| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Detected and Quantified |
|---|
| Creation Date | 2005-11-16 15:48:42 UTC |
|---|
| Update Date | 2021-09-14 15:48:15 UTC |
|---|
| HMDB ID | HMDB0000133 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Guanosine |
|---|
| Description | Guanosine (G), also known as 2-amino-inosine, belongs to the class of organic compounds known as purine nucleosides. Purine nucleosides are compounds comprising a purine base attached to a ribosyl or deoxyribosyl sugar moiety. Guanosine consists of a guanine base attached to a ribose (ribofuranose) ring via a beta-N9-glycosidic bond. Guanosine is a white, crystalline powder with no odor and mild saline taste. It is very soluble in acetic acid, and slightly soluble in water, but insoluble in ethanol, diethyl ether, benzene, and chloroform. Guanosine exists in all living species, ranging from bacteria to plants to humans. High levels of guanosine can be found in clovers, coffee plants, and the pollen of pines. It has been detected, but not quantified in, several different foods, such as leeks, garlic, chicory roots, green bell peppers, and black-eyed peas. Guanosine plays an important role in various biochemical processes including the synthesis of nucleic acids such as RNA and intracellular signal transduction (cGMP). The antiviral drug acyclovir, often used in herpes treatment, and the anti-HIV drug abacavir, are both structurally similar to guanosine. Guanosine can be phosphorylated to become guanosine monophosphate (GMP), cyclic guanosine monophosphate (cGMP), guanosine diphosphate (GDP), and guanosine triphosphate (GTP). In humans, guanosine is involved in intracellular signalling through the adenosine receptors A1R and A2AR (PMID: 31847113 ). Evidence from rodent and cell models has shown a number of important neurotrophic and neuroprotective effects of guanosine. In particular, it is effective in preventing deleterious consequences of seizures, spinal cord injury, pain, mood disorders and aging-related diseases, such as ischemia, Parkinson’s and Alzheimer’s diseases (PMID: 27699087 ). Studies with rodent models of Parkinson’s disease have shown that guanosine decreases neuronal apoptotic cell death and increases dopaminergic neurons at substantia nigra pars compacta, accompanied by an improvement of motor symptoms in Parkinson’s disease (i.e. a reduction of bradykinesia). Guanosine promotes neurite arborization, outgrowth, proliferation and differentiation. Systemic administration of guanosine for eight weeks (8 mg/kg) has been shown to stimulate neuroprogenitors proliferation in the subventricular zone (SVZ) in a mouse model of Parkinsonism (PMID: 27699087 ). The effect of guanosine treatment is accompanied by an increased number of fibroblast growth factor (FGF-2)-positive cells which is an important regulator of neuroprogenitor/stem cell proliferation, survival and differentiation (PMID: 27699087 ). Guanosine prevents reactive oxygen species (ROS) generation and cell death in hippocampal slices subjected to the oxygen/glucose deprivation (PMID: 31847113 ). |
|---|
| Structure | NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)C(=O)N1 InChI=1S/C10H13N5O5/c11-10-13-7-4(8(19)14-10)12-2-15(7)9-6(18)5(17)3(1-16)20-9/h2-3,5-6,9,16-18H,1H2,(H3,11,13,14,19)/t3-,5-,6-,9-/m1/s1 |
|---|
| Synonyms | | Value | Source |
|---|
| 2(3H)-Imino-9-beta-D-ribofuranosyl-9H-purin-6(1H)-one | ChEBI | | 2-Amino-1,9-dihydro-9-beta-D-ribofuranosyl-6H-purin-6-one | ChEBI | | 2-Amino-9-beta-D-ribofuranosyl-1,9-dihydro-6H-purin-6-one | ChEBI | | 9-beta-D-Ribofuranosyl-guanine | ChEBI | | G | ChEBI | | Guanine riboside | ChEBI | | Guanine-9-beta-D-ribofuranoside | ChEBI | | Guanosin | ChEBI | | Guo | ChEBI | | 2(3H)-Imino-9-b-D-ribofuranosyl-9H-purin-6(1H)-one | Generator | | 2(3H)-Imino-9-β-D-ribofuranosyl-9H-purin-6(1H)-one | Generator | | 2-Amino-1,9-dihydro-9-b-D-ribofuranosyl-6H-purin-6-one | Generator | | 2-Amino-1,9-dihydro-9-β-D-ribofuranosyl-6H-purin-6-one | Generator | | 2-Amino-9-b-D-ribofuranosyl-1,9-dihydro-6H-purin-6-one | Generator | | 2-Amino-9-β-D-ribofuranosyl-1,9-dihydro-6H-purin-6-one | Generator | | 9-b-D-Ribofuranosyl-guanine | Generator | | 9-Β-D-ribofuranosyl-guanine | Generator | | Guanine-9-b-D-ribofuranoside | Generator | | Guanine-9-β-D-ribofuranoside | Generator | | 2-Amino-1,9-dihydro-9-beta-delta-ribofuranosyl-6H-purin-6-one | HMDB | | 2-Amino-inosine | HMDB | | 9-beta-delta-Ribofuranosyl-guanine | HMDB | | b-D-Ribofuranoside guanine-9 | HMDB | | beta-delta-Ribofuranoside guanine-9 | HMDB | | Ribonucleoside | HMDB | | Vernine | HMDB |
|
|---|
| Chemical Formula | C10H13N5O5 |
|---|
| Average Molecular Weight | 283.2407 |
|---|
| Monoisotopic Molecular Weight | 283.091668551 |
|---|
| IUPAC Name | 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6,9-dihydro-1H-purin-6-one |
|---|
| Traditional Name | guanosine |
|---|
| CAS Registry Number | 118-00-3 |
|---|
| SMILES | NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)C(=O)N1 |
|---|
| InChI Identifier | InChI=1S/C10H13N5O5/c11-10-13-7-4(8(19)14-10)12-2-15(7)9-6(18)5(17)3(1-16)20-9/h2-3,5-6,9,16-18H,1H2,(H3,11,13,14,19)/t3-,5-,6-,9-/m1/s1 |
|---|
| InChI Key | NYHBQMYGNKIUIF-UUOKFMHZSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as purine nucleosides. Purine nucleosides are compounds comprising a purine base attached to a ribosyl or deoxyribosyl moiety. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Nucleosides, nucleotides, and analogues |
|---|
| Class | Purine nucleosides |
|---|
| Sub Class | Not Available |
|---|
| Direct Parent | Purine nucleosides |
|---|
| Alternative Parents | |
|---|
| Substituents | - Purine nucleoside
- Glycosyl compound
- N-glycosyl compound
- Pentose monosaccharide
- Imidazopyrimidine
- Purine
- Hydroxypyrimidine
- Monosaccharide
- N-substituted imidazole
- Pyrimidine
- Heteroaromatic compound
- Azole
- Imidazole
- Tetrahydrofuran
- Secondary alcohol
- Azacycle
- Oxacycle
- Organoheterocyclic compound
- Primary alcohol
- Organopnictogen compound
- Organooxygen compound
- Organonitrogen compound
- Alcohol
- Hydrocarbon derivative
- Organic oxygen compound
- Organic nitrogen compound
- Aromatic heteropolycyclic compound
|
|---|
| Molecular Framework | Aromatic heteropolycyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Not Available | Not Available |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | 239 °C | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | 0.7 mg/mL at 18 °C | Not Available | | LogP | -1.90 | SANGSTER (1993) |
|
|---|
| Experimental Chromatographic Properties | Experimental Collision Cross Sections |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 1.77 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 9.7291 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 6.21 minutes | 32390414 | | AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid | 258.9 seconds | 40023050 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 652.7 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 256.0 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 50.8 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 158.3 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 59.7 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 325.8 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 262.6 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 724.0 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 592.0 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 73.4 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 824.9 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 178.2 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 198.5 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 720.4 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 396.1 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 322.4 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Guanosine,1TMS,isomer #1 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O | 2775.1 | Semi standard non polar | 33892256 | | Guanosine,1TMS,isomer #2 | C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@@H]1O | 2792.0 | Semi standard non polar | 33892256 | | Guanosine,1TMS,isomer #3 | C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C=NC2=C1N=C(N)[NH]C2=O | 2783.9 | Semi standard non polar | 33892256 | | Guanosine,1TMS,isomer #4 | C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)C(=O)[NH]1 | 2817.6 | Semi standard non polar | 33892256 | | Guanosine,1TMS,isomer #5 | C[Si](C)(C)N1C(N)=NC2=C(N=CN2[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)C1=O | 2845.9 | Semi standard non polar | 33892256 | | Guanosine,2TMS,isomer #1 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O | 2713.5 | Semi standard non polar | 33892256 | | Guanosine,2TMS,isomer #10 | C[Si](C)(C)N(C1=NC2=C(N=CN2[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)C(=O)[NH]1)[Si](C)(C)C | 2710.3 | Semi standard non polar | 33892256 | | Guanosine,2TMS,isomer #11 | C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C | 2818.7 | Semi standard non polar | 33892256 | | Guanosine,2TMS,isomer #2 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O[Si](C)(C)C | 2714.7 | Semi standard non polar | 33892256 | | Guanosine,2TMS,isomer #3 | C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1 | 2716.0 | Semi standard non polar | 33892256 | | Guanosine,2TMS,isomer #4 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@H](O)[C@@H]1O | 2792.8 | Semi standard non polar | 33892256 | | Guanosine,2TMS,isomer #5 | C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@@H]1O[Si](C)(C)C | 2715.9 | Semi standard non polar | 33892256 | | Guanosine,2TMS,isomer #6 | C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)[NH]1 | 2727.2 | Semi standard non polar | 33892256 | | Guanosine,2TMS,isomer #7 | C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@@H]1O | 2803.2 | Semi standard non polar | 33892256 | | Guanosine,2TMS,isomer #8 | C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)[NH]1 | 2725.7 | Semi standard non polar | 33892256 | | Guanosine,2TMS,isomer #9 | C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C=NC2=C1N=C(N)N([Si](C)(C)C)C2=O | 2799.7 | Semi standard non polar | 33892256 | | Guanosine,3TMS,isomer #1 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C | 2659.8 | Semi standard non polar | 33892256 | | Guanosine,3TMS,isomer #10 | C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C3=O)[C@@H]1O | 2710.5 | Semi standard non polar | 33892256 | | Guanosine,3TMS,isomer #11 | C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)N1[Si](C)(C)C | 2781.0 | Semi standard non polar | 33892256 | | Guanosine,3TMS,isomer #12 | C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C=NC2=C1N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C2=O | 2701.3 | Semi standard non polar | 33892256 | | Guanosine,3TMS,isomer #13 | C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)N1[Si](C)(C)C | 2780.1 | Semi standard non polar | 33892256 | | Guanosine,3TMS,isomer #14 | C[Si](C)(C)N(C1=NC2=C(N=CN2[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C)[Si](C)(C)C | 2819.9 | Semi standard non polar | 33892256 | | Guanosine,3TMS,isomer #2 | C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)[NH]1 | 2674.4 | Semi standard non polar | 33892256 | | Guanosine,3TMS,isomer #3 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O | 2747.0 | Semi standard non polar | 33892256 | | Guanosine,3TMS,isomer #4 | C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)[NH]1 | 2672.2 | Semi standard non polar | 33892256 | | Guanosine,3TMS,isomer #5 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@H](O)[C@@H]1O[Si](C)(C)C | 2751.7 | Semi standard non polar | 33892256 | | Guanosine,3TMS,isomer #6 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C3=O)[C@H](O)[C@@H]1O | 2701.2 | Semi standard non polar | 33892256 | | Guanosine,3TMS,isomer #7 | C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C | 2771.6 | Semi standard non polar | 33892256 | | Guanosine,3TMS,isomer #8 | C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C(=O)[NH]1 | 2687.4 | Semi standard non polar | 33892256 | | Guanosine,3TMS,isomer #9 | C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@@H]1O[Si](C)(C)C | 2755.1 | Semi standard non polar | 33892256 | | Guanosine,4TMS,isomer #1 | C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C(=O)[NH]1 | 2706.0 | Semi standard non polar | 33892256 | | Guanosine,4TMS,isomer #1 | C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C(=O)[NH]1 | 2904.1 | Standard non polar | 33892256 | | Guanosine,4TMS,isomer #1 | C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C(=O)[NH]1 | 3779.6 | Standard polar | 33892256 | | Guanosine,4TMS,isomer #10 | C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C3=O)[C@@H]1O | 2821.9 | Semi standard non polar | 33892256 | | Guanosine,4TMS,isomer #10 | C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C3=O)[C@@H]1O | 3027.5 | Standard non polar | 33892256 | | Guanosine,4TMS,isomer #10 | C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C3=O)[C@@H]1O | 3613.7 | Standard polar | 33892256 | | Guanosine,4TMS,isomer #11 | C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C=NC2=C1N=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C2=O | 2828.3 | Semi standard non polar | 33892256 | | Guanosine,4TMS,isomer #11 | C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C=NC2=C1N=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C2=O | 3035.2 | Standard non polar | 33892256 | | Guanosine,4TMS,isomer #11 | C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C=NC2=C1N=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C2=O | 3661.9 | Standard polar | 33892256 | | Guanosine,4TMS,isomer #2 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C | 2746.7 | Semi standard non polar | 33892256 | | Guanosine,4TMS,isomer #2 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C | 2829.6 | Standard non polar | 33892256 | | Guanosine,4TMS,isomer #2 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C | 4060.0 | Standard polar | 33892256 | | Guanosine,4TMS,isomer #3 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O | 2726.5 | Semi standard non polar | 33892256 | | Guanosine,4TMS,isomer #3 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O | 3011.6 | Standard non polar | 33892256 | | Guanosine,4TMS,isomer #3 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O | 3683.4 | Standard polar | 33892256 | | Guanosine,4TMS,isomer #4 | C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)N1[Si](C)(C)C | 2777.3 | Semi standard non polar | 33892256 | | Guanosine,4TMS,isomer #4 | C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)N1[Si](C)(C)C | 2916.7 | Standard non polar | 33892256 | | Guanosine,4TMS,isomer #4 | C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)N1[Si](C)(C)C | 3769.3 | Standard polar | 33892256 | | Guanosine,4TMS,isomer #5 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C3=O)[C@H](O)[C@@H]1O[Si](C)(C)C | 2724.5 | Semi standard non polar | 33892256 | | Guanosine,4TMS,isomer #5 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C3=O)[C@H](O)[C@@H]1O[Si](C)(C)C | 2994.7 | Standard non polar | 33892256 | | Guanosine,4TMS,isomer #5 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C3=O)[C@H](O)[C@@H]1O[Si](C)(C)C | 3633.1 | Standard polar | 33892256 | | Guanosine,4TMS,isomer #6 | C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)N1[Si](C)(C)C | 2776.2 | Semi standard non polar | 33892256 | | Guanosine,4TMS,isomer #6 | C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)N1[Si](C)(C)C | 2897.5 | Standard non polar | 33892256 | | Guanosine,4TMS,isomer #6 | C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)N1[Si](C)(C)C | 3718.7 | Standard polar | 33892256 | | Guanosine,4TMS,isomer #7 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C3=O)[C@H](O)[C@@H]1O | 2802.6 | Semi standard non polar | 33892256 | | Guanosine,4TMS,isomer #7 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C3=O)[C@H](O)[C@@H]1O | 3049.8 | Standard non polar | 33892256 | | Guanosine,4TMS,isomer #7 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C3=O)[C@H](O)[C@@H]1O | 3757.3 | Standard polar | 33892256 | | Guanosine,4TMS,isomer #8 | C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C3=O)[C@@H]1O[Si](C)(C)C | 2737.9 | Semi standard non polar | 33892256 | | Guanosine,4TMS,isomer #8 | C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C3=O)[C@@H]1O[Si](C)(C)C | 3002.3 | Standard non polar | 33892256 | | Guanosine,4TMS,isomer #8 | C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C3=O)[C@@H]1O[Si](C)(C)C | 3608.9 | Standard polar | 33892256 | | Guanosine,4TMS,isomer #9 | C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C(=O)N1[Si](C)(C)C | 2789.1 | Semi standard non polar | 33892256 | | Guanosine,4TMS,isomer #9 | C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C(=O)N1[Si](C)(C)C | 2910.5 | Standard non polar | 33892256 | | Guanosine,4TMS,isomer #9 | C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C(=O)N1[Si](C)(C)C | 3698.3 | Standard polar | 33892256 | | Guanosine,5TMS,isomer #1 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C | 2793.5 | Semi standard non polar | 33892256 | | Guanosine,5TMS,isomer #1 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C | 2981.0 | Standard non polar | 33892256 | | Guanosine,5TMS,isomer #1 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C | 3401.7 | Standard polar | 33892256 | | Guanosine,5TMS,isomer #2 | C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C(=O)N1[Si](C)(C)C | 2806.3 | Semi standard non polar | 33892256 | | Guanosine,5TMS,isomer #2 | C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C(=O)N1[Si](C)(C)C | 2883.6 | Standard non polar | 33892256 | | Guanosine,5TMS,isomer #2 | C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C(=O)N1[Si](C)(C)C | 3481.8 | Standard polar | 33892256 | | Guanosine,5TMS,isomer #3 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O | 2846.5 | Semi standard non polar | 33892256 | | Guanosine,5TMS,isomer #3 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O | 3023.6 | Standard non polar | 33892256 | | Guanosine,5TMS,isomer #3 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O | 3420.1 | Standard polar | 33892256 | | Guanosine,5TMS,isomer #4 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C3=O)[C@H](O)[C@@H]1O[Si](C)(C)C | 2844.6 | Semi standard non polar | 33892256 | | Guanosine,5TMS,isomer #4 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C3=O)[C@H](O)[C@@H]1O[Si](C)(C)C | 3001.9 | Standard non polar | 33892256 | | Guanosine,5TMS,isomer #4 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C3=O)[C@H](O)[C@@H]1O[Si](C)(C)C | 3374.6 | Standard polar | 33892256 | | Guanosine,5TMS,isomer #5 | C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C3=O)[C@@H]1O[Si](C)(C)C | 2869.4 | Semi standard non polar | 33892256 | | Guanosine,5TMS,isomer #5 | C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C3=O)[C@@H]1O[Si](C)(C)C | 3024.2 | Standard non polar | 33892256 | | Guanosine,5TMS,isomer #5 | C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C3=O)[C@@H]1O[Si](C)(C)C | 3351.9 | Standard polar | 33892256 | | Guanosine,6TMS,isomer #1 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C | 2896.8 | Semi standard non polar | 33892256 | | Guanosine,6TMS,isomer #1 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C | 2982.9 | Standard non polar | 33892256 | | Guanosine,6TMS,isomer #1 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C | 3189.8 | Standard polar | 33892256 | | Guanosine,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O | 3013.0 | Semi standard non polar | 33892256 | | Guanosine,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@@H]1O | 3008.7 | Semi standard non polar | 33892256 | | Guanosine,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C=NC2=C1N=C(N)[NH]C2=O | 3011.5 | Semi standard non polar | 33892256 | | Guanosine,1TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)C(=O)[NH]1 | 3017.6 | Semi standard non polar | 33892256 | | Guanosine,1TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)N1C(N)=NC2=C(N=CN2[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)C1=O | 3035.5 | Semi standard non polar | 33892256 | | Guanosine,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O | 3135.0 | Semi standard non polar | 33892256 | | Guanosine,2TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)N(C1=NC2=C(N=CN2[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)C(=O)[NH]1)[Si](C)(C)C(C)(C)C | 3142.5 | Semi standard non polar | 33892256 | | Guanosine,2TBDMS,isomer #11 | CC(C)(C)[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C(C)(C)C | 3224.5 | Semi standard non polar | 33892256 | | Guanosine,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C | 3123.9 | Semi standard non polar | 33892256 | | Guanosine,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1 | 3145.3 | Semi standard non polar | 33892256 | | Guanosine,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C(C)(C)C)C3=O)[C@H](O)[C@@H]1O | 3219.4 | Semi standard non polar | 33892256 | | Guanosine,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@@H]1O[Si](C)(C)C(C)(C)C | 3111.6 | Semi standard non polar | 33892256 | | Guanosine,2TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)C(=O)[NH]1 | 3133.0 | Semi standard non polar | 33892256 | | Guanosine,2TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C(C)(C)C)C3=O)[C@@H]1O | 3222.4 | Semi standard non polar | 33892256 | | Guanosine,2TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)C(=O)[NH]1 | 3129.3 | Semi standard non polar | 33892256 | | Guanosine,2TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C=NC2=C1N=C(N)N([Si](C)(C)C(C)(C)C)C2=O | 3210.2 | Semi standard non polar | 33892256 | | Guanosine,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C | 3270.0 | Semi standard non polar | 33892256 | | Guanosine,3TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]C3=O)[C@@H]1O | 3308.4 | Semi standard non polar | 33892256 | | Guanosine,3TBDMS,isomer #11 | CC(C)(C)[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)C(=O)N1[Si](C)(C)C(C)(C)C | 3400.6 | Semi standard non polar | 33892256 | | Guanosine,3TBDMS,isomer #12 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C=NC2=C1N=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]C2=O | 3304.5 | Semi standard non polar | 33892256 | | Guanosine,3TBDMS,isomer #13 | CC(C)(C)[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C | 3393.6 | Semi standard non polar | 33892256 | | Guanosine,3TBDMS,isomer #14 | CC(C)(C)[Si](C)(C)N(C1=NC2=C(N=CN2[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3405.4 | Semi standard non polar | 33892256 | | Guanosine,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)C(=O)[NH]1 | 3308.3 | Semi standard non polar | 33892256 | | Guanosine,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C(C)(C)C)C3=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O | 3406.8 | Semi standard non polar | 33892256 | | Guanosine,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)C(=O)[NH]1 | 3306.2 | Semi standard non polar | 33892256 | | Guanosine,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C(C)(C)C)C3=O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C | 3406.5 | Semi standard non polar | 33892256 | | Guanosine,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]C3=O)[C@H](O)[C@@H]1O | 3306.5 | Semi standard non polar | 33892256 | | Guanosine,3TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C(C)(C)C | 3405.3 | Semi standard non polar | 33892256 | | Guanosine,3TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)C(=O)[NH]1 | 3274.1 | Semi standard non polar | 33892256 | | Guanosine,3TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C(C)(C)C)C3=O)[C@@H]1O[Si](C)(C)C(C)(C)C | 3391.9 | Semi standard non polar | 33892256 | | Guanosine,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)C(=O)[NH]1 | 3483.2 | Semi standard non polar | 33892256 | | Guanosine,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)C(=O)[NH]1 | 3676.1 | Standard non polar | 33892256 | | Guanosine,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)C(=O)[NH]1 | 3945.1 | Standard polar | 33892256 | | Guanosine,4TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C3=O)[C@@H]1O | 3574.9 | Semi standard non polar | 33892256 | | Guanosine,4TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C3=O)[C@@H]1O | 3784.3 | Standard non polar | 33892256 | | Guanosine,4TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C3=O)[C@@H]1O | 3782.9 | Standard polar | 33892256 | | Guanosine,4TBDMS,isomer #11 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C=NC2=C1N=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C2=O | 3578.7 | Semi standard non polar | 33892256 | | Guanosine,4TBDMS,isomer #11 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C=NC2=C1N=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C2=O | 3796.9 | Standard non polar | 33892256 | | Guanosine,4TBDMS,isomer #11 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C=NC2=C1N=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C2=O | 3814.3 | Standard polar | 33892256 | | Guanosine,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C(C)(C)C)C3=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C | 3585.1 | Semi standard non polar | 33892256 | | Guanosine,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C(C)(C)C)C3=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C | 3586.9 | Standard non polar | 33892256 | | Guanosine,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C(C)(C)C)C3=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C | 4131.2 | Standard polar | 33892256 | | Guanosine,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]C3=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O | 3477.8 | Semi standard non polar | 33892256 | | Guanosine,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]C3=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O | 3773.3 | Standard non polar | 33892256 | | Guanosine,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]C3=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O | 3851.8 | Standard polar | 33892256 | | Guanosine,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C | 3575.5 | Semi standard non polar | 33892256 | | Guanosine,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C | 3687.0 | Standard non polar | 33892256 | | Guanosine,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C | 3901.7 | Standard polar | 33892256 | | Guanosine,4TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]C3=O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C | 3475.3 | Semi standard non polar | 33892256 | | Guanosine,4TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]C3=O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C | 3753.5 | Standard non polar | 33892256 | | Guanosine,4TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]C3=O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C | 3819.5 | Standard polar | 33892256 | | Guanosine,4TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)C(=O)N1[Si](C)(C)C(C)(C)C | 3569.6 | Semi standard non polar | 33892256 | | Guanosine,4TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)C(=O)N1[Si](C)(C)C(C)(C)C | 3666.5 | Standard non polar | 33892256 | | Guanosine,4TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)C(=O)N1[Si](C)(C)C(C)(C)C | 3869.3 | Standard polar | 33892256 | | Guanosine,4TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C3=O)[C@H](O)[C@@H]1O | 3580.3 | Semi standard non polar | 33892256 | | Guanosine,4TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C3=O)[C@H](O)[C@@H]1O | 3785.2 | Standard non polar | 33892256 | | Guanosine,4TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C3=O)[C@H](O)[C@@H]1O | 3868.6 | Standard polar | 33892256 | | Guanosine,4TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]C3=O)[C@@H]1O[Si](C)(C)C(C)(C)C | 3466.4 | Semi standard non polar | 33892256 | | Guanosine,4TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]C3=O)[C@@H]1O[Si](C)(C)C(C)(C)C | 3773.8 | Standard non polar | 33892256 | | Guanosine,4TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]C3=O)[C@@H]1O[Si](C)(C)C(C)(C)C | 3800.4 | Standard polar | 33892256 | | Guanosine,4TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C | 3556.3 | Semi standard non polar | 33892256 | | Guanosine,4TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C | 3687.0 | Standard non polar | 33892256 | | Guanosine,4TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C | 3852.2 | Standard polar | 33892256 | | Guanosine,5TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]C3=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C | 3666.5 | Semi standard non polar | 33892256 | | Guanosine,5TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]C3=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C | 3855.0 | Standard non polar | 33892256 | | Guanosine,5TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]C3=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C | 3718.2 | Standard polar | 33892256 | | Guanosine,5TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C | 3728.7 | Semi standard non polar | 33892256 | | Guanosine,5TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C | 3764.3 | Standard non polar | 33892256 | | Guanosine,5TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C | 3793.3 | Standard polar | 33892256 | | Guanosine,5TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C3=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O | 3747.9 | Semi standard non polar | 33892256 | | Guanosine,5TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C3=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O | 3887.1 | Standard non polar | 33892256 | | Guanosine,5TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C3=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O | 3717.3 | Standard polar | 33892256 | | Guanosine,5TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C3=O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C | 3746.0 | Semi standard non polar | 33892256 | | Guanosine,5TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C3=O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C | 3864.5 | Standard non polar | 33892256 | | Guanosine,5TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C3=O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C | 3684.5 | Standard polar | 33892256 | | Guanosine,5TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C3=O)[C@@H]1O[Si](C)(C)C(C)(C)C | 3746.3 | Semi standard non polar | 33892256 | | Guanosine,5TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C3=O)[C@@H]1O[Si](C)(C)C(C)(C)C | 3888.4 | Standard non polar | 33892256 | | Guanosine,5TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C3=O)[C@@H]1O[Si](C)(C)C(C)(C)C | 3668.7 | Standard polar | 33892256 |
|
|---|
| Disease References | | Colorectal cancer |
|---|
- Sinha R, Ahn J, Sampson JN, Shi J, Yu G, Xiong X, Hayes RB, Goedert JJ: Fecal Microbiota, Fecal Metabolome, and Colorectal Cancer Interrelations. PLoS One. 2016 Mar 25;11(3):e0152126. doi: 10.1371/journal.pone.0152126. eCollection 2016. [PubMed:27015276 ]
- Brown DG, Rao S, Weir TL, O'Malia J, Bazan M, Brown RJ, Ryan EP: Metabolomics and metabolic pathway networks from human colorectal cancers, adjacent mucosa, and stool. Cancer Metab. 2016 Jun 6;4:11. doi: 10.1186/s40170-016-0151-y. eCollection 2016. [PubMed:27275383 ]
- Goedert JJ, Sampson JN, Moore SC, Xiao Q, Xiong X, Hayes RB, Ahn J, Shi J, Sinha R: Fecal metabolomics: assay performance and association with colorectal cancer. Carcinogenesis. 2014 Sep;35(9):2089-96. doi: 10.1093/carcin/bgu131. Epub 2014 Jul 18. [PubMed:25037050 ]
| | Crohn's disease |
|---|
- Kolho KL, Pessia A, Jaakkola T, de Vos WM, Velagapudi V: Faecal and Serum Metabolomics in Paediatric Inflammatory Bowel Disease. J Crohns Colitis. 2017 Mar 1;11(3):321-334. doi: 10.1093/ecco-jcc/jjw158. [PubMed:27609529 ]
| | Ulcerative colitis |
|---|
- Kolho KL, Pessia A, Jaakkola T, de Vos WM, Velagapudi V: Faecal and Serum Metabolomics in Paediatric Inflammatory Bowel Disease. J Crohns Colitis. 2017 Mar 1;11(3):321-334. doi: 10.1093/ecco-jcc/jjw158. [PubMed:27609529 ]
| | Attachment loss |
|---|
- Liebsch C, Pitchika V, Pink C, Samietz S, Kastenmuller G, Artati A, Suhre K, Adamski J, Nauck M, Volzke H, Friedrich N, Kocher T, Holtfreter B, Pietzner M: The Saliva Metabolome in Association to Oral Health Status. J Dent Res. 2019 Jun;98(6):642-651. doi: 10.1177/0022034519842853. Epub 2019 Apr 26. [PubMed:31026179 ]
| | Periodontal Probing Depth |
|---|
- Liebsch C, Pitchika V, Pink C, Samietz S, Kastenmuller G, Artati A, Suhre K, Adamski J, Nauck M, Volzke H, Friedrich N, Kocher T, Holtfreter B, Pietzner M: The Saliva Metabolome in Association to Oral Health Status. J Dent Res. 2019 Jun;98(6):642-651. doi: 10.1177/0022034519842853. Epub 2019 Apr 26. [PubMed:31026179 ]
| | Tooth Decay |
|---|
- Liebsch C, Pitchika V, Pink C, Samietz S, Kastenmuller G, Artati A, Suhre K, Adamski J, Nauck M, Volzke H, Friedrich N, Kocher T, Holtfreter B, Pietzner M: The Saliva Metabolome in Association to Oral Health Status. J Dent Res. 2019 Jun;98(6):642-651. doi: 10.1177/0022034519842853. Epub 2019 Apr 26. [PubMed:31026179 ]
| | Purine nucleoside phosphorylase deficiency |
|---|
- Wevers RA, Engelke UF, Moolenaar SH, Brautigam C, de Jong JG, Duran R, de Abreu RA, van Gennip AH: 1H-NMR spectroscopy of body fluids: inborn errors of purine and pyrimidine metabolism. Clin Chem. 1999 Apr;45(4):539-48. [PubMed:10102915 ]
| | Eosinophilic esophagitis |
|---|
- Slae, M., Huynh, H., Wishart, D.S. (2014). Analysis of 30 normal pediatric urine samples via NMR spectroscopy (unpublished work). NA.
|
|
|---|
| General References | - Sreekumar A, Poisson LM, Rajendiran TM, Khan AP, Cao Q, Yu J, Laxman B, Mehra R, Lonigro RJ, Li Y, Nyati MK, Ahsan A, Kalyana-Sundaram S, Han B, Cao X, Byun J, Omenn GS, Ghosh D, Pennathur S, Alexander DC, Berger A, Shuster JR, Wei JT, Varambally S, Beecher C, Chinnaiyan AM: Metabolomic profiles delineate potential role for sarcosine in prostate cancer progression. Nature. 2009 Feb 12;457(7231):910-4. doi: 10.1038/nature07762. [PubMed:19212411 ]
- Lee SH, Jung BH, Kim SY, Chung BC: A rapid and sensitive method for quantitation of nucleosides in human urine using liquid chromatography/mass spectrometry with direct urine injection. Rapid Commun Mass Spectrom. 2004;18(9):973-7. [PubMed:15116424 ]
- Traut TW: Physiological concentrations of purines and pyrimidines. Mol Cell Biochem. 1994 Nov 9;140(1):1-22. [PubMed:7877593 ]
- Wevers RA, Engelke UF, Moolenaar SH, Brautigam C, de Jong JG, Duran R, de Abreu RA, van Gennip AH: 1H-NMR spectroscopy of body fluids: inborn errors of purine and pyrimidine metabolism. Clin Chem. 1999 Apr;45(4):539-48. [PubMed:10102915 ]
- Hartwick RA, Krstulovic AM, Brown PR: Identification and quantitation of nucleosides, bases and other UV-absorbing compounds in serum, using reversed-phase high-performance liquid chromatography. II. Evaluation of human sera. J Chromatogr. 1979 Dec 30;186:659-76. [PubMed:546939 ]
- Saute JA, da Silveira LE, Soares FA, Martini LH, Souza DO, Ganzella M: Amnesic effect of GMP depends on its conversion to guanosine. Neurobiol Learn Mem. 2006 May;85(3):206-12. Epub 2005 Dec 1. [PubMed:16325434 ]
- Elshenawy S, Pinney SE, Stuart T, Doulias PT, Zura G, Parry S, Elovitz MA, Bennett MJ, Bansal A, Strauss JF 3rd, Ischiropoulos H, Simmons RA: The Metabolomic Signature of the Placenta in Spontaneous Preterm Birth. Int J Mol Sci. 2020 Feb 4;21(3). pii: ijms21031043. doi: 10.3390/ijms21031043. [PubMed:32033212 ]
- Lanznaster D, Massari CM, Markova V, Simkova T, Duroux R, Jacobson KA, Fernandez-Duenas V, Tasca CI, Ciruela F: Adenosine A1-A2A Receptor-Receptor Interaction: Contribution to Guanosine-Mediated Effects. Cells. 2019 Dec 13;8(12). pii: cells8121630. doi: 10.3390/cells8121630. [PubMed:31847113 ]
- Lanznaster D, Dal-Cim T, Piermartiri TC, Tasca CI: Guanosine: a Neuromodulator with Therapeutic Potential in Brain Disorders. Aging Dis. 2016 Oct 1;7(5):657-679. doi: 10.14336/AD.2016.0208. eCollection 2016 Oct. [PubMed:27699087 ]
|
|---|