| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Expected but not Quantified |
|---|
| Creation Date | 2012-09-11 21:09:46 UTC |
|---|
| Update Date | 2022-03-07 02:54:47 UTC |
|---|
| HMDB ID | HMDB0036095 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | 13-Hydroxyabscisic acid |
|---|
| Description | 13-Hydroxyabscisic acid belongs to the class of organic compounds known as abscisic acids and derivatives. These are terpene compounds containing the abscisic acid moiety, which is characterized by a 3-methylpenta-2,4-dienoic acid attached to the C1 carbon of a 4-oxocyclohex-2-ene moiety. Based on a literature review a small amount of articles have been published on 13-Hydroxyabscisic acid. |
|---|
| Structure | C\C(\C=C\C1(O)C(C)=CC(=O)CC1(C)CO)=C/C(O)=O InChI=1S/C15H20O5/c1-10(6-13(18)19)4-5-15(20)11(2)7-12(17)8-14(15,3)9-16/h4-7,16,20H,8-9H2,1-3H3,(H,18,19)/b5-4+,10-6+ |
|---|
| Synonyms | | Value | Source |
|---|
| 13-Hydroxyabscisate | Generator | | 5-[1-Hydroxy-6-(hydroxymethyl)-2,6-dimethyl-4-oxo-2-cyclohexen-1-yl]-3-methyl-2,4-pentadienoic acid | HMDB | | (2E,4E)-5-[1-Hydroxy-6-(hydroxymethyl)-2,6-dimethyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoate | Generator |
|
|---|
| Chemical Formula | C15H20O5 |
|---|
| Average Molecular Weight | 280.3163 |
|---|
| Monoisotopic Molecular Weight | 280.13107375 |
|---|
| IUPAC Name | (2E,4E)-5-[1-hydroxy-6-(hydroxymethyl)-2,6-dimethyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid |
|---|
| Traditional Name | (2E,4E)-5-[1-hydroxy-6-(hydroxymethyl)-2,6-dimethyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid |
|---|
| CAS Registry Number | 25841-53-6 |
|---|
| SMILES | C\C(\C=C\C1(O)C(C)=CC(=O)CC1(C)CO)=C/C(O)=O |
|---|
| InChI Identifier | InChI=1S/C15H20O5/c1-10(6-13(18)19)4-5-15(20)11(2)7-12(17)8-14(15,3)9-16/h4-7,16,20H,8-9H2,1-3H3,(H,18,19)/b5-4+,10-6+ |
|---|
| InChI Key | AVFORCKFTWHFAR-UMCKCUICSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as abscisic acids and derivatives. These are terpene compounds containing the abscisic acid moiety, which is characterized by a 3-methylpenta-2,4-dienoic acid attached to the C1 carbon of a 4-oxocyclohex-2-ene moiety. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Lipids and lipid-like molecules |
|---|
| Class | Prenol lipids |
|---|
| Sub Class | Sesquiterpenoids |
|---|
| Direct Parent | Abscisic acids and derivatives |
|---|
| Alternative Parents | |
|---|
| Substituents | - Abscisic acid
- Medium-chain fatty acid
- Branched fatty acid
- Cyclohexenone
- Hydroxy fatty acid
- Methyl-branched fatty acid
- Fatty acyl
- Fatty acid
- Unsaturated fatty acid
- Tertiary alcohol
- Cyclic ketone
- Ketone
- Carboxylic acid derivative
- Carboxylic acid
- Monocarboxylic acid or derivatives
- Hydrocarbon derivative
- Alcohol
- Organic oxygen compound
- Carbonyl group
- Organic oxide
- Primary alcohol
- Organooxygen compound
- Aliphatic homomonocyclic compound
|
|---|
| Molecular Framework | Aliphatic homomonocyclic compounds |
|---|
| External Descriptors | Not Available |
|---|
| Ontology |
|---|
| Physiological effect | Not Available |
|---|
| Disposition | |
|---|
| Process | |
|---|
| Role | |
|---|
| Physical Properties |
|---|
| State | Not Available |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 4.35 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 10.1607 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 1.71 minutes | 32390414 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 1645.0 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 202.2 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 104.6 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 156.0 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 50.9 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 304.3 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 323.3 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 72.2 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 694.8 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 267.9 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1012.0 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 216.4 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 247.3 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 353.1 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 187.0 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 54.5 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| 13-Hydroxyabscisic acid,1TMS,isomer #1 | CC1=CC(=O)CC(C)(CO)C1(/C=C/C(C)=C/C(=O)O)O[Si](C)(C)C | 2554.6 | Semi standard non polar | 33892256 | | 13-Hydroxyabscisic acid,1TMS,isomer #2 | CC1=CC(=O)CC(C)(CO[Si](C)(C)C)C1(O)/C=C/C(C)=C/C(=O)O | 2519.5 | Semi standard non polar | 33892256 | | 13-Hydroxyabscisic acid,1TMS,isomer #3 | CC1=CC(=O)CC(C)(CO)C1(O)/C=C/C(C)=C/C(=O)O[Si](C)(C)C | 2547.5 | Semi standard non polar | 33892256 | | 13-Hydroxyabscisic acid,1TMS,isomer #4 | CC1=CC(O[Si](C)(C)C)=CC(C)(CO)C1(O)/C=C/C(C)=C/C(=O)O | 2544.6 | Semi standard non polar | 33892256 | | 13-Hydroxyabscisic acid,2TMS,isomer #1 | CC1=CC(=O)CC(C)(CO[Si](C)(C)C)C1(/C=C/C(C)=C/C(=O)O)O[Si](C)(C)C | 2527.8 | Semi standard non polar | 33892256 | | 13-Hydroxyabscisic acid,2TMS,isomer #2 | CC1=CC(=O)CC(C)(CO)C1(/C=C/C(C)=C/C(=O)O[Si](C)(C)C)O[Si](C)(C)C | 2554.2 | Semi standard non polar | 33892256 | | 13-Hydroxyabscisic acid,2TMS,isomer #3 | CC1=CC(O[Si](C)(C)C)=CC(C)(CO)C1(/C=C/C(C)=C/C(=O)O)O[Si](C)(C)C | 2536.3 | Semi standard non polar | 33892256 | | 13-Hydroxyabscisic acid,2TMS,isomer #4 | CC1=CC(=O)CC(C)(CO[Si](C)(C)C)C1(O)/C=C/C(C)=C/C(=O)O[Si](C)(C)C | 2506.7 | Semi standard non polar | 33892256 | | 13-Hydroxyabscisic acid,2TMS,isomer #5 | CC1=CC(O[Si](C)(C)C)=CC(C)(CO[Si](C)(C)C)C1(O)/C=C/C(C)=C/C(=O)O | 2454.8 | Semi standard non polar | 33892256 | | 13-Hydroxyabscisic acid,2TMS,isomer #6 | CC1=CC(O[Si](C)(C)C)=CC(C)(CO)C1(O)/C=C/C(C)=C/C(=O)O[Si](C)(C)C | 2531.2 | Semi standard non polar | 33892256 | | 13-Hydroxyabscisic acid,3TMS,isomer #1 | CC1=CC(=O)CC(C)(CO[Si](C)(C)C)C1(/C=C/C(C)=C/C(=O)O[Si](C)(C)C)O[Si](C)(C)C | 2515.9 | Semi standard non polar | 33892256 | | 13-Hydroxyabscisic acid,3TMS,isomer #2 | CC1=CC(O[Si](C)(C)C)=CC(C)(CO[Si](C)(C)C)C1(/C=C/C(C)=C/C(=O)O)O[Si](C)(C)C | 2450.4 | Semi standard non polar | 33892256 | | 13-Hydroxyabscisic acid,3TMS,isomer #3 | CC1=CC(O[Si](C)(C)C)=CC(C)(CO)C1(/C=C/C(C)=C/C(=O)O[Si](C)(C)C)O[Si](C)(C)C | 2522.5 | Semi standard non polar | 33892256 | | 13-Hydroxyabscisic acid,3TMS,isomer #4 | CC1=CC(O[Si](C)(C)C)=CC(C)(CO[Si](C)(C)C)C1(O)/C=C/C(C)=C/C(=O)O[Si](C)(C)C | 2436.1 | Semi standard non polar | 33892256 | | 13-Hydroxyabscisic acid,4TMS,isomer #1 | CC1=CC(O[Si](C)(C)C)=CC(C)(CO[Si](C)(C)C)C1(/C=C/C(C)=C/C(=O)O[Si](C)(C)C)O[Si](C)(C)C | 2426.4 | Semi standard non polar | 33892256 | | 13-Hydroxyabscisic acid,4TMS,isomer #1 | CC1=CC(O[Si](C)(C)C)=CC(C)(CO[Si](C)(C)C)C1(/C=C/C(C)=C/C(=O)O[Si](C)(C)C)O[Si](C)(C)C | 2473.7 | Standard non polar | 33892256 | | 13-Hydroxyabscisic acid,1TBDMS,isomer #1 | CC1=CC(=O)CC(C)(CO)C1(/C=C/C(C)=C/C(=O)O)O[Si](C)(C)C(C)(C)C | 2799.8 | Semi standard non polar | 33892256 | | 13-Hydroxyabscisic acid,1TBDMS,isomer #2 | CC1=CC(=O)CC(C)(CO[Si](C)(C)C(C)(C)C)C1(O)/C=C/C(C)=C/C(=O)O | 2773.8 | Semi standard non polar | 33892256 | | 13-Hydroxyabscisic acid,1TBDMS,isomer #3 | CC1=CC(=O)CC(C)(CO)C1(O)/C=C/C(C)=C/C(=O)O[Si](C)(C)C(C)(C)C | 2797.8 | Semi standard non polar | 33892256 | | 13-Hydroxyabscisic acid,1TBDMS,isomer #4 | CC1=CC(O[Si](C)(C)C(C)(C)C)=CC(C)(CO)C1(O)/C=C/C(C)=C/C(=O)O | 2785.1 | Semi standard non polar | 33892256 | | 13-Hydroxyabscisic acid,2TBDMS,isomer #1 | CC1=CC(=O)CC(C)(CO[Si](C)(C)C(C)(C)C)C1(/C=C/C(C)=C/C(=O)O)O[Si](C)(C)C(C)(C)C | 3019.6 | Semi standard non polar | 33892256 | | 13-Hydroxyabscisic acid,2TBDMS,isomer #2 | CC1=CC(=O)CC(C)(CO)C1(/C=C/C(C)=C/C(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3021.2 | Semi standard non polar | 33892256 | | 13-Hydroxyabscisic acid,2TBDMS,isomer #3 | CC1=CC(O[Si](C)(C)C(C)(C)C)=CC(C)(CO)C1(/C=C/C(C)=C/C(=O)O)O[Si](C)(C)C(C)(C)C | 3010.0 | Semi standard non polar | 33892256 | | 13-Hydroxyabscisic acid,2TBDMS,isomer #4 | CC1=CC(=O)CC(C)(CO[Si](C)(C)C(C)(C)C)C1(O)/C=C/C(C)=C/C(=O)O[Si](C)(C)C(C)(C)C | 3027.4 | Semi standard non polar | 33892256 | | 13-Hydroxyabscisic acid,2TBDMS,isomer #5 | CC1=CC(O[Si](C)(C)C(C)(C)C)=CC(C)(CO[Si](C)(C)C(C)(C)C)C1(O)/C=C/C(C)=C/C(=O)O | 2959.1 | Semi standard non polar | 33892256 | | 13-Hydroxyabscisic acid,2TBDMS,isomer #6 | CC1=CC(O[Si](C)(C)C(C)(C)C)=CC(C)(CO)C1(O)/C=C/C(C)=C/C(=O)O[Si](C)(C)C(C)(C)C | 3004.6 | Semi standard non polar | 33892256 | | 13-Hydroxyabscisic acid,3TBDMS,isomer #1 | CC1=CC(=O)CC(C)(CO[Si](C)(C)C(C)(C)C)C1(/C=C/C(C)=C/C(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3238.7 | Semi standard non polar | 33892256 | | 13-Hydroxyabscisic acid,3TBDMS,isomer #2 | CC1=CC(O[Si](C)(C)C(C)(C)C)=CC(C)(CO[Si](C)(C)C(C)(C)C)C1(/C=C/C(C)=C/C(=O)O)O[Si](C)(C)C(C)(C)C | 3186.9 | Semi standard non polar | 33892256 | | 13-Hydroxyabscisic acid,3TBDMS,isomer #3 | CC1=CC(O[Si](C)(C)C(C)(C)C)=CC(C)(CO)C1(/C=C/C(C)=C/C(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3207.8 | Semi standard non polar | 33892256 | | 13-Hydroxyabscisic acid,3TBDMS,isomer #4 | CC1=CC(O[Si](C)(C)C(C)(C)C)=CC(C)(CO[Si](C)(C)C(C)(C)C)C1(O)/C=C/C(C)=C/C(=O)O[Si](C)(C)C(C)(C)C | 3154.6 | Semi standard non polar | 33892256 | | 13-Hydroxyabscisic acid,4TBDMS,isomer #1 | CC1=CC(O[Si](C)(C)C(C)(C)C)=CC(C)(CO[Si](C)(C)C(C)(C)C)C1(/C=C/C(C)=C/C(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3375.2 | Semi standard non polar | 33892256 | | 13-Hydroxyabscisic acid,4TBDMS,isomer #1 | CC1=CC(O[Si](C)(C)C(C)(C)C)=CC(C)(CO[Si](C)(C)C(C)(C)C)C1(/C=C/C(C)=C/C(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3225.1 | Standard non polar | 33892256 |
|
|---|