| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 3.25 minutes | 32390414 |
| Predicted by Siyang on May 30, 2022 | 10.1246 minutes | 33406817 |
| Predicted by Siyang using ReTip algorithm on June 8, 2022 | 6.13 minutes | 32390414 |
| AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid | 116.2 seconds | 40023050 |
| Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 958.5 seconds | 40023050 |
| Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 209.1 seconds | 40023050 |
| Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 79.1 seconds | 40023050 |
| Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 135.4 seconds | 40023050 |
| RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 60.4 seconds | 40023050 |
| Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 406.3 seconds | 40023050 |
| BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 293.5 seconds | 40023050 |
| HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 753.7 seconds | 40023050 |
| UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 613.6 seconds | 40023050 |
| BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 164.0 seconds | 40023050 |
| UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 983.2 seconds | 40023050 |
| SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 172.0 seconds | 40023050 |
| RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 212.1 seconds | 40023050 |
| MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 576.4 seconds | 40023050 |
| KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 491.8 seconds | 40023050 |
| Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 376.2 seconds | 40023050 |
| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| (+)-Gallocatechin,1TMS,isomer #1 | C[Si](C)(C)O[C@H]1CC2=C(O)C=C(O)C=C2O[C@@H]1C1=CC(O)=C(O)C(O)=C1 | 3235.1 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,1TMS,isomer #2 | C[Si](C)(C)OC1=CC(O)=CC2=C1C[C@H](O)[C@@H](C1=CC(O)=C(O)C(O)=C1)O2 | 3232.4 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,1TMS,isomer #3 | C[Si](C)(C)OC1=CC(O)=C2C[C@H](O)[C@@H](C3=CC(O)=C(O)C(O)=C3)OC2=C1 | 3294.9 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,1TMS,isomer #4 | C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O)=C3C[C@@H]2O)=CC(O)=C1O | 3279.2 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,1TMS,isomer #5 | C[Si](C)(C)OC1=C(O)C=C([C@H]2OC3=CC(O)=CC(O)=C3C[C@@H]2O)C=C1O | 3277.0 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,2TMS,isomer #1 | C[Si](C)(C)OC1=CC(O)=CC2=C1C[C@H](O[Si](C)(C)C)[C@@H](C1=CC(O)=C(O)C(O)=C1)O2 | 3179.7 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,2TMS,isomer #10 | C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O)=C3C[C@@H]2O)=CC(O[Si](C)(C)C)=C1O | 3216.5 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,2TMS,isomer #11 | C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O)=C3C[C@@H]2O)=CC(O)=C1O[Si](C)(C)C | 3164.0 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,2TMS,isomer #2 | C[Si](C)(C)OC1=CC(O)=C2C[C@H](O[Si](C)(C)C)[C@@H](C3=CC(O)=C(O)C(O)=C3)OC2=C1 | 3179.8 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,2TMS,isomer #3 | C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O)=C3C[C@@H]2O[Si](C)(C)C)=CC(O)=C1O | 3194.0 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,2TMS,isomer #4 | C[Si](C)(C)OC1=C(O)C=C([C@H]2OC3=CC(O)=CC(O)=C3C[C@@H]2O[Si](C)(C)C)C=C1O | 3197.3 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,2TMS,isomer #5 | C[Si](C)(C)OC1=CC2=C(C[C@H](O)[C@@H](C3=CC(O)=C(O)C(O)=C3)O2)C(O[Si](C)(C)C)=C1 | 3114.2 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,2TMS,isomer #6 | C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C[C@@H]2O)=CC(O)=C1O | 3144.1 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,2TMS,isomer #7 | C[Si](C)(C)OC1=CC(O)=CC2=C1C[C@H](O)[C@@H](C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)O2 | 3137.7 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,2TMS,isomer #8 | C[Si](C)(C)OC1=CC(O)=C2C[C@H](O)[C@@H](C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1 | 3170.5 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,2TMS,isomer #9 | C[Si](C)(C)OC1=CC(O)=C2C[C@H](O)[C@@H](C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC2=C1 | 3180.6 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,3TMS,isomer #1 | C[Si](C)(C)OC1=CC2=C(C[C@H](O[Si](C)(C)C)[C@@H](C3=CC(O)=C(O)C(O)=C3)O2)C(O[Si](C)(C)C)=C1 | 3004.1 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,3TMS,isomer #10 | C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C[C@@H]2O)=CC(O[Si](C)(C)C)=C1O | 3035.1 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,3TMS,isomer #11 | C[Si](C)(C)OC1=CC(O)=CC2=C1C[C@H](O)[C@@H](C1=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)O2 | 3007.6 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,3TMS,isomer #12 | C[Si](C)(C)OC1=CC(O)=C2C[C@H](O)[C@@H](C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1 | 3025.4 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,3TMS,isomer #13 | C[Si](C)(C)OC1=CC(O)=C2C[C@H](O)[C@@H](C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1 | 3007.2 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,3TMS,isomer #14 | C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O)=C3C[C@@H]2O)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C | 3056.7 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,3TMS,isomer #2 | C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C[C@@H]2O[Si](C)(C)C)=CC(O)=C1O | 3048.2 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,3TMS,isomer #3 | C[Si](C)(C)OC1=CC(O)=CC2=C1C[C@H](O[Si](C)(C)C)[C@@H](C1=CC(O)=C(O[Si](C)(C)C)C(O)=C1)O2 | 3014.3 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,3TMS,isomer #4 | C[Si](C)(C)OC1=CC(O)=C2C[C@H](O[Si](C)(C)C)[C@@H](C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1 | 3000.3 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,3TMS,isomer #5 | C[Si](C)(C)OC1=CC(O)=C2C[C@H](O[Si](C)(C)C)[C@@H](C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC2=C1 | 2977.4 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,3TMS,isomer #6 | C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O)=C3C[C@@H]2O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C1O | 3094.7 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,3TMS,isomer #7 | C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O)=C3C[C@@H]2O[Si](C)(C)C)=CC(O)=C1O[Si](C)(C)C | 3060.0 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,3TMS,isomer #8 | C[Si](C)(C)OC1=CC2=C(C[C@H](O)[C@@H](C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)O2)C(O[Si](C)(C)C)=C1 | 2959.7 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,3TMS,isomer #9 | C[Si](C)(C)OC1=CC2=C(C[C@H](O)[C@@H](C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)O2)C(O[Si](C)(C)C)=C1 | 3032.5 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,4TMS,isomer #1 | C[Si](C)(C)OC1=CC2=C(C[C@H](O[Si](C)(C)C)[C@@H](C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)O2)C(O[Si](C)(C)C)=C1 | 2884.8 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,4TMS,isomer #10 | C[Si](C)(C)OC1=CC(O)=CC2=C1C[C@H](O)[C@@H](C1=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)O2 | 2966.3 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,4TMS,isomer #11 | C[Si](C)(C)OC1=CC(O)=C2C[C@H](O)[C@@H](C3=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1 | 2984.0 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,4TMS,isomer #2 | C[Si](C)(C)OC1=CC2=C(C[C@H](O[Si](C)(C)C)[C@@H](C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)O2)C(O[Si](C)(C)C)=C1 | 2972.0 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,4TMS,isomer #3 | C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C[C@@H]2O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C1O | 2942.1 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,4TMS,isomer #4 | C[Si](C)(C)OC1=CC(O)=CC2=C1C[C@H](O[Si](C)(C)C)[C@@H](C1=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)O2 | 2922.6 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,4TMS,isomer #5 | C[Si](C)(C)OC1=CC(O)=C2C[C@H](O[Si](C)(C)C)[C@@H](C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1 | 2939.8 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,4TMS,isomer #6 | C[Si](C)(C)OC1=CC(O)=C2C[C@H](O[Si](C)(C)C)[C@@H](C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1 | 2920.9 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,4TMS,isomer #7 | C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O)=C3C[C@@H]2O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C | 3000.2 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,4TMS,isomer #8 | C[Si](C)(C)OC1=CC2=C(C[C@H](O)[C@@H](C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)O2)C(O[Si](C)(C)C)=C1 | 3017.3 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,4TMS,isomer #9 | C[Si](C)(C)OC1=CC2=C(C[C@H](O)[C@@H](C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)O2)C(O[Si](C)(C)C)=C1 | 2985.4 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,5TMS,isomer #1 | C[Si](C)(C)OC1=CC2=C(C[C@H](O[Si](C)(C)C)[C@@H](C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)O2)C(O[Si](C)(C)C)=C1 | 2993.6 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,5TMS,isomer #2 | C[Si](C)(C)OC1=CC2=C(C[C@H](O[Si](C)(C)C)[C@@H](C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)O2)C(O[Si](C)(C)C)=C1 | 2980.0 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,5TMS,isomer #3 | C[Si](C)(C)OC1=CC(O)=CC2=C1C[C@H](O[Si](C)(C)C)[C@@H](C1=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)O2 | 2950.8 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,5TMS,isomer #4 | C[Si](C)(C)OC1=CC(O)=C2C[C@H](O[Si](C)(C)C)[C@@H](C3=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1 | 2968.0 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,5TMS,isomer #5 | C[Si](C)(C)OC1=CC2=C(C[C@H](O)[C@@H](C3=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)O2)C(O[Si](C)(C)C)=C1 | 3012.5 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,6TMS,isomer #1 | C[Si](C)(C)OC1=CC2=C(C[C@H](O[Si](C)(C)C)[C@@H](C3=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)O2)C(O[Si](C)(C)C)=C1 | 3009.0 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@H]1CC2=C(O)C=C(O)C=C2O[C@@H]1C1=CC(O)=C(O)C(O)=C1 | 3562.8 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=C1C[C@H](O)[C@@H](C1=CC(O)=C(O)C(O)=C1)O2 | 3536.8 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C[C@H](O)[C@@H](C3=CC(O)=C(O)C(O)=C3)OC2=C1 | 3572.1 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,1TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O)=C3C[C@@H]2O)=CC(O)=C1O | 3599.9 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,1TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC1=C(O)C=C([C@H]2OC3=CC(O)=CC(O)=C3C[C@@H]2O)C=C1O | 3583.1 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=C1C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C1=CC(O)=C(O)C(O)=C1)O2 | 3716.7 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,2TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O)=C3C[C@@H]2O)=CC(O[Si](C)(C)C(C)(C)C)=C1O | 3788.9 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,2TBDMS,isomer #11 | CC(C)(C)[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O)=C3C[C@@H]2O)=CC(O)=C1O[Si](C)(C)C(C)(C)C | 3708.0 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C3=CC(O)=C(O)C(O)=C3)OC2=C1 | 3710.9 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O)=C3C[C@@H]2O[Si](C)(C)C(C)(C)C)=CC(O)=C1O | 3769.9 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC1=C(O)C=C([C@H]2OC3=CC(O)=CC(O)=C3C[C@@H]2O[Si](C)(C)C(C)(C)C)C=C1O | 3746.1 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC1=CC2=C(C[C@H](O)[C@@H](C3=CC(O)=C(O)C(O)=C3)O2)C(O[Si](C)(C)C(C)(C)C)=C1 | 3643.2 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,2TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C[C@@H]2O)=CC(O)=C1O | 3679.4 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,2TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=C1C[C@H](O)[C@@H](C1=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C1)O2 | 3668.1 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,2TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C[C@H](O)[C@@H](C3=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)OC2=C1 | 3698.6 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,2TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C[C@H](O)[C@@H](C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)OC2=C1 | 3710.6 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC1=CC2=C(C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C3=CC(O)=C(O)C(O)=C3)O2)C(O[Si](C)(C)C(C)(C)C)=C1 | 3750.7 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,3TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C[C@@H]2O)=CC(O[Si](C)(C)C(C)(C)C)=C1O | 3798.6 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,3TBDMS,isomer #11 | CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=C1C[C@H](O)[C@@H](C1=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C1)O2 | 3753.6 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,3TBDMS,isomer #12 | CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C[C@H](O)[C@@H](C3=CC(O[Si](C)(C)C(C)(C)C)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)OC2=C1 | 3831.9 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,3TBDMS,isomer #13 | CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C[C@H](O)[C@@H](C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C3)OC2=C1 | 3779.1 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,3TBDMS,isomer #14 | CC(C)(C)[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O)=C3C[C@@H]2O)=CC(O[Si](C)(C)C(C)(C)C)=C1O[Si](C)(C)C(C)(C)C | 3785.5 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C[C@@H]2O[Si](C)(C)C(C)(C)C)=CC(O)=C1O | 3775.1 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=C1C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C1=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C1)O2 | 3767.2 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C3=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)OC2=C1 | 3750.3 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)OC2=C1 | 3748.4 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O)=C3C[C@@H]2O[Si](C)(C)C(C)(C)C)=CC(O[Si](C)(C)C(C)(C)C)=C1O | 3832.5 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,3TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O)=C3C[C@@H]2O[Si](C)(C)C(C)(C)C)=CC(O)=C1O[Si](C)(C)C(C)(C)C | 3782.3 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,3TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)OC1=CC2=C(C[C@H](O)[C@@H](C3=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)O2)C(O[Si](C)(C)C(C)(C)C)=C1 | 3762.2 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,3TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)OC1=CC2=C(C[C@H](O)[C@@H](C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)O2)C(O[Si](C)(C)C(C)(C)C)=C1 | 3814.9 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC1=CC2=C(C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C3=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)O2)C(O[Si](C)(C)C(C)(C)C)=C1 | 3879.3 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,4TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=C1C[C@H](O)[C@@H](C1=CC(O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C1)O2 | 3888.2 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,4TBDMS,isomer #11 | CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C[C@H](O)[C@@H](C3=CC(O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C3)OC2=C1 | 3905.7 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC1=CC2=C(C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)O2)C(O[Si](C)(C)C(C)(C)C)=C1 | 3910.1 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C[C@@H]2O[Si](C)(C)C(C)(C)C)=CC(O[Si](C)(C)C(C)(C)C)=C1O | 3895.7 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=C1C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C1=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C1)O2 | 3856.2 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,4TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C3=CC(O[Si](C)(C)C(C)(C)C)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)OC2=C1 | 3901.2 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,4TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C3)OC2=C1 | 3863.9 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,4TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O)=C3C[C@@H]2O[Si](C)(C)C(C)(C)C)=CC(O[Si](C)(C)C(C)(C)C)=C1O[Si](C)(C)C(C)(C)C | 3878.6 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,4TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)OC1=CC2=C(C[C@H](O)[C@@H](C3=CC(O[Si](C)(C)C(C)(C)C)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)O2)C(O[Si](C)(C)C(C)(C)C)=C1 | 3951.7 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,4TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)OC1=CC2=C(C[C@H](O)[C@@H](C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C3)O2)C(O[Si](C)(C)C(C)(C)C)=C1 | 3910.5 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,5TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC1=CC2=C(C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C3=CC(O[Si](C)(C)C(C)(C)C)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)O2)C(O[Si](C)(C)C(C)(C)C)=C1 | 4073.2 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,5TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC1=CC2=C(C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C3)O2)C(O[Si](C)(C)C(C)(C)C)=C1 | 4045.0 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,5TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=C1C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C1=CC(O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C1)O2 | 4010.1 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,5TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C3=CC(O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C3)OC2=C1 | 4023.4 | Semi standard non polar | 33892256 |
| (+)-Gallocatechin,5TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC1=CC2=C(C[C@H](O)[C@@H](C3=CC(O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C3)O2)C(O[Si](C)(C)C(C)(C)C)=C1 | 4071.6 | Semi standard non polar | 33892256 |