| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Expected but not Quantified |
|---|
| Creation Date | 2012-09-11 17:43:48 UTC |
|---|
| Update Date | 2023-02-21 17:20:44 UTC |
|---|
| HMDB ID | HMDB0031519 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | 4-Mercapto-4-methyl-2-pentanone |
|---|
| Description | 4-Mercapto-4-methyl-2-pentanone, also known as 4-sulfanyl-4-methylpentan-2-one or 4-methyl-4-sulfanyl-2-pentanone, belongs to the class of organic compounds known as ketones. These are organic compounds in which a carbonyl group is bonded to two carbon atoms R2C=O (neither R may be a hydrogen atom). Ketones that have one or more alpha-hydrogen atoms undergo keto-enol tautomerization, the tautomer being an enol. Thus, 4-mercapto-4-methyl-2-pentanone is considered to be an oxygenated hydrocarbon. 4-Mercapto-4-methyl-2-pentanone is a blackcurrant, box tree, and cat-urine tasting compound. 4-Mercapto-4-methyl-2-pentanone has been detected, but not quantified in, alcoholic beverages and grape wine. This could make 4-mercapto-4-methyl-2-pentanone a potential biomarker for the consumption of these foods. 4-Mercapto-4-methyl-2-pentanone is a secondary metabolite. Secondary metabolites are metabolically or physiologically non-essential metabolites that may serve a role as defense or signalling molecules. In some cases they are simply molecules that arise from the incomplete metabolism of other secondary metabolites. Based on a literature review a significant number of articles have been published on 4-Mercapto-4-methyl-2-pentanone. |
|---|
| Structure | InChI=1S/C6H12OS/c1-5(7)4-6(2,3)8/h8H,4H2,1-3H3 |
|---|
| Synonyms | | Value | Source |
|---|
| 4-Methyl-4-mercapto-2-pentanone | ChEBI | | 4-Methyl-4-mercaptopentan-2-one | ChEBI | | 4-Methyl-4-sulfanyl-2-pentanone | ChEBI | | 4-Methyl-4-thiolpentan-2-one | ChEBI | | 4-Sulfanyl-4-methylpentan-2-one | ChEBI | | 4-Sulphanyl-4-methylpentan-2-one | ChEBI | | 4-Methyl-4-sulphanyl-2-pentanone | Generator | | 4-mercapto-4-Methyl-pentan-2-one | HMDB | | 4-mercapto-4-Methylpentan-2-one | HMDB | | 4-Methyl-4-mercapto-pentan-2-one | HMDB | | 4-Mercapto-4-methyl-2-pentanone | ChEBI |
|
|---|
| Chemical Formula | C6H12OS |
|---|
| Average Molecular Weight | 132.224 |
|---|
| Monoisotopic Molecular Weight | 132.060885696 |
|---|
| IUPAC Name | 4-methyl-4-sulfanylpentan-2-one |
|---|
| Traditional Name | 4-methyl-4-sulfanylpentan-2-one |
|---|
| CAS Registry Number | 19872-52-7 |
|---|
| SMILES | CC(=O)CC(C)(C)S |
|---|
| InChI Identifier | InChI=1S/C6H12OS/c1-5(7)4-6(2,3)8/h8H,4H2,1-3H3 |
|---|
| InChI Key | QRNZMFDCKKEPSX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as ketones. These are organic compounds in which a carbonyl group is bonded to two carbon atoms R2C=O (neither R may be a hydrogen atom). Ketones that have one or more alpha-hydrogen atoms undergo keto-enol tautomerization, the tautomer being an enol. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Organic oxygen compounds |
|---|
| Class | Organooxygen compounds |
|---|
| Sub Class | Carbonyl compounds |
|---|
| Direct Parent | Ketones |
|---|
| Alternative Parents | |
|---|
| Substituents | - Ketone
- Alkylthiol
- Organic oxide
- Hydrocarbon derivative
- Organosulfur compound
- Aliphatic acyclic compound
|
|---|
| Molecular Framework | Aliphatic acyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Physiological effect | |
|---|
| Disposition | |
|---|
| Process | Not Available |
|---|
| Role | Not Available |
|---|
| Physical Properties |
|---|
| State | Not Available |
|---|
| Experimental Molecular Properties | |
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 3.43 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 13.1885 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 3.22 minutes | 32390414 | | AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid | 29.2 seconds | 40023050 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 1926.2 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 499.4 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 168.3 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 304.0 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 94.6 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 455.6 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 486.3 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 139.1 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 997.9 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 354.1 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1060.2 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 339.6 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 297.9 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 412.0 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 471.3 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 37.5 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| 4-Mercapto-4-methyl-2-pentanone,1TMS,isomer #1 | CC(=O)CC(C)(C)S[Si](C)(C)C | 1168.6 | Semi standard non polar | 33892256 | | 4-Mercapto-4-methyl-2-pentanone,1TMS,isomer #1 | CC(=O)CC(C)(C)S[Si](C)(C)C | 1198.1 | Standard non polar | 33892256 | | 4-Mercapto-4-methyl-2-pentanone,1TMS,isomer #2 | CC(=CC(C)(C)S)O[Si](C)(C)C | 1123.4 | Semi standard non polar | 33892256 | | 4-Mercapto-4-methyl-2-pentanone,1TMS,isomer #2 | CC(=CC(C)(C)S)O[Si](C)(C)C | 1212.0 | Standard non polar | 33892256 | | 4-Mercapto-4-methyl-2-pentanone,1TMS,isomer #3 | C=C(CC(C)(C)S)O[Si](C)(C)C | 1139.4 | Semi standard non polar | 33892256 | | 4-Mercapto-4-methyl-2-pentanone,1TMS,isomer #3 | C=C(CC(C)(C)S)O[Si](C)(C)C | 1178.7 | Standard non polar | 33892256 | | 4-Mercapto-4-methyl-2-pentanone,2TMS,isomer #1 | CC(=CC(C)(C)S[Si](C)(C)C)O[Si](C)(C)C | 1337.8 | Semi standard non polar | 33892256 | | 4-Mercapto-4-methyl-2-pentanone,2TMS,isomer #1 | CC(=CC(C)(C)S[Si](C)(C)C)O[Si](C)(C)C | 1391.3 | Standard non polar | 33892256 | | 4-Mercapto-4-methyl-2-pentanone,2TMS,isomer #2 | C=C(CC(C)(C)S[Si](C)(C)C)O[Si](C)(C)C | 1356.1 | Semi standard non polar | 33892256 | | 4-Mercapto-4-methyl-2-pentanone,2TMS,isomer #2 | C=C(CC(C)(C)S[Si](C)(C)C)O[Si](C)(C)C | 1409.9 | Standard non polar | 33892256 | | 4-Mercapto-4-methyl-2-pentanone,1TBDMS,isomer #1 | CC(=O)CC(C)(C)S[Si](C)(C)C(C)(C)C | 1410.7 | Semi standard non polar | 33892256 | | 4-Mercapto-4-methyl-2-pentanone,1TBDMS,isomer #1 | CC(=O)CC(C)(C)S[Si](C)(C)C(C)(C)C | 1435.2 | Standard non polar | 33892256 | | 4-Mercapto-4-methyl-2-pentanone,1TBDMS,isomer #2 | CC(=CC(C)(C)S)O[Si](C)(C)C(C)(C)C | 1332.6 | Semi standard non polar | 33892256 | | 4-Mercapto-4-methyl-2-pentanone,1TBDMS,isomer #2 | CC(=CC(C)(C)S)O[Si](C)(C)C(C)(C)C | 1433.2 | Standard non polar | 33892256 | | 4-Mercapto-4-methyl-2-pentanone,1TBDMS,isomer #3 | C=C(CC(C)(C)S)O[Si](C)(C)C(C)(C)C | 1357.8 | Semi standard non polar | 33892256 | | 4-Mercapto-4-methyl-2-pentanone,1TBDMS,isomer #3 | C=C(CC(C)(C)S)O[Si](C)(C)C(C)(C)C | 1378.2 | Standard non polar | 33892256 | | 4-Mercapto-4-methyl-2-pentanone,2TBDMS,isomer #1 | CC(=CC(C)(C)S[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 1825.9 | Semi standard non polar | 33892256 | | 4-Mercapto-4-methyl-2-pentanone,2TBDMS,isomer #1 | CC(=CC(C)(C)S[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 1843.5 | Standard non polar | 33892256 | | 4-Mercapto-4-methyl-2-pentanone,2TBDMS,isomer #2 | C=C(CC(C)(C)S[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 1829.4 | Semi standard non polar | 33892256 | | 4-Mercapto-4-methyl-2-pentanone,2TBDMS,isomer #2 | C=C(CC(C)(C)S[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 1836.3 | Standard non polar | 33892256 |
|
|---|