| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 2.35 minutes | 32390414 |
| Predicted by Siyang on May 30, 2022 | 10.0059 minutes | 33406817 |
| Predicted by Siyang using ReTip algorithm on June 8, 2022 | 8.03 minutes | 32390414 |
| AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid | 284.0 seconds | 40023050 |
| Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 985.2 seconds | 40023050 |
| Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 213.6 seconds | 40023050 |
| Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 100.6 seconds | 40023050 |
| Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 167.8 seconds | 40023050 |
| RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 80.9 seconds | 40023050 |
| Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 279.8 seconds | 40023050 |
| BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 318.2 seconds | 40023050 |
| HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 689.9 seconds | 40023050 |
| UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 674.9 seconds | 40023050 |
| BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 293.3 seconds | 40023050 |
| UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 873.7 seconds | 40023050 |
| SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 193.9 seconds | 40023050 |
| RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 230.7 seconds | 40023050 |
| MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 386.5 seconds | 40023050 |
| KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 367.8 seconds | 40023050 |
| Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 239.6 seconds | 40023050 |
| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Phenylalanylglutamic acid,1TMS,isomer #1 | C[Si](C)(C)OC(=O)CC[C@H](NC(=O)[C@@H](N)CC1=CC=CC=C1)C(=O)O | 2628.0 | Semi standard non polar | 33892256 |
| Phenylalanylglutamic acid,1TMS,isomer #2 | C[Si](C)(C)OC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](N)CC1=CC=CC=C1 | 2582.9 | Semi standard non polar | 33892256 |
| Phenylalanylglutamic acid,1TMS,isomer #3 | C[Si](C)(C)N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H](CCC(=O)O)C(=O)O | 2644.7 | Semi standard non polar | 33892256 |
| Phenylalanylglutamic acid,1TMS,isomer #4 | C[Si](C)(C)N(C(=O)[C@@H](N)CC1=CC=CC=C1)[C@@H](CCC(=O)O)C(=O)O | 2568.5 | Semi standard non polar | 33892256 |
| Phenylalanylglutamic acid,2TMS,isomer #1 | C[Si](C)(C)OC(=O)CC[C@H](NC(=O)[C@@H](N)CC1=CC=CC=C1)C(=O)O[Si](C)(C)C | 2556.9 | Semi standard non polar | 33892256 |
| Phenylalanylglutamic acid,2TMS,isomer #2 | C[Si](C)(C)N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H](CCC(=O)O[Si](C)(C)C)C(=O)O | 2630.4 | Semi standard non polar | 33892256 |
| Phenylalanylglutamic acid,2TMS,isomer #3 | C[Si](C)(C)OC(=O)CC[C@@H](C(=O)O)N(C(=O)[C@@H](N)CC1=CC=CC=C1)[Si](C)(C)C | 2523.6 | Semi standard non polar | 33892256 |
| Phenylalanylglutamic acid,2TMS,isomer #4 | C[Si](C)(C)N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H](CCC(=O)O)C(=O)O[Si](C)(C)C | 2604.2 | Semi standard non polar | 33892256 |
| Phenylalanylglutamic acid,2TMS,isomer #5 | C[Si](C)(C)OC(=O)[C@H](CCC(=O)O)N(C(=O)[C@@H](N)CC1=CC=CC=C1)[Si](C)(C)C | 2532.6 | Semi standard non polar | 33892256 |
| Phenylalanylglutamic acid,2TMS,isomer #6 | C[Si](C)(C)N([C@@H](CC1=CC=CC=C1)C(=O)N[C@@H](CCC(=O)O)C(=O)O)[Si](C)(C)C | 2766.2 | Semi standard non polar | 33892256 |
| Phenylalanylglutamic acid,2TMS,isomer #7 | C[Si](C)(C)N[C@@H](CC1=CC=CC=C1)C(=O)N([C@@H](CCC(=O)O)C(=O)O)[Si](C)(C)C | 2596.0 | Semi standard non polar | 33892256 |
| Phenylalanylglutamic acid,3TMS,isomer #1 | C[Si](C)(C)N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H](CCC(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 2589.7 | Semi standard non polar | 33892256 |
| Phenylalanylglutamic acid,3TMS,isomer #1 | C[Si](C)(C)N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H](CCC(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 2566.0 | Standard non polar | 33892256 |
| Phenylalanylglutamic acid,3TMS,isomer #2 | C[Si](C)(C)OC(=O)CC[C@@H](C(=O)O[Si](C)(C)C)N(C(=O)[C@@H](N)CC1=CC=CC=C1)[Si](C)(C)C | 2490.8 | Semi standard non polar | 33892256 |
| Phenylalanylglutamic acid,3TMS,isomer #2 | C[Si](C)(C)OC(=O)CC[C@@H](C(=O)O[Si](C)(C)C)N(C(=O)[C@@H](N)CC1=CC=CC=C1)[Si](C)(C)C | 2523.2 | Standard non polar | 33892256 |
| Phenylalanylglutamic acid,3TMS,isomer #3 | C[Si](C)(C)OC(=O)CC[C@H](NC(=O)[C@H](CC1=CC=CC=C1)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O | 2739.1 | Semi standard non polar | 33892256 |
| Phenylalanylglutamic acid,3TMS,isomer #3 | C[Si](C)(C)OC(=O)CC[C@H](NC(=O)[C@H](CC1=CC=CC=C1)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O | 2657.5 | Standard non polar | 33892256 |
| Phenylalanylglutamic acid,3TMS,isomer #4 | C[Si](C)(C)N[C@@H](CC1=CC=CC=C1)C(=O)N([C@@H](CCC(=O)O[Si](C)(C)C)C(=O)O)[Si](C)(C)C | 2564.7 | Semi standard non polar | 33892256 |
| Phenylalanylglutamic acid,3TMS,isomer #4 | C[Si](C)(C)N[C@@H](CC1=CC=CC=C1)C(=O)N([C@@H](CCC(=O)O[Si](C)(C)C)C(=O)O)[Si](C)(C)C | 2631.4 | Standard non polar | 33892256 |
| Phenylalanylglutamic acid,3TMS,isomer #5 | C[Si](C)(C)OC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC1=CC=CC=C1)N([Si](C)(C)C)[Si](C)(C)C | 2718.7 | Semi standard non polar | 33892256 |
| Phenylalanylglutamic acid,3TMS,isomer #5 | C[Si](C)(C)OC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC1=CC=CC=C1)N([Si](C)(C)C)[Si](C)(C)C | 2658.0 | Standard non polar | 33892256 |
| Phenylalanylglutamic acid,3TMS,isomer #6 | C[Si](C)(C)N[C@@H](CC1=CC=CC=C1)C(=O)N([C@@H](CCC(=O)O)C(=O)O[Si](C)(C)C)[Si](C)(C)C | 2568.7 | Semi standard non polar | 33892256 |
| Phenylalanylglutamic acid,3TMS,isomer #6 | C[Si](C)(C)N[C@@H](CC1=CC=CC=C1)C(=O)N([C@@H](CCC(=O)O)C(=O)O[Si](C)(C)C)[Si](C)(C)C | 2606.9 | Standard non polar | 33892256 |
| Phenylalanylglutamic acid,3TMS,isomer #7 | C[Si](C)(C)N(C(=O)[C@H](CC1=CC=CC=C1)N([Si](C)(C)C)[Si](C)(C)C)[C@@H](CCC(=O)O)C(=O)O | 2685.0 | Semi standard non polar | 33892256 |
| Phenylalanylglutamic acid,3TMS,isomer #7 | C[Si](C)(C)N(C(=O)[C@H](CC1=CC=CC=C1)N([Si](C)(C)C)[Si](C)(C)C)[C@@H](CCC(=O)O)C(=O)O | 2701.4 | Standard non polar | 33892256 |
| Phenylalanylglutamic acid,4TMS,isomer #1 | C[Si](C)(C)OC(=O)CC[C@H](NC(=O)[C@H](CC1=CC=CC=C1)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O[Si](C)(C)C | 2698.5 | Semi standard non polar | 33892256 |
| Phenylalanylglutamic acid,4TMS,isomer #1 | C[Si](C)(C)OC(=O)CC[C@H](NC(=O)[C@H](CC1=CC=CC=C1)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O[Si](C)(C)C | 2679.1 | Standard non polar | 33892256 |
| Phenylalanylglutamic acid,4TMS,isomer #2 | C[Si](C)(C)N[C@@H](CC1=CC=CC=C1)C(=O)N([C@@H](CCC(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C)[Si](C)(C)C | 2555.7 | Semi standard non polar | 33892256 |
| Phenylalanylglutamic acid,4TMS,isomer #2 | C[Si](C)(C)N[C@@H](CC1=CC=CC=C1)C(=O)N([C@@H](CCC(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C)[Si](C)(C)C | 2632.5 | Standard non polar | 33892256 |
| Phenylalanylglutamic acid,4TMS,isomer #3 | C[Si](C)(C)OC(=O)CC[C@@H](C(=O)O)N(C(=O)[C@H](CC1=CC=CC=C1)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C | 2685.2 | Semi standard non polar | 33892256 |
| Phenylalanylglutamic acid,4TMS,isomer #3 | C[Si](C)(C)OC(=O)CC[C@@H](C(=O)O)N(C(=O)[C@H](CC1=CC=CC=C1)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C | 2738.3 | Standard non polar | 33892256 |
| Phenylalanylglutamic acid,4TMS,isomer #4 | C[Si](C)(C)OC(=O)[C@H](CCC(=O)O)N(C(=O)[C@H](CC1=CC=CC=C1)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C | 2709.5 | Semi standard non polar | 33892256 |
| Phenylalanylglutamic acid,4TMS,isomer #4 | C[Si](C)(C)OC(=O)[C@H](CCC(=O)O)N(C(=O)[C@H](CC1=CC=CC=C1)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C | 2711.9 | Standard non polar | 33892256 |
| Phenylalanylglutamic acid,5TMS,isomer #1 | C[Si](C)(C)OC(=O)CC[C@@H](C(=O)O[Si](C)(C)C)N(C(=O)[C@H](CC1=CC=CC=C1)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C | 2749.4 | Semi standard non polar | 33892256 |
| Phenylalanylglutamic acid,5TMS,isomer #1 | C[Si](C)(C)OC(=O)CC[C@@H](C(=O)O[Si](C)(C)C)N(C(=O)[C@H](CC1=CC=CC=C1)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C | 2745.9 | Standard non polar | 33892256 |
| Phenylalanylglutamic acid,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)CC[C@H](NC(=O)[C@@H](N)CC1=CC=CC=C1)C(=O)O | 2872.7 | Semi standard non polar | 33892256 |
| Phenylalanylglutamic acid,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](N)CC1=CC=CC=C1 | 2830.1 | Semi standard non polar | 33892256 |
| Phenylalanylglutamic acid,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H](CCC(=O)O)C(=O)O | 2847.0 | Semi standard non polar | 33892256 |
| Phenylalanylglutamic acid,1TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N(C(=O)[C@@H](N)CC1=CC=CC=C1)[C@@H](CCC(=O)O)C(=O)O | 2813.4 | Semi standard non polar | 33892256 |
| Phenylalanylglutamic acid,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)CC[C@H](NC(=O)[C@@H](N)CC1=CC=CC=C1)C(=O)O[Si](C)(C)C(C)(C)C | 3037.8 | Semi standard non polar | 33892256 |
| Phenylalanylglutamic acid,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H](CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O | 3078.2 | Semi standard non polar | 33892256 |
| Phenylalanylglutamic acid,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)CC[C@@H](C(=O)O)N(C(=O)[C@@H](N)CC1=CC=CC=C1)[Si](C)(C)C(C)(C)C | 3046.4 | Semi standard non polar | 33892256 |
| Phenylalanylglutamic acid,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H](CCC(=O)O)C(=O)O[Si](C)(C)C(C)(C)C | 3040.5 | Semi standard non polar | 33892256 |
| Phenylalanylglutamic acid,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC(=O)[C@H](CCC(=O)O)N(C(=O)[C@@H](N)CC1=CC=CC=C1)[Si](C)(C)C(C)(C)C | 3036.9 | Semi standard non polar | 33892256 |
| Phenylalanylglutamic acid,2TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)N([C@@H](CC1=CC=CC=C1)C(=O)N[C@@H](CCC(=O)O)C(=O)O)[Si](C)(C)C(C)(C)C | 3195.2 | Semi standard non polar | 33892256 |
| Phenylalanylglutamic acid,2TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)N[C@@H](CC1=CC=CC=C1)C(=O)N([C@@H](CCC(=O)O)C(=O)O)[Si](C)(C)C(C)(C)C | 3052.6 | Semi standard non polar | 33892256 |
| Phenylalanylglutamic acid,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H](CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 3246.6 | Semi standard non polar | 33892256 |
| Phenylalanylglutamic acid,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H](CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 3115.3 | Standard non polar | 33892256 |
| Phenylalanylglutamic acid,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)CC[C@@H](C(=O)O[Si](C)(C)C(C)(C)C)N(C(=O)[C@@H](N)CC1=CC=CC=C1)[Si](C)(C)C(C)(C)C | 3229.3 | Semi standard non polar | 33892256 |
| Phenylalanylglutamic acid,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)CC[C@@H](C(=O)O[Si](C)(C)C(C)(C)C)N(C(=O)[C@@H](N)CC1=CC=CC=C1)[Si](C)(C)C(C)(C)C | 3075.6 | Standard non polar | 33892256 |
| Phenylalanylglutamic acid,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)CC[C@H](NC(=O)[C@H](CC1=CC=CC=C1)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O | 3449.7 | Semi standard non polar | 33892256 |
| Phenylalanylglutamic acid,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)CC[C@H](NC(=O)[C@H](CC1=CC=CC=C1)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O | 3165.5 | Standard non polar | 33892256 |
| Phenylalanylglutamic acid,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N[C@@H](CC1=CC=CC=C1)C(=O)N([C@@H](CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O)[Si](C)(C)C(C)(C)C | 3274.9 | Semi standard non polar | 33892256 |
| Phenylalanylglutamic acid,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N[C@@H](CC1=CC=CC=C1)C(=O)N([C@@H](CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O)[Si](C)(C)C(C)(C)C | 3136.9 | Standard non polar | 33892256 |
| Phenylalanylglutamic acid,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC1=CC=CC=C1)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3422.8 | Semi standard non polar | 33892256 |
| Phenylalanylglutamic acid,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC1=CC=CC=C1)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3157.6 | Standard non polar | 33892256 |
| Phenylalanylglutamic acid,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)N[C@@H](CC1=CC=CC=C1)C(=O)N([C@@H](CCC(=O)O)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3267.3 | Semi standard non polar | 33892256 |
| Phenylalanylglutamic acid,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)N[C@@H](CC1=CC=CC=C1)C(=O)N([C@@H](CCC(=O)O)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3114.7 | Standard non polar | 33892256 |
| Phenylalanylglutamic acid,3TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)N(C(=O)[C@H](CC1=CC=CC=C1)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H](CCC(=O)O)C(=O)O | 3395.8 | Semi standard non polar | 33892256 |
| Phenylalanylglutamic acid,3TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)N(C(=O)[C@H](CC1=CC=CC=C1)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H](CCC(=O)O)C(=O)O | 3190.2 | Standard non polar | 33892256 |
| Phenylalanylglutamic acid,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)CC[C@H](NC(=O)[C@H](CC1=CC=CC=C1)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 3619.8 | Semi standard non polar | 33892256 |
| Phenylalanylglutamic acid,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)CC[C@H](NC(=O)[C@H](CC1=CC=CC=C1)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 3333.0 | Standard non polar | 33892256 |
| Phenylalanylglutamic acid,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)N[C@@H](CC1=CC=CC=C1)C(=O)N([C@@H](CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3427.5 | Semi standard non polar | 33892256 |
| Phenylalanylglutamic acid,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)N[C@@H](CC1=CC=CC=C1)C(=O)N([C@@H](CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3290.7 | Standard non polar | 33892256 |
| Phenylalanylglutamic acid,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)CC[C@@H](C(=O)O)N(C(=O)[C@H](CC1=CC=CC=C1)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3610.9 | Semi standard non polar | 33892256 |
| Phenylalanylglutamic acid,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)CC[C@@H](C(=O)O)N(C(=O)[C@H](CC1=CC=CC=C1)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3370.0 | Standard non polar | 33892256 |
| Phenylalanylglutamic acid,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=O)[C@H](CCC(=O)O)N(C(=O)[C@H](CC1=CC=CC=C1)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3607.7 | Semi standard non polar | 33892256 |
| Phenylalanylglutamic acid,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=O)[C@H](CCC(=O)O)N(C(=O)[C@H](CC1=CC=CC=C1)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3350.9 | Standard non polar | 33892256 |
| Phenylalanylglutamic acid,5TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)CC[C@@H](C(=O)O[Si](C)(C)C(C)(C)C)N(C(=O)[C@H](CC1=CC=CC=C1)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3789.1 | Semi standard non polar | 33892256 |
| Phenylalanylglutamic acid,5TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)CC[C@@H](C(=O)O[Si](C)(C)C(C)(C)C)N(C(=O)[C@H](CC1=CC=CC=C1)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3520.4 | Standard non polar | 33892256 |