2H]-	277.692	30932474
DeepCCS	[M+Na]+	252.146	30932474
AllCCS	[M+H]+	246.4	32859911
AllCCS	[M+H-H2O]+	245.8	32859911
AllCCS	[M+NH4]+	247.0	32859911
AllCCS	[M+Na]+	247.2	32859911
AllCCS	[M-H]-	232.4	32859911
AllCCS	[M+Na-2H]-	237.2	32859911
AllCCS	[M+HCOO]-	242.6	32859911

Predicted Retention Times

Underivatized

Chromatographic Method	Retention Time	Reference
Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022.	7.87 minutes	32390414
Predicted by Siyang on May 30, 2022	16.0332 minutes	33406817
Predicted by Siyang using ReTip algorithm on June 8, 2022	3.66 minutes	32390414
Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid	3373.8 seconds	40023050
Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid	146.7 seconds	40023050
Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid	245.7 seconds	40023050
Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid	148.5 seconds	40023050
RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid	207.3 seconds	40023050
Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid	843.0 seconds	40023050
BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid	839.6 seconds	40023050
HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate)	100.9 seconds	40023050
UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid	1214.3 seconds	40023050
BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid	647.5 seconds	40023050
UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid	1795.9 seconds	40023050
SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid	493.2 seconds	40023050
RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid	543.0 seconds	40023050
MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate	129.7 seconds	40023050
KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA	222.6 seconds	40023050
Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water	11.4 seconds	40023050

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
Fasciculic acid B	CC(CCC(O)C(C)(C)O)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(OC(=O)CC(C)(O)CC(O)=O)C(O)C(C)(C)C1CC3	3948.3	Standard polar	33892256
Fasciculic acid B	CC(CCC(O)C(C)(C)O)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(OC(=O)CC(C)(O)CC(O)=O)C(O)C(C)(C)C1CC3	3917.2	Standard non polar	33892256
Fasciculic acid B	CC(CCC(O)C(C)(C)O)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(OC(=O)CC(C)(O)CC(O)=O)C(O)C(C)(C)C1CC3	4625.9	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
Fasciculic acid B,1TMS,isomer #1	CC(CCC(O[Si](C)(C)C)C(C)(C)O)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(OC(=O)CC(C)(O)CC(=O)O)C(O)C(C)(C)C1CC3	4904.5	Semi standard non polar	33892256
Fasciculic acid B,1TMS,isomer #2	CC(CCC(O)C(C)(C)O[Si](C)(C)C)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(OC(=O)CC(C)(O)CC(=O)O)C(O)C(C)(C)C1CC3	4964.6	Semi standard non polar	33892256
Fasciculic acid B,1TMS,isomer #3	CC(CCC(O)C(C)(C)O)C1CCC2(C)C3=C(CC(O[Si](C)(C)C)C12C)C1(C)CC(OC(=O)CC(C)(O)CC(=O)O)C(O)C(C)(C)C1CC3	4832.6	Semi standard non polar	33892256
Fasciculic acid B,1TMS,isomer #4	CC(CCC(O)C(C)(C)O)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(OC(=O)CC(C)(CC(=O)O)O[Si](C)(C)C)C(O)C(C)(C)C1CC3	4896.4	Semi standard non polar	33892256
Fasciculic acid B,1TMS,isomer #5	CC(CCC(O)C(C)(C)O)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(OC(=O)CC(C)(O)CC(=O)O[Si](C)(C)C)C(O)C(C)(C)C1CC3	4848.1	Semi standard non polar	33892256
Fasciculic acid B,1TMS,isomer #6	CC(CCC(O)C(C)(C)O)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(OC(=O)CC(C)(O)CC(=O)O)C(O[Si](C)(C)C)C(C)(C)C1CC3	4930.9	Semi standard non polar	33892256
Fasciculic acid B,2TMS,isomer #1	CC(CCC(O[Si](C)(C)C)C(C)(C)O[Si](C)(C)C)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(OC(=O)CC(C)(O)CC(=O)O)C(O)C(C)(C)C1CC3	4935.3	Semi standard non polar	33892256
Fasciculic acid B,2TMS,isomer #10	CC(CCC(O)C(C)(C)O)C1CCC2(C)C3=C(CC(O[Si](C)(C)C)C12C)C1(C)CC(OC(=O)CC(C)(CC(=O)O)O[Si](C)(C)C)C(O)C(C)(C)C1CC3	4728.0	Semi standard non polar	33892256
Fasciculic acid B,2TMS,isomer #11	CC(CCC(O)C(C)(C)O)C1CCC2(C)C3=C(CC(O[Si](C)(C)C)C12C)C1(C)CC(OC(=O)CC(C)(O)CC(=O)O[Si](C)(C)C)C(O)C(C)(C)C1CC3	4651.1	Semi standard non polar	33892256
Fasciculic acid B,2TMS,isomer #12	CC(CCC(O)C(C)(C)O)C1CCC2(C)C3=C(CC(O[Si](C)(C)C)C12C)C1(C)CC(OC(=O)CC(C)(O)CC(=O)O)C(O[Si](C)(C)C)C(C)(C)C1CC3	4729.2	Semi standard non polar	33892256
Fasciculic acid B,2TMS,isomer #13	CC(CCC(O)C(C)(C)O)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(OC(=O)CC(C)(CC(=O)O[Si](C)(C)C)O[Si](C)(C)C)C(O)C(C)(C)C1CC3	4792.1	Semi standard non polar	33892256
Fasciculic acid B,2TMS,isomer #14	CC(CCC(O)C(C)(C)O)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(OC(=O)CC(C)(CC(=O)O)O[Si](C)(C)C)C(O[Si](C)(C)C)C(C)(C)C1CC3	4864.5	Semi standard non polar	33892256
Fasciculic acid B,2TMS,isomer #15	CC(CCC(O)C(C)(C)O)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(OC(=O)CC(C)(O)CC(=O)O[Si](C)(C)C)C(O[Si](C)(C)C)C(C)(C)C1CC3	4781.3	Semi standard non polar	33892256
Fasciculic acid B,2TMS,isomer #2	CC(CCC(O[Si](C)(C)C)C(C)(C)O)C1CCC2(C)C3=C(CC(O[Si](C)(C)C)C12C)C1(C)CC(OC(=O)CC(C)(O)CC(=O)O)C(O)C(C)(C)C1CC3	4735.7	Semi standard non polar	33892256
Fasciculic acid B,2TMS,isomer #3	CC(CCC(O[Si](C)(C)C)C(C)(C)O)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(OC(=O)CC(C)(CC(=O)O)O[Si](C)(C)C)C(O)C(C)(C)C1CC3	4855.0	Semi standard non polar	33892256
Fasciculic acid B,2TMS,isomer #4	CC(CCC(O[Si](C)(C)C)C(C)(C)O)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(OC(=O)CC(C)(O)CC(=O)O[Si](C)(C)C)C(O)C(C)(C)C1CC3	4777.4	Semi standard non polar	33892256
Fasciculic acid B,2TMS,isomer #5	CC(CCC(O[Si](C)(C)C)C(C)(C)O)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(OC(=O)CC(C)(O)CC(=O)O)C(O[Si](C)(C)C)C(C)(C)C1CC3	4865.0	Semi standard non polar	33892256
Fasciculic acid B,2TMS,isomer #6	CC(CCC(O)C(C)(C)O[Si](C)(C)C)C1CCC2(C)C3=C(CC(O[Si](C)(C)C)C12C)C1(C)CC(OC(=O)CC(C)(O)CC(=O)O)C(O)C(C)(C)C1CC3	4815.7	Semi standard non polar	33892256
Fasciculic acid B,2TMS,isomer #7	CC(CCC(O)C(C)(C)O[Si](C)(C)C)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(OC(=O)CC(C)(CC(=O)O)O[Si](C)(C)C)C(O)C(C)(C)C1CC3	4915.3	Semi standard non polar	33892256
Fasciculic acid B,2TMS,isomer #8	CC(CCC(O)C(C)(C)O[Si](C)(C)C)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(OC(=O)CC(C)(O)CC(=O)O[Si](C)(C)C)C(O)C(C)(C)C1CC3	4849.7	Semi standard non polar	33892256
Fasciculic acid B,2TMS,isomer #9	CC(CCC(O)C(C)(C)O[Si](C)(C)C)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(OC(=O)CC(C)(O)CC(=O)O)C(O[Si](C)(C)C)C(C)(C)C1CC3	4941.2	Semi standard non polar	33892256
Fasciculic acid B,3TMS,isomer #1	CC(CCC(O[Si](C)(C)C)C(C)(C)O[Si](C)(C)C)C1CCC2(C)C3=C(CC(O[Si](C)(C)C)C12C)C1(C)CC(OC(=O)CC(C)(O)CC(=O)O)C(O)C(C)(C)C1CC3	4742.3	Semi standard non polar	33892256
Fasciculic acid B,3TMS,isomer #10	CC(CCC(O[Si](C)(C)C)C(C)(C)O)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(OC(=O)CC(C)(O)CC(=O)O[Si](C)(C)C)C(O[Si](C)(C)C)C(C)(C)C1CC3	4691.1	Semi standard non polar	33892256
Fasciculic acid B,3TMS,isomer #11	CC(CCC(O)C(C)(C)O[Si](C)(C)C)C1CCC2(C)C3=C(CC(O[Si](C)(C)C)C12C)C1(C)CC(OC(=O)CC(C)(CC(=O)O)O[Si](C)(C)C)C(O)C(C)(C)C1CC3	4712.9	Semi standard non polar	33892256
Fasciculic acid B,3TMS,isomer #12	CC(CCC(O)C(C)(C)O[Si](C)(C)C)C1CCC2(C)C3=C(CC(O[Si](C)(C)C)C12C)C1(C)CC(OC(=O)CC(C)(O)CC(=O)O[Si](C)(C)C)C(O)C(C)(C)C1CC3	4636.3	Semi standard non polar	33892256
Fasciculic acid B,3TMS,isomer #13	CC(CCC(O)C(C)(C)O[Si](C)(C)C)C1CCC2(C)C3=C(CC(O[Si](C)(C)C)C12C)C1(C)CC(OC(=O)CC(C)(O)CC(=O)O)C(O[Si](C)(C)C)C(C)(C)C1CC3	4720.2	Semi standard non polar	33892256
Fasciculic acid B,3TMS,isomer #14	CC(CCC(O)C(C)(C)O[Si](C)(C)C)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(OC(=O)CC(C)(CC(=O)O[Si](C)(C)C)O[Si](C)(C)C)C(O)C(C)(C)C1CC3	4776.4	Semi standard non polar	33892256
Fasciculic acid B,3TMS,isomer #15	CC(CCC(O)C(C)(C)O[Si](C)(C)C)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(OC(=O)CC(C)(CC(=O)O)O[Si](C)(C)C)C(O[Si](C)(C)C)C(C)(C)C1CC3	4851.4	Semi standard non polar	33892256
Fasciculic acid B,3TMS,isomer #16	CC(CCC(O)C(C)(C)O[Si](C)(C)C)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(OC(=O)CC(C)(O)CC(=O)O[Si](C)(C)C)C(O[Si](C)(C)C)C(C)(C)C1CC3	4759.2	Semi standard non polar	33892256
Fasciculic acid B,3TMS,isomer #17	CC(CCC(O)C(C)(C)O)C1CCC2(C)C3=C(CC(O[Si](C)(C)C)C12C)C1(C)CC(OC(=O)CC(C)(CC(=O)O[Si](C)(C)C)O[Si](C)(C)C)C(O)C(C)(C)C1CC3	4576.1	Semi standard non polar	33892256
Fasciculic acid B,3TMS,isomer #18	CC(CCC(O)C(C)(C)O)C1CCC2(C)C3=C(CC(O[Si](C)(C)C)C12C)C1(C)CC(OC(=O)CC(C)(CC(=O)O)O[Si](C)(C)C)C(O[Si](C)(C)C)C(C)(C)C1CC3	4623.9	Semi standard non polar	33892256
Fasciculic acid B,3TMS,isomer #19	CC(CCC(O)C(C)(C)O)C1CCC2(C)C3=C(CC(O[Si](C)(C)C)C12C)C1(C)CC(OC(=O)CC(C)(O)CC(=O)O[Si](C)(C)C)C(O[Si](C)(C)C)C(C)(C)C1CC3	4539.7	Semi standard non polar	33892256
Fasciculic acid B,3TMS,isomer #2	CC(CCC(O[Si](C)(C)C)C(C)(C)O[Si](C)(C)C)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(OC(=O)CC(C)(CC(=O)O)O[Si](C)(C)C)C(O)C(C)(C)C1CC3	4862.1	Semi standard non polar	33892256
Fasciculic acid B,3TMS,isomer #20	CC(CCC(O)C(C)(C)O)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(OC(=O)CC(C)(CC(=O)O[Si](C)(C)C)O[Si](C)(C)C)C(O[Si](C)(C)C)C(C)(C)C1CC3	4711.1	Semi standard non polar	33892256
Fasciculic acid B,3TMS,isomer #3	CC(CCC(O[Si](C)(C)C)C(C)(C)O[Si](C)(C)C)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(OC(=O)CC(C)(O)CC(=O)O[Si](C)(C)C)C(O)C(C)(C)C1CC3	4773.9	Semi standard non polar	33892256
Fasciculic acid B,3TMS,isomer #4	CC(CCC(O[Si](C)(C)C)C(C)(C)O[Si](C)(C)C)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(OC(=O)CC(C)(O)CC(=O)O)C(O[Si](C)(C)C)C(C)(C)C1CC3	4879.8	Semi standard non polar	33892256
Fasciculic acid B,3TMS,isomer #5	CC(CCC(O[Si](C)(C)C)C(C)(C)O)C1CCC2(C)C3=C(CC(O[Si](C)(C)C)C12C)C1(C)CC(OC(=O)CC(C)(CC(=O)O)O[Si](C)(C)C)C(O)C(C)(C)C1CC3	4637.7	Semi standard non polar	33892256
Fasciculic acid B,3TMS,isomer #6	CC(CCC(O[Si](C)(C)C)C(C)(C)O)C1CCC2(C)C3=C(CC(O[Si](C)(C)C)C12C)C1(C)CC(OC(=O)CC(C)(O)CC(=O)O[Si](C)(C)C)C(O)C(C)(C)C1CC3	4570.6	Semi standard non polar	33892256
Fasciculic acid B,3TMS,isomer #7	CC(CCC(O[Si](C)(C)C)C(C)(C)O)C1CCC2(C)C3=C(CC(O[Si](C)(C)C)C12C)C1(C)CC(OC(=O)CC(C)(O)CC(=O)O)C(O[Si](C)(C)C)C(C)(C)C1CC3	4637.5	Semi standard non polar	33892256
Fasciculic acid B,3TMS,isomer #8	CC(CCC(O[Si](C)(C)C)C(C)(C)O)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(OC(=O)CC(C)(CC(=O)O[Si](C)(C)C)O[Si](C)(C)C)C(O)C(C)(C)C1CC3	4718.0	Semi standard non polar	33892256
Fasciculic acid B,3TMS,isomer #9	CC(CCC(O[Si](C)(C)C)C(C)(C)O)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(OC(=O)CC(C)(CC(=O)O)O[Si](C)(C)C)C(O[Si](C)(C)C)C(C)(C)C1CC3	4774.7	Semi standard non polar	33892256
Fasciculic acid B,1TBDMS,isomer #1	CC(CCC(O[Si](C)(C)C(C)(C)C)C(C)(C)O)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(OC(=O)CC(C)(O)CC(=O)O)C(O)C(C)(C)C1CC3	5139.3	Semi standard non polar	33892256
Fasciculic acid B,1TBDMS,isomer #2	CC(CCC(O)C(C)(C)O[Si](C)(C)C(C)(C)C)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(OC(=O)CC(C)(O)CC(=O)O)C(O)C(C)(C)C1CC3	5177.2	Semi standard non polar	33892256
Fasciculic acid B,1TBDMS,isomer #3	CC(CCC(O)C(C)(C)O)C1CCC2(C)C3=C(CC(O[Si](C)(C)C(C)(C)C)C12C)C1(C)CC(OC(=O)CC(C)(O)CC(=O)O)C(O)C(C)(C)C1CC3	5053.4	Semi standard non polar	33892256
Fasciculic acid B,1TBDMS,isomer #4	CC(CCC(O)C(C)(C)O)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(OC(=O)CC(C)(CC(=O)O)O[Si](C)(C)C(C)(C)C)C(O)C(C)(C)C1CC3	5124.1	Semi standard non polar	33892256
Fasciculic acid B,1TBDMS,isomer #5	CC(CCC(O)C(C)(C)O)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(OC(=O)CC(C)(O)CC(=O)O[Si](C)(C)C(C)(C)C)C(O)C(C)(C)C1CC3	5082.1	Semi standard non polar	33892256
Fasciculic acid B,1TBDMS,isomer #6	CC(CCC(O)C(C)(C)O)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(OC(=O)CC(C)(O)CC(=O)O)C(O[Si](C)(C)C(C)(C)C)C(C)(C)C1CC3	5159.0	Semi standard non polar	33892256
Fasciculic acid B,2TBDMS,isomer #1	CC(CCC(O[Si](C)(C)C(C)(C)C)C(C)(C)O[Si](C)(C)C(C)(C)C)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(OC(=O)CC(C)(O)CC(=O)O)C(O)C(C)(C)C1CC3	5384.0	Semi standard non polar	33892256
Fasciculic acid B,2TBDMS,isomer #10	CC(CCC(O)C(C)(C)O)C1CCC2(C)C3=C(CC(O[Si](C)(C)C(C)(C)C)C12C)C1(C)CC(OC(=O)CC(C)(CC(=O)O)O[Si](C)(C)C(C)(C)C)C(O)C(C)(C)C1CC3	5174.8	Semi standard non polar	33892256
Fasciculic acid B,2TBDMS,isomer #11	CC(CCC(O)C(C)(C)O)C1CCC2(C)C3=C(CC(O[Si](C)(C)C(C)(C)C)C12C)C1(C)CC(OC(=O)CC(C)(O)CC(=O)O[Si](C)(C)C(C)(C)C)C(O)C(C)(C)C1CC3	5120.2	Semi standard non polar	33892256
Fasciculic acid B,2TBDMS,isomer #12	CC(CCC(O)C(C)(C)O)C1CCC2(C)C3=C(CC(O[Si](C)(C)C(C)(C)C)C12C)C1(C)CC(OC(=O)CC(C)(O)CC(=O)O)C(O[Si](C)(C)C(C)(C)C)C(C)(C)C1CC3	5195.0	Semi standard non polar	33892256
Fasciculic acid B,2TBDMS,isomer #13	CC(CCC(O)C(C)(C)O)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(OC(=O)CC(C)(CC(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)C(O)C(C)(C)C1CC3	5245.9	Semi standard non polar	33892256
Fasciculic acid B,2TBDMS,isomer #14	CC(CCC(O)C(C)(C)O)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(OC(=O)CC(C)(CC(=O)O)O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(C)(C)C1CC3	5330.7	Semi standard non polar	33892256
Fasciculic acid B,2TBDMS,isomer #15	CC(CCC(O)C(C)(C)O)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(OC(=O)CC(C)(O)CC(=O)O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(C)(C)C1CC3	5257.0	Semi standard non polar	33892256
Fasciculic acid B,2TBDMS,isomer #2	CC(CCC(O[Si](C)(C)C(C)(C)C)C(C)(C)O)C1CCC2(C)C3=C(CC(O[Si](C)(C)C(C)(C)C)C12C)C1(C)CC(OC(=O)CC(C)(O)CC(=O)O)C(O)C(C)(C)C1CC3	5196.4	Semi standard non polar	33892256
Fasciculic acid B,2TBDMS,isomer #3	CC(CCC(O[Si](C)(C)C(C)(C)C)C(C)(C)O)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(OC(=O)CC(C)(CC(=O)O)O[Si](C)(C)C(C)(C)C)C(O)C(C)(C)C1CC3	5311.4	Semi standard non polar	33892256
Fasciculic acid B,2TBDMS,isomer #4	CC(CCC(O[Si](C)(C)C(C)(C)C)C(C)(C)O)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(OC(=O)CC(C)(O)CC(=O)O[Si](C)(C)C(C)(C)C)C(O)C(C)(C)C1CC3	5252.7	Semi standard non polar	33892256
Fasciculic acid B,2TBDMS,isomer #5	CC(CCC(O[Si](C)(C)C(C)(C)C)C(C)(C)O)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(OC(=O)CC(C)(O)CC(=O)O)C(O[Si](C)(C)C(C)(C)C)C(C)(C)C1CC3	5336.3	Semi standard non polar	33892256
Fasciculic acid B,2TBDMS,isomer #6	CC(CCC(O)C(C)(C)O[Si](C)(C)C(C)(C)C)C1CCC2(C)C3=C(CC(O[Si](C)(C)C(C)(C)C)C12C)C1(C)CC(OC(=O)CC(C)(O)CC(=O)O)C(O)C(C)(C)C1CC3	5257.0	Semi standard non polar	33892256
Fasciculic acid B,2TBDMS,isomer #7	CC(CCC(O)C(C)(C)O[Si](C)(C)C(C)(C)C)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(OC(=O)CC(C)(CC(=O)O)O[Si](C)(C)C(C)(C)C)C(O)C(C)(C)C1CC3	5354.5	Semi standard non polar	33892256
Fasciculic acid B,2TBDMS,isomer #8	CC(CCC(O)C(C)(C)O[Si](C)(C)C(C)(C)C)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(OC(=O)CC(C)(O)CC(=O)O[Si](C)(C)C(C)(C)C)C(O)C(C)(C)C1CC3	5296.1	Semi standard non polar	33892256
Fasciculic acid B,2TBDMS,isomer #9	CC(CCC(O)C(C)(C)O[Si](C)(C)C(C)(C)C)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(OC(=O)CC(C)(O)CC(=O)O)C(O[Si](C)(C)C(C)(C)C)C(C)(C)C1CC3	5394.4	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - Fasciculic acid B GC-MS (Non-derivatized) - 70eV, Positive	splash10-0ab9-8106639000-230cdf41635c0157351a	2017-09-01	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Fasciculic acid B GC-MS (TMS_1_1) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Fasciculic acid B GC-MS (TMS_1_2) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Fasciculic acid B GC-MS (TMS_1_3) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Fasciculic acid B GC-MS (TMS_1_4) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Fasciculic acid B GC-MS (TMS_1_5) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Fasciculic acid B GC-MS (TMS_1_6) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Fasciculic acid B GC-MS (TMS_2_1) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Fasciculic acid B GC-MS (TMS_2_2) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Fasciculic acid B GC-MS (TMS_2_3) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Fasciculic acid B GC-MS (TMS_2_4) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Fasciculic acid B GC-MS (TMS_2_5) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Fasciculic acid B GC-MS (TMS_2_6) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Fasciculic acid B GC-MS (TMS_2_7) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Fasciculic acid B GC-MS (TMS_2_8) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Fasciculic acid B GC-MS (TMS_2_9) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Fasciculic acid B GC-MS (TMS_2_10) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Fasciculic acid B GC-MS (TMS_2_11) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Fasciculic acid B GC-MS (TMS_2_12) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Fasciculic acid B GC-MS (TMS_2_13) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Fasciculic acid B GC-MS (TMS_2_14) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Fasciculic acid B GC-MS (TMS_2_15) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Fasciculic acid B GC-MS (TMS_3_1) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Fasciculic acid B GC-MS (TMS_3_2) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Fasciculic acid B GC-MS (TMS_3_3) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Experimental LC-MS/MS	LC-MS/MS Spectrum - Fasciculic acid B , negative-QTOF	splash10-002u-1300669000-4789717bafdeea95b8d3	2017-09-14	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Fasciculic acid B , positive-QTOF	splash10-000i-0941600000-c85dd6c16826abc847a2	2017-09-14	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Fasciculic acid B , positive-QTOF	splash10-000i-1941500000-ac4a2e2be5bb2787572d	2017-09-14	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Fasciculic acid B , positive-QTOF	splash10-000i-0952800000-d6b9ddbc52864d4fda3e	2017-09-14	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Fasciculic acid B 40V, Negative-QTOF	splash10-0uk9-0800900000-83dcbc771a48e807b27b	2021-09-20	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Fasciculic acid B 20V, Negative-QTOF	splash10-000i-0300039000-c60f7259f861d3b0e94b	2021-09-20	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Fasciculic acid B 10V, Negative-QTOF	splash10-000i-0000009000-c978cf47f07648838a70	2021-09-20	HMDB team, MONA	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Fasciculic acid B 10V, Positive-QTOF	splash10-0uxr-0100239000-a46dfcabb55db12f215a	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Fasciculic acid B 20V, Positive-QTOF	splash10-0fb9-3400689000-4fdbfa6ec39ee731a50c	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Fasciculic acid B 40V, Positive-QTOF	splash10-0fbi-4303942000-65756948120229f4186c	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Fasciculic acid B 10V, Negative-QTOF	splash10-00rf-1300296000-9b704787f3edf26a473d	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Fasciculic acid B 20V, Negative-QTOF	splash10-00dl-4500794000-4f7fcabbe5c9c06daf92	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Fasciculic acid B 40V, Negative-QTOF	splash10-009f-9600700000-db38180f9870bd39dd6d	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Fasciculic acid B 10V, Positive-QTOF	splash10-0pdi-0001908000-5cab14077ccc359e45e4	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Fasciculic acid B 20V, Positive-QTOF	splash10-0r00-3102936000-42ec5d830c0d55dcd7a1	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Fasciculic acid B 40V, Positive-QTOF	splash10-0a73-9200000000-474088e540c76bf8a916	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Fasciculic acid B 10V, Negative-QTOF	splash10-01b9-0200459000-d9d564ce1160e433793a	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Fasciculic acid B 20V, Negative-QTOF	splash10-0abc-8900601000-10e21c089d1c7311f3d9	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Fasciculic acid B 40V, Negative-QTOF	splash10-0abd-9100561000-83f5d50f5f3a0b9bbdeb	2021-09-24	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Extracellular

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

FDB015325

KNApSAcK ID

C00034510

Chemspider ID

22943367

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

14506482

PDB ID

Not Available

ChEBI ID

184011

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

rw1855191

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

Simons K, Toomre D: Lipid rafts and signal transduction. Nat Rev Mol Cell Biol. 2000 Oct;1(1):31-9. [PubMed:11413487 ]
Watson AD: Thematic review series: systems biology approaches to metabolic and cardiovascular disorders. Lipidomics: a global approach to lipid analysis in biological systems. J Lipid Res. 2006 Oct;47(10):2101-11. Epub 2006 Aug 10. [PubMed:16902246 ]
Sethi JK, Vidal-Puig AJ: Thematic review series: adipocyte biology. Adipose tissue function and plasticity orchestrate nutritional adaptation. J Lipid Res. 2007 Jun;48(6):1253-62. Epub 2007 Mar 20. [PubMed:17374880 ]
Lingwood D, Simons K: Lipid rafts as a membrane-organizing principle. Science. 2010 Jan 1;327(5961):46-50. doi: 10.1126/science.1174621. [PubMed:20044567 ]
(). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .
Gunstone, Frank D., John L. Harwood, and Albert J. Dijkstra (2007). The lipid handbook with CD-ROM. CRC Press.

Showing metabocard for Fasciculic acid B (HMDB0036438)

MOL for HMDB0036438 (Fasciculic acid B)

3D MOL for HMDB0036438 (Fasciculic acid B)

3D SDF for HMDB0036438 (Fasciculic acid B)

3D-SDF for HMDB0036438 (Fasciculic acid B)

PDB for HMDB0036438 (Fasciculic acid B)

3D PDB for HMDB0036438 (Fasciculic acid B)

SMILES for HMDB0036438 (Fasciculic acid B)

INCHI for HMDB0036438 (Fasciculic acid B)

Structure for HMDB0036438 (Fasciculic acid B)

3D Structure for HMDB0036438 (Fasciculic acid B)

Predicted Collision Cross Sections

Predicted Retention Times

Underivatized

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra