| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 7.07 minutes | 32390414 |
| Predicted by Siyang on May 30, 2022 | 13.1394 minutes | 33406817 |
| Predicted by Siyang using ReTip algorithm on June 8, 2022 | 4.34 minutes | 32390414 |
| AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid | 85.5 seconds | 40023050 |
| Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 2021.6 seconds | 40023050 |
| Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 203.5 seconds | 40023050 |
| Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 166.5 seconds | 40023050 |
| Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 176.3 seconds | 40023050 |
| RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 356.0 seconds | 40023050 |
| Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 451.5 seconds | 40023050 |
| BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 414.5 seconds | 40023050 |
| HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 588.7 seconds | 40023050 |
| UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 1148.4 seconds | 40023050 |
| BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 455.0 seconds | 40023050 |
| UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1099.0 seconds | 40023050 |
| SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 349.4 seconds | 40023050 |
| RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 367.6 seconds | 40023050 |
| MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 455.8 seconds | 40023050 |
| KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 120.8 seconds | 40023050 |
| Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 8.3 seconds | 40023050 |
| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Dehydrophytosphingosine,1TMS,isomer #1 | CCCCCCCCC/C=C/CCCC(O[Si](C)(C)C)C(O)C(N)CO | 2619.3 | Semi standard non polar | 33892256 |
| Dehydrophytosphingosine,1TMS,isomer #2 | CCCCCCCCC/C=C/CCCC(O)C(O[Si](C)(C)C)C(N)CO | 2619.4 | Semi standard non polar | 33892256 |
| Dehydrophytosphingosine,1TMS,isomer #3 | CCCCCCCCC/C=C/CCCC(O)C(O)C(N)CO[Si](C)(C)C | 2674.4 | Semi standard non polar | 33892256 |
| Dehydrophytosphingosine,1TMS,isomer #4 | CCCCCCCCC/C=C/CCCC(O)C(O)C(CO)N[Si](C)(C)C | 2737.7 | Semi standard non polar | 33892256 |
| Dehydrophytosphingosine,2TMS,isomer #1 | CCCCCCCCC/C=C/CCCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C(N)CO | 2602.4 | Semi standard non polar | 33892256 |
| Dehydrophytosphingosine,2TMS,isomer #2 | CCCCCCCCC/C=C/CCCC(O[Si](C)(C)C)C(O)C(N)CO[Si](C)(C)C | 2628.2 | Semi standard non polar | 33892256 |
| Dehydrophytosphingosine,2TMS,isomer #3 | CCCCCCCCC/C=C/CCCC(O[Si](C)(C)C)C(O)C(CO)N[Si](C)(C)C | 2716.9 | Semi standard non polar | 33892256 |
| Dehydrophytosphingosine,2TMS,isomer #4 | CCCCCCCCC/C=C/CCCC(O)C(O[Si](C)(C)C)C(N)CO[Si](C)(C)C | 2637.7 | Semi standard non polar | 33892256 |
| Dehydrophytosphingosine,2TMS,isomer #5 | CCCCCCCCC/C=C/CCCC(O)C(O[Si](C)(C)C)C(CO)N[Si](C)(C)C | 2686.6 | Semi standard non polar | 33892256 |
| Dehydrophytosphingosine,2TMS,isomer #6 | CCCCCCCCC/C=C/CCCC(O)C(O)C(CO[Si](C)(C)C)N[Si](C)(C)C | 2724.8 | Semi standard non polar | 33892256 |
| Dehydrophytosphingosine,2TMS,isomer #7 | CCCCCCCCC/C=C/CCCC(O)C(O)C(CO)N([Si](C)(C)C)[Si](C)(C)C | 2822.2 | Semi standard non polar | 33892256 |
| Dehydrophytosphingosine,3TMS,isomer #1 | CCCCCCCCC/C=C/CCCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C(N)CO[Si](C)(C)C | 2610.4 | Semi standard non polar | 33892256 |
| Dehydrophytosphingosine,3TMS,isomer #2 | CCCCCCCCC/C=C/CCCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C(CO)N[Si](C)(C)C | 2647.6 | Semi standard non polar | 33892256 |
| Dehydrophytosphingosine,3TMS,isomer #3 | CCCCCCCCC/C=C/CCCC(O[Si](C)(C)C)C(O)C(CO[Si](C)(C)C)N[Si](C)(C)C | 2640.0 | Semi standard non polar | 33892256 |
| Dehydrophytosphingosine,3TMS,isomer #4 | CCCCCCCCC/C=C/CCCC(O[Si](C)(C)C)C(O)C(CO)N([Si](C)(C)C)[Si](C)(C)C | 2827.3 | Semi standard non polar | 33892256 |
| Dehydrophytosphingosine,3TMS,isomer #5 | CCCCCCCCC/C=C/CCCC(O)C(O[Si](C)(C)C)C(CO[Si](C)(C)C)N[Si](C)(C)C | 2631.1 | Semi standard non polar | 33892256 |
| Dehydrophytosphingosine,3TMS,isomer #6 | CCCCCCCCC/C=C/CCCC(O)C(O[Si](C)(C)C)C(CO)N([Si](C)(C)C)[Si](C)(C)C | 2824.9 | Semi standard non polar | 33892256 |
| Dehydrophytosphingosine,3TMS,isomer #7 | CCCCCCCCC/C=C/CCCC(O)C(O)C(CO[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2863.5 | Semi standard non polar | 33892256 |
| Dehydrophytosphingosine,4TMS,isomer #1 | CCCCCCCCC/C=C/CCCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C(CO[Si](C)(C)C)N[Si](C)(C)C | 2633.7 | Semi standard non polar | 33892256 |
| Dehydrophytosphingosine,4TMS,isomer #1 | CCCCCCCCC/C=C/CCCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C(CO[Si](C)(C)C)N[Si](C)(C)C | 2715.9 | Standard non polar | 33892256 |
| Dehydrophytosphingosine,4TMS,isomer #2 | CCCCCCCCC/C=C/CCCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C(CO)N([Si](C)(C)C)[Si](C)(C)C | 2808.5 | Semi standard non polar | 33892256 |
| Dehydrophytosphingosine,4TMS,isomer #2 | CCCCCCCCC/C=C/CCCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C(CO)N([Si](C)(C)C)[Si](C)(C)C | 2762.1 | Standard non polar | 33892256 |
| Dehydrophytosphingosine,4TMS,isomer #3 | CCCCCCCCC/C=C/CCCC(O[Si](C)(C)C)C(O)C(CO[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2841.9 | Semi standard non polar | 33892256 |
| Dehydrophytosphingosine,4TMS,isomer #3 | CCCCCCCCC/C=C/CCCC(O[Si](C)(C)C)C(O)C(CO[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2790.8 | Standard non polar | 33892256 |
| Dehydrophytosphingosine,4TMS,isomer #4 | CCCCCCCCC/C=C/CCCC(O)C(O[Si](C)(C)C)C(CO[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2806.8 | Semi standard non polar | 33892256 |
| Dehydrophytosphingosine,4TMS,isomer #4 | CCCCCCCCC/C=C/CCCC(O)C(O[Si](C)(C)C)C(CO[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2782.7 | Standard non polar | 33892256 |
| Dehydrophytosphingosine,5TMS,isomer #1 | CCCCCCCCC/C=C/CCCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C(CO[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2843.7 | Semi standard non polar | 33892256 |
| Dehydrophytosphingosine,5TMS,isomer #1 | CCCCCCCCC/C=C/CCCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C(CO[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2779.6 | Standard non polar | 33892256 |
| Dehydrophytosphingosine,1TBDMS,isomer #1 | CCCCCCCCC/C=C/CCCC(O[Si](C)(C)C(C)(C)C)C(O)C(N)CO | 2854.8 | Semi standard non polar | 33892256 |
| Dehydrophytosphingosine,1TBDMS,isomer #2 | CCCCCCCCC/C=C/CCCC(O)C(O[Si](C)(C)C(C)(C)C)C(N)CO | 2853.2 | Semi standard non polar | 33892256 |
| Dehydrophytosphingosine,1TBDMS,isomer #3 | CCCCCCCCC/C=C/CCCC(O)C(O)C(N)CO[Si](C)(C)C(C)(C)C | 2890.7 | Semi standard non polar | 33892256 |
| Dehydrophytosphingosine,1TBDMS,isomer #4 | CCCCCCCCC/C=C/CCCC(O)C(O)C(CO)N[Si](C)(C)C(C)(C)C | 2961.0 | Semi standard non polar | 33892256 |
| Dehydrophytosphingosine,2TBDMS,isomer #1 | CCCCCCCCC/C=C/CCCC(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(N)CO | 3021.6 | Semi standard non polar | 33892256 |
| Dehydrophytosphingosine,2TBDMS,isomer #2 | CCCCCCCCC/C=C/CCCC(O[Si](C)(C)C(C)(C)C)C(O)C(N)CO[Si](C)(C)C(C)(C)C | 3055.2 | Semi standard non polar | 33892256 |
| Dehydrophytosphingosine,2TBDMS,isomer #3 | CCCCCCCCC/C=C/CCCC(O[Si](C)(C)C(C)(C)C)C(O)C(CO)N[Si](C)(C)C(C)(C)C | 3149.9 | Semi standard non polar | 33892256 |
| Dehydrophytosphingosine,2TBDMS,isomer #4 | CCCCCCCCC/C=C/CCCC(O)C(O[Si](C)(C)C(C)(C)C)C(N)CO[Si](C)(C)C(C)(C)C | 3057.4 | Semi standard non polar | 33892256 |
| Dehydrophytosphingosine,2TBDMS,isomer #5 | CCCCCCCCC/C=C/CCCC(O)C(O[Si](C)(C)C(C)(C)C)C(CO)N[Si](C)(C)C(C)(C)C | 3124.3 | Semi standard non polar | 33892256 |
| Dehydrophytosphingosine,2TBDMS,isomer #6 | CCCCCCCCC/C=C/CCCC(O)C(O)C(CO[Si](C)(C)C(C)(C)C)N[Si](C)(C)C(C)(C)C | 3165.7 | Semi standard non polar | 33892256 |
| Dehydrophytosphingosine,2TBDMS,isomer #7 | CCCCCCCCC/C=C/CCCC(O)C(O)C(CO)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3238.0 | Semi standard non polar | 33892256 |
| Dehydrophytosphingosine,3TBDMS,isomer #1 | CCCCCCCCC/C=C/CCCC(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(N)CO[Si](C)(C)C(C)(C)C | 3234.1 | Semi standard non polar | 33892256 |
| Dehydrophytosphingosine,3TBDMS,isomer #2 | CCCCCCCCC/C=C/CCCC(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(CO)N[Si](C)(C)C(C)(C)C | 3265.0 | Semi standard non polar | 33892256 |
| Dehydrophytosphingosine,3TBDMS,isomer #3 | CCCCCCCCC/C=C/CCCC(O[Si](C)(C)C(C)(C)C)C(O)C(CO[Si](C)(C)C(C)(C)C)N[Si](C)(C)C(C)(C)C | 3311.4 | Semi standard non polar | 33892256 |
| Dehydrophytosphingosine,3TBDMS,isomer #4 | CCCCCCCCC/C=C/CCCC(O[Si](C)(C)C(C)(C)C)C(O)C(CO)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3480.0 | Semi standard non polar | 33892256 |
| Dehydrophytosphingosine,3TBDMS,isomer #5 | CCCCCCCCC/C=C/CCCC(O)C(O[Si](C)(C)C(C)(C)C)C(CO[Si](C)(C)C(C)(C)C)N[Si](C)(C)C(C)(C)C | 3282.2 | Semi standard non polar | 33892256 |
| Dehydrophytosphingosine,3TBDMS,isomer #6 | CCCCCCCCC/C=C/CCCC(O)C(O[Si](C)(C)C(C)(C)C)C(CO)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3451.9 | Semi standard non polar | 33892256 |
| Dehydrophytosphingosine,3TBDMS,isomer #7 | CCCCCCCCC/C=C/CCCC(O)C(O)C(CO[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3499.6 | Semi standard non polar | 33892256 |
| Dehydrophytosphingosine,4TBDMS,isomer #1 | CCCCCCCCC/C=C/CCCC(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(CO[Si](C)(C)C(C)(C)C)N[Si](C)(C)C(C)(C)C | 3426.2 | Semi standard non polar | 33892256 |
| Dehydrophytosphingosine,4TBDMS,isomer #1 | CCCCCCCCC/C=C/CCCC(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(CO[Si](C)(C)C(C)(C)C)N[Si](C)(C)C(C)(C)C | 3366.6 | Standard non polar | 33892256 |
| Dehydrophytosphingosine,4TBDMS,isomer #2 | CCCCCCCCC/C=C/CCCC(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(CO)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3707.5 | Semi standard non polar | 33892256 |
| Dehydrophytosphingosine,4TBDMS,isomer #2 | CCCCCCCCC/C=C/CCCC(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(CO)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3405.6 | Standard non polar | 33892256 |
| Dehydrophytosphingosine,4TBDMS,isomer #3 | CCCCCCCCC/C=C/CCCC(O[Si](C)(C)C(C)(C)C)C(O)C(CO[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3728.7 | Semi standard non polar | 33892256 |
| Dehydrophytosphingosine,4TBDMS,isomer #3 | CCCCCCCCC/C=C/CCCC(O[Si](C)(C)C(C)(C)C)C(O)C(CO[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3438.3 | Standard non polar | 33892256 |
| Dehydrophytosphingosine,4TBDMS,isomer #4 | CCCCCCCCC/C=C/CCCC(O)C(O[Si](C)(C)C(C)(C)C)C(CO[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3690.7 | Semi standard non polar | 33892256 |
| Dehydrophytosphingosine,4TBDMS,isomer #4 | CCCCCCCCC/C=C/CCCC(O)C(O[Si](C)(C)C(C)(C)C)C(CO[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3429.1 | Standard non polar | 33892256 |
| Dehydrophytosphingosine,5TBDMS,isomer #1 | CCCCCCCCC/C=C/CCCC(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(CO[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3916.2 | Semi standard non polar | 33892256 |
| Dehydrophytosphingosine,5TBDMS,isomer #1 | CCCCCCCCC/C=C/CCCC(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(CO[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3570.9 | Standard non polar | 33892256 |