| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 1.27 minutes | 32390414 |
| Predicted by Siyang on May 30, 2022 | 9.6579 minutes | 33406817 |
| Predicted by Siyang using ReTip algorithm on June 8, 2022 | 4.53 minutes | 32390414 |
| AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid | 143.5 seconds | 40023050 |
| Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 475.0 seconds | 40023050 |
| Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 370.3 seconds | 40023050 |
| Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 46.9 seconds | 40023050 |
| Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 252.9 seconds | 40023050 |
| RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 143.2 seconds | 40023050 |
| Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 306.1 seconds | 40023050 |
| BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 252.6 seconds | 40023050 |
| HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 475.9 seconds | 40023050 |
| UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 629.7 seconds | 40023050 |
| BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 47.0 seconds | 40023050 |
| UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 637.8 seconds | 40023050 |
| SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 220.1 seconds | 40023050 |
| RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 365.5 seconds | 40023050 |
| MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 618.6 seconds | 40023050 |
| KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 288.4 seconds | 40023050 |
| Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 240.9 seconds | 40023050 |
| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| 2-Hydroxyadenine,1TMS,isomer #1 | C[Si](C)(C)OC1=NC(N)=C2[NH]C=NC2=N1 | 2019.2 | Semi standard non polar | 33892256 |
| 2-Hydroxyadenine,1TMS,isomer #2 | C[Si](C)(C)NC1=NC(O)=NC2=C1[NH]C=N2 | 2196.1 | Semi standard non polar | 33892256 |
| 2-Hydroxyadenine,1TMS,isomer #3 | C[Si](C)(C)N1C=NC2=NC(O)=NC(N)=C21 | 2089.7 | Semi standard non polar | 33892256 |
| 2-Hydroxyadenine,2TMS,isomer #1 | C[Si](C)(C)NC1=NC(O[Si](C)(C)C)=NC2=C1[NH]C=N2 | 2053.7 | Semi standard non polar | 33892256 |
| 2-Hydroxyadenine,2TMS,isomer #1 | C[Si](C)(C)NC1=NC(O[Si](C)(C)C)=NC2=C1[NH]C=N2 | 2079.9 | Standard non polar | 33892256 |
| 2-Hydroxyadenine,2TMS,isomer #1 | C[Si](C)(C)NC1=NC(O[Si](C)(C)C)=NC2=C1[NH]C=N2 | 3114.7 | Standard polar | 33892256 |
| 2-Hydroxyadenine,2TMS,isomer #2 | C[Si](C)(C)OC1=NC(N)=C2C(=N1)N=CN2[Si](C)(C)C | 2097.0 | Semi standard non polar | 33892256 |
| 2-Hydroxyadenine,2TMS,isomer #2 | C[Si](C)(C)OC1=NC(N)=C2C(=N1)N=CN2[Si](C)(C)C | 2017.9 | Standard non polar | 33892256 |
| 2-Hydroxyadenine,2TMS,isomer #2 | C[Si](C)(C)OC1=NC(N)=C2C(=N1)N=CN2[Si](C)(C)C | 2778.8 | Standard polar | 33892256 |
| 2-Hydroxyadenine,2TMS,isomer #3 | C[Si](C)(C)N(C1=NC(O)=NC2=C1[NH]C=N2)[Si](C)(C)C | 2119.4 | Semi standard non polar | 33892256 |
| 2-Hydroxyadenine,2TMS,isomer #3 | C[Si](C)(C)N(C1=NC(O)=NC2=C1[NH]C=N2)[Si](C)(C)C | 2143.8 | Standard non polar | 33892256 |
| 2-Hydroxyadenine,2TMS,isomer #3 | C[Si](C)(C)N(C1=NC(O)=NC2=C1[NH]C=N2)[Si](C)(C)C | 2843.2 | Standard polar | 33892256 |
| 2-Hydroxyadenine,2TMS,isomer #4 | C[Si](C)(C)NC1=NC(O)=NC2=C1N([Si](C)(C)C)C=N2 | 2183.1 | Semi standard non polar | 33892256 |
| 2-Hydroxyadenine,2TMS,isomer #4 | C[Si](C)(C)NC1=NC(O)=NC2=C1N([Si](C)(C)C)C=N2 | 2061.1 | Standard non polar | 33892256 |
| 2-Hydroxyadenine,2TMS,isomer #4 | C[Si](C)(C)NC1=NC(O)=NC2=C1N([Si](C)(C)C)C=N2 | 2683.7 | Standard polar | 33892256 |
| 2-Hydroxyadenine,3TMS,isomer #1 | C[Si](C)(C)OC1=NC(N([Si](C)(C)C)[Si](C)(C)C)=C2[NH]C=NC2=N1 | 2029.2 | Semi standard non polar | 33892256 |
| 2-Hydroxyadenine,3TMS,isomer #1 | C[Si](C)(C)OC1=NC(N([Si](C)(C)C)[Si](C)(C)C)=C2[NH]C=NC2=N1 | 2137.1 | Standard non polar | 33892256 |
| 2-Hydroxyadenine,3TMS,isomer #1 | C[Si](C)(C)OC1=NC(N([Si](C)(C)C)[Si](C)(C)C)=C2[NH]C=NC2=N1 | 2698.5 | Standard polar | 33892256 |
| 2-Hydroxyadenine,3TMS,isomer #2 | C[Si](C)(C)NC1=NC(O[Si](C)(C)C)=NC2=C1N([Si](C)(C)C)C=N2 | 2111.2 | Semi standard non polar | 33892256 |
| 2-Hydroxyadenine,3TMS,isomer #2 | C[Si](C)(C)NC1=NC(O[Si](C)(C)C)=NC2=C1N([Si](C)(C)C)C=N2 | 2006.2 | Standard non polar | 33892256 |
| 2-Hydroxyadenine,3TMS,isomer #2 | C[Si](C)(C)NC1=NC(O[Si](C)(C)C)=NC2=C1N([Si](C)(C)C)C=N2 | 2677.6 | Standard polar | 33892256 |
| 2-Hydroxyadenine,3TMS,isomer #3 | C[Si](C)(C)N(C1=NC(O)=NC2=C1N([Si](C)(C)C)C=N2)[Si](C)(C)C | 2128.3 | Semi standard non polar | 33892256 |
| 2-Hydroxyadenine,3TMS,isomer #3 | C[Si](C)(C)N(C1=NC(O)=NC2=C1N([Si](C)(C)C)C=N2)[Si](C)(C)C | 2196.1 | Standard non polar | 33892256 |
| 2-Hydroxyadenine,3TMS,isomer #3 | C[Si](C)(C)N(C1=NC(O)=NC2=C1N([Si](C)(C)C)C=N2)[Si](C)(C)C | 2457.0 | Standard polar | 33892256 |
| 2-Hydroxyadenine,4TMS,isomer #1 | C[Si](C)(C)OC1=NC(N([Si](C)(C)C)[Si](C)(C)C)=C2C(=N1)N=CN2[Si](C)(C)C | 2106.8 | Semi standard non polar | 33892256 |
| 2-Hydroxyadenine,4TMS,isomer #1 | C[Si](C)(C)OC1=NC(N([Si](C)(C)C)[Si](C)(C)C)=C2C(=N1)N=CN2[Si](C)(C)C | 2127.9 | Standard non polar | 33892256 |
| 2-Hydroxyadenine,4TMS,isomer #1 | C[Si](C)(C)OC1=NC(N([Si](C)(C)C)[Si](C)(C)C)=C2C(=N1)N=CN2[Si](C)(C)C | 2421.8 | Standard polar | 33892256 |
| 2-Hydroxyadenine,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC1=NC(N)=C2[NH]C=NC2=N1 | 2280.3 | Semi standard non polar | 33892256 |
| 2-Hydroxyadenine,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NC1=NC(O)=NC2=C1[NH]C=N2 | 2403.6 | Semi standard non polar | 33892256 |
| 2-Hydroxyadenine,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N1C=NC2=NC(O)=NC(N)=C21 | 2359.7 | Semi standard non polar | 33892256 |
| 2-Hydroxyadenine,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NC1=NC(O[Si](C)(C)C(C)(C)C)=NC2=C1[NH]C=N2 | 2482.1 | Semi standard non polar | 33892256 |
| 2-Hydroxyadenine,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NC1=NC(O[Si](C)(C)C(C)(C)C)=NC2=C1[NH]C=N2 | 2439.3 | Standard non polar | 33892256 |
| 2-Hydroxyadenine,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NC1=NC(O[Si](C)(C)C(C)(C)C)=NC2=C1[NH]C=N2 | 3148.0 | Standard polar | 33892256 |
| 2-Hydroxyadenine,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC1=NC(N)=C2C(=N1)N=CN2[Si](C)(C)C(C)(C)C | 2497.1 | Semi standard non polar | 33892256 |
| 2-Hydroxyadenine,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC1=NC(N)=C2C(=N1)N=CN2[Si](C)(C)C(C)(C)C | 2377.3 | Standard non polar | 33892256 |
| 2-Hydroxyadenine,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC1=NC(N)=C2C(=N1)N=CN2[Si](C)(C)C(C)(C)C | 2842.2 | Standard polar | 33892256 |
| 2-Hydroxyadenine,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N(C1=NC(O)=NC2=C1[NH]C=N2)[Si](C)(C)C(C)(C)C | 2541.4 | Semi standard non polar | 33892256 |
| 2-Hydroxyadenine,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N(C1=NC(O)=NC2=C1[NH]C=N2)[Si](C)(C)C(C)(C)C | 2568.4 | Standard non polar | 33892256 |
| 2-Hydroxyadenine,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N(C1=NC(O)=NC2=C1[NH]C=N2)[Si](C)(C)C(C)(C)C | 2850.8 | Standard polar | 33892256 |
| 2-Hydroxyadenine,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)NC1=NC(O)=NC2=C1N([Si](C)(C)C(C)(C)C)C=N2 | 2612.2 | Semi standard non polar | 33892256 |
| 2-Hydroxyadenine,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)NC1=NC(O)=NC2=C1N([Si](C)(C)C(C)(C)C)C=N2 | 2458.7 | Standard non polar | 33892256 |
| 2-Hydroxyadenine,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)NC1=NC(O)=NC2=C1N([Si](C)(C)C(C)(C)C)C=N2 | 2754.6 | Standard polar | 33892256 |
| 2-Hydroxyadenine,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC1=NC(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=C2[NH]C=NC2=N1 | 2580.1 | Semi standard non polar | 33892256 |
| 2-Hydroxyadenine,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC1=NC(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=C2[NH]C=NC2=N1 | 2755.1 | Standard non polar | 33892256 |
| 2-Hydroxyadenine,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC1=NC(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=C2[NH]C=NC2=N1 | 2815.1 | Standard polar | 33892256 |
| 2-Hydroxyadenine,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NC1=NC(O[Si](C)(C)C(C)(C)C)=NC2=C1N([Si](C)(C)C(C)(C)C)C=N2 | 2680.3 | Semi standard non polar | 33892256 |
| 2-Hydroxyadenine,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NC1=NC(O[Si](C)(C)C(C)(C)C)=NC2=C1N([Si](C)(C)C(C)(C)C)C=N2 | 2629.2 | Standard non polar | 33892256 |
| 2-Hydroxyadenine,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NC1=NC(O[Si](C)(C)C(C)(C)C)=NC2=C1N([Si](C)(C)C(C)(C)C)C=N2 | 2821.9 | Standard polar | 33892256 |
| 2-Hydroxyadenine,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N(C1=NC(O)=NC2=C1N([Si](C)(C)C(C)(C)C)C=N2)[Si](C)(C)C(C)(C)C | 2744.5 | Semi standard non polar | 33892256 |
| 2-Hydroxyadenine,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N(C1=NC(O)=NC2=C1N([Si](C)(C)C(C)(C)C)C=N2)[Si](C)(C)C(C)(C)C | 2783.7 | Standard non polar | 33892256 |
| 2-Hydroxyadenine,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N(C1=NC(O)=NC2=C1N([Si](C)(C)C(C)(C)C)C=N2)[Si](C)(C)C(C)(C)C | 2666.6 | Standard polar | 33892256 |
| 2-Hydroxyadenine,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC1=NC(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=C2C(=N1)N=CN2[Si](C)(C)C(C)(C)C | 2831.0 | Semi standard non polar | 33892256 |
| 2-Hydroxyadenine,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC1=NC(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=C2C(=N1)N=CN2[Si](C)(C)C(C)(C)C | 2925.6 | Standard non polar | 33892256 |
| 2-Hydroxyadenine,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC1=NC(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=C2C(=N1)N=CN2[Si](C)(C)C(C)(C)C | 2743.6 | Standard polar | 33892256 |