| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 0.47 minutes | 32390414 |
| Predicted by Siyang on May 30, 2022 | 9.6866 minutes | 33406817 |
| Predicted by Siyang using ReTip algorithm on June 8, 2022 | 6.01 minutes | 32390414 |
| AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid | 302.0 seconds | 40023050 |
| Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 634.4 seconds | 40023050 |
| Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 309.4 seconds | 40023050 |
| Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 33.2 seconds | 40023050 |
| Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 183.4 seconds | 40023050 |
| RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 76.7 seconds | 40023050 |
| Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 293.2 seconds | 40023050 |
| BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 226.3 seconds | 40023050 |
| HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 703.6 seconds | 40023050 |
| UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 577.8 seconds | 40023050 |
| BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 42.0 seconds | 40023050 |
| UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 785.4 seconds | 40023050 |
| SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 196.6 seconds | 40023050 |
| RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 260.1 seconds | 40023050 |
| MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 650.8 seconds | 40023050 |
| KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 366.5 seconds | 40023050 |
| Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 323.2 seconds | 40023050 |
| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| L-Galactose,1TMS,isomer #1 | C[Si](C)(C)OC[C@@H]1O[C@@H](O)[C@@H](O)[C@H](O)[C@@H]1O | 1738.4 | Semi standard non polar | 33892256 |
| L-Galactose,1TMS,isomer #2 | C[Si](C)(C)O[C@@H]1O[C@@H](CO)[C@@H](O)[C@@H](O)[C@@H]1O | 1673.8 | Semi standard non polar | 33892256 |
| L-Galactose,1TMS,isomer #3 | C[Si](C)(C)O[C@@H]1[C@H](O)O[C@@H](CO)[C@@H](O)[C@H]1O | 1683.6 | Semi standard non polar | 33892256 |
| L-Galactose,1TMS,isomer #4 | C[Si](C)(C)O[C@H]1[C@H](O)[C@H](O)O[C@@H](CO)[C@H]1O | 1688.3 | Semi standard non polar | 33892256 |
| L-Galactose,1TMS,isomer #5 | C[Si](C)(C)O[C@@H]1[C@H](CO)O[C@@H](O)[C@@H](O)[C@@H]1O | 1678.0 | Semi standard non polar | 33892256 |
| L-Galactose,2TMS,isomer #1 | C[Si](C)(C)OC[C@@H]1O[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O | 1722.4 | Semi standard non polar | 33892256 |
| L-Galactose,2TMS,isomer #10 | C[Si](C)(C)O[C@H]1[C@H](O)[C@H](O)O[C@@H](CO)[C@H]1O[Si](C)(C)C | 1681.6 | Semi standard non polar | 33892256 |
| L-Galactose,2TMS,isomer #2 | C[Si](C)(C)OC[C@@H]1O[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O | 1737.0 | Semi standard non polar | 33892256 |
| L-Galactose,2TMS,isomer #3 | C[Si](C)(C)OC[C@@H]1O[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O | 1742.6 | Semi standard non polar | 33892256 |
| L-Galactose,2TMS,isomer #4 | C[Si](C)(C)OC[C@@H]1O[C@@H](O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C | 1712.2 | Semi standard non polar | 33892256 |
| L-Galactose,2TMS,isomer #5 | C[Si](C)(C)O[C@@H]1O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O | 1701.4 | Semi standard non polar | 33892256 |
| L-Galactose,2TMS,isomer #6 | C[Si](C)(C)O[C@@H]1O[C@@H](CO)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O | 1703.5 | Semi standard non polar | 33892256 |
| L-Galactose,2TMS,isomer #7 | C[Si](C)(C)O[C@@H]1O[C@@H](CO)[C@@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C | 1679.6 | Semi standard non polar | 33892256 |
| L-Galactose,2TMS,isomer #8 | C[Si](C)(C)O[C@@H]1[C@H](CO)O[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O | 1697.1 | Semi standard non polar | 33892256 |
| L-Galactose,2TMS,isomer #9 | C[Si](C)(C)O[C@@H]1[C@H](O)O[C@@H](CO)[C@@H](O)[C@H]1O[Si](C)(C)C | 1692.2 | Semi standard non polar | 33892256 |
| L-Galactose,3TMS,isomer #1 | C[Si](C)(C)OC[C@@H]1O[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O | 1703.6 | Semi standard non polar | 33892256 |
| L-Galactose,3TMS,isomer #10 | C[Si](C)(C)O[C@@H]1[C@H](O)O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 1736.7 | Semi standard non polar | 33892256 |
| L-Galactose,3TMS,isomer #2 | C[Si](C)(C)OC[C@@H]1O[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O | 1753.4 | Semi standard non polar | 33892256 |
| L-Galactose,3TMS,isomer #3 | C[Si](C)(C)OC[C@@H]1O[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C | 1717.5 | Semi standard non polar | 33892256 |
| L-Galactose,3TMS,isomer #4 | C[Si](C)(C)OC[C@@H]1O[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O | 1748.2 | Semi standard non polar | 33892256 |
| L-Galactose,3TMS,isomer #5 | C[Si](C)(C)OC[C@@H]1O[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C | 1766.0 | Semi standard non polar | 33892256 |
| L-Galactose,3TMS,isomer #6 | C[Si](C)(C)OC[C@@H]1O[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C | 1701.0 | Semi standard non polar | 33892256 |
| L-Galactose,3TMS,isomer #7 | C[Si](C)(C)O[C@@H]1O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O | 1739.0 | Semi standard non polar | 33892256 |
| L-Galactose,3TMS,isomer #8 | C[Si](C)(C)O[C@@H]1O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C | 1733.4 | Semi standard non polar | 33892256 |
| L-Galactose,3TMS,isomer #9 | C[Si](C)(C)O[C@@H]1O[C@@H](CO)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C | 1725.4 | Semi standard non polar | 33892256 |
| L-Galactose,4TMS,isomer #1 | C[Si](C)(C)OC[C@@H]1O[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O | 1815.5 | Semi standard non polar | 33892256 |
| L-Galactose,4TMS,isomer #2 | C[Si](C)(C)OC[C@@H]1O[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C | 1815.2 | Semi standard non polar | 33892256 |
| L-Galactose,4TMS,isomer #3 | C[Si](C)(C)OC[C@@H]1O[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C | 1820.5 | Semi standard non polar | 33892256 |
| L-Galactose,4TMS,isomer #4 | C[Si](C)(C)OC[C@@H]1O[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C | 1819.4 | Semi standard non polar | 33892256 |
| L-Galactose,4TMS,isomer #5 | C[Si](C)(C)O[C@@H]1O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C | 1800.9 | Semi standard non polar | 33892256 |
| L-Galactose,5TMS,isomer #1 | C[Si](C)(C)OC[C@@H]1O[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C | 1877.4 | Semi standard non polar | 33892256 |
| L-Galactose,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](O)[C@@H](O)[C@H](O)[C@@H]1O | 2002.6 | Semi standard non polar | 33892256 |
| L-Galactose,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)O[C@@H]1O[C@@H](CO)[C@@H](O)[C@@H](O)[C@@H]1O | 1940.1 | Semi standard non polar | 33892256 |
| L-Galactose,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O)O[C@@H](CO)[C@@H](O)[C@H]1O | 1940.5 | Semi standard non polar | 33892256 |
| L-Galactose,1TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@H](O)O[C@@H](CO)[C@H]1O | 1947.1 | Semi standard non polar | 33892256 |
| L-Galactose,1TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](CO)O[C@@H](O)[C@@H](O)[C@@H]1O | 1943.8 | Semi standard non polar | 33892256 |
| L-Galactose,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O | 2208.7 | Semi standard non polar | 33892256 |
| L-Galactose,2TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@H](O)O[C@@H](CO)[C@H]1O[Si](C)(C)C(C)(C)C | 2181.6 | Semi standard non polar | 33892256 |
| L-Galactose,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O | 2210.9 | Semi standard non polar | 33892256 |
| L-Galactose,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O | 2219.8 | Semi standard non polar | 33892256 |
| L-Galactose,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C | 2197.5 | Semi standard non polar | 33892256 |
| L-Galactose,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)O[C@@H]1O[C@@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O | 2193.9 | Semi standard non polar | 33892256 |
| L-Galactose,2TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)O[C@@H]1O[C@@H](CO)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O | 2195.0 | Semi standard non polar | 33892256 |
| L-Galactose,2TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)O[C@@H]1O[C@@H](CO)[C@@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C | 2180.7 | Semi standard non polar | 33892256 |
| L-Galactose,2TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](CO)O[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O | 2190.8 | Semi standard non polar | 33892256 |
| L-Galactose,2TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O)O[C@@H](CO)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 2192.8 | Semi standard non polar | 33892256 |
| L-Galactose,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O | 2441.4 | Semi standard non polar | 33892256 |
| L-Galactose,3TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O)O[C@@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C | 2455.2 | Semi standard non polar | 33892256 |
| L-Galactose,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O | 2449.6 | Semi standard non polar | 33892256 |
| L-Galactose,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C | 2445.1 | Semi standard non polar | 33892256 |
| L-Galactose,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O | 2466.7 | Semi standard non polar | 33892256 |
| L-Galactose,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C | 2468.7 | Semi standard non polar | 33892256 |
| L-Galactose,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C | 2439.7 | Semi standard non polar | 33892256 |
| L-Galactose,3TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)O[C@@H]1O[C@@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O | 2451.2 | Semi standard non polar | 33892256 |
| L-Galactose,3TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)O[C@@H]1O[C@@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C | 2451.3 | Semi standard non polar | 33892256 |
| L-Galactose,3TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)O[C@@H]1O[C@@H](CO)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C | 2454.9 | Semi standard non polar | 33892256 |
| L-Galactose,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O | 2671.4 | Semi standard non polar | 33892256 |
| L-Galactose,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C | 2668.4 | Semi standard non polar | 33892256 |
| L-Galactose,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C | 2664.4 | Semi standard non polar | 33892256 |
| L-Galactose,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C | 2681.0 | Semi standard non polar | 33892256 |
| L-Galactose,4TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)O[C@@H]1O[C@@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C | 2669.4 | Semi standard non polar | 33892256 |
| L-Galactose,5TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C | 2890.3 | Semi standard non polar | 33892256 |