| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Expected but not Quantified |
|---|
| Creation Date | 2012-09-11 17:36:07 UTC |
|---|
| Update Date | 2022-03-07 02:52:30 UTC |
|---|
| HMDB ID | HMDB0030323 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Paxilline |
|---|
| Description | Paxilline belongs to the class of organic compounds known as naphthopyrans. Naphthopyrans are compounds containing a pyran ring fused to a naphthalene moiety. Furan is a 6 membered-ring non-aromatic ring with five carbon and one oxygen atoms. Naphthalene is a polycyclic aromatic hydrocarbon made up of two fused benzene rings. Paxilline is a primary metabolite. Primary metabolites are metabolically or physiologically essential metabolites. They are directly involved in an organism’s growth, development or reproduction. Based on a literature review very few articles have been published on Paxilline. |
|---|
| Structure | [H][C@]12CC3=C(NC4=CC=CC=C34)[C@]1(C)[C@@]1(C)CC[C@]3([H])O[C@@H](C(=O)C=C3[C@]1(O)CC2)C(C)(C)O InChI=1S/C27H33NO4/c1-24(2,30)23-20(29)14-18-21(32-23)10-11-25(3)26(4)15(9-12-27(18,25)31)13-17-16-7-5-6-8-19(16)28-22(17)26/h5-8,14-15,21,23,28,30-31H,9-13H2,1-4H3/t15-,21-,23-,25+,26+,27+/m0/s1 |
|---|
| Synonyms | Not Available |
|---|
| Chemical Formula | C27H33NO4 |
|---|
| Average Molecular Weight | 435.5552 |
|---|
| Monoisotopic Molecular Weight | 435.240958549 |
|---|
| IUPAC Name | (1S,2R,5S,7R,11S,14S)-11-hydroxy-7-(2-hydroxypropan-2-yl)-1,2-dimethyl-6-oxa-23-azahexacyclo[12.10.0.0²,¹¹.0⁵,¹⁰.0¹⁶,²⁴.0¹⁷,²²]tetracosa-9,16(24),17,19,21-pentaen-8-one |
|---|
| Traditional Name | paxilline |
|---|
| CAS Registry Number | 57186-25-1 |
|---|
| SMILES | [H][C@]12CC3=C(NC4=CC=CC=C34)[C@]1(C)[C@@]1(C)CC[C@]3([H])O[C@@H](C(=O)C=C3[C@]1(O)CC2)C(C)(C)O |
|---|
| InChI Identifier | InChI=1S/C27H33NO4/c1-24(2,30)23-20(29)14-18-21(32-23)10-11-25(3)26(4)15(9-12-27(18,25)31)13-17-16-7-5-6-8-19(16)28-22(17)26/h5-8,14-15,21,23,28,30-31H,9-13H2,1-4H3/t15-,21-,23-,25+,26+,27+/m0/s1 |
|---|
| InChI Key | ACNHBCIZLNNLRS-UBGQALKQSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as naphthopyrans. Naphthopyrans are compounds containing a pyran ring fused to a naphthalene moiety. Furan is a 6 membered-ring non-aromatic ring with five carbon and one oxygen atoms. Naphthalene is a polycyclic aromatic hydrocarbon made up of two fused benzene rings. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Organoheterocyclic compounds |
|---|
| Class | Naphthopyrans |
|---|
| Sub Class | Not Available |
|---|
| Direct Parent | Naphthopyrans |
|---|
| Alternative Parents | |
|---|
| Substituents | - Naphthopyran
- Naphthalene
- 3-alkylindole
- Indole
- Indole or derivatives
- Dihydropyranone
- Pyran
- Benzenoid
- Heteroaromatic compound
- Tertiary alcohol
- Pyrrole
- Cyclic alcohol
- Cyclic ketone
- Ketone
- Oxacycle
- Azacycle
- Dialkyl ether
- Ether
- Alcohol
- Organic oxide
- Organopnictogen compound
- Organic oxygen compound
- Hydrocarbon derivative
- Organic nitrogen compound
- Organonitrogen compound
- Organooxygen compound
- Carbonyl group
- Aromatic heteropolycyclic compound
|
|---|
| Molecular Framework | Aromatic heteropolycyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Physiological effect | Not Available |
|---|
| Disposition | |
|---|
| Process | |
|---|
| Role | |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | 252 °C | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 6.65 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 15.3372 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 2.21 minutes | 32390414 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 3060.9 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 270.2 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 213.4 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 173.4 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 240.1 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 854.2 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 753.8 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 78.4 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 1202.0 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 564.0 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1672.0 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 485.1 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 456.6 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 205.7 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 280.5 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 8.3 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Paxilline,1TMS,isomer #1 | CC(C)(O)[C@H]1O[C@H]2CC[C@@]3(C)[C@@](O[Si](C)(C)C)(CC[C@H]4CC5=C([NH]C6=CC=CC=C56)[C@@]43C)C2=CC1=O | 3898.9 | Semi standard non polar | 33892256 | | Paxilline,1TMS,isomer #2 | CC(C)(O[Si](C)(C)C)[C@H]1O[C@H]2CC[C@@]3(C)[C@@](O)(CC[C@H]4CC5=C([NH]C6=CC=CC=C56)[C@@]43C)C2=CC1=O | 3923.9 | Semi standard non polar | 33892256 | | Paxilline,1TMS,isomer #3 | CC(C)(O)C1=C(O[Si](C)(C)C)C=C2[C@H](CC[C@@]3(C)[C@@]2(O)CC[C@H]2CC4=C([NH]C5=CC=CC=C45)[C@@]23C)O1 | 3882.7 | Semi standard non polar | 33892256 | | Paxilline,1TMS,isomer #4 | CC(C)(O)[C@H]1O[C@H]2CC[C@@]3(C)[C@@](O)(CC[C@H]4CC5=C(N([Si](C)(C)C)C6=CC=CC=C56)[C@@]43C)C2=CC1=O | 3919.7 | Semi standard non polar | 33892256 | | Paxilline,2TMS,isomer #1 | CC(C)(O[Si](C)(C)C)[C@H]1O[C@H]2CC[C@@]3(C)[C@@](O[Si](C)(C)C)(CC[C@H]4CC5=C([NH]C6=CC=CC=C56)[C@@]43C)C2=CC1=O | 3823.7 | Semi standard non polar | 33892256 | | Paxilline,2TMS,isomer #2 | CC(C)(O)C1=C(O[Si](C)(C)C)C=C2[C@H](CC[C@@]3(C)[C@@]2(O[Si](C)(C)C)CC[C@H]2CC4=C([NH]C5=CC=CC=C45)[C@@]23C)O1 | 3836.2 | Semi standard non polar | 33892256 | | Paxilline,2TMS,isomer #3 | CC(C)(O)[C@H]1O[C@H]2CC[C@@]3(C)[C@@](O[Si](C)(C)C)(CC[C@H]4CC5=C(N([Si](C)(C)C)C6=CC=CC=C56)[C@@]43C)C2=CC1=O | 3831.2 | Semi standard non polar | 33892256 | | Paxilline,2TMS,isomer #4 | CC(C)(O[Si](C)(C)C)C1=C(O[Si](C)(C)C)C=C2[C@H](CC[C@@]3(C)[C@@]2(O)CC[C@H]2CC4=C([NH]C5=CC=CC=C45)[C@@]23C)O1 | 3874.6 | Semi standard non polar | 33892256 | | Paxilline,2TMS,isomer #5 | CC(C)(O[Si](C)(C)C)[C@H]1O[C@H]2CC[C@@]3(C)[C@@](O)(CC[C@H]4CC5=C(N([Si](C)(C)C)C6=CC=CC=C56)[C@@]43C)C2=CC1=O | 3854.9 | Semi standard non polar | 33892256 | | Paxilline,2TMS,isomer #6 | CC(C)(O)C1=C(O[Si](C)(C)C)C=C2[C@H](CC[C@@]3(C)[C@@]2(O)CC[C@H]2CC4=C(N([Si](C)(C)C)C5=CC=CC=C45)[C@@]23C)O1 | 3841.7 | Semi standard non polar | 33892256 | | Paxilline,3TMS,isomer #1 | CC(C)(O[Si](C)(C)C)C1=C(O[Si](C)(C)C)C=C2[C@H](CC[C@@]3(C)[C@@]2(O[Si](C)(C)C)CC[C@H]2CC4=C([NH]C5=CC=CC=C45)[C@@]23C)O1 | 3791.9 | Semi standard non polar | 33892256 | | Paxilline,3TMS,isomer #1 | CC(C)(O[Si](C)(C)C)C1=C(O[Si](C)(C)C)C=C2[C@H](CC[C@@]3(C)[C@@]2(O[Si](C)(C)C)CC[C@H]2CC4=C([NH]C5=CC=CC=C45)[C@@]23C)O1 | 3556.5 | Standard non polar | 33892256 | | Paxilline,3TMS,isomer #2 | CC(C)(O[Si](C)(C)C)[C@H]1O[C@H]2CC[C@@]3(C)[C@@](O[Si](C)(C)C)(CC[C@H]4CC5=C(N([Si](C)(C)C)C6=CC=CC=C56)[C@@]43C)C2=CC1=O | 3783.4 | Semi standard non polar | 33892256 | | Paxilline,3TMS,isomer #2 | CC(C)(O[Si](C)(C)C)[C@H]1O[C@H]2CC[C@@]3(C)[C@@](O[Si](C)(C)C)(CC[C@H]4CC5=C(N([Si](C)(C)C)C6=CC=CC=C56)[C@@]43C)C2=CC1=O | 3618.9 | Standard non polar | 33892256 | | Paxilline,3TMS,isomer #3 | CC(C)(O)C1=C(O[Si](C)(C)C)C=C2[C@H](CC[C@@]3(C)[C@@]2(O[Si](C)(C)C)CC[C@H]2CC4=C(N([Si](C)(C)C)C5=CC=CC=C45)[C@@]23C)O1 | 3759.9 | Semi standard non polar | 33892256 | | Paxilline,3TMS,isomer #3 | CC(C)(O)C1=C(O[Si](C)(C)C)C=C2[C@H](CC[C@@]3(C)[C@@]2(O[Si](C)(C)C)CC[C@H]2CC4=C(N([Si](C)(C)C)C5=CC=CC=C45)[C@@]23C)O1 | 3535.5 | Standard non polar | 33892256 | | Paxilline,3TMS,isomer #4 | CC(C)(O[Si](C)(C)C)C1=C(O[Si](C)(C)C)C=C2[C@H](CC[C@@]3(C)[C@@]2(O)CC[C@H]2CC4=C(N([Si](C)(C)C)C5=CC=CC=C45)[C@@]23C)O1 | 3794.2 | Semi standard non polar | 33892256 | | Paxilline,3TMS,isomer #4 | CC(C)(O[Si](C)(C)C)C1=C(O[Si](C)(C)C)C=C2[C@H](CC[C@@]3(C)[C@@]2(O)CC[C@H]2CC4=C(N([Si](C)(C)C)C5=CC=CC=C45)[C@@]23C)O1 | 3673.2 | Standard non polar | 33892256 | | Paxilline,4TMS,isomer #1 | CC(C)(O[Si](C)(C)C)C1=C(O[Si](C)(C)C)C=C2[C@H](CC[C@@]3(C)[C@@]2(O[Si](C)(C)C)CC[C@H]2CC4=C(N([Si](C)(C)C)C5=CC=CC=C45)[C@@]23C)O1 | 3726.8 | Semi standard non polar | 33892256 | | Paxilline,4TMS,isomer #1 | CC(C)(O[Si](C)(C)C)C1=C(O[Si](C)(C)C)C=C2[C@H](CC[C@@]3(C)[C@@]2(O[Si](C)(C)C)CC[C@H]2CC4=C(N([Si](C)(C)C)C5=CC=CC=C45)[C@@]23C)O1 | 3593.9 | Standard non polar | 33892256 | | Paxilline,1TBDMS,isomer #1 | CC(C)(O)[C@H]1O[C@H]2CC[C@@]3(C)[C@@](O[Si](C)(C)C(C)(C)C)(CC[C@H]4CC5=C([NH]C6=CC=CC=C56)[C@@]43C)C2=CC1=O | 4112.6 | Semi standard non polar | 33892256 | | Paxilline,1TBDMS,isomer #2 | CC(C)(O[Si](C)(C)C(C)(C)C)[C@H]1O[C@H]2CC[C@@]3(C)[C@@](O)(CC[C@H]4CC5=C([NH]C6=CC=CC=C56)[C@@]43C)C2=CC1=O | 4165.9 | Semi standard non polar | 33892256 | | Paxilline,1TBDMS,isomer #3 | CC(C)(O)C1=C(O[Si](C)(C)C(C)(C)C)C=C2[C@H](CC[C@@]3(C)[C@@]2(O)CC[C@H]2CC4=C([NH]C5=CC=CC=C45)[C@@]23C)O1 | 4110.8 | Semi standard non polar | 33892256 | | Paxilline,1TBDMS,isomer #4 | CC(C)(O)[C@H]1O[C@H]2CC[C@@]3(C)[C@@](O)(CC[C@H]4CC5=C(N([Si](C)(C)C(C)(C)C)C6=CC=CC=C56)[C@@]43C)C2=CC1=O | 4116.4 | Semi standard non polar | 33892256 | | Paxilline,2TBDMS,isomer #1 | CC(C)(O[Si](C)(C)C(C)(C)C)[C@H]1O[C@H]2CC[C@@]3(C)[C@@](O[Si](C)(C)C(C)(C)C)(CC[C@H]4CC5=C([NH]C6=CC=CC=C56)[C@@]43C)C2=CC1=O | 4257.9 | Semi standard non polar | 33892256 | | Paxilline,2TBDMS,isomer #2 | CC(C)(O)C1=C(O[Si](C)(C)C(C)(C)C)C=C2[C@H](CC[C@@]3(C)[C@@]2(O[Si](C)(C)C(C)(C)C)CC[C@H]2CC4=C([NH]C5=CC=CC=C45)[C@@]23C)O1 | 4261.9 | Semi standard non polar | 33892256 | | Paxilline,2TBDMS,isomer #3 | CC(C)(O)[C@H]1O[C@H]2CC[C@@]3(C)[C@@](O[Si](C)(C)C(C)(C)C)(CC[C@H]4CC5=C(N([Si](C)(C)C(C)(C)C)C6=CC=CC=C56)[C@@]43C)C2=CC1=O | 4207.1 | Semi standard non polar | 33892256 | | Paxilline,2TBDMS,isomer #4 | CC(C)(O[Si](C)(C)C(C)(C)C)C1=C(O[Si](C)(C)C(C)(C)C)C=C2[C@H](CC[C@@]3(C)[C@@]2(O)CC[C@H]2CC4=C([NH]C5=CC=CC=C45)[C@@]23C)O1 | 4312.9 | Semi standard non polar | 33892256 | | Paxilline,2TBDMS,isomer #5 | CC(C)(O[Si](C)(C)C(C)(C)C)[C@H]1O[C@H]2CC[C@@]3(C)[C@@](O)(CC[C@H]4CC5=C(N([Si](C)(C)C(C)(C)C)C6=CC=CC=C56)[C@@]43C)C2=CC1=O | 4271.6 | Semi standard non polar | 33892256 | | Paxilline,2TBDMS,isomer #6 | CC(C)(O)C1=C(O[Si](C)(C)C(C)(C)C)C=C2[C@H](CC[C@@]3(C)[C@@]2(O)CC[C@H]2CC4=C(N([Si](C)(C)C(C)(C)C)C5=CC=CC=C45)[C@@]23C)O1 | 4234.5 | Semi standard non polar | 33892256 | | Paxilline,3TBDMS,isomer #1 | CC(C)(O[Si](C)(C)C(C)(C)C)C1=C(O[Si](C)(C)C(C)(C)C)C=C2[C@H](CC[C@@]3(C)[C@@]2(O[Si](C)(C)C(C)(C)C)CC[C@H]2CC4=C([NH]C5=CC=CC=C45)[C@@]23C)O1 | 4393.8 | Semi standard non polar | 33892256 | | Paxilline,3TBDMS,isomer #1 | CC(C)(O[Si](C)(C)C(C)(C)C)C1=C(O[Si](C)(C)C(C)(C)C)C=C2[C@H](CC[C@@]3(C)[C@@]2(O[Si](C)(C)C(C)(C)C)CC[C@H]2CC4=C([NH]C5=CC=CC=C45)[C@@]23C)O1 | 4175.6 | Standard non polar | 33892256 | | Paxilline,3TBDMS,isomer #2 | CC(C)(O[Si](C)(C)C(C)(C)C)[C@H]1O[C@H]2CC[C@@]3(C)[C@@](O[Si](C)(C)C(C)(C)C)(CC[C@H]4CC5=C(N([Si](C)(C)C(C)(C)C)C6=CC=CC=C56)[C@@]43C)C2=CC1=O | 4368.8 | Semi standard non polar | 33892256 | | Paxilline,3TBDMS,isomer #2 | CC(C)(O[Si](C)(C)C(C)(C)C)[C@H]1O[C@H]2CC[C@@]3(C)[C@@](O[Si](C)(C)C(C)(C)C)(CC[C@H]4CC5=C(N([Si](C)(C)C(C)(C)C)C6=CC=CC=C56)[C@@]43C)C2=CC1=O | 4236.5 | Standard non polar | 33892256 | | Paxilline,3TBDMS,isomer #3 | CC(C)(O)C1=C(O[Si](C)(C)C(C)(C)C)C=C2[C@H](CC[C@@]3(C)[C@@]2(O[Si](C)(C)C(C)(C)C)CC[C@H]2CC4=C(N([Si](C)(C)C(C)(C)C)C5=CC=CC=C45)[C@@]23C)O1 | 4312.8 | Semi standard non polar | 33892256 | | Paxilline,3TBDMS,isomer #3 | CC(C)(O)C1=C(O[Si](C)(C)C(C)(C)C)C=C2[C@H](CC[C@@]3(C)[C@@]2(O[Si](C)(C)C(C)(C)C)CC[C@H]2CC4=C(N([Si](C)(C)C(C)(C)C)C5=CC=CC=C45)[C@@]23C)O1 | 4138.3 | Standard non polar | 33892256 | | Paxilline,3TBDMS,isomer #4 | CC(C)(O[Si](C)(C)C(C)(C)C)C1=C(O[Si](C)(C)C(C)(C)C)C=C2[C@H](CC[C@@]3(C)[C@@]2(O)CC[C@H]2CC4=C(N([Si](C)(C)C(C)(C)C)C5=CC=CC=C45)[C@@]23C)O1 | 4393.0 | Semi standard non polar | 33892256 | | Paxilline,3TBDMS,isomer #4 | CC(C)(O[Si](C)(C)C(C)(C)C)C1=C(O[Si](C)(C)C(C)(C)C)C=C2[C@H](CC[C@@]3(C)[C@@]2(O)CC[C@H]2CC4=C(N([Si](C)(C)C(C)(C)C)C5=CC=CC=C45)[C@@]23C)O1 | 4306.9 | Standard non polar | 33892256 | | Paxilline,4TBDMS,isomer #1 | CC(C)(O[Si](C)(C)C(C)(C)C)C1=C(O[Si](C)(C)C(C)(C)C)C=C2[C@H](CC[C@@]3(C)[C@@]2(O[Si](C)(C)C(C)(C)C)CC[C@H]2CC4=C(N([Si](C)(C)C(C)(C)C)C5=CC=CC=C45)[C@@]23C)O1 | 4457.2 | Semi standard non polar | 33892256 | | Paxilline,4TBDMS,isomer #1 | CC(C)(O[Si](C)(C)C(C)(C)C)C1=C(O[Si](C)(C)C(C)(C)C)C=C2[C@H](CC[C@@]3(C)[C@@]2(O[Si](C)(C)C(C)(C)C)CC[C@H]2CC4=C(N([Si](C)(C)C(C)(C)C)C5=CC=CC=C45)[C@@]23C)O1 | 4362.6 | Standard non polar | 33892256 |
|
|---|