| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Expected but not Quantified |
|---|
| Creation Date | 2008-09-15 16:49:24 UTC |
|---|
| Update Date | 2021-09-14 15:18:59 UTC |
|---|
| HMDB ID | HMDB0010321 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | 3,17-Androstanediol glucuronide |
|---|
| Description | 3,17-Androstanediol glucuronide is a natural human metabolite of 3,17-Androstanediol generated in the liver by UDP glucuonyltransferase. Glucuronidation is used to assist in the excretion of toxic substances, drugs or other substances that cannot be used as an energy source. Glucuronic acid is attached via a glycosidic bond to the substance, and the resulting glucuronide, which has a much higher water solubility than the original substance, is eventually excreted by the kidneys. |
|---|
| Structure | [H][C@@]12CC[C@H](O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC[C@@]2([H])C[C@@H](CC[C@]12C)OC(=O)[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O InChI=1S/C25H40O8/c1-24-9-7-13(32-23(31)21-19(28)18(27)20(29)22(30)33-21)11-12(24)3-4-14-15-5-6-17(26)25(15,2)10-8-16(14)24/h12-22,26-30H,3-11H2,1-2H3/t12-,13+,14-,15-,16-,17-,18-,19-,20+,21-,22+,24-,25-/m0/s1 |
|---|
| Synonyms | | Value | Source |
|---|
| 3-alpha-Androstanediol glucuronide | MeSH | | Androstane-3,17-diol glucuronide, (3beta,5alpha,17beta)-isomer | MeSH | | 3-Hydroxyandrostan-17-yl-glucopyranosiduronic acid | MeSH | | 5-alpha-Androstane-3 alpha,17 beta-diol glucuronide | MeSH | | Androstane-3,17-diol glucuronide, (3alpha,5beta,17beta)-isomer | MeSH | | 3 alpha-Diol g | MeSH | | Androstane-3,17-diol glucuronide | MeSH | | (1S,2S,5R,7S,10R,11S,14S,15S)-14-Hydroxy-2,15-dimethyltetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadecan-5-yl (2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylic acid | Generator | | 3,17-Androstanediol glucuronide | MeSH |
|
|---|
| Chemical Formula | C25H40O8 |
|---|
| Average Molecular Weight | 468.5803 |
|---|
| Monoisotopic Molecular Weight | 468.272318256 |
|---|
| IUPAC Name | (1S,2S,5R,7S,10R,11S,14S,15S)-14-hydroxy-2,15-dimethyltetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadecan-5-yl (2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylate |
|---|
| Traditional Name | (1S,2S,5R,7S,10R,11S,14S,15S)-14-hydroxy-2,15-dimethyltetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadecan-5-yl (2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylate |
|---|
| CAS Registry Number | Not Available |
|---|
| SMILES | [H][C@@]12CC[C@H](O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC[C@@]2([H])C[C@@H](CC[C@]12C)OC(=O)[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O |
|---|
| InChI Identifier | InChI=1S/C25H40O8/c1-24-9-7-13(32-23(31)21-19(28)18(27)20(29)22(30)33-21)11-12(24)3-4-14-15-5-6-17(26)25(15,2)10-8-16(14)24/h12-22,26-30H,3-11H2,1-2H3/t12-,13+,14-,15-,16-,17-,18-,19-,20+,21-,22+,24-,25-/m0/s1 |
|---|
| InChI Key | TWDCYBTXSUNASK-WGGIPMEBSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as steroid esters. Steroid esters are compounds containing a steroid moiety which bears a carboxylic acid ester group. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Lipids and lipid-like molecules |
|---|
| Class | Steroids and steroid derivatives |
|---|
| Sub Class | Steroid esters |
|---|
| Direct Parent | Steroid esters |
|---|
| Alternative Parents | |
|---|
| Substituents | - Steroid ester
- Androstane-skeleton
- Hydroxysteroid
- 17-hydroxysteroid
- Glucuronic acid or derivatives
- Beta-hydroxy acid
- Hydroxy acid
- Monosaccharide
- Oxane
- Pyran
- Cyclic alcohol
- Hemiacetal
- Carboxylic acid ester
- Secondary alcohol
- Monocarboxylic acid or derivatives
- Oxacycle
- Carboxylic acid derivative
- Polyol
- Organoheterocyclic compound
- Organic oxygen compound
- Organooxygen compound
- Alcohol
- Hydrocarbon derivative
- Carbonyl group
- Organic oxide
- Aliphatic heteropolycyclic compound
|
|---|
| Molecular Framework | Aliphatic heteropolycyclic compounds |
|---|
| External Descriptors | Not Available |
|---|
| Ontology |
|---|
| Not Available | Not Available |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. | 5.34 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 13.3212 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 3.77 minutes | 32390414 | | AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid | 112.8 seconds | 40023050 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 2601.3 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 177.5 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 177.8 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 170.3 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 481.0 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 504.3 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 595.5 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 302.8 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 970.4 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 499.3 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1549.2 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 328.0 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 418.5 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 322.2 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 202.8 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 84.8 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| 3,17-Androstanediol glucuronide,1TMS,isomer #1 | C[C@]12CC[C@@H](OC(=O)[C@H]3O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]3O)C[C@@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O[Si](C)(C)C)CC[C@@H]12 | 3892.7 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,1TMS,isomer #2 | C[C@]12CC[C@H]3[C@@H](CC[C@H]4C[C@H](OC(=O)[C@H]5O[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]5O)CC[C@@]43C)[C@@H]1CC[C@@H]2O | 3861.0 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,1TMS,isomer #3 | C[C@]12CC[C@H]3[C@@H](CC[C@H]4C[C@H](OC(=O)[C@H]5O[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]5O)CC[C@@]43C)[C@@H]1CC[C@@H]2O | 3890.3 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,1TMS,isomer #4 | C[C@]12CC[C@H]3[C@@H](CC[C@H]4C[C@H](OC(=O)[C@H]5O[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]5O)CC[C@@]43C)[C@@H]1CC[C@@H]2O | 3875.4 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,1TMS,isomer #5 | C[C@]12CC[C@H]3[C@@H](CC[C@H]4C[C@H](OC(=O)[C@H]5O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]5O[Si](C)(C)C)CC[C@@]43C)[C@@H]1CC[C@@H]2O | 3860.2 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,2TMS,isomer #1 | C[C@]12CC[C@@H](OC(=O)[C@H]3O[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]3O)C[C@@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O[Si](C)(C)C)CC[C@@H]12 | 3842.2 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,2TMS,isomer #10 | C[C@]12CC[C@H]3[C@@H](CC[C@H]4C[C@H](OC(=O)[C@H]5O[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]5O[Si](C)(C)C)CC[C@@]43C)[C@@H]1CC[C@@H]2O | 3828.8 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,2TMS,isomer #2 | C[C@]12CC[C@@H](OC(=O)[C@H]3O[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]3O)C[C@@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O[Si](C)(C)C)CC[C@@H]12 | 3872.9 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,2TMS,isomer #3 | C[C@]12CC[C@@H](OC(=O)[C@H]3O[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]3O)C[C@@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O[Si](C)(C)C)CC[C@@H]12 | 3852.2 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,2TMS,isomer #4 | C[C@]12CC[C@@H](OC(=O)[C@H]3O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]3O[Si](C)(C)C)C[C@@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O[Si](C)(C)C)CC[C@@H]12 | 3841.6 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,2TMS,isomer #5 | C[C@]12CC[C@H]3[C@@H](CC[C@H]4C[C@H](OC(=O)[C@H]5O[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]5O)CC[C@@]43C)[C@@H]1CC[C@@H]2O | 3844.5 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,2TMS,isomer #6 | C[C@]12CC[C@H]3[C@@H](CC[C@H]4C[C@H](OC(=O)[C@H]5O[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]5O)CC[C@@]43C)[C@@H]1CC[C@@H]2O | 3843.9 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,2TMS,isomer #7 | C[C@]12CC[C@H]3[C@@H](CC[C@H]4C[C@H](OC(=O)[C@H]5O[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]5O[Si](C)(C)C)CC[C@@]43C)[C@@H]1CC[C@@H]2O | 3827.1 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,2TMS,isomer #8 | C[C@]12CC[C@H]3[C@@H](CC[C@H]4C[C@H](OC(=O)[C@H]5O[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]5O)CC[C@@]43C)[C@@H]1CC[C@@H]2O | 3866.8 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,2TMS,isomer #9 | C[C@]12CC[C@H]3[C@@H](CC[C@H]4C[C@H](OC(=O)[C@H]5O[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]5O[Si](C)(C)C)CC[C@@]43C)[C@@H]1CC[C@@H]2O | 3861.7 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,3TMS,isomer #1 | C[C@]12CC[C@@H](OC(=O)[C@H]3O[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]3O)C[C@@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O[Si](C)(C)C)CC[C@@H]12 | 3838.1 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,3TMS,isomer #10 | C[C@]12CC[C@H]3[C@@H](CC[C@H]4C[C@H](OC(=O)[C@H]5O[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]5O[Si](C)(C)C)CC[C@@]43C)[C@@H]1CC[C@@H]2O | 3849.2 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,3TMS,isomer #2 | C[C@]12CC[C@@H](OC(=O)[C@H]3O[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]3O)C[C@@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O[Si](C)(C)C)CC[C@@H]12 | 3849.6 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,3TMS,isomer #3 | C[C@]12CC[C@@H](OC(=O)[C@H]3O[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]3O[Si](C)(C)C)C[C@@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O[Si](C)(C)C)CC[C@@H]12 | 3822.1 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,3TMS,isomer #4 | C[C@]12CC[C@@H](OC(=O)[C@H]3O[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3O)C[C@@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O[Si](C)(C)C)CC[C@@H]12 | 3874.3 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,3TMS,isomer #5 | C[C@]12CC[C@@H](OC(=O)[C@H]3O[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]3O[Si](C)(C)C)C[C@@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O[Si](C)(C)C)CC[C@@H]12 | 3852.6 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,3TMS,isomer #6 | C[C@]12CC[C@@H](OC(=O)[C@H]3O[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)C[C@@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O[Si](C)(C)C)CC[C@@H]12 | 3826.0 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,3TMS,isomer #7 | C[C@]12CC[C@H]3[C@@H](CC[C@H]4C[C@H](OC(=O)[C@H]5O[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]5O)CC[C@@]43C)[C@@H]1CC[C@@H]2O | 3867.2 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,3TMS,isomer #8 | C[C@]12CC[C@H]3[C@@H](CC[C@H]4C[C@H](OC(=O)[C@H]5O[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]5O[Si](C)(C)C)CC[C@@]43C)[C@@H]1CC[C@@H]2O | 3845.3 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,3TMS,isomer #9 | C[C@]12CC[C@H]3[C@@H](CC[C@H]4C[C@H](OC(=O)[C@H]5O[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]5O[Si](C)(C)C)CC[C@@]43C)[C@@H]1CC[C@@H]2O | 3845.4 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,4TMS,isomer #1 | C[C@]12CC[C@@H](OC(=O)[C@H]3O[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3O)C[C@@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O[Si](C)(C)C)CC[C@@H]12 | 3862.6 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,4TMS,isomer #2 | C[C@]12CC[C@@H](OC(=O)[C@H]3O[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]3O[Si](C)(C)C)C[C@@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O[Si](C)(C)C)CC[C@@H]12 | 3841.7 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,4TMS,isomer #3 | C[C@]12CC[C@@H](OC(=O)[C@H]3O[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)C[C@@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O[Si](C)(C)C)CC[C@@H]12 | 3849.9 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,4TMS,isomer #4 | C[C@]12CC[C@@H](OC(=O)[C@H]3O[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)C[C@@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O[Si](C)(C)C)CC[C@@H]12 | 3855.4 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,4TMS,isomer #5 | C[C@]12CC[C@H]3[C@@H](CC[C@H]4C[C@H](OC(=O)[C@H]5O[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]5O[Si](C)(C)C)CC[C@@]43C)[C@@H]1CC[C@@H]2O | 3837.2 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,5TMS,isomer #1 | C[C@]12CC[C@@H](OC(=O)[C@H]3O[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)C[C@@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O[Si](C)(C)C)CC[C@@H]12 | 3837.6 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@H]1CC[C@H]2[C@@H]3CC[C@H]4C[C@H](OC(=O)[C@H]5O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]5O)CC[C@]4(C)[C@H]3CC[C@]12C | 4118.8 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)O[C@@H]1O[C@H](C(=O)O[C@@H]2CC[C@@]3(C)[C@@H](CC[C@H]4[C@@H]5CC[C@H](O)[C@@]5(C)CC[C@@H]43)C2)[C@@H](O)[C@H](O)[C@H]1O | 4097.7 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](C(=O)O[C@@H]2CC[C@@]3(C)[C@@H](CC[C@H]4[C@@H]5CC[C@H](O)[C@@]5(C)CC[C@@H]43)C2)O[C@H]1O | 4127.5 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,1TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](C(=O)O[C@@H]2CC[C@@]3(C)[C@@H](CC[C@H]4[C@@H]5CC[C@H](O)[C@@]5(C)CC[C@@H]43)C2)O[C@@H](O)[C@@H]1O | 4114.1 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,1TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](C(=O)O[C@@H]2CC[C@@]3(C)[C@@H](CC[C@H]4[C@@H]5CC[C@H](O)[C@@]5(C)CC[C@@H]43)C2)O[C@@H](O)[C@H](O)[C@H]1O | 4093.1 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@@H]1O[C@H](C(=O)O[C@@H]2CC[C@@]3(C)[C@@H](CC[C@@H]4[C@@H]3CC[C@]3(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]43)C2)[C@@H](O)[C@H](O)[C@H]1O | 4275.8 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,2TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](C(=O)O[C@@H]2CC[C@@]3(C)[C@@H](CC[C@H]4[C@@H]5CC[C@H](O)[C@@]5(C)CC[C@@H]43)C2)O[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 4272.5 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)O[C@H]1CC[C@H]2[C@@H]3CC[C@H]4C[C@H](OC(=O)[C@H]5O[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]5O)CC[C@]4(C)[C@H]3CC[C@]12C | 4311.6 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](C(=O)O[C@@H]2CC[C@@]3(C)[C@@H](CC[C@@H]4[C@@H]3CC[C@]3(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]43)C2)O[C@@H](O)[C@@H]1O | 4295.1 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](C(=O)O[C@@H]2CC[C@@]3(C)[C@@H](CC[C@@H]4[C@@H]3CC[C@]3(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]43)C2)O[C@@H](O)[C@H](O)[C@H]1O | 4271.7 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)O[C@@H]1O[C@H](C(=O)O[C@@H]2CC[C@@]3(C)[C@@H](CC[C@H]4[C@@H]5CC[C@H](O)[C@@]5(C)CC[C@@H]43)C2)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O | 4275.0 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,2TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)O[C@@H]1O[C@H](C(=O)O[C@@H]2CC[C@@]3(C)[C@@H](CC[C@H]4[C@@H]5CC[C@H](O)[C@@]5(C)CC[C@@H]43)C2)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O | 4296.4 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,2TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)O[C@@H]1O[C@H](C(=O)O[C@@H]2CC[C@@]3(C)[C@@H](CC[C@H]4[C@@H]5CC[C@H](O)[C@@]5(C)CC[C@@H]43)C2)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 4283.7 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,2TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](C(=O)O[C@@H]2CC[C@@]3(C)[C@@H](CC[C@H]4[C@@H]5CC[C@H](O)[C@@]5(C)CC[C@@H]43)C2)O[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C | 4311.3 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,2TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](C(=O)O[C@@H]2CC[C@@]3(C)[C@@H](CC[C@H]4[C@@H]5CC[C@H](O)[C@@]5(C)CC[C@@H]43)C2)O[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O | 4308.7 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@@H]1O[C@H](C(=O)O[C@@H]2CC[C@@]3(C)[C@@H](CC[C@@H]4[C@@H]3CC[C@]3(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]43)C2)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O | 4447.3 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,3TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C(=O)O[C@@H]2CC[C@@]3(C)[C@@H](CC[C@H]4[C@@H]5CC[C@H](O)[C@@]5(C)CC[C@@H]43)C2)O[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C | 4473.5 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)O[C@@H]1O[C@H](C(=O)O[C@@H]2CC[C@@]3(C)[C@@H](CC[C@@H]4[C@@H]3CC[C@]3(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]43)C2)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O | 4479.1 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)O[C@@H]1O[C@H](C(=O)O[C@@H]2CC[C@@]3(C)[C@@H](CC[C@@H]4[C@@H]3CC[C@]3(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]43)C2)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 4458.2 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](C(=O)O[C@@H]2CC[C@@]3(C)[C@@H](CC[C@@H]4[C@@H]3CC[C@]3(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]43)C2)O[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C | 4495.7 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](C(=O)O[C@@H]2CC[C@@]3(C)[C@@H](CC[C@@H]4[C@@H]3CC[C@]3(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]43)C2)O[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O | 4491.0 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)O[C@H]1CC[C@H]2[C@@H]3CC[C@H]4C[C@H](OC(=O)[C@H]5O[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]5O[Si](C)(C)C(C)(C)C)CC[C@]4(C)[C@H]3CC[C@]12C | 4453.2 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,3TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)O[C@@H]1O[C@H](C(=O)O[C@@H]2CC[C@@]3(C)[C@@H](CC[C@H]4[C@@H]5CC[C@H](O)[C@@]5(C)CC[C@@H]43)C2)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O | 4463.5 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,3TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](C(=O)O[C@@H]2CC[C@@]3(C)[C@@H](CC[C@H]4[C@@H]5CC[C@H](O)[C@@]5(C)CC[C@@H]43)C2)O[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O | 4464.1 | Semi standard non polar | 33892256 | | 3,17-Androstanediol glucuronide,3TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)O[C@@H]1O[C@H](C(=O)O[C@@H]2CC[C@@]3(C)[C@@H](CC[C@H]4[C@@H]5CC[C@H](O)[C@@]5(C)CC[C@@H]43)C2)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C | 4479.6 | Semi standard non polar | 33892256 |
|
|---|
| GC-MS Spectra| Spectrum Type | Description | Splash Key | Deposition Date | Source | View |
|---|
| Predicted GC-MS | Predicted GC-MS Spectrum - 3,17-Androstanediol glucuronide GC-MS (Non-derivatized) - 70eV, Positive | splash10-0ufr-2252900000-e8b21ec4c59fa25430ab | 2017-09-01 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - 3,17-Androstanediol glucuronide GC-MS (3 TMS) - 70eV, Positive | splash10-01c0-2172009000-a4958380a87f863237f7 | 2017-10-06 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - 3,17-Androstanediol glucuronide GC-MS (Non-derivatized) - 70eV, Positive | Not Available | 2021-10-12 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - 3,17-Androstanediol glucuronide GC-MS (Non-derivatized) - 70eV, Positive | Not Available | 2021-10-12 | Wishart Lab | View Spectrum |
MS/MS Spectra| Spectrum Type | Description | Splash Key | Deposition Date | Source | View |
|---|
| Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 3,17-Androstanediol glucuronide 10V, Positive-QTOF | splash10-0v00-0150900000-0da9bc97749253b33683 | 2016-06-03 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 3,17-Androstanediol glucuronide 20V, Positive-QTOF | splash10-004i-0390300000-769869c73d90594fb8fa | 2016-06-03 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 3,17-Androstanediol glucuronide 40V, Positive-QTOF | splash10-004l-0390000000-ab30d939b842834b10a2 | 2016-06-03 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 3,17-Androstanediol glucuronide 10V, Negative-QTOF | splash10-01bc-2381900000-ddd548b54c8a4bf88f9d | 2016-08-03 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 3,17-Androstanediol glucuronide 20V, Negative-QTOF | splash10-006x-1190100000-744b9dc5e79d1a3e4f64 | 2016-08-03 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 3,17-Androstanediol glucuronide 40V, Negative-QTOF | splash10-0006-2090000000-057254cc12d8b9c61a33 | 2016-08-03 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 3,17-Androstanediol glucuronide 10V, Positive-QTOF | splash10-014i-0310900000-517b004bcf83a149c60a | 2021-09-22 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 3,17-Androstanediol glucuronide 20V, Positive-QTOF | splash10-0a6r-1955700000-9ec79c9a2db226eff76a | 2021-09-22 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 3,17-Androstanediol glucuronide 40V, Positive-QTOF | splash10-0a4i-2619100000-3ed5b3c0d176a46e5643 | 2021-09-22 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 3,17-Androstanediol glucuronide 10V, Negative-QTOF | splash10-014i-0010900000-7ee483c9728f56ae4d62 | 2021-09-22 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 3,17-Androstanediol glucuronide 20V, Negative-QTOF | splash10-014i-3311900000-b3c084f686634bed1729 | 2021-09-22 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 3,17-Androstanediol glucuronide 40V, Negative-QTOF | splash10-0l06-9235300000-443959a6b86b8cc3bd06 | 2021-09-22 | Wishart Lab | View Spectrum |
|
|---|