| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Expected but not Quantified |
|---|
| Creation Date | 2013-07-09 16:08:25 UTC |
|---|
| Update Date | 2019-07-23 07:15:25 UTC |
|---|
| HMDB ID | HMDB0060938 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | 4-trans-Hydroxycyclohexyl glyburide |
|---|
| Description | 4-trans-Hydroxycyclohexyl glyburide is a metabolite of glyburide. Glibenclamide, also known as glyburide (USAN), is an antidiabetic drug in a class of medications known as sulfonylureas, closely related to sulfa drugs. It was developed in 1966 in a cooperative study between Boehringer Mannheim (now part of Roche) and Hoechst (now part of Sanofi-Aventis). (Wikipedia) |
|---|
| Structure | COC1=C(C=C(Cl)C=C1)C(O)=NCCC1=CC=C(C=C1)S(=O)(=O)NC(O)=N[C@H]1CC[C@H](O)CC1 InChI=1S/C23H28ClN3O6S/c1-33-21-11-4-16(24)14-20(21)22(29)25-13-12-15-2-9-19(10-3-15)34(31,32)27-23(30)26-17-5-7-18(28)8-6-17/h2-4,9-11,14,17-18,28H,5-8,12-13H2,1H3,(H,25,29)(H2,26,27,30)/t17-,18- |
|---|
| Synonyms | Not Available |
|---|
| Chemical Formula | C23H28ClN3O6S |
|---|
| Average Molecular Weight | 510.003 |
|---|
| Monoisotopic Molecular Weight | 509.13873404 |
|---|
| IUPAC Name | 5-chloro-2-methoxy-N-(2-{4-[({[(1r,4r)-4-hydroxycyclohexyl]-C-hydroxycarbonimidoyl}amino)sulfonyl]phenyl}ethyl)benzene-1-carboximidic acid |
|---|
| Traditional Name | 5-chloro-2-methoxy-N-{2-[4-({[(1r,4r)-4-hydroxycyclohexyl]-C-hydroxycarbonimidoyl}aminosulfonyl)phenyl]ethyl}benzenecarboximidic acid |
|---|
| CAS Registry Number | Not Available |
|---|
| SMILES | COC1=C(C=C(Cl)C=C1)C(O)=NCCC1=CC=C(C=C1)S(=O)(=O)NC(O)=N[C@H]1CC[C@H](O)CC1 |
|---|
| InChI Identifier | InChI=1S/C23H28ClN3O6S/c1-33-21-11-4-16(24)14-20(21)22(29)25-13-12-15-2-9-19(10-3-15)34(31,32)27-23(30)26-17-5-7-18(28)8-6-17/h2-4,9-11,14,17-18,28H,5-8,12-13H2,1H3,(H,25,29)(H2,26,27,30)/t17-,18- |
|---|
| InChI Key | IUWSGCQEWOOQDN-IYARVYRRSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as benzenesulfonamides. These are organic compounds containing a sulfonamide group that is S-linked to a benzene ring. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Benzenoids |
|---|
| Class | Benzene and substituted derivatives |
|---|
| Sub Class | Benzenesulfonamides |
|---|
| Direct Parent | Benzenesulfonamides |
|---|
| Alternative Parents | |
|---|
| Substituents | - Benzenesulfonamide
- Halobenzoic acid or derivatives
- 3-halobenzoic acid or derivatives
- Benzoic acid or derivatives
- Benzenesulfonyl group
- Benzamide
- Phenol ether
- Phenoxy compound
- Anisole
- Methoxybenzene
- Benzoyl
- Alkyl aryl ether
- Chlorobenzene
- Sulfonylurea
- Cyclohexanol
- Halobenzene
- Aryl chloride
- Aryl halide
- Aminosulfonyl compound
- Cyclic alcohol
- Sulfonyl
- Organosulfonic acid or derivatives
- Organic sulfonic acid or derivatives
- Carbonic acid derivative
- Carboxamide group
- Secondary carboxylic acid amide
- Secondary alcohol
- Carboxylic acid derivative
- Ether
- Alcohol
- Organohalogen compound
- Organochloride
- Carbonyl group
- Organonitrogen compound
- Organooxygen compound
- Organosulfur compound
- Hydrocarbon derivative
- Organic oxide
- Organopnictogen compound
- Organic oxygen compound
- Organic nitrogen compound
- Aromatic homomonocyclic compound
|
|---|
| Molecular Framework | Aromatic homomonocyclic compounds |
|---|
| External Descriptors | Not Available |
|---|
| Ontology |
|---|
| Physiological effect | Not Available |
|---|
| Disposition | |
|---|
| Process | Not Available |
|---|
| Role | Not Available |
|---|
| Physical Properties |
|---|
| State | Not Available |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 3.57 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 13.633 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 2.89 minutes | 32390414 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| 4-trans-Hydroxycyclohexyl glyburide,1TMS,isomer #1 | COC1=CC=C(Cl)C=C1C(=NCCC1=CC=C(S(=O)(=O)NC(O)=N[C@H]2CC[C@H](O)CC2)C=C1)O[Si](C)(C)C | 4386.2 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,1TMS,isomer #1 | COC1=CC=C(Cl)C=C1C(=NCCC1=CC=C(S(=O)(=O)NC(O)=N[C@H]2CC[C@H](O)CC2)C=C1)O[Si](C)(C)C | 4386.2 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,1TMS,isomer #2 | COC1=CC=C(Cl)C=C1C(O)=NCCC1=CC=C(S(=O)(=O)NC(=N[C@H]2CC[C@H](O)CC2)O[Si](C)(C)C)C=C1 | 4345.1 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,1TMS,isomer #2 | COC1=CC=C(Cl)C=C1C(O)=NCCC1=CC=C(S(=O)(=O)NC(=N[C@H]2CC[C@H](O)CC2)O[Si](C)(C)C)C=C1 | 4345.1 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,1TMS,isomer #3 | COC1=CC=C(Cl)C=C1C(O)=NCCC1=CC=C(S(=O)(=O)NC(O)=N[C@H]2CC[C@H](O[Si](C)(C)C)CC2)C=C1 | 4384.7 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,1TMS,isomer #3 | COC1=CC=C(Cl)C=C1C(O)=NCCC1=CC=C(S(=O)(=O)NC(O)=N[C@H]2CC[C@H](O[Si](C)(C)C)CC2)C=C1 | 4384.7 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,1TMS,isomer #4 | COC1=CC=C(Cl)C=C1C(O)=NCCC1=CC=C(S(=O)(=O)N(C(O)=N[C@H]2CC[C@H](O)CC2)[Si](C)(C)C)C=C1 | 4354.2 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,1TMS,isomer #4 | COC1=CC=C(Cl)C=C1C(O)=NCCC1=CC=C(S(=O)(=O)N(C(O)=N[C@H]2CC[C@H](O)CC2)[Si](C)(C)C)C=C1 | 4354.2 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,2TMS,isomer #1 | COC1=CC=C(Cl)C=C1C(=NCCC1=CC=C(S(=O)(=O)NC(=N[C@H]2CC[C@H](O)CC2)O[Si](C)(C)C)C=C1)O[Si](C)(C)C | 4213.4 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,2TMS,isomer #1 | COC1=CC=C(Cl)C=C1C(=NCCC1=CC=C(S(=O)(=O)NC(=N[C@H]2CC[C@H](O)CC2)O[Si](C)(C)C)C=C1)O[Si](C)(C)C | 4213.4 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,2TMS,isomer #2 | COC1=CC=C(Cl)C=C1C(=NCCC1=CC=C(S(=O)(=O)NC(O)=N[C@H]2CC[C@H](O[Si](C)(C)C)CC2)C=C1)O[Si](C)(C)C | 4244.9 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,2TMS,isomer #2 | COC1=CC=C(Cl)C=C1C(=NCCC1=CC=C(S(=O)(=O)NC(O)=N[C@H]2CC[C@H](O[Si](C)(C)C)CC2)C=C1)O[Si](C)(C)C | 4244.9 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,2TMS,isomer #3 | COC1=CC=C(Cl)C=C1C(=NCCC1=CC=C(S(=O)(=O)N(C(O)=N[C@H]2CC[C@H](O)CC2)[Si](C)(C)C)C=C1)O[Si](C)(C)C | 4184.7 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,2TMS,isomer #3 | COC1=CC=C(Cl)C=C1C(=NCCC1=CC=C(S(=O)(=O)N(C(O)=N[C@H]2CC[C@H](O)CC2)[Si](C)(C)C)C=C1)O[Si](C)(C)C | 4184.7 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,2TMS,isomer #4 | COC1=CC=C(Cl)C=C1C(O)=NCCC1=CC=C(S(=O)(=O)NC(=N[C@H]2CC[C@H](O[Si](C)(C)C)CC2)O[Si](C)(C)C)C=C1 | 4195.0 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,2TMS,isomer #4 | COC1=CC=C(Cl)C=C1C(O)=NCCC1=CC=C(S(=O)(=O)NC(=N[C@H]2CC[C@H](O[Si](C)(C)C)CC2)O[Si](C)(C)C)C=C1 | 4195.0 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,2TMS,isomer #5 | COC1=CC=C(Cl)C=C1C(O)=NCCC1=CC=C(S(=O)(=O)N(C(=N[C@H]2CC[C@H](O)CC2)O[Si](C)(C)C)[Si](C)(C)C)C=C1 | 4179.0 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,2TMS,isomer #5 | COC1=CC=C(Cl)C=C1C(O)=NCCC1=CC=C(S(=O)(=O)N(C(=N[C@H]2CC[C@H](O)CC2)O[Si](C)(C)C)[Si](C)(C)C)C=C1 | 4179.0 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,2TMS,isomer #6 | COC1=CC=C(Cl)C=C1C(O)=NCCC1=CC=C(S(=O)(=O)N(C(O)=N[C@H]2CC[C@H](O[Si](C)(C)C)CC2)[Si](C)(C)C)C=C1 | 4187.1 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,2TMS,isomer #6 | COC1=CC=C(Cl)C=C1C(O)=NCCC1=CC=C(S(=O)(=O)N(C(O)=N[C@H]2CC[C@H](O[Si](C)(C)C)CC2)[Si](C)(C)C)C=C1 | 4187.1 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,3TMS,isomer #1 | COC1=CC=C(Cl)C=C1C(=NCCC1=CC=C(S(=O)(=O)NC(=N[C@H]2CC[C@H](O[Si](C)(C)C)CC2)O[Si](C)(C)C)C=C1)O[Si](C)(C)C | 4081.3 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,3TMS,isomer #1 | COC1=CC=C(Cl)C=C1C(=NCCC1=CC=C(S(=O)(=O)NC(=N[C@H]2CC[C@H](O[Si](C)(C)C)CC2)O[Si](C)(C)C)C=C1)O[Si](C)(C)C | 4081.3 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,3TMS,isomer #2 | COC1=CC=C(Cl)C=C1C(=NCCC1=CC=C(S(=O)(=O)N(C(=N[C@H]2CC[C@H](O)CC2)O[Si](C)(C)C)[Si](C)(C)C)C=C1)O[Si](C)(C)C | 4065.9 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,3TMS,isomer #2 | COC1=CC=C(Cl)C=C1C(=NCCC1=CC=C(S(=O)(=O)N(C(=N[C@H]2CC[C@H](O)CC2)O[Si](C)(C)C)[Si](C)(C)C)C=C1)O[Si](C)(C)C | 4065.9 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,3TMS,isomer #3 | COC1=CC=C(Cl)C=C1C(=NCCC1=CC=C(S(=O)(=O)N(C(O)=N[C@H]2CC[C@H](O[Si](C)(C)C)CC2)[Si](C)(C)C)C=C1)O[Si](C)(C)C | 4059.8 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,3TMS,isomer #3 | COC1=CC=C(Cl)C=C1C(=NCCC1=CC=C(S(=O)(=O)N(C(O)=N[C@H]2CC[C@H](O[Si](C)(C)C)CC2)[Si](C)(C)C)C=C1)O[Si](C)(C)C | 4059.8 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,3TMS,isomer #4 | COC1=CC=C(Cl)C=C1C(O)=NCCC1=CC=C(S(=O)(=O)N(C(=N[C@H]2CC[C@H](O[Si](C)(C)C)CC2)O[Si](C)(C)C)[Si](C)(C)C)C=C1 | 4040.8 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,3TMS,isomer #4 | COC1=CC=C(Cl)C=C1C(O)=NCCC1=CC=C(S(=O)(=O)N(C(=N[C@H]2CC[C@H](O[Si](C)(C)C)CC2)O[Si](C)(C)C)[Si](C)(C)C)C=C1 | 4040.8 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,4TMS,isomer #1 | COC1=CC=C(Cl)C=C1C(=NCCC1=CC=C(S(=O)(=O)N(C(=N[C@H]2CC[C@H](O[Si](C)(C)C)CC2)O[Si](C)(C)C)[Si](C)(C)C)C=C1)O[Si](C)(C)C | 3971.2 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,4TMS,isomer #1 | COC1=CC=C(Cl)C=C1C(=NCCC1=CC=C(S(=O)(=O)N(C(=N[C@H]2CC[C@H](O[Si](C)(C)C)CC2)O[Si](C)(C)C)[Si](C)(C)C)C=C1)O[Si](C)(C)C | 3759.9 | Standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,4TMS,isomer #1 | COC1=CC=C(Cl)C=C1C(=NCCC1=CC=C(S(=O)(=O)N(C(=N[C@H]2CC[C@H](O[Si](C)(C)C)CC2)O[Si](C)(C)C)[Si](C)(C)C)C=C1)O[Si](C)(C)C | 5235.1 | Standard polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,1TBDMS,isomer #1 | COC1=CC=C(Cl)C=C1C(=NCCC1=CC=C(S(=O)(=O)NC(O)=N[C@H]2CC[C@H](O)CC2)C=C1)O[Si](C)(C)C(C)(C)C | 4606.6 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,1TBDMS,isomer #1 | COC1=CC=C(Cl)C=C1C(=NCCC1=CC=C(S(=O)(=O)NC(O)=N[C@H]2CC[C@H](O)CC2)C=C1)O[Si](C)(C)C(C)(C)C | 4606.6 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,1TBDMS,isomer #2 | COC1=CC=C(Cl)C=C1C(O)=NCCC1=CC=C(S(=O)(=O)NC(=N[C@H]2CC[C@H](O)CC2)O[Si](C)(C)C(C)(C)C)C=C1 | 4555.7 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,1TBDMS,isomer #2 | COC1=CC=C(Cl)C=C1C(O)=NCCC1=CC=C(S(=O)(=O)NC(=N[C@H]2CC[C@H](O)CC2)O[Si](C)(C)C(C)(C)C)C=C1 | 4555.7 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,1TBDMS,isomer #3 | COC1=CC=C(Cl)C=C1C(O)=NCCC1=CC=C(S(=O)(=O)NC(O)=N[C@H]2CC[C@H](O[Si](C)(C)C(C)(C)C)CC2)C=C1 | 4600.7 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,1TBDMS,isomer #3 | COC1=CC=C(Cl)C=C1C(O)=NCCC1=CC=C(S(=O)(=O)NC(O)=N[C@H]2CC[C@H](O[Si](C)(C)C(C)(C)C)CC2)C=C1 | 4600.7 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,1TBDMS,isomer #4 | COC1=CC=C(Cl)C=C1C(O)=NCCC1=CC=C(S(=O)(=O)N(C(O)=N[C@H]2CC[C@H](O)CC2)[Si](C)(C)C(C)(C)C)C=C1 | 4594.1 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,1TBDMS,isomer #4 | COC1=CC=C(Cl)C=C1C(O)=NCCC1=CC=C(S(=O)(=O)N(C(O)=N[C@H]2CC[C@H](O)CC2)[Si](C)(C)C(C)(C)C)C=C1 | 4594.1 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,2TBDMS,isomer #1 | COC1=CC=C(Cl)C=C1C(=NCCC1=CC=C(S(=O)(=O)NC(=N[C@H]2CC[C@H](O)CC2)O[Si](C)(C)C(C)(C)C)C=C1)O[Si](C)(C)C(C)(C)C | 4612.5 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,2TBDMS,isomer #1 | COC1=CC=C(Cl)C=C1C(=NCCC1=CC=C(S(=O)(=O)NC(=N[C@H]2CC[C@H](O)CC2)O[Si](C)(C)C(C)(C)C)C=C1)O[Si](C)(C)C(C)(C)C | 4612.5 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,2TBDMS,isomer #2 | COC1=CC=C(Cl)C=C1C(=NCCC1=CC=C(S(=O)(=O)NC(O)=N[C@H]2CC[C@H](O[Si](C)(C)C(C)(C)C)CC2)C=C1)O[Si](C)(C)C(C)(C)C | 4660.2 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,2TBDMS,isomer #2 | COC1=CC=C(Cl)C=C1C(=NCCC1=CC=C(S(=O)(=O)NC(O)=N[C@H]2CC[C@H](O[Si](C)(C)C(C)(C)C)CC2)C=C1)O[Si](C)(C)C(C)(C)C | 4660.2 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,2TBDMS,isomer #3 | COC1=CC=C(Cl)C=C1C(=NCCC1=CC=C(S(=O)(=O)N(C(O)=N[C@H]2CC[C@H](O)CC2)[Si](C)(C)C(C)(C)C)C=C1)O[Si](C)(C)C(C)(C)C | 4626.6 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,2TBDMS,isomer #3 | COC1=CC=C(Cl)C=C1C(=NCCC1=CC=C(S(=O)(=O)N(C(O)=N[C@H]2CC[C@H](O)CC2)[Si](C)(C)C(C)(C)C)C=C1)O[Si](C)(C)C(C)(C)C | 4626.6 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,2TBDMS,isomer #4 | COC1=CC=C(Cl)C=C1C(O)=NCCC1=CC=C(S(=O)(=O)NC(=N[C@H]2CC[C@H](O[Si](C)(C)C(C)(C)C)CC2)O[Si](C)(C)C(C)(C)C)C=C1 | 4621.8 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,2TBDMS,isomer #4 | COC1=CC=C(Cl)C=C1C(O)=NCCC1=CC=C(S(=O)(=O)NC(=N[C@H]2CC[C@H](O[Si](C)(C)C(C)(C)C)CC2)O[Si](C)(C)C(C)(C)C)C=C1 | 4621.8 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,2TBDMS,isomer #5 | COC1=CC=C(Cl)C=C1C(O)=NCCC1=CC=C(S(=O)(=O)N(C(=N[C@H]2CC[C@H](O)CC2)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C=C1 | 4596.6 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,2TBDMS,isomer #5 | COC1=CC=C(Cl)C=C1C(O)=NCCC1=CC=C(S(=O)(=O)N(C(=N[C@H]2CC[C@H](O)CC2)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C=C1 | 4596.6 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,2TBDMS,isomer #6 | COC1=CC=C(Cl)C=C1C(O)=NCCC1=CC=C(S(=O)(=O)N(C(O)=N[C@H]2CC[C@H](O[Si](C)(C)C(C)(C)C)CC2)[Si](C)(C)C(C)(C)C)C=C1 | 4646.7 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,2TBDMS,isomer #6 | COC1=CC=C(Cl)C=C1C(O)=NCCC1=CC=C(S(=O)(=O)N(C(O)=N[C@H]2CC[C@H](O[Si](C)(C)C(C)(C)C)CC2)[Si](C)(C)C(C)(C)C)C=C1 | 4646.7 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,3TBDMS,isomer #1 | COC1=CC=C(Cl)C=C1C(=NCCC1=CC=C(S(=O)(=O)NC(=N[C@H]2CC[C@H](O[Si](C)(C)C(C)(C)C)CC2)O[Si](C)(C)C(C)(C)C)C=C1)O[Si](C)(C)C(C)(C)C | 4654.2 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,3TBDMS,isomer #1 | COC1=CC=C(Cl)C=C1C(=NCCC1=CC=C(S(=O)(=O)NC(=N[C@H]2CC[C@H](O[Si](C)(C)C(C)(C)C)CC2)O[Si](C)(C)C(C)(C)C)C=C1)O[Si](C)(C)C(C)(C)C | 4654.2 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,3TBDMS,isomer #2 | COC1=CC=C(Cl)C=C1C(=NCCC1=CC=C(S(=O)(=O)N(C(=N[C@H]2CC[C@H](O)CC2)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C=C1)O[Si](C)(C)C(C)(C)C | 4672.5 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,3TBDMS,isomer #2 | COC1=CC=C(Cl)C=C1C(=NCCC1=CC=C(S(=O)(=O)N(C(=N[C@H]2CC[C@H](O)CC2)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C=C1)O[Si](C)(C)C(C)(C)C | 4672.5 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,3TBDMS,isomer #3 | COC1=CC=C(Cl)C=C1C(=NCCC1=CC=C(S(=O)(=O)N(C(O)=N[C@H]2CC[C@H](O[Si](C)(C)C(C)(C)C)CC2)[Si](C)(C)C(C)(C)C)C=C1)O[Si](C)(C)C(C)(C)C | 4696.2 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,3TBDMS,isomer #3 | COC1=CC=C(Cl)C=C1C(=NCCC1=CC=C(S(=O)(=O)N(C(O)=N[C@H]2CC[C@H](O[Si](C)(C)C(C)(C)C)CC2)[Si](C)(C)C(C)(C)C)C=C1)O[Si](C)(C)C(C)(C)C | 4696.2 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,3TBDMS,isomer #4 | COC1=CC=C(Cl)C=C1C(O)=NCCC1=CC=C(S(=O)(=O)N(C(=N[C@H]2CC[C@H](O[Si](C)(C)C(C)(C)C)CC2)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C=C1 | 4671.9 | Semi standard non polar | 33892256 | | 4-trans-Hydroxycyclohexyl glyburide,3TBDMS,isomer #4 | COC1=CC=C(Cl)C=C1C(O)=NCCC1=CC=C(S(=O)(=O)N(C(=N[C@H]2CC[C@H](O[Si](C)(C)C(C)(C)C)CC2)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C=C1 | 4671.9 | Semi standard non polar | 33892256 |
|
|---|