| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Expected but not Quantified |
|---|
| Creation Date | 2012-09-11 19:20:55 UTC |
|---|
| Update Date | 2022-03-07 02:54:07 UTC |
|---|
| HMDB ID | HMDB0034501 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Tomentosic acid |
|---|
| Description | Tomentosic acid, also known as tomentosate or sericic acid, belongs to the class of organic compounds known as triterpenoids. These are terpene molecules containing six isoprene units. Based on a literature review a small amount of articles have been published on Tomentosic acid. |
|---|
| Structure | CC1(C)CCC2(CCC3(C)C(=CCC4C5(C)CC(O)C(O)C(C)(CO)C5CCC34C)C2C1O)C(O)=O InChI=1S/C30H48O6/c1-25(2)11-13-30(24(35)36)14-12-28(5)17(21(30)23(25)34)7-8-20-26(3)15-18(32)22(33)27(4,16-31)19(26)9-10-29(20,28)6/h7,18-23,31-34H,8-16H2,1-6H3,(H,35,36) |
|---|
| Synonyms | | Value | Source |
|---|
| Tomentosate | Generator | | 2,3,19,23-Tetrahydroxyolean-12-en-28-Oic acid | HMDB | | 1,10,11-Trihydroxy-9-(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,12b,13,14b-icosahydropicene-4a-carboxylate | HMDB | | Sericic acid | HMDB |
|
|---|
| Chemical Formula | C30H48O6 |
|---|
| Average Molecular Weight | 504.6985 |
|---|
| Monoisotopic Molecular Weight | 504.345089268 |
|---|
| IUPAC Name | 1,10,11-trihydroxy-9-(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,12b,13,14b-icosahydropicene-4a-carboxylic acid |
|---|
| Traditional Name | 1,10,11-trihydroxy-9-(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-1,3,4,5,6,7,8,8a,10,11,12,12b,13,14b-tetradecahydropicene-4a-carboxylic acid |
|---|
| CAS Registry Number | 6753-23-7 |
|---|
| SMILES | CC1(C)CCC2(CCC3(C)C(=CCC4C5(C)CC(O)C(O)C(C)(CO)C5CCC34C)C2C1O)C(O)=O |
|---|
| InChI Identifier | InChI=1S/C30H48O6/c1-25(2)11-13-30(24(35)36)14-12-28(5)17(21(30)23(25)34)7-8-20-26(3)15-18(32)22(33)27(4,16-31)19(26)9-10-29(20,28)6/h7,18-23,31-34H,8-16H2,1-6H3,(H,35,36) |
|---|
| InChI Key | IFIQVSCCFRXSJV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as triterpenoids. These are terpene molecules containing six isoprene units. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Lipids and lipid-like molecules |
|---|
| Class | Prenol lipids |
|---|
| Sub Class | Triterpenoids |
|---|
| Direct Parent | Triterpenoids |
|---|
| Alternative Parents | |
|---|
| Substituents | - Triterpenoid
- 12-hydroxysteroid
- Hydroxysteroid
- Steroid
- Cyclic alcohol
- Secondary alcohol
- Carboxylic acid derivative
- Carboxylic acid
- Monocarboxylic acid or derivatives
- Polyol
- Hydrocarbon derivative
- Organic oxide
- Organic oxygen compound
- Carbonyl group
- Organooxygen compound
- Alcohol
- Primary alcohol
- Aliphatic homopolycyclic compound
|
|---|
| Molecular Framework | Aliphatic homopolycyclic compounds |
|---|
| External Descriptors | Not Available |
|---|
| Ontology |
|---|
| Physiological effect | Not Available |
|---|
| Disposition | |
|---|
| Process | Not Available |
|---|
| Role | Not Available |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | 328 - 330 °C | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | 0.91 mg/L @ 25 °C (est) | The Good Scents Company Information System | | LogP | Not Available | Not Available |
|
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 8.23 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 14.5567 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 3.02 minutes | 32390414 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 2947.9 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 165.0 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 215.0 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 162.4 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 333.6 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 632.0 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 747.2 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 124.2 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 1151.2 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 563.9 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1687.1 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 434.9 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 487.4 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 218.6 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 231.1 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 8.5 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Tomentosic acid,1TMS,isomer #1 | CC1(C)CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CC(O[Si](C)(C)C)C(O)C(C)(CO)C5CCC43C)C2C1O | 4283.1 | Semi standard non polar | 33892256 | | Tomentosic acid,1TMS,isomer #2 | CC1(C)CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CC(O)C(O[Si](C)(C)C)C(C)(CO)C5CCC43C)C2C1O | 4284.4 | Semi standard non polar | 33892256 | | Tomentosic acid,1TMS,isomer #3 | CC1(C)CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CC(O)C(O)C(C)(CO[Si](C)(C)C)C5CCC43C)C2C1O | 4281.7 | Semi standard non polar | 33892256 | | Tomentosic acid,1TMS,isomer #4 | CC1(C)CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CC(O)C(O)C(C)(CO)C5CCC43C)C2C1O[Si](C)(C)C | 4314.1 | Semi standard non polar | 33892256 | | Tomentosic acid,1TMS,isomer #5 | CC1(C)CCC2(C(=O)O[Si](C)(C)C)CCC3(C)C(=CCC4C5(C)CC(O)C(O)C(C)(CO)C5CCC43C)C2C1O | 4200.3 | Semi standard non polar | 33892256 | | Tomentosic acid,2TMS,isomer #1 | CC1(C)CCC2(C(=O)O[Si](C)(C)C)CCC3(C)C(=CCC4C5(C)CC(O[Si](C)(C)C)C(O)C(C)(CO)C5CCC43C)C2C1O | 4153.5 | Semi standard non polar | 33892256 | | Tomentosic acid,2TMS,isomer #10 | CC1(C)CCC2(C(=O)O[Si](C)(C)C)CCC3(C)C(=CCC4C5(C)CC(O)C(O)C(C)(CO)C5CCC43C)C2C1O[Si](C)(C)C | 4230.5 | Semi standard non polar | 33892256 | | Tomentosic acid,2TMS,isomer #2 | CC1(C)CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CC(O[Si](C)(C)C)C(O[Si](C)(C)C)C(C)(CO)C5CCC43C)C2C1O | 4268.9 | Semi standard non polar | 33892256 | | Tomentosic acid,2TMS,isomer #3 | CC1(C)CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CC(O[Si](C)(C)C)C(O)C(C)(CO[Si](C)(C)C)C5CCC43C)C2C1O | 4271.9 | Semi standard non polar | 33892256 | | Tomentosic acid,2TMS,isomer #4 | CC1(C)CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CC(O[Si](C)(C)C)C(O)C(C)(CO)C5CCC43C)C2C1O[Si](C)(C)C | 4237.9 | Semi standard non polar | 33892256 | | Tomentosic acid,2TMS,isomer #5 | CC1(C)CCC2(C(=O)O[Si](C)(C)C)CCC3(C)C(=CCC4C5(C)CC(O)C(O[Si](C)(C)C)C(C)(CO)C5CCC43C)C2C1O | 4155.7 | Semi standard non polar | 33892256 | | Tomentosic acid,2TMS,isomer #6 | CC1(C)CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CC(O)C(O[Si](C)(C)C)C(C)(CO[Si](C)(C)C)C5CCC43C)C2C1O | 4276.4 | Semi standard non polar | 33892256 | | Tomentosic acid,2TMS,isomer #7 | CC1(C)CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CC(O)C(O[Si](C)(C)C)C(C)(CO)C5CCC43C)C2C1O[Si](C)(C)C | 4241.7 | Semi standard non polar | 33892256 | | Tomentosic acid,2TMS,isomer #8 | CC1(C)CCC2(C(=O)O[Si](C)(C)C)CCC3(C)C(=CCC4C5(C)CC(O)C(O)C(C)(CO[Si](C)(C)C)C5CCC43C)C2C1O | 4200.6 | Semi standard non polar | 33892256 | | Tomentosic acid,2TMS,isomer #9 | CC1(C)CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CC(O)C(O)C(C)(CO[Si](C)(C)C)C5CCC43C)C2C1O[Si](C)(C)C | 4286.9 | Semi standard non polar | 33892256 | | Tomentosic acid,3TMS,isomer #1 | CC1(C)CCC2(C(=O)O[Si](C)(C)C)CCC3(C)C(=CCC4C5(C)CC(O[Si](C)(C)C)C(O[Si](C)(C)C)C(C)(CO)C5CCC43C)C2C1O | 4078.8 | Semi standard non polar | 33892256 | | Tomentosic acid,3TMS,isomer #10 | CC1(C)CCC2(C(=O)O[Si](C)(C)C)CCC3(C)C(=CCC4C5(C)CC(O)C(O)C(C)(CO[Si](C)(C)C)C5CCC43C)C2C1O[Si](C)(C)C | 4106.2 | Semi standard non polar | 33892256 | | Tomentosic acid,3TMS,isomer #2 | CC1(C)CCC2(C(=O)O[Si](C)(C)C)CCC3(C)C(=CCC4C5(C)CC(O[Si](C)(C)C)C(O)C(C)(CO[Si](C)(C)C)C5CCC43C)C2C1O | 4086.8 | Semi standard non polar | 33892256 | | Tomentosic acid,3TMS,isomer #3 | CC1(C)CCC2(C(=O)O[Si](C)(C)C)CCC3(C)C(=CCC4C5(C)CC(O[Si](C)(C)C)C(O)C(C)(CO)C5CCC43C)C2C1O[Si](C)(C)C | 4059.3 | Semi standard non polar | 33892256 | | Tomentosic acid,3TMS,isomer #4 | CC1(C)CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CC(O[Si](C)(C)C)C(O[Si](C)(C)C)C(C)(CO[Si](C)(C)C)C5CCC43C)C2C1O | 4236.5 | Semi standard non polar | 33892256 | | Tomentosic acid,3TMS,isomer #5 | CC1(C)CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CC(O[Si](C)(C)C)C(O[Si](C)(C)C)C(C)(CO)C5CCC43C)C2C1O[Si](C)(C)C | 4132.5 | Semi standard non polar | 33892256 | | Tomentosic acid,3TMS,isomer #6 | CC1(C)CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CC(O[Si](C)(C)C)C(O)C(C)(CO[Si](C)(C)C)C5CCC43C)C2C1O[Si](C)(C)C | 4151.0 | Semi standard non polar | 33892256 | | Tomentosic acid,3TMS,isomer #7 | CC1(C)CCC2(C(=O)O[Si](C)(C)C)CCC3(C)C(=CCC4C5(C)CC(O)C(O[Si](C)(C)C)C(C)(CO[Si](C)(C)C)C5CCC43C)C2C1O | 4080.7 | Semi standard non polar | 33892256 | | Tomentosic acid,3TMS,isomer #8 | CC1(C)CCC2(C(=O)O[Si](C)(C)C)CCC3(C)C(=CCC4C5(C)CC(O)C(O[Si](C)(C)C)C(C)(CO)C5CCC43C)C2C1O[Si](C)(C)C | 4058.0 | Semi standard non polar | 33892256 | | Tomentosic acid,3TMS,isomer #9 | CC1(C)CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CC(O)C(O[Si](C)(C)C)C(C)(CO[Si](C)(C)C)C5CCC43C)C2C1O[Si](C)(C)C | 4149.4 | Semi standard non polar | 33892256 | | Tomentosic acid,4TMS,isomer #1 | CC1(C)CCC2(C(=O)O[Si](C)(C)C)CCC3(C)C(=CCC4C5(C)CC(O[Si](C)(C)C)C(O[Si](C)(C)C)C(C)(CO[Si](C)(C)C)C5CCC43C)C2C1O | 4029.6 | Semi standard non polar | 33892256 | | Tomentosic acid,4TMS,isomer #2 | CC1(C)CCC2(C(=O)O[Si](C)(C)C)CCC3(C)C(=CCC4C5(C)CC(O[Si](C)(C)C)C(O[Si](C)(C)C)C(C)(CO)C5CCC43C)C2C1O[Si](C)(C)C | 3974.4 | Semi standard non polar | 33892256 | | Tomentosic acid,4TMS,isomer #3 | CC1(C)CCC2(C(=O)O[Si](C)(C)C)CCC3(C)C(=CCC4C5(C)CC(O[Si](C)(C)C)C(O)C(C)(CO[Si](C)(C)C)C5CCC43C)C2C1O[Si](C)(C)C | 3993.2 | Semi standard non polar | 33892256 | | Tomentosic acid,4TMS,isomer #4 | CC1(C)CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CC(O[Si](C)(C)C)C(O[Si](C)(C)C)C(C)(CO[Si](C)(C)C)C5CCC43C)C2C1O[Si](C)(C)C | 4077.5 | Semi standard non polar | 33892256 | | Tomentosic acid,4TMS,isomer #5 | CC1(C)CCC2(C(=O)O[Si](C)(C)C)CCC3(C)C(=CCC4C5(C)CC(O)C(O[Si](C)(C)C)C(C)(CO[Si](C)(C)C)C5CCC43C)C2C1O[Si](C)(C)C | 3976.7 | Semi standard non polar | 33892256 | | Tomentosic acid,5TMS,isomer #1 | CC1(C)CCC2(C(=O)O[Si](C)(C)C)CCC3(C)C(=CCC4C5(C)CC(O[Si](C)(C)C)C(O[Si](C)(C)C)C(C)(CO[Si](C)(C)C)C5CCC43C)C2C1O[Si](C)(C)C | 3934.7 | Semi standard non polar | 33892256 | | Tomentosic acid,1TBDMS,isomer #1 | CC1(C)CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CC(O[Si](C)(C)C(C)(C)C)C(O)C(C)(CO)C5CCC43C)C2C1O | 4504.4 | Semi standard non polar | 33892256 | | Tomentosic acid,1TBDMS,isomer #2 | CC1(C)CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CC(O)C(O[Si](C)(C)C(C)(C)C)C(C)(CO)C5CCC43C)C2C1O | 4509.4 | Semi standard non polar | 33892256 | | Tomentosic acid,1TBDMS,isomer #3 | CC1(C)CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CC(O)C(O)C(C)(CO[Si](C)(C)C(C)(C)C)C5CCC43C)C2C1O | 4518.1 | Semi standard non polar | 33892256 | | Tomentosic acid,1TBDMS,isomer #4 | CC1(C)CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CC(O)C(O)C(C)(CO)C5CCC43C)C2C1O[Si](C)(C)C(C)(C)C | 4535.2 | Semi standard non polar | 33892256 | | Tomentosic acid,1TBDMS,isomer #5 | CC1(C)CCC2(C(=O)O[Si](C)(C)C(C)(C)C)CCC3(C)C(=CCC4C5(C)CC(O)C(O)C(C)(CO)C5CCC43C)C2C1O | 4447.1 | Semi standard non polar | 33892256 | | Tomentosic acid,2TBDMS,isomer #1 | CC1(C)CCC2(C(=O)O[Si](C)(C)C(C)(C)C)CCC3(C)C(=CCC4C5(C)CC(O[Si](C)(C)C(C)(C)C)C(O)C(C)(CO)C5CCC43C)C2C1O | 4595.2 | Semi standard non polar | 33892256 | | Tomentosic acid,2TBDMS,isomer #10 | CC1(C)CCC2(C(=O)O[Si](C)(C)C(C)(C)C)CCC3(C)C(=CCC4C5(C)CC(O)C(O)C(C)(CO)C5CCC43C)C2C1O[Si](C)(C)C(C)(C)C | 4682.4 | Semi standard non polar | 33892256 | | Tomentosic acid,2TBDMS,isomer #2 | CC1(C)CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CC(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(C)(CO)C5CCC43C)C2C1O | 4700.1 | Semi standard non polar | 33892256 | | Tomentosic acid,2TBDMS,isomer #3 | CC1(C)CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CC(O[Si](C)(C)C(C)(C)C)C(O)C(C)(CO[Si](C)(C)C(C)(C)C)C5CCC43C)C2C1O | 4702.7 | Semi standard non polar | 33892256 | | Tomentosic acid,2TBDMS,isomer #4 | CC1(C)CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CC(O[Si](C)(C)C(C)(C)C)C(O)C(C)(CO)C5CCC43C)C2C1O[Si](C)(C)C(C)(C)C | 4659.5 | Semi standard non polar | 33892256 | | Tomentosic acid,2TBDMS,isomer #5 | CC1(C)CCC2(C(=O)O[Si](C)(C)C(C)(C)C)CCC3(C)C(=CCC4C5(C)CC(O)C(O[Si](C)(C)C(C)(C)C)C(C)(CO)C5CCC43C)C2C1O | 4603.3 | Semi standard non polar | 33892256 | | Tomentosic acid,2TBDMS,isomer #6 | CC1(C)CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CC(O)C(O[Si](C)(C)C(C)(C)C)C(C)(CO[Si](C)(C)C(C)(C)C)C5CCC43C)C2C1O | 4704.5 | Semi standard non polar | 33892256 | | Tomentosic acid,2TBDMS,isomer #7 | CC1(C)CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CC(O)C(O[Si](C)(C)C(C)(C)C)C(C)(CO)C5CCC43C)C2C1O[Si](C)(C)C(C)(C)C | 4663.6 | Semi standard non polar | 33892256 | | Tomentosic acid,2TBDMS,isomer #8 | CC1(C)CCC2(C(=O)O[Si](C)(C)C(C)(C)C)CCC3(C)C(=CCC4C5(C)CC(O)C(O)C(C)(CO[Si](C)(C)C(C)(C)C)C5CCC43C)C2C1O | 4653.1 | Semi standard non polar | 33892256 | | Tomentosic acid,2TBDMS,isomer #9 | CC1(C)CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CC(O)C(O)C(C)(CO[Si](C)(C)C(C)(C)C)C5CCC43C)C2C1O[Si](C)(C)C(C)(C)C | 4715.4 | Semi standard non polar | 33892256 | | Tomentosic acid,3TBDMS,isomer #1 | CC1(C)CCC2(C(=O)O[Si](C)(C)C(C)(C)C)CCC3(C)C(=CCC4C5(C)CC(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(C)(CO)C5CCC43C)C2C1O | 4729.2 | Semi standard non polar | 33892256 | | Tomentosic acid,3TBDMS,isomer #10 | CC1(C)CCC2(C(=O)O[Si](C)(C)C(C)(C)C)CCC3(C)C(=CCC4C5(C)CC(O)C(O)C(C)(CO[Si](C)(C)C(C)(C)C)C5CCC43C)C2C1O[Si](C)(C)C(C)(C)C | 4760.3 | Semi standard non polar | 33892256 | | Tomentosic acid,3TBDMS,isomer #2 | CC1(C)CCC2(C(=O)O[Si](C)(C)C(C)(C)C)CCC3(C)C(=CCC4C5(C)CC(O[Si](C)(C)C(C)(C)C)C(O)C(C)(CO[Si](C)(C)C(C)(C)C)C5CCC43C)C2C1O | 4728.3 | Semi standard non polar | 33892256 | | Tomentosic acid,3TBDMS,isomer #3 | CC1(C)CCC2(C(=O)O[Si](C)(C)C(C)(C)C)CCC3(C)C(=CCC4C5(C)CC(O[Si](C)(C)C(C)(C)C)C(O)C(C)(CO)C5CCC43C)C2C1O[Si](C)(C)C(C)(C)C | 4704.1 | Semi standard non polar | 33892256 | | Tomentosic acid,3TBDMS,isomer #4 | CC1(C)CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CC(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(C)(CO[Si](C)(C)C(C)(C)C)C5CCC43C)C2C1O | 4882.9 | Semi standard non polar | 33892256 | | Tomentosic acid,3TBDMS,isomer #5 | CC1(C)CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CC(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(C)(CO)C5CCC43C)C2C1O[Si](C)(C)C(C)(C)C | 4787.9 | Semi standard non polar | 33892256 | | Tomentosic acid,3TBDMS,isomer #6 | CC1(C)CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CC(O[Si](C)(C)C(C)(C)C)C(O)C(C)(CO[Si](C)(C)C(C)(C)C)C5CCC43C)C2C1O[Si](C)(C)C(C)(C)C | 4787.4 | Semi standard non polar | 33892256 | | Tomentosic acid,3TBDMS,isomer #7 | CC1(C)CCC2(C(=O)O[Si](C)(C)C(C)(C)C)CCC3(C)C(=CCC4C5(C)CC(O)C(O[Si](C)(C)C(C)(C)C)C(C)(CO[Si](C)(C)C(C)(C)C)C5CCC43C)C2C1O | 4735.0 | Semi standard non polar | 33892256 | | Tomentosic acid,3TBDMS,isomer #8 | CC1(C)CCC2(C(=O)O[Si](C)(C)C(C)(C)C)CCC3(C)C(=CCC4C5(C)CC(O)C(O[Si](C)(C)C(C)(C)C)C(C)(CO)C5CCC43C)C2C1O[Si](C)(C)C(C)(C)C | 4712.5 | Semi standard non polar | 33892256 | | Tomentosic acid,3TBDMS,isomer #9 | CC1(C)CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CC(O)C(O[Si](C)(C)C(C)(C)C)C(C)(CO[Si](C)(C)C(C)(C)C)C5CCC43C)C2C1O[Si](C)(C)C(C)(C)C | 4789.5 | Semi standard non polar | 33892256 |
|
|---|