| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 0.04 minutes | 32390414 |
| Predicted by Siyang on May 30, 2022 | 10.3057 minutes | 33406817 |
| Predicted by Siyang using ReTip algorithm on June 8, 2022 | 4.83 minutes | 32390414 |
| Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 651.3 seconds | 40023050 |
| Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 354.4 seconds | 40023050 |
| Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 18.6 seconds | 40023050 |
| Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 207.6 seconds | 40023050 |
| RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 97.3 seconds | 40023050 |
| Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 311.2 seconds | 40023050 |
| BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 223.3 seconds | 40023050 |
| HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 703.6 seconds | 40023050 |
| UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 613.9 seconds | 40023050 |
| BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 42.2 seconds | 40023050 |
| UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 843.9 seconds | 40023050 |
| SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 212.6 seconds | 40023050 |
| RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 326.7 seconds | 40023050 |
| MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 766.2 seconds | 40023050 |
| KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 463.8 seconds | 40023050 |
| Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 367.2 seconds | 40023050 |
| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| D-chiro-Inositol,1TMS,isomer #1 | C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)[C@@H]1O | 1743.3 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,1TMS,isomer #2 | C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O | 1743.3 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,1TMS,isomer #3 | C[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)[C@H]1O | 1743.3 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,2TMS,isomer #1 | C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O | 1708.2 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,2TMS,isomer #2 | C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O | 1721.1 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,2TMS,isomer #3 | C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O | 1735.0 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,2TMS,isomer #4 | C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O | 1721.1 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,2TMS,isomer #5 | C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C | 1708.2 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,2TMS,isomer #6 | C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O | 1721.1 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,2TMS,isomer #7 | C[Si](C)(C)O[C@H]1[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O | 1735.0 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,2TMS,isomer #8 | C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C | 1708.2 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,2TMS,isomer #9 | C[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)[C@H]1O[Si](C)(C)C | 1708.2 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,3TMS,isomer #1 | C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O | 1686.0 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,3TMS,isomer #10 | C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O | 1735.6 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,3TMS,isomer #2 | C[Si](C)(C)O[C@H]1[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C | 1735.6 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,3TMS,isomer #3 | C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O | 1735.6 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,3TMS,isomer #4 | C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C | 1686.0 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,3TMS,isomer #5 | C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O | 1735.6 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,3TMS,isomer #6 | C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]1O | 1780.1 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,3TMS,isomer #7 | C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C | 1735.6 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,3TMS,isomer #8 | C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C | 1686.0 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,3TMS,isomer #9 | C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O | 1735.6 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,4TMS,isomer #1 | C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C | 1804.7 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,4TMS,isomer #10 | C[Si](C)(C)O[C@H]1[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O | 1858.6 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,4TMS,isomer #11 | C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C | 1804.7 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,4TMS,isomer #12 | C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C | 1854.5 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,4TMS,isomer #2 | C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O | 1858.6 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,4TMS,isomer #3 | C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]1O | 1804.7 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,4TMS,isomer #4 | C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O | 1858.6 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,4TMS,isomer #5 | C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O | 1854.5 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,4TMS,isomer #6 | C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C | 1804.7 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,4TMS,isomer #7 | C[Si](C)(C)O[C@H]1[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O | 1858.6 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,4TMS,isomer #8 | C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O | 1858.6 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,4TMS,isomer #9 | C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O | 1858.6 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,5TMS,isomer #1 | C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C | 1934.2 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,5TMS,isomer #2 | C[Si](C)(C)O[C@H]1[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 1934.2 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,5TMS,isomer #3 | C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C | 1934.2 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,5TMS,isomer #4 | C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 1934.2 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,5TMS,isomer #5 | C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C | 1934.2 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,5TMS,isomer #6 | C[Si](C)(C)O[C@H]1[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C | 1934.2 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,6TMS,isomer #1 | C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 2009.2 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,6TMS,isomer #2 | C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 2009.2 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)[C@@H]1O | 2020.4 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O | 2020.4 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)[C@H]1O | 2020.4 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O | 2193.7 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O | 2206.2 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O | 2236.9 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O | 2206.2 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C | 2193.7 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,2TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@H]1O | 2206.2 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,2TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O | 2236.9 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,2TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 2193.7 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,2TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 2193.7 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@H]1O | 2456.9 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,3TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O | 2490.3 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 2490.3 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O | 2490.3 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C | 2456.9 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O | 2490.3 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O | 2511.9 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,3TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C | 2490.3 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,3TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C | 2456.9 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,3TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O | 2490.3 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C | 2713.4 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,4TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O | 2733.1 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,4TBDMS,isomer #11 | CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C | 2713.4 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,4TBDMS,isomer #12 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 2735.3 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O | 2733.1 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O | 2713.4 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O | 2733.1 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,4TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O | 2735.3 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,4TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C | 2713.4 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,4TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O | 2733.1 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,4TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O | 2733.1 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,4TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O | 2733.1 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,5TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 2931.4 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,5TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C | 2931.4 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,5TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C | 2931.4 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,5TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C | 2931.4 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,5TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C | 2931.4 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,5TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C | 2931.4 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,6TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C | 3172.1 | Semi standard non polar | 33892256 |
| D-chiro-Inositol,6TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C | 3172.1 | Semi standard non polar | 33892256 |