| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Expected but not Quantified |
|---|
| Creation Date | 2012-09-11 21:29:00 UTC |
|---|
| Update Date | 2022-03-07 02:54:53 UTC |
|---|
| HMDB ID | HMDB0036349 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Amlaic acid |
|---|
| Description | Amlaic acid, also known as amlaate, belongs to the class of organic compounds known as tannins. These are naturally occurring polyphenols which be categorized into four main classes: hydrolyzable tannin (based on ellagic acid or gallic acid), condensed tannins (made of oligomeric or polymeric proanthocyanidins), complex tannins (made of a catechin bound to a gallotannin or elagitannin), and phlorotannins (oligomers of phloroglucinol). Amlaic acid has been detected, but not quantified in, fruits. This could make amlaic acid a potential biomarker for the consumption of these foods. Based on a literature review very few articles have been published on Amlaic acid. |
|---|
| Structure | OCC1OC(OC(=O)C2=CC(O)=C(O)C(O)=C2)C2OC(=O)C3=C(C4C(CC(=O)OC4C(=O)OC1C2O)C(O)=O)C(O)=C(O)C(O)=C3 InChI=1S/C27H24O19/c28-5-12-20-19(36)22(27(42-12)46-24(39)6-1-9(29)16(33)10(30)2-6)45-25(40)8-3-11(31)17(34)18(35)14(8)15-7(23(37)38)4-13(32)43-21(15)26(41)44-20/h1-3,7,12,15,19-22,27-31,33-36H,4-5H2,(H,37,38) |
|---|
| Synonyms | | Value | Source |
|---|
| Amlaate | Generator | | Methyl 2-propenyl tetrasulphide | HMDB | | Allyl methyl tetrasulfide | HMDB | | 11,12,13,22-Tetrahydroxy-21-(hydroxymethyl)-3,6,16-trioxo-19-(3,4,5-trihydroxybenzoyloxy)-2,5,17,20-tetraoxatetracyclo[16.3.1.0⁴,⁹.0¹⁰,¹⁵]docosa-10,12,14-triene-8-carboxylate | HMDB |
|
|---|
| Chemical Formula | C27H24O19 |
|---|
| Average Molecular Weight | 652.4681 |
|---|
| Monoisotopic Molecular Weight | 652.091178586 |
|---|
| IUPAC Name | 11,12,13,22-tetrahydroxy-21-(hydroxymethyl)-3,6,16-trioxo-19-(3,4,5-trihydroxybenzoyloxy)-2,5,17,20-tetraoxatetracyclo[16.3.1.0⁴,⁹.0¹⁰,¹⁵]docosa-10(15),11,13-triene-8-carboxylic acid |
|---|
| Traditional Name | 11,12,13,22-tetrahydroxy-21-(hydroxymethyl)-3,6,16-trioxo-19-(3,4,5-trihydroxybenzoyloxy)-2,5,17,20-tetraoxatetracyclo[16.3.1.0⁴,⁹.0¹⁰,¹⁵]docosa-10(15),11,13-triene-8-carboxylic acid |
|---|
| CAS Registry Number | 17278-02-3 |
|---|
| SMILES | OCC1OC(OC(=O)C2=CC(O)=C(O)C(O)=C2)C2OC(=O)C3=C(C4C(CC(=O)OC4C(=O)OC1C2O)C(O)=O)C(O)=C(O)C(O)=C3 |
|---|
| InChI Identifier | InChI=1S/C27H24O19/c28-5-12-20-19(36)22(27(42-12)46-24(39)6-1-9(29)16(33)10(30)2-6)45-25(40)8-3-11(31)17(34)18(35)14(8)15-7(23(37)38)4-13(32)43-21(15)26(41)44-20/h1-3,7,12,15,19-22,27-31,33-36H,4-5H2,(H,37,38) |
|---|
| InChI Key | KFDXRACNJCIDON-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as tannins. These are naturally occurring polyphenols which be categorized into four main classes: Hydrolyzable tannin (based on ellagic acid or gallic acid), condensed tannins (made of oligomeric or polymeric proanthocyanidins), complex tannins (made of a catechin bound to a gallotannin or elagitannin), and phlorotannins (oligomers of phloroglucinol). |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Phenylpropanoids and polyketides |
|---|
| Class | Tannins |
|---|
| Sub Class | Not Available |
|---|
| Direct Parent | Tannins |
|---|
| Alternative Parents | |
|---|
| Substituents | - Tannin
- Pentacarboxylic acid or derivatives
- Galloyl ester
- Gallic acid or derivatives
- P-hydroxybenzoic acid alkyl ester
- M-hydroxybenzoic acid ester
- P-hydroxybenzoic acid ester
- Benzoate ester
- Pyrogallol derivative
- Benzenetriol
- Benzoic acid or derivatives
- Benzoyl
- Delta_valerolactone
- 1-hydroxy-4-unsubstituted benzenoid
- 1-hydroxy-2-unsubstituted benzenoid
- Phenol
- Delta valerolactone
- Monosaccharide
- Oxane
- Monocyclic benzene moiety
- Benzenoid
- Lactone
- Carboxylic acid ester
- Secondary alcohol
- Acetal
- Oxacycle
- Organoheterocyclic compound
- Carboxylic acid derivative
- Carboxylic acid
- Polyol
- Alcohol
- Carbonyl group
- Organic oxygen compound
- Primary alcohol
- Organic oxide
- Hydrocarbon derivative
- Organooxygen compound
- Aromatic heteropolycyclic compound
|
|---|
| Molecular Framework | Aromatic heteropolycyclic compounds |
|---|
| External Descriptors | Not Available |
|---|
| Ontology |
|---|
| Physiological effect | Not Available |
|---|
| Disposition | |
|---|
| Process | Not Available |
|---|
| Role | |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | 206 °C | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 2.91 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 13.4088 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 7.19 minutes | 32390414 | | AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid | 235.6 seconds | 40023050 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 1852.6 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 180.0 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 59.1 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 120.2 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 90.5 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 474.3 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 550.9 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 893.6 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 764.5 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 239.7 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1686.4 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 295.6 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 319.7 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 692.4 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 179.5 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 742.9 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Amlaic acid,1TMS,isomer #1 | C[Si](C)(C)OCC1OC(OC(=O)C2=CC(O)=C(O)C(O)=C2)C2OC(=O)C3=CC(O)=C(O)C(O)=C3C3C(C(=O)O)CC(=O)OC3C(=O)OC1C2O | 5847.9 | Semi standard non polar | 33892256 | | Amlaic acid,1TMS,isomer #2 | C[Si](C)(C)OC1=CC(C(=O)OC2OC(CO)C3OC(=O)C4OC(=O)CC(C(=O)O)C4C4=C(C=C(O)C(O)=C4O)C(=O)OC2C3O)=CC(O)=C1O | 5804.2 | Semi standard non polar | 33892256 | | Amlaic acid,1TMS,isomer #3 | C[Si](C)(C)OC1=C(O)C=C(C(=O)OC2OC(CO)C3OC(=O)C4OC(=O)CC(C(=O)O)C4C4=C(C=C(O)C(O)=C4O)C(=O)OC2C3O)C=C1O | 5744.3 | Semi standard non polar | 33892256 | | Amlaic acid,1TMS,isomer #4 | C[Si](C)(C)OC1C2OC(=O)C3OC(=O)CC(C(=O)O)C3C3=C(C=C(O)C(O)=C3O)C(=O)OC1C(OC(=O)C1=CC(O)=C(O)C(O)=C1)OC2CO | 5842.9 | Semi standard non polar | 33892256 | | Amlaic acid,1TMS,isomer #5 | C[Si](C)(C)OC(=O)C1CC(=O)OC2C(=O)OC3C(CO)OC(OC(=O)C4=CC(O)=C(O)C(O)=C4)C(OC(=O)C4=CC(O)=C(O)C(O)=C4C12)C3O | 5775.0 | Semi standard non polar | 33892256 | | Amlaic acid,1TMS,isomer #6 | C[Si](C)(C)OC1=C(O)C(O)=CC2=C1C1C(C(=O)O)CC(=O)OC1C(=O)OC1C(CO)OC(OC(=O)C3=CC(O)=C(O)C(O)=C3)C(OC2=O)C1O | 5750.3 | Semi standard non polar | 33892256 | | Amlaic acid,1TMS,isomer #7 | C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3C(OC(=O)C4=CC(O)=C(O)C(O)=C4)OC(CO)C(OC(=O)C4OC(=O)CC(C(=O)O)C4C2=C1O)C3O | 5695.3 | Semi standard non polar | 33892256 | | Amlaic acid,1TMS,isomer #8 | C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1C(C(=O)O)CC(=O)OC1C(=O)OC1C(CO)OC(OC(=O)C3=CC(O)=C(O)C(O)=C3)C(OC2=O)C1O | 5811.2 | Semi standard non polar | 33892256 | | Amlaic acid,2TMS,isomer #1 | C[Si](C)(C)OCC1OC(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C2OC(=O)C3=CC(O)=C(O)C(O)=C3C3C(C(=O)O)CC(=O)OC3C(=O)OC1C2O | 5685.2 | Semi standard non polar | 33892256 | | Amlaic acid,2TMS,isomer #10 | C[Si](C)(C)OC1=CC(C(=O)OC2OC(CO)C3OC(=O)C4OC(=O)CC(C(=O)O)C4C4=C(C=C(O)C(O[Si](C)(C)C)=C4O)C(=O)OC2C3O)=CC(O)=C1O | 5503.9 | Semi standard non polar | 33892256 | | Amlaic acid,2TMS,isomer #11 | C[Si](C)(C)OC1=CC(C(=O)OC2OC(CO)C3OC(=O)C4OC(=O)CC(C(=O)O)C4C4=C(C=C(O)C(O)=C4O[Si](C)(C)C)C(=O)OC2C3O)=CC(O)=C1O | 5575.6 | Semi standard non polar | 33892256 | | Amlaic acid,2TMS,isomer #12 | C[Si](C)(C)OC1=CC(C(=O)OC2OC(CO)C3OC(=O)C4OC(=O)CC(C(=O)O)C4C4=C(C=C(O)C(O)=C4O)C(=O)OC2C3O[Si](C)(C)C)=CC(O)=C1O | 5676.0 | Semi standard non polar | 33892256 | | Amlaic acid,2TMS,isomer #13 | C[Si](C)(C)OC1=CC(C(=O)OC2OC(CO)C3OC(=O)C4OC(=O)CC(C(=O)O)C4C4=C(C=C(O)C(O)=C4O)C(=O)OC2C3O)=CC(O[Si](C)(C)C)=C1O | 5653.7 | Semi standard non polar | 33892256 | | Amlaic acid,2TMS,isomer #14 | C[Si](C)(C)OC1=CC(C(=O)OC2OC(CO)C3OC(=O)C4OC(=O)CC(C(=O)O)C4C4=C(C=C(O)C(O)=C4O)C(=O)OC2C3O)=CC(O)=C1O[Si](C)(C)C | 5573.8 | Semi standard non polar | 33892256 | | Amlaic acid,2TMS,isomer #15 | C[Si](C)(C)OC(=O)C1CC(=O)OC2C(=O)OC3C(CO)OC(OC(=O)C4=CC(O)=C(O[Si](C)(C)C)C(O)=C4)C(OC(=O)C4=CC(O)=C(O)C(O)=C4C12)C3O | 5516.0 | Semi standard non polar | 33892256 | | Amlaic acid,2TMS,isomer #16 | C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1C(C(=O)O)CC(=O)OC1C(=O)OC1C(CO)OC(OC(=O)C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)C(OC2=O)C1O | 5557.5 | Semi standard non polar | 33892256 | | Amlaic acid,2TMS,isomer #17 | C[Si](C)(C)OC1=C(O)C=C(C(=O)OC2OC(CO)C3OC(=O)C4OC(=O)CC(C(=O)O)C4C4=C(C=C(O)C(O[Si](C)(C)C)=C4O)C(=O)OC2C3O)C=C1O | 5473.7 | Semi standard non polar | 33892256 | | Amlaic acid,2TMS,isomer #18 | C[Si](C)(C)OC1=C(O)C=C(C(=O)OC2OC(CO)C3OC(=O)C4OC(=O)CC(C(=O)O)C4C4=C(C=C(O)C(O)=C4O[Si](C)(C)C)C(=O)OC2C3O)C=C1O | 5527.5 | Semi standard non polar | 33892256 | | Amlaic acid,2TMS,isomer #19 | C[Si](C)(C)OC1=C(O)C=C(C(=O)OC2OC(CO)C3OC(=O)C4OC(=O)CC(C(=O)O)C4C4=C(C=C(O)C(O)=C4O)C(=O)OC2C3O[Si](C)(C)C)C=C1O | 5631.3 | Semi standard non polar | 33892256 | | Amlaic acid,2TMS,isomer #2 | C[Si](C)(C)OCC1OC(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C2OC(=O)C3=CC(O)=C(O)C(O)=C3C3C(C(=O)O)CC(=O)OC3C(=O)OC1C2O | 5639.7 | Semi standard non polar | 33892256 | | Amlaic acid,2TMS,isomer #20 | C[Si](C)(C)OC(=O)C1CC(=O)OC2C(=O)OC3C(CO)OC(OC(=O)C4=CC(O)=C(O)C(O)=C4)C(OC(=O)C4=CC(O)=C(O)C(O)=C4C12)C3O[Si](C)(C)C | 5661.6 | Semi standard non polar | 33892256 | | Amlaic acid,2TMS,isomer #21 | C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1C(C(=O)O)CC(=O)OC1C(=O)OC1C(CO)OC(OC(=O)C3=CC(O)=C(O)C(O)=C3)C(OC2=O)C1O[Si](C)(C)C | 5685.1 | Semi standard non polar | 33892256 | | Amlaic acid,2TMS,isomer #22 | C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3C(OC(=O)C4=CC(O)=C(O)C(O)=C4)OC(CO)C(OC(=O)C4OC(=O)CC(C(=O)O)C4C2=C1O)C3O[Si](C)(C)C | 5587.8 | Semi standard non polar | 33892256 | | Amlaic acid,2TMS,isomer #23 | C[Si](C)(C)OC1=C(O)C(O)=CC2=C1C1C(C(=O)O)CC(=O)OC1C(=O)OC1C(CO)OC(OC(=O)C3=CC(O)=C(O)C(O)=C3)C(OC2=O)C1O[Si](C)(C)C | 5650.4 | Semi standard non polar | 33892256 | | Amlaic acid,2TMS,isomer #24 | C[Si](C)(C)OC(=O)C1CC(=O)OC2C(=O)OC3C(CO)OC(OC(=O)C4=CC(O)=C(O)C(O)=C4)C(OC(=O)C4=CC(O[Si](C)(C)C)=C(O)C(O)=C4C12)C3O | 5570.6 | Semi standard non polar | 33892256 | | Amlaic acid,2TMS,isomer #25 | C[Si](C)(C)OC(=O)C1CC(=O)OC2C(=O)OC3C(CO)OC(OC(=O)C4=CC(O)=C(O)C(O)=C4)C(OC(=O)C4=CC(O)=C(O[Si](C)(C)C)C(O)=C4C12)C3O | 5481.4 | Semi standard non polar | 33892256 | | Amlaic acid,2TMS,isomer #26 | C[Si](C)(C)OC(=O)C1CC(=O)OC2C(=O)OC3C(CO)OC(OC(=O)C4=CC(O)=C(O)C(O)=C4)C(OC(=O)C4=CC(O)=C(O)C(O[Si](C)(C)C)=C4C12)C3O | 5542.7 | Semi standard non polar | 33892256 | | Amlaic acid,2TMS,isomer #27 | C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3C(OC(=O)C4=CC(O)=C(O)C(O)=C4)OC(CO)C(OC(=O)C4OC(=O)CC(C(=O)O)C4C2=C1O[Si](C)(C)C)C3O | 5556.2 | Semi standard non polar | 33892256 | | Amlaic acid,2TMS,isomer #28 | C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1C(C(=O)O)CC(=O)OC1C(=O)OC1C(CO)OC(OC(=O)C3=CC(O)=C(O)C(O)=C3)C(OC2=O)C1O | 5629.8 | Semi standard non polar | 33892256 | | Amlaic acid,2TMS,isomer #29 | C[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C)C1C(C(=O)O)CC(=O)OC1C(=O)OC1C(CO)OC(OC(=O)C3=CC(O)=C(O)C(O)=C3)C(OC2=O)C1O | 5556.9 | Semi standard non polar | 33892256 | | Amlaic acid,2TMS,isomer #3 | C[Si](C)(C)OCC1OC(OC(=O)C2=CC(O)=C(O)C(O)=C2)C2OC(=O)C3=CC(O[Si](C)(C)C)=C(O)C(O)=C3C3C(C(=O)O)CC(=O)OC3C(=O)OC1C2O | 5692.4 | Semi standard non polar | 33892256 | | Amlaic acid,2TMS,isomer #4 | C[Si](C)(C)OCC1OC(OC(=O)C2=CC(O)=C(O)C(O)=C2)C2OC(=O)C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3C3C(C(=O)O)CC(=O)OC3C(=O)OC1C2O | 5583.1 | Semi standard non polar | 33892256 | | Amlaic acid,2TMS,isomer #5 | C[Si](C)(C)OCC1OC(OC(=O)C2=CC(O)=C(O)C(O)=C2)C2OC(=O)C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3C3C(C(=O)O)CC(=O)OC3C(=O)OC1C2O | 5658.1 | Semi standard non polar | 33892256 | | Amlaic acid,2TMS,isomer #6 | C[Si](C)(C)OCC1OC(OC(=O)C2=CC(O)=C(O)C(O)=C2)C2OC(=O)C3=CC(O)=C(O)C(O)=C3C3C(C(=O)O[Si](C)(C)C)CC(=O)OC3C(=O)OC1C2O | 5679.0 | Semi standard non polar | 33892256 | | Amlaic acid,2TMS,isomer #7 | C[Si](C)(C)OCC1OC(OC(=O)C2=CC(O)=C(O)C(O)=C2)C2OC(=O)C3=CC(O)=C(O)C(O)=C3C3C(C(=O)O)CC(=O)OC3C(=O)OC1C2O[Si](C)(C)C | 5759.6 | Semi standard non polar | 33892256 | | Amlaic acid,2TMS,isomer #8 | C[Si](C)(C)OC(=O)C1CC(=O)OC2C(=O)OC3C(CO)OC(OC(=O)C4=CC(O)=C(O)C(O[Si](C)(C)C)=C4)C(OC(=O)C4=CC(O)=C(O)C(O)=C4C12)C3O | 5561.5 | Semi standard non polar | 33892256 | | Amlaic acid,2TMS,isomer #9 | C[Si](C)(C)OC1=CC(C(=O)OC2OC(CO)C3OC(=O)C4OC(=O)CC(C(=O)O)C4C4=C(C=C(O[Si](C)(C)C)C(O)=C4O)C(=O)OC2C3O)=CC(O)=C1O | 5612.4 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #1 | C[Si](C)(C)OCC1OC(OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C2OC(=O)C3=CC(O)=C(O)C(O)=C3C3C(C(=O)O)CC(=O)OC3C(=O)OC1C2O | 5540.8 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #10 | C[Si](C)(C)OCC1OC(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C2OC(=O)C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3C3C(C(=O)O)CC(=O)OC3C(=O)OC1C2O | 5437.5 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #11 | C[Si](C)(C)OCC1OC(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C2OC(=O)C3=CC(O)=C(O)C(O)=C3C3C(C(=O)O[Si](C)(C)C)CC(=O)OC3C(=O)OC1C2O | 5431.4 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #12 | C[Si](C)(C)OCC1OC(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C2OC(=O)C3=CC(O)=C(O)C(O)=C3C3C(C(=O)O)CC(=O)OC3C(=O)OC1C2O[Si](C)(C)C | 5548.4 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #13 | C[Si](C)(C)OCC1OC(OC(=O)C2=CC(O)=C(O)C(O)=C2)C2OC(=O)C3=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)=C3C3C(C(=O)O)CC(=O)OC3C(=O)OC1C2O | 5447.8 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #14 | C[Si](C)(C)OCC1OC(OC(=O)C2=CC(O)=C(O)C(O)=C2)C2OC(=O)C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3C3C(C(=O)O)CC(=O)OC3C(=O)OC1C2O | 5528.3 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #15 | C[Si](C)(C)OCC1OC(OC(=O)C2=CC(O)=C(O)C(O)=C2)C2OC(=O)C3=CC(O[Si](C)(C)C)=C(O)C(O)=C3C3C(C(=O)O[Si](C)(C)C)CC(=O)OC3C(=O)OC1C2O | 5473.5 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #16 | C[Si](C)(C)OCC1OC(OC(=O)C2=CC(O)=C(O)C(O)=C2)C2OC(=O)C3=CC(O[Si](C)(C)C)=C(O)C(O)=C3C3C(C(=O)O)CC(=O)OC3C(=O)OC1C2O[Si](C)(C)C | 5594.7 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #17 | C[Si](C)(C)OCC1OC(OC(=O)C2=CC(O)=C(O)C(O)=C2)C2OC(=O)C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3C3C(C(=O)O)CC(=O)OC3C(=O)OC1C2O | 5474.5 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #18 | C[Si](C)(C)OCC1OC(OC(=O)C2=CC(O)=C(O)C(O)=C2)C2OC(=O)C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3C3C(C(=O)O[Si](C)(C)C)CC(=O)OC3C(=O)OC1C2O | 5377.9 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #19 | C[Si](C)(C)OCC1OC(OC(=O)C2=CC(O)=C(O)C(O)=C2)C2OC(=O)C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3C3C(C(=O)O)CC(=O)OC3C(=O)OC1C2O[Si](C)(C)C | 5474.6 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #2 | C[Si](C)(C)OCC1OC(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C2OC(=O)C3=CC(O)=C(O)C(O)=C3C3C(C(=O)O)CC(=O)OC3C(=O)OC1C2O | 5471.2 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #20 | C[Si](C)(C)OCC1OC(OC(=O)C2=CC(O)=C(O)C(O)=C2)C2OC(=O)C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3C3C(C(=O)O[Si](C)(C)C)CC(=O)OC3C(=O)OC1C2O | 5462.0 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #21 | C[Si](C)(C)OCC1OC(OC(=O)C2=CC(O)=C(O)C(O)=C2)C2OC(=O)C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3C3C(C(=O)O)CC(=O)OC3C(=O)OC1C2O[Si](C)(C)C | 5575.5 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #22 | C[Si](C)(C)OCC1OC(OC(=O)C2=CC(O)=C(O)C(O)=C2)C2OC(=O)C3=CC(O)=C(O)C(O)=C3C3C(C(=O)O[Si](C)(C)C)CC(=O)OC3C(=O)OC1C2O[Si](C)(C)C | 5583.0 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #23 | C[Si](C)(C)OC(=O)C1CC(=O)OC2C(=O)OC3C(CO)OC(OC(=O)C4=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C4)C(OC(=O)C4=CC(O)=C(O)C(O)=C4C12)C3O | 5388.4 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #24 | C[Si](C)(C)OC(=O)C1CC(=O)OC2C(=O)OC3C(CO)OC(OC(=O)C4=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(OC(=O)C4=CC(O)=C(O)C(O)=C4C12)C3O | 5341.3 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #25 | C[Si](C)(C)OC(=O)C1CC(=O)OC2C(=O)OC3C(CO)OC(OC(=O)C4=CC(O)=C(O)C(O[Si](C)(C)C)=C4)C(OC(=O)C4=CC(O[Si](C)(C)C)=C(O)C(O)=C4C12)C3O | 5335.3 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #26 | C[Si](C)(C)OC(=O)C1CC(=O)OC2C(=O)OC3C(CO)OC(OC(=O)C4=CC(O)=C(O)C(O[Si](C)(C)C)=C4)C(OC(=O)C4=CC(O)=C(O[Si](C)(C)C)C(O)=C4C12)C3O | 5253.4 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #27 | C[Si](C)(C)OC(=O)C1CC(=O)OC2C(=O)OC3C(CO)OC(OC(=O)C4=CC(O)=C(O)C(O[Si](C)(C)C)=C4)C(OC(=O)C4=CC(O)=C(O)C(O[Si](C)(C)C)=C4C12)C3O | 5319.3 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #28 | C[Si](C)(C)OC(=O)C1CC(=O)OC2C(=O)OC3C(CO)OC(OC(=O)C4=CC(O)=C(O)C(O[Si](C)(C)C)=C4)C(OC(=O)C4=CC(O)=C(O)C(O)=C4C12)C3O[Si](C)(C)C | 5446.4 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #29 | C[Si](C)(C)OC1=CC(C(=O)OC2OC(CO)C3OC(=O)C4OC(=O)CC(C(=O)O)C4C4=C(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4O)C(=O)OC2C3O)=CC(O)=C1O | 5350.3 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #3 | C[Si](C)(C)OCC1OC(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C2OC(=O)C3=CC(O[Si](C)(C)C)=C(O)C(O)=C3C3C(C(=O)O)CC(=O)OC3C(=O)OC1C2O | 5494.0 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #30 | C[Si](C)(C)OC1=CC(C(=O)OC2OC(CO)C3OC(=O)C4OC(=O)CC(C(=O)O)C4C4=C(C=C(O[Si](C)(C)C)C(O)=C4O[Si](C)(C)C)C(=O)OC2C3O)=CC(O)=C1O | 5398.4 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #31 | C[Si](C)(C)OC1=CC(C(=O)OC2OC(CO)C3OC(=O)C4OC(=O)CC(C(=O)O)C4C4=C(C=C(O[Si](C)(C)C)C(O)=C4O)C(=O)OC2C3O[Si](C)(C)C)=CC(O)=C1O | 5470.4 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #32 | C[Si](C)(C)OC1=CC(C(=O)OC2OC(CO)C3OC(=O)C4OC(=O)CC(C(=O)O)C4C4=C(C=C(O[Si](C)(C)C)C(O)=C4O)C(=O)OC2C3O)=CC(O[Si](C)(C)C)=C1O | 5424.6 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #33 | C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1C(C(=O)O)CC(=O)OC1C(=O)OC1C(CO)OC(OC(=O)C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)C(OC2=O)C1O | 5357.0 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #34 | C[Si](C)(C)OC1=CC(C(=O)OC2OC(CO)C3OC(=O)C4OC(=O)CC(C(=O)O)C4C4=C(C=C(O)C(O[Si](C)(C)C)=C4O[Si](C)(C)C)C(=O)OC2C3O)=CC(O)=C1O | 5344.5 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #35 | C[Si](C)(C)OC1=CC(C(=O)OC2OC(CO)C3OC(=O)C4OC(=O)CC(C(=O)O)C4C4=C(C=C(O)C(O[Si](C)(C)C)=C4O)C(=O)OC2C3O[Si](C)(C)C)=CC(O)=C1O | 5378.4 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #36 | C[Si](C)(C)OC1=CC(C(=O)OC2OC(CO)C3OC(=O)C4OC(=O)CC(C(=O)O)C4C4=C(C=C(O)C(O[Si](C)(C)C)=C4O)C(=O)OC2C3O)=CC(O[Si](C)(C)C)=C1O | 5349.8 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #37 | C[Si](C)(C)OC1=CC(C(=O)OC2OC(CO)C3OC(=O)C4OC(=O)CC(C(=O)O)C4C4=C(C=C(O)C(O[Si](C)(C)C)=C4O)C(=O)OC2C3O)=CC(O)=C1O[Si](C)(C)C | 5269.9 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #38 | C[Si](C)(C)OC1=CC(C(=O)OC2OC(CO)C3OC(=O)C4OC(=O)CC(C(=O)O)C4C4=C(C=C(O)C(O)=C4O[Si](C)(C)C)C(=O)OC2C3O[Si](C)(C)C)=CC(O)=C1O | 5446.6 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #39 | C[Si](C)(C)OC1=CC(C(=O)OC2OC(CO)C3OC(=O)C4OC(=O)CC(C(=O)O)C4C4=C(C=C(O)C(O)=C4O[Si](C)(C)C)C(=O)OC2C3O)=CC(O[Si](C)(C)C)=C1O | 5399.8 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #4 | C[Si](C)(C)OCC1OC(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C2OC(=O)C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3C3C(C(=O)O)CC(=O)OC3C(=O)OC1C2O | 5395.6 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #40 | C[Si](C)(C)OC1=CC(C(=O)OC2OC(CO)C3OC(=O)C4OC(=O)CC(C(=O)O)C4C4=C(C=C(O)C(O)=C4O[Si](C)(C)C)C(=O)OC2C3O)=CC(O)=C1O[Si](C)(C)C | 5338.1 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #41 | C[Si](C)(C)OC1=CC(C(=O)OC2OC(CO)C3OC(=O)C4OC(=O)CC(C(=O)O)C4C4=C(C=C(O)C(O)=C4O)C(=O)OC2C3O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C1O | 5521.4 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #42 | C[Si](C)(C)OC1=CC(C(=O)OC2OC(CO)C3OC(=O)C4OC(=O)CC(C(=O)O)C4C4=C(C=C(O)C(O)=C4O)C(=O)OC2C3O[Si](C)(C)C)=CC(O)=C1O[Si](C)(C)C | 5459.2 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #43 | C[Si](C)(C)OC1=CC(C(=O)OC2OC(CO)C3OC(=O)C4OC(=O)CC(C(=O)O)C4C4=C(C=C(O)C(O)=C4O)C(=O)OC2C3O)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C | 5436.3 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #44 | C[Si](C)(C)OC(=O)C1CC(=O)OC2C(=O)OC3C(CO)OC(OC(=O)C4=CC(O)=C(O[Si](C)(C)C)C(O)=C4)C(OC(=O)C4=CC(O[Si](C)(C)C)=C(O)C(O)=C4C12)C3O | 5287.1 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #45 | C[Si](C)(C)OC(=O)C1CC(=O)OC2C(=O)OC3C(CO)OC(OC(=O)C4=CC(O)=C(O[Si](C)(C)C)C(O)=C4)C(OC(=O)C4=CC(O)=C(O[Si](C)(C)C)C(O)=C4C12)C3O | 5234.1 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #46 | C[Si](C)(C)OC(=O)C1CC(=O)OC2C(=O)OC3C(CO)OC(OC(=O)C4=CC(O)=C(O[Si](C)(C)C)C(O)=C4)C(OC(=O)C4=CC(O)=C(O)C(O[Si](C)(C)C)=C4C12)C3O | 5267.0 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #47 | C[Si](C)(C)OC(=O)C1CC(=O)OC2C(=O)OC3C(CO)OC(OC(=O)C4=CC(O)=C(O[Si](C)(C)C)C(O)=C4)C(OC(=O)C4=CC(O)=C(O)C(O)=C4C12)C3O[Si](C)(C)C | 5403.0 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #48 | C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1C(C(=O)O)CC(=O)OC1C(=O)OC1C(CO)OC(OC(=O)C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)C(OC2=O)C1O | 5347.4 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #49 | C[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C)C1C(C(=O)O)CC(=O)OC1C(=O)OC1C(CO)OC(OC(=O)C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)C(OC2=O)C1O | 5309.8 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #5 | C[Si](C)(C)OCC1OC(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C2OC(=O)C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3C3C(C(=O)O)CC(=O)OC3C(=O)OC1C2O | 5475.7 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #50 | C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1C(C(=O)O)CC(=O)OC1C(=O)OC1C(CO)OC(OC(=O)C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)C(OC2=O)C1O[Si](C)(C)C | 5427.1 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #51 | C[Si](C)(C)OC1=C(O)C=C(C(=O)OC2OC(CO)C3OC(=O)C4OC(=O)CC(C(=O)O)C4C4=C(C=C(O)C(O[Si](C)(C)C)=C4O[Si](C)(C)C)C(=O)OC2C3O)C=C1O | 5292.9 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #52 | C[Si](C)(C)OC1=C(O)C=C(C(=O)OC2OC(CO)C3OC(=O)C4OC(=O)CC(C(=O)O)C4C4=C(C=C(O)C(O[Si](C)(C)C)=C4O)C(=O)OC2C3O[Si](C)(C)C)C=C1O | 5344.7 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #53 | C[Si](C)(C)OC1=C(O)C=C(C(=O)OC2OC(CO)C3OC(=O)C4OC(=O)CC(C(=O)O)C4C4=C(C=C(O)C(O)=C4O[Si](C)(C)C)C(=O)OC2C3O[Si](C)(C)C)C=C1O | 5404.4 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #54 | C[Si](C)(C)OC(=O)C1CC(=O)OC2C(=O)OC3C(CO)OC(OC(=O)C4=CC(O)=C(O)C(O)=C4)C(OC(=O)C4=CC(O[Si](C)(C)C)=C(O)C(O)=C4C12)C3O[Si](C)(C)C | 5454.8 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #55 | C[Si](C)(C)OC(=O)C1CC(=O)OC2C(=O)OC3C(CO)OC(OC(=O)C4=CC(O)=C(O)C(O)=C4)C(OC(=O)C4=CC(O)=C(O[Si](C)(C)C)C(O)=C4C12)C3O[Si](C)(C)C | 5372.8 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #56 | C[Si](C)(C)OC(=O)C1CC(=O)OC2C(=O)OC3C(CO)OC(OC(=O)C4=CC(O)=C(O)C(O)=C4)C(OC(=O)C4=CC(O)=C(O)C(O[Si](C)(C)C)=C4C12)C3O[Si](C)(C)C | 5433.6 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #57 | C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1C(C(=O)O)CC(=O)OC1C(=O)OC1C(CO)OC(OC(=O)C3=CC(O)=C(O)C(O)=C3)C(OC2=O)C1O[Si](C)(C)C | 5505.4 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #58 | C[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C)C1C(C(=O)O)CC(=O)OC1C(=O)OC1C(CO)OC(OC(=O)C3=CC(O)=C(O)C(O)=C3)C(OC2=O)C1O[Si](C)(C)C | 5447.6 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #59 | C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3C(OC(=O)C4=CC(O)=C(O)C(O)=C4)OC(CO)C(OC(=O)C4OC(=O)CC(C(=O)O)C4C2=C1O[Si](C)(C)C)C3O[Si](C)(C)C | 5452.0 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #6 | C[Si](C)(C)OCC1OC(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C2OC(=O)C3=CC(O)=C(O)C(O)=C3C3C(C(=O)O[Si](C)(C)C)CC(=O)OC3C(=O)OC1C2O | 5466.4 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #60 | C[Si](C)(C)OC(=O)C1CC(=O)OC2C(=O)OC3C(CO)OC(OC(=O)C4=CC(O)=C(O)C(O)=C4)C(OC(=O)C4=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)=C4C12)C3O | 5338.3 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #61 | C[Si](C)(C)OC(=O)C1CC(=O)OC2C(=O)OC3C(CO)OC(OC(=O)C4=CC(O)=C(O)C(O)=C4)C(OC(=O)C4=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C4C12)C3O | 5382.2 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #62 | C[Si](C)(C)OC(=O)C1CC(=O)OC2C(=O)OC3C(CO)OC(OC(=O)C4=CC(O)=C(O)C(O)=C4)C(OC(=O)C4=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4C12)C3O | 5335.2 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #63 | C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C1C(C(=O)O)CC(=O)OC1C(=O)OC1C(CO)OC(OC(=O)C3=CC(O)=C(O)C(O)=C3)C(OC2=O)C1O | 5438.7 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #7 | C[Si](C)(C)OCC1OC(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C2OC(=O)C3=CC(O)=C(O)C(O)=C3C3C(C(=O)O)CC(=O)OC3C(=O)OC1C2O[Si](C)(C)C | 5588.7 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #8 | C[Si](C)(C)OCC1OC(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C2OC(=O)C3=CC(O[Si](C)(C)C)=C(O)C(O)=C3C3C(C(=O)O)CC(=O)OC3C(=O)OC1C2O | 5455.8 | Semi standard non polar | 33892256 | | Amlaic acid,3TMS,isomer #9 | C[Si](C)(C)OCC1OC(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C2OC(=O)C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3C3C(C(=O)O)CC(=O)OC3C(=O)OC1C2O | 5365.3 | Semi standard non polar | 33892256 | | Amlaic acid,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OCC1OC(OC(=O)C2=CC(O)=C(O)C(O)=C2)C2OC(=O)C3=CC(O)=C(O)C(O)=C3C3C(C(=O)O)CC(=O)OC3C(=O)OC1C2O | 6030.1 | Semi standard non polar | 33892256 | | Amlaic acid,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC1=CC(C(=O)OC2OC(CO)C3OC(=O)C4OC(=O)CC(C(=O)O)C4C4=C(C=C(O)C(O)=C4O)C(=O)OC2C3O)=CC(O)=C1O | 5969.1 | Semi standard non polar | 33892256 | | Amlaic acid,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C(=O)OC2OC(CO)C3OC(=O)C4OC(=O)CC(C(=O)O)C4C4=C(C=C(O)C(O)=C4O)C(=O)OC2C3O)C=C1O | 5942.3 | Semi standard non polar | 33892256 | | Amlaic acid,1TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC1C2OC(=O)C3OC(=O)CC(C(=O)O)C3C3=C(C=C(O)C(O)=C3O)C(=O)OC1C(OC(=O)C1=CC(O)=C(O)C(O)=C1)OC2CO | 6064.8 | Semi standard non polar | 33892256 | | Amlaic acid,1TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC(=O)C1CC(=O)OC2C(=O)OC3C(CO)OC(OC(=O)C4=CC(O)=C(O)C(O)=C4)C(OC(=O)C4=CC(O)=C(O)C(O)=C4C12)C3O | 5965.6 | Semi standard non polar | 33892256 | | Amlaic acid,1TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OC1=C(O)C(O)=CC2=C1C1C(C(=O)O)CC(=O)OC1C(=O)OC1C(CO)OC(OC(=O)C3=CC(O)=C(O)C(O)=C3)C(OC2=O)C1O | 5954.2 | Semi standard non polar | 33892256 | | Amlaic acid,1TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)OC1=C(O)C=C2C(=O)OC3C(OC(=O)C4=CC(O)=C(O)C(O)=C4)OC(CO)C(OC(=O)C4OC(=O)CC(C(=O)O)C4C2=C1O)C3O | 5892.5 | Semi standard non polar | 33892256 | | Amlaic acid,1TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1C(C(=O)O)CC(=O)OC1C(=O)OC1C(CO)OC(OC(=O)C3=CC(O)=C(O)C(O)=C3)C(OC2=O)C1O | 5971.7 | Semi standard non polar | 33892256 | | Amlaic acid,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OCC1OC(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C2OC(=O)C3=CC(O)=C(O)C(O)=C3C3C(C(=O)O)CC(=O)OC3C(=O)OC1C2O | 6007.5 | Semi standard non polar | 33892256 | | Amlaic acid,2TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)OC1=CC(C(=O)OC2OC(CO)C3OC(=O)C4OC(=O)CC(C(=O)O)C4C4=C(C=C(O)C(O[Si](C)(C)C(C)(C)C)=C4O)C(=O)OC2C3O)=CC(O)=C1O | 5846.4 | Semi standard non polar | 33892256 | | Amlaic acid,2TBDMS,isomer #11 | CC(C)(C)[Si](C)(C)OC1=CC(C(=O)OC2OC(CO)C3OC(=O)C4OC(=O)CC(C(=O)O)C4C4=C(C=C(O)C(O)=C4O[Si](C)(C)C(C)(C)C)C(=O)OC2C3O)=CC(O)=C1O | 5909.0 | Semi standard non polar | 33892256 | | Amlaic acid,2TBDMS,isomer #12 | CC(C)(C)[Si](C)(C)OC1=CC(C(=O)OC2OC(CO)C3OC(=O)C4OC(=O)CC(C(=O)O)C4C4=C(C=C(O)C(O)=C4O)C(=O)OC2C3O[Si](C)(C)C(C)(C)C)=CC(O)=C1O | 6016.2 | Semi standard non polar | 33892256 | | Amlaic acid,2TBDMS,isomer #13 | CC(C)(C)[Si](C)(C)OC1=CC(C(=O)OC2OC(CO)C3OC(=O)C4OC(=O)CC(C(=O)O)C4C4=C(C=C(O)C(O)=C4O)C(=O)OC2C3O)=CC(O[Si](C)(C)C(C)(C)C)=C1O | 5964.0 | Semi standard non polar | 33892256 | | Amlaic acid,2TBDMS,isomer #14 | CC(C)(C)[Si](C)(C)OC1=CC(C(=O)OC2OC(CO)C3OC(=O)C4OC(=O)CC(C(=O)O)C4C4=C(C=C(O)C(O)=C4O)C(=O)OC2C3O)=CC(O)=C1O[Si](C)(C)C(C)(C)C | 5912.0 | Semi standard non polar | 33892256 | | Amlaic acid,2TBDMS,isomer #15 | CC(C)(C)[Si](C)(C)OC(=O)C1CC(=O)OC2C(=O)OC3C(CO)OC(OC(=O)C4=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C4)C(OC(=O)C4=CC(O)=C(O)C(O)=C4C12)C3O | 5875.9 | Semi standard non polar | 33892256 | | Amlaic acid,2TBDMS,isomer #16 | CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1C(C(=O)O)CC(=O)OC1C(=O)OC1C(CO)OC(OC(=O)C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)C(OC2=O)C1O | 5908.2 | Semi standard non polar | 33892256 | | Amlaic acid,2TBDMS,isomer #17 | CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C(=O)OC2OC(CO)C3OC(=O)C4OC(=O)CC(C(=O)O)C4C4=C(C=C(O)C(O[Si](C)(C)C(C)(C)C)=C4O)C(=O)OC2C3O)C=C1O | 5867.1 | Semi standard non polar | 33892256 | | Amlaic acid,2TBDMS,isomer #18 | CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C(=O)OC2OC(CO)C3OC(=O)C4OC(=O)CC(C(=O)O)C4C4=C(C=C(O)C(O)=C4O[Si](C)(C)C(C)(C)C)C(=O)OC2C3O)C=C1O | 5893.2 | Semi standard non polar | 33892256 | | Amlaic acid,2TBDMS,isomer #19 | CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C(=O)OC2OC(CO)C3OC(=O)C4OC(=O)CC(C(=O)O)C4C4=C(C=C(O)C(O)=C4O)C(=O)OC2C3O[Si](C)(C)C(C)(C)C)C=C1O | 5985.9 | Semi standard non polar | 33892256 | | Amlaic acid,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OCC1OC(OC(=O)C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C2OC(=O)C3=CC(O)=C(O)C(O)=C3C3C(C(=O)O)CC(=O)OC3C(=O)OC1C2O | 5979.7 | Semi standard non polar | 33892256 | | Amlaic acid,2TBDMS,isomer #20 | CC(C)(C)[Si](C)(C)OC(=O)C1CC(=O)OC2C(=O)OC3C(CO)OC(OC(=O)C4=CC(O)=C(O)C(O)=C4)C(OC(=O)C4=CC(O)=C(O)C(O)=C4C12)C3O[Si](C)(C)C(C)(C)C | 6016.2 | Semi standard non polar | 33892256 | | Amlaic acid,2TBDMS,isomer #21 | CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1C(C(=O)O)CC(=O)OC1C(=O)OC1C(CO)OC(OC(=O)C3=CC(O)=C(O)C(O)=C3)C(OC2=O)C1O[Si](C)(C)C(C)(C)C | 6025.3 | Semi standard non polar | 33892256 | | Amlaic acid,2TBDMS,isomer #22 | CC(C)(C)[Si](C)(C)OC1=C(O)C=C2C(=O)OC3C(OC(=O)C4=CC(O)=C(O)C(O)=C4)OC(CO)C(OC(=O)C4OC(=O)CC(C(=O)O)C4C2=C1O)C3O[Si](C)(C)C(C)(C)C | 5929.3 | Semi standard non polar | 33892256 | | Amlaic acid,2TBDMS,isomer #23 | CC(C)(C)[Si](C)(C)OC1=C(O)C(O)=CC2=C1C1C(C(=O)O)CC(=O)OC1C(=O)OC1C(CO)OC(OC(=O)C3=CC(O)=C(O)C(O)=C3)C(OC2=O)C1O[Si](C)(C)C(C)(C)C | 6008.7 | Semi standard non polar | 33892256 | | Amlaic acid,2TBDMS,isomer #24 | CC(C)(C)[Si](C)(C)OC(=O)C1CC(=O)OC2C(=O)OC3C(CO)OC(OC(=O)C4=CC(O)=C(O)C(O)=C4)C(OC(=O)C4=CC(O[Si](C)(C)C(C)(C)C)=C(O)C(O)=C4C12)C3O | 5908.6 | Semi standard non polar | 33892256 | | Amlaic acid,2TBDMS,isomer #25 | CC(C)(C)[Si](C)(C)OC(=O)C1CC(=O)OC2C(=O)OC3C(CO)OC(OC(=O)C4=CC(O)=C(O)C(O)=C4)C(OC(=O)C4=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C4C12)C3O | 5825.3 | Semi standard non polar | 33892256 | | Amlaic acid,2TBDMS,isomer #26 | CC(C)(C)[Si](C)(C)OC(=O)C1CC(=O)OC2C(=O)OC3C(CO)OC(OC(=O)C4=CC(O)=C(O)C(O)=C4)C(OC(=O)C4=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C4C12)C3O | 5896.0 | Semi standard non polar | 33892256 | | Amlaic acid,2TBDMS,isomer #27 | CC(C)(C)[Si](C)(C)OC1=C(O)C=C2C(=O)OC3C(OC(=O)C4=CC(O)=C(O)C(O)=C4)OC(CO)C(OC(=O)C4OC(=O)CC(C(=O)O)C4C2=C1O[Si](C)(C)C(C)(C)C)C3O | 5911.2 | Semi standard non polar | 33892256 | | Amlaic acid,2TBDMS,isomer #28 | CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C(C)(C)C)=C1O)C1C(C(=O)O)CC(=O)OC1C(=O)OC1C(CO)OC(OC(=O)C3=CC(O)=C(O)C(O)=C3)C(OC2=O)C1O | 5954.1 | Semi standard non polar | 33892256 | | Amlaic acid,2TBDMS,isomer #29 | CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C(C)(C)C)C1C(C(=O)O)CC(=O)OC1C(=O)OC1C(CO)OC(OC(=O)C3=CC(O)=C(O)C(O)=C3)C(OC2=O)C1O | 5881.0 | Semi standard non polar | 33892256 | | Amlaic acid,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OCC1OC(OC(=O)C2=CC(O)=C(O)C(O)=C2)C2OC(=O)C3=CC(O[Si](C)(C)C(C)(C)C)=C(O)C(O)=C3C3C(C(=O)O)CC(=O)OC3C(=O)OC1C2O | 6012.7 | Semi standard non polar | 33892256 | | Amlaic acid,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OCC1OC(OC(=O)C2=CC(O)=C(O)C(O)=C2)C2OC(=O)C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C3C3C(C(=O)O)CC(=O)OC3C(=O)OC1C2O | 5910.3 | Semi standard non polar | 33892256 | | Amlaic acid,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OCC1OC(OC(=O)C2=CC(O)=C(O)C(O)=C2)C2OC(=O)C3=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3C3C(C(=O)O)CC(=O)OC3C(=O)OC1C2O | 6004.1 | Semi standard non polar | 33892256 | | Amlaic acid,2TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OCC1OC(OC(=O)C2=CC(O)=C(O)C(O)=C2)C2OC(=O)C3=CC(O)=C(O)C(O)=C3C3C(C(=O)O[Si](C)(C)C(C)(C)C)CC(=O)OC3C(=O)OC1C2O | 6011.2 | Semi standard non polar | 33892256 | | Amlaic acid,2TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)OCC1OC(OC(=O)C2=CC(O)=C(O)C(O)=C2)C2OC(=O)C3=CC(O)=C(O)C(O)=C3C3C(C(=O)O)CC(=O)OC3C(=O)OC1C2O[Si](C)(C)C(C)(C)C | 6125.5 | Semi standard non polar | 33892256 | | Amlaic acid,2TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)OC(=O)C1CC(=O)OC2C(=O)OC3C(CO)OC(OC(=O)C4=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)C(OC(=O)C4=CC(O)=C(O)C(O)=C4C12)C3O | 5900.5 | Semi standard non polar | 33892256 | | Amlaic acid,2TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)OC1=CC(C(=O)OC2OC(CO)C3OC(=O)C4OC(=O)CC(C(=O)O)C4C4=C(C=C(O[Si](C)(C)C(C)(C)C)C(O)=C4O)C(=O)OC2C3O)=CC(O)=C1O | 5925.5 | Semi standard non polar | 33892256 |
|
|---|
| GC-MS Spectra| Spectrum Type | Description | Splash Key | Deposition Date | Source | View |
|---|
| Predicted GC-MS | Predicted GC-MS Spectrum - Amlaic acid GC-MS (Non-derivatized) - 70eV, Positive | splash10-0ziu-8810898000-740c3490768ce1372b6d | 2017-09-01 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Amlaic acid GC-MS (TMS_1_1) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Amlaic acid GC-MS (TMS_1_2) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Amlaic acid GC-MS (TMS_1_3) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Amlaic acid GC-MS (TMS_1_4) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Amlaic acid GC-MS (TMS_1_5) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Amlaic acid GC-MS (TMS_1_6) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Amlaic acid GC-MS (TMS_1_7) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Amlaic acid GC-MS (TMS_1_8) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Amlaic acid GC-MS (TMS_2_1) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Amlaic acid GC-MS (TMS_2_2) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Amlaic acid GC-MS (TMS_2_3) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Amlaic acid GC-MS (TMS_2_4) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Amlaic acid GC-MS (TMS_2_5) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Amlaic acid GC-MS (TMS_2_6) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Amlaic acid GC-MS (TMS_2_7) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Amlaic acid GC-MS (TMS_2_8) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Amlaic acid GC-MS (TMS_2_9) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Amlaic acid GC-MS (TMS_2_10) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Amlaic acid GC-MS (TMS_2_11) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Amlaic acid GC-MS (TMS_2_12) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Amlaic acid GC-MS (TMS_2_13) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Amlaic acid GC-MS (TMS_2_14) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Amlaic acid GC-MS (TMS_2_15) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Amlaic acid GC-MS (TMS_2_16) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum |
MS/MS Spectra| Spectrum Type | Description | Splash Key | Deposition Date | Source | View |
|---|
| Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Amlaic acid 10V, Positive-QTOF | splash10-0uk9-0900204000-4189fb31c23cc2c579ae | 2016-08-02 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Amlaic acid 20V, Positive-QTOF | splash10-0uk9-0900101000-1cb2e373fe455daf02ad | 2016-08-02 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Amlaic acid 40V, Positive-QTOF | splash10-0uk9-0943000000-41131238ab4ab17b5aaa | 2016-08-02 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Amlaic acid 10V, Negative-QTOF | splash10-0uxr-0900117000-2769ef00a7886f545832 | 2016-08-03 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Amlaic acid 20V, Negative-QTOF | splash10-014i-0900312000-980a3d48f10e90789a2c | 2016-08-03 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Amlaic acid 40V, Negative-QTOF | splash10-014i-2932200000-9b70d227151588225dd9 | 2016-08-03 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Amlaic acid 10V, Negative-QTOF | splash10-0zgr-0000319000-b78d9a613a955346a732 | 2021-09-23 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Amlaic acid 20V, Negative-QTOF | splash10-0f79-0500956000-2ad95d3f70dc42adc493 | 2021-09-23 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Amlaic acid 40V, Negative-QTOF | splash10-0103-5800191000-cd5fc9f2275bb7e55b92 | 2021-09-23 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Amlaic acid 10V, Positive-QTOF | splash10-015i-0000900000-fd0ebb9a9c7b60900923 | 2021-09-24 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Amlaic acid 20V, Positive-QTOF | splash10-0udr-2900100000-b0067850c5b25debbffe | 2021-09-24 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Amlaic acid 40V, Positive-QTOF | splash10-0udi-7700921000-026b6ed4ccb8be1875da | 2021-09-24 | Wishart Lab | View Spectrum |
NMR Spectra| Spectrum Type | Description | Deposition Date | Source | View |
|---|
| Predicted 1D NMR | 1H NMR Spectrum (1D, 100 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 100 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 1000 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 1000 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 200 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 200 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 300 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 300 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 400 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 400 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 500 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 500 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 600 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 600 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 700 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 700 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 800 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 800 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 900 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 900 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum |
|
|---|