Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References XML

Record Information

Version

5.0

Status

Detected but not Quantified

Creation Date

2019-12-05 19:12:27 UTC

Update Date

2022-09-22 17:44:16 UTC

HMDB ID

HMDB0240607

Secondary Accession Numbers

None

Metabolite Identification

Common Name

Glycohyocholic acid

Description

Glycohyocholic acid (GHCA) is a bile acid. Bile acids are steroid acids found predominantly in the bile of mammals. The distinction between different bile acids is minute, depending only on the presence or absence of hydroxyl groups on positions 3, 7, and 12. Bile acids are physiological detergents that facilitate excretion, absorption, and transport of fats and sterols in the intestine and liver. Bile acids are also steroidal amphipathic molecules derived from the catabolism of cholesterol. They modulate bile flow and lipid secretion, are essential for the absorption of dietary fats and vitamins, and have been implicated in the regulation of all the key enzymes involved in cholesterol homeostasis. Bile acids recirculate through the liver, bile ducts, small intestine and portal vein to form an enterohepatic circuit. They exist as anions at physiological pH and, consequently, require a carrier for transport across the membranes of the enterohepatic tissues. The unique detergent properties of bile acids are essential for the digestion and intestinal absorption of hydrophobic nutrients. Bile acids have potent toxic properties (e.g. membrane disruption) and there are a plethora of mechanisms to limit their accumulation in blood and tissues (PMID: 11316487 , 16037564 , 12576301 , 11907135 ).

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI


  Mrv1652312051920202D          

 38 41  0  0  1  0            999 V2000
   18.9922   -2.6311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2778   -2.2185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7067   -2.2185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7067   -1.3936    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.5633   -2.6311    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   20.4210   -2.6311    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.1355   -2.2185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8499   -2.6311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8499   -3.4561    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.5644   -2.2185    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.8488   -2.2185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5633   -3.4561    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   13.9209   -4.5360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2065   -4.9484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9209   -6.1859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3498   -6.1859    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   14.6354   -4.9484    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   15.3498   -3.7109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5633   -4.7908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0483   -4.1235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6354   -4.1235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3498   -4.5360    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   15.3498   -5.3608    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   16.0642   -4.9484    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   16.0642   -4.1235    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   16.7787   -4.5360    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   16.7787   -3.7109    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   16.7787   -2.8859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7787   -5.3608    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   18.2777   -3.0436    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.2065   -5.7734    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   12.4920   -6.1859    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.0642   -5.7734    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   16.7787   -6.1859    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.6354   -5.7734    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   14.6354   -6.5984    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   16.0642   -3.2984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3498   -7.0109    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  1  3  1  0  0  0  0
  5  2  1  0  0  0  0
  3  6  1  0  0  0  0
  3  4  2  0  0  0  0
  6  7  1  0  0  0  0
  7  8  1  0  0  0  0
  8 10  1  0  0  0  0
  8  9  2  0  0  0  0
  5 11  1  6  0  0  0
  5 12  1  0  0  0  0
 26 27  1  0  0  0  0
 27 12  1  0  0  0  0
 27 37  1  0  0  0  0
 24 26  1  0  0  0  0
 26 19  1  0  0  0  0
 22 18  1  0  0  0  0
 17 22  1  0  0  0  0
 22 24  1  0  0  0  0
 24 33  1  0  0  0  0
 35 17  1  0  0  0  0
 17 21  1  1  0  0  0
 17 13  1  0  0  0  0
 12 20  1  0  0  0  0
 18 37  1  0  0  0  0
 20 19  1  0  0  0  0
 16 33  1  0  0  0  0
 35 15  1  0  0  0  0
 35 16  1  0  0  0  0
 14 13  1  0  0  0  0
 31 15  1  0  0  0  0
 31 14  1  0  0  0  0
 22 23  1  6  0  0  0
 24 25  1  1  0  0  0
 26 29  1  6  0  0  0
 27 28  1  1  0  0  0
 12 30  1  6  0  0  0
 31 32  1  6  0  0  0
 33 34  1  6  0  0  0
 35 36  1  1  0  0  0
 16 38  1  6  0  0  0
M  END

HMDB0240607
     RDKit          3D
Glycohyocholic acid
 76 79  0  0  0  0  0  0  0  0999 V2000
    2.9482   -2.2202   -0.6066 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8119   -0.7542   -0.4862 C   0  0  2  0  0  0  0  0  0  0  0  0
    3.9644   -0.2555    0.3658 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3035   -0.5608   -0.2134 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3827   -0.0450    0.6647 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0703    0.5465    1.7170 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7313   -0.2296    0.2999 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.8002    0.2671    1.1448 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1238   -0.0381    0.5682 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2101   -0.6512   -0.5164 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.2725    0.3514    1.2226 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5698   -0.1995    0.0545 C   0  0  1  0  0  0  0  0  0  0  0  0
    1.7182    1.3335    0.0629 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3102    1.8849   -0.1492 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5169    0.6908    0.0617 C   0  0  1  0  0  0  0  0  0  0  0  0
   -1.9260    0.7216   -0.3268 C   0  0  2  0  0  0  0  0  0  0  0  0
   -2.6234    1.9243    0.2029 C   0  0  2  0  0  0  0  0  0  0  0  0
   -2.2803    2.0810    1.5657 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1134    1.9020    0.0339 C   0  0  2  0  0  0  0  0  0  0  0  0
   -4.7013    2.2559    1.2202 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5830    0.5900   -0.5258 C   0  0  2  0  0  0  0  0  0  0  0  0
   -6.0553    0.4772   -0.6065 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7651    0.1801    0.6565 C   0  0  2  0  0  0  0  0  0  0  0  0
   -7.1825    1.3729    1.2933 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0550   -0.7234    1.6032 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5711   -0.6296    1.5790 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9863   -0.6035    0.1857 C   0  0  1  0  0  0  0  0  0  0  0  0
   -4.4951   -1.8314   -0.5638 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5061   -0.5584    0.2977 C   0  0  1  0  0  0  0  0  0  0  0  0
   -1.8536   -1.7012   -0.3641 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3986   -1.6692   -0.5603 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2991   -0.3844   -0.6751 C   0  0  2  0  0  0  0  0  0  0  0  0
    0.4315    0.1178   -2.1039 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0894   -2.7529   -1.0680 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7856   -2.4071   -1.3487 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.3035   -2.7257    0.3177 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.9984   -0.3140   -1.5115 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.9023   -0.6740    1.4031 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.9182    0.8564    0.5113 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.4319   -0.0918   -1.2052 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3990   -1.6564   -0.3752 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.9916   -0.7249   -0.5812 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.7261    1.3697    1.2469 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.6505   -0.2226    2.1440 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.3295    1.0445    1.9464 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.4114   -0.4731    1.1189 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4016    1.6740   -0.7362 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1290    1.6728    1.0399 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.1967    2.3989   -1.1007 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0810    2.6502    0.6492 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4451    0.3944    1.1430 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1509    0.6385   -1.4056 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1968    2.8165   -0.3032 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2693    3.0647    1.7863 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4082    2.6875   -0.7213 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7278    3.2373    1.2813 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1807    0.5398   -1.5817 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3258   -0.2732   -1.3995 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4619    1.4509   -1.0092 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7369   -0.3320    0.3849 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5485    1.2112    2.1787 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4172   -1.7889    1.5041 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3861   -0.4335    2.6443 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1830    0.1938    2.1910 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1721   -1.5729    2.0562 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0828   -2.7645   -0.1906 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4113   -1.6835   -1.6585 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6062   -1.8774   -0.3653 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1611   -0.5212    1.3717 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0946   -2.6275    0.2413 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4086   -1.8890   -1.3326 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.1300   -2.2835    0.2287 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1967   -2.2503   -1.5137 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.3491   -0.7247   -2.8351 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3855    0.6927   -2.2454 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3733    0.8293   -2.3805 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
  9 11  1  0
  2 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 17 19  1  0
 19 20  1  0
 19 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 23 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  6
 27 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  6
 32 12  1  0
 32 15  1  0
 29 16  1  0
 27 21  1  0
  1 34  1  0
  1 35  1  0
  1 36  1  0
  2 37  1  6
  3 38  1  0
  3 39  1  0
  4 40  1  0
  4 41  1  0
  7 42  1  0
  8 43  1  0
  8 44  1  0
 11 45  1  0
 12 46  1  1
 13 47  1  0
 13 48  1  0
 14 49  1  0
 14 50  1  0
 15 51  1  1
 16 52  1  6
 17 53  1  6
 18 54  1  0
 19 55  1  6
 20 56  1  0
 21 57  1  6
 22 58  1  0
 22 59  1  0
 23 60  1  6
 24 61  1  0
 25 62  1  0
 25 63  1  0
 26 64  1  0
 26 65  1  0
 28 66  1  0
 28 67  1  0
 28 68  1  0
 29 69  1  1
 30 70  1  0
 30 71  1  0
 31 72  1  0
 31 73  1  0
 33 74  1  0
 33 75  1  0
 33 76  1  0
M  END


  Mrv1652312051920202D          

 38 41  0  0  1  0            999 V2000
   18.9922   -2.6311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2778   -2.2185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7067   -2.2185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7067   -1.3936    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.5633   -2.6311    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   20.4210   -2.6311    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.1355   -2.2185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8499   -2.6311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8499   -3.4561    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.5644   -2.2185    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.8488   -2.2185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5633   -3.4561    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   13.9209   -4.5360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2065   -4.9484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9209   -6.1859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3498   -6.1859    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   14.6354   -4.9484    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   15.3498   -3.7109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5633   -4.7908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0483   -4.1235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6354   -4.1235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3498   -4.5360    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   15.3498   -5.3608    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   16.0642   -4.9484    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   16.0642   -4.1235    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   16.7787   -4.5360    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   16.7787   -3.7109    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   16.7787   -2.8859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7787   -5.3608    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   18.2777   -3.0436    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.2065   -5.7734    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   12.4920   -6.1859    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.0642   -5.7734    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   16.7787   -6.1859    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.6354   -5.7734    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   14.6354   -6.5984    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   16.0642   -3.2984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3498   -7.0109    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  1  3  1  0  0  0  0
  5  2  1  0  0  0  0
  3  6  1  0  0  0  0
  3  4  2  0  0  0  0
  6  7  1  0  0  0  0
  7  8  1  0  0  0  0
  8 10  1  0  0  0  0
  8  9  2  0  0  0  0
  5 11  1  6  0  0  0
  5 12  1  0  0  0  0
 26 27  1  0  0  0  0
 27 12  1  0  0  0  0
 27 37  1  0  0  0  0
 24 26  1  0  0  0  0
 26 19  1  0  0  0  0
 22 18  1  0  0  0  0
 17 22  1  0  0  0  0
 22 24  1  0  0  0  0
 24 33  1  0  0  0  0
 35 17  1  0  0  0  0
 17 21  1  1  0  0  0
 17 13  1  0  0  0  0
 12 20  1  0  0  0  0
 18 37  1  0  0  0  0
 20 19  1  0  0  0  0
 16 33  1  0  0  0  0
 35 15  1  0  0  0  0
 35 16  1  0  0  0  0
 14 13  1  0  0  0  0
 31 15  1  0  0  0  0
 31 14  1  0  0  0  0
 22 23  1  6  0  0  0
 24 25  1  1  0  0  0
 26 29  1  6  0  0  0
 27 28  1  1  0  0  0
 12 30  1  6  0  0  0
 31 32  1  6  0  0  0
 33 34  1  6  0  0  0
 35 36  1  1  0  0  0
 16 38  1  6  0  0  0
M  END
> <DATABASE_ID>
HMDB0240607

> <DATABASE_NAME>
hmdb

> <SMILES>
[H][C@@]1(CC[C@@]2([H])[C@]3([H])[C@H](O)[C@H](O)[C@]4([H])C[C@H](O)CC[C@]4(C)[C@@]3([H])CC[C@]12C)[C@H](C)CCC(=O)NCC(O)=O

> <INCHI_IDENTIFIER>
InChI=1S/C26H43NO6/c1-14(4-7-20(29)27-13-21(30)31)16-5-6-17-22-18(9-11-25(16,17)2)26(3)10-8-15(28)12-19(26)23(32)24(22)33/h14-19,22-24,28,32-33H,4-13H2,1-3H3,(H,27,29)(H,30,31)/t14-,15-,16-,17+,18+,19+,22+,23-,24+,25-,26-/m1/s1

> <INCHI_KEY>
ZQYUKJFJPJDMMR-ZDWCHQGWSA-N

> <FORMULA>
C26H43NO6

> <MOLECULAR_WEIGHT>
465.631

> <EXACT_MASS>
465.309038109

> <JCHEM_ACCEPTOR_COUNT>
6

> <JCHEM_ATOM_COUNT>
76

> <JCHEM_AVERAGE_POLARIZABILITY>
52.95235732208522

> <JCHEM_BIOAVAILABILITY>
1

> <JCHEM_DONOR_COUNT>
5

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
2-[(4R)-4-[(1S,2R,5R,7R,8R,9S,10S,11S,14R,15R)-5,8,9-trihydroxy-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadecan-14-yl]pentanamido]acetic acid

> <ALOGPS_LOGP>
1.46

> <JCHEM_LOGP>
1.6110724069999995

> <ALOGPS_LOGS>
-4.45

> <JCHEM_MDDR_LIKE_RULE>
1

> <JCHEM_NUMBER_OF_RINGS>
4

> <JCHEM_PHYSIOLOGICAL_CHARGE>
-1

> <JCHEM_PKA>
13.620411472878

> <JCHEM_PKA_STRONGEST_ACIDIC>
3.7732693913013486

> <JCHEM_PKA_STRONGEST_BASIC>
-1.4837474864590656

> <JCHEM_POLAR_SURFACE_AREA>
127.09000000000002

> <JCHEM_REFRACTIVITY>
123.36180000000002

> <JCHEM_ROTATABLE_BOND_COUNT>
6

> <JCHEM_RULE_OF_FIVE>
1

> <ALOGPS_SOLUBILITY>
1.64e-02 g/l

> <JCHEM_TRADITIONAL_IUPAC>
[(4R)-4-[(1S,2R,5R,7R,8R,9S,10S,11S,14R,15R)-5,8,9-trihydroxy-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadecan-14-yl]pentanamido]acetic acid

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0240607
     RDKit          3D
Glycohyocholic acid
 76 79  0  0  0  0  0  0  0  0999 V2000
    2.9482   -2.2202   -0.6066 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8119   -0.7542   -0.4862 C   0  0  2  0  0  0  0  0  0  0  0  0
    3.9644   -0.2555    0.3658 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3035   -0.5608   -0.2134 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3827   -0.0450    0.6647 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0703    0.5465    1.7170 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7313   -0.2296    0.2999 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.8002    0.2671    1.1448 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1238   -0.0381    0.5682 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2101   -0.6512   -0.5164 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.2725    0.3514    1.2226 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5698   -0.1995    0.0545 C   0  0  1  0  0  0  0  0  0  0  0  0
    1.7182    1.3335    0.0629 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3102    1.8849   -0.1492 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5169    0.6908    0.0617 C   0  0  1  0  0  0  0  0  0  0  0  0
   -1.9260    0.7216   -0.3268 C   0  0  2  0  0  0  0  0  0  0  0  0
   -2.6234    1.9243    0.2029 C   0  0  2  0  0  0  0  0  0  0  0  0
   -2.2803    2.0810    1.5657 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1134    1.9020    0.0339 C   0  0  2  0  0  0  0  0  0  0  0  0
   -4.7013    2.2559    1.2202 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5830    0.5900   -0.5258 C   0  0  2  0  0  0  0  0  0  0  0  0
   -6.0553    0.4772   -0.6065 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7651    0.1801    0.6565 C   0  0  2  0  0  0  0  0  0  0  0  0
   -7.1825    1.3729    1.2933 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0550   -0.7234    1.6032 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5711   -0.6296    1.5790 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9863   -0.6035    0.1857 C   0  0  1  0  0  0  0  0  0  0  0  0
   -4.4951   -1.8314   -0.5638 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5061   -0.5584    0.2977 C   0  0  1  0  0  0  0  0  0  0  0  0
   -1.8536   -1.7012   -0.3641 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3986   -1.6692   -0.5603 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2991   -0.3844   -0.6751 C   0  0  2  0  0  0  0  0  0  0  0  0
    0.4315    0.1178   -2.1039 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0894   -2.7529   -1.0680 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7856   -2.4071   -1.3487 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.3035   -2.7257    0.3177 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.9984   -0.3140   -1.5115 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.9023   -0.6740    1.4031 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.9182    0.8564    0.5113 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.4319   -0.0918   -1.2052 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3990   -1.6564   -0.3752 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.9916   -0.7249   -0.5812 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.7261    1.3697    1.2469 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.6505   -0.2226    2.1440 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.3295    1.0445    1.9464 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.4114   -0.4731    1.1189 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4016    1.6740   -0.7362 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1290    1.6728    1.0399 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.1967    2.3989   -1.1007 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0810    2.6502    0.6492 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4451    0.3944    1.1430 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1509    0.6385   -1.4056 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1968    2.8165   -0.3032 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2693    3.0647    1.7863 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4082    2.6875   -0.7213 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7278    3.2373    1.2813 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1807    0.5398   -1.5817 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3258   -0.2732   -1.3995 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4619    1.4509   -1.0092 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7369   -0.3320    0.3849 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5485    1.2112    2.1787 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4172   -1.7889    1.5041 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3861   -0.4335    2.6443 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1830    0.1938    2.1910 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1721   -1.5729    2.0562 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0828   -2.7645   -0.1906 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4113   -1.6835   -1.6585 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6062   -1.8774   -0.3653 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1611   -0.5212    1.3717 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0946   -2.6275    0.2413 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4086   -1.8890   -1.3326 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.1300   -2.2835    0.2287 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1967   -2.2503   -1.5137 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.3491   -0.7247   -2.8351 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3855    0.6927   -2.2454 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3733    0.8293   -2.3805 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
  9 11  1  0
  2 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 17 19  1  0
 19 20  1  0
 19 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 23 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  6
 27 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  6
 32 12  1  0
 32 15  1  0
 29 16  1  0
 27 21  1  0
  1 34  1  0
  1 35  1  0
  1 36  1  0
  2 37  1  6
  3 38  1  0
  3 39  1  0
  4 40  1  0
  4 41  1  0
  7 42  1  0
  8 43  1  0
  8 44  1  0
 11 45  1  0
 12 46  1  1
 13 47  1  0
 13 48  1  0
 14 49  1  0
 14 50  1  0
 15 51  1  1
 16 52  1  6
 17 53  1  6
 18 54  1  0
 19 55  1  6
 20 56  1  0
 21 57  1  6
 22 58  1  0
 22 59  1  0
 23 60  1  6
 24 61  1  0
 25 62  1  0
 25 63  1  0
 26 64  1  0
 26 65  1  0
 28 66  1  0
 28 67  1  0
 28 68  1  0
 29 69  1  1
 30 70  1  0
 30 71  1  0
 31 72  1  0
 31 73  1  0
 33 74  1  0
 33 75  1  0
 33 76  1  0
M  END

HEADER    PROTEIN                                 05-DEC-19   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   05-DEC-19         0                                  
HETATM    1  C   UNK     0      35.452  -4.911   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0      34.119  -4.141   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0      36.786  -4.141   0.000  0.00  0.00           C+0
HETATM    4  O   UNK     0      36.786  -2.601   0.000  0.00  0.00           O+0
HETATM    5  C   UNK     0      32.785  -4.911   0.000  0.00  0.00           C+0
HETATM    6  N   UNK     0      38.119  -4.911   0.000  0.00  0.00           N+0
HETATM    7  C   UNK     0      39.453  -4.141   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0      40.786  -4.911   0.000  0.00  0.00           C+0
HETATM    9  O   UNK     0      40.786  -6.451   0.000  0.00  0.00           O+0
HETATM   10  O   UNK     0      42.120  -4.141   0.000  0.00  0.00           O+0
HETATM   11  C   UNK     0      31.451  -4.141   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0      32.785  -6.451   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0      25.986  -8.467   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0      24.652  -9.237   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0      25.986 -11.547   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0      28.653 -11.547   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0      27.319  -9.237   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0      28.653  -6.927   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0      32.785  -8.943   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0      33.690  -7.697   0.000  0.00  0.00           C+0
HETATM   21  C   UNK     0      27.319  -7.697   0.000  0.00  0.00           C+0
HETATM   22  C   UNK     0      28.653  -8.467   0.000  0.00  0.00           C+0
HETATM   23  H   UNK     0      28.653 -10.007   0.000  0.00  0.00           H+0
HETATM   24  C   UNK     0      29.987  -9.237   0.000  0.00  0.00           C+0
HETATM   25  H   UNK     0      29.987  -7.697   0.000  0.00  0.00           H+0
HETATM   26  C   UNK     0      31.320  -8.467   0.000  0.00  0.00           C+0
HETATM   27  C   UNK     0      31.320  -6.927   0.000  0.00  0.00           C+0
HETATM   28  C   UNK     0      31.320  -5.387   0.000  0.00  0.00           C+0
HETATM   29  H   UNK     0      31.320 -10.007   0.000  0.00  0.00           H+0
HETATM   30  H   UNK     0      34.118  -5.681   0.000  0.00  0.00           H+0
HETATM   31  C   UNK     0      24.652 -10.777   0.000  0.00  0.00           C+0
HETATM   32  O   UNK     0      23.318 -11.547   0.000  0.00  0.00           O+0
HETATM   33  C   UNK     0      29.987 -10.777   0.000  0.00  0.00           C+0
HETATM   34  O   UNK     0      31.320 -11.547   0.000  0.00  0.00           O+0
HETATM   35  C   UNK     0      27.319 -10.777   0.000  0.00  0.00           C+0
HETATM   36  H   UNK     0      27.319 -12.317   0.000  0.00  0.00           H+0
HETATM   37  C   UNK     0      29.987  -6.157   0.000  0.00  0.00           C+0
HETATM   38  O   UNK     0      28.653 -13.087   0.000  0.00  0.00           O+0
CONECT    1    2    3                                                       
CONECT    2    1    5                                                       
CONECT    3    1    6    4                                                  
CONECT    4    3                                                            
CONECT    5    2   11   12                                                  
CONECT    6    3    7                                                       
CONECT    7    6    8                                                       
CONECT    8    7   10    9                                                  
CONECT    9    8                                                            
CONECT   10    8                                                            
CONECT   11    5                                                            
CONECT   12    5   27   20   30                                             
CONECT   13   17   14                                                       
CONECT   14   13   31                                                       
CONECT   15   35   31                                                       
CONECT   16   33   35   38                                                  
CONECT   17   22   35   21   13                                             
CONECT   18   22   37                                                       
CONECT   19   26   20                                                       
CONECT   20   12   19                                                       
CONECT   21   17                                                            
CONECT   22   18   17   24   23                                             
CONECT   23   22                                                            
CONECT   24   26   22   33   25                                             
CONECT   25   24                                                            
CONECT   26   27   24   19   29                                             
CONECT   27   26   12   37   28                                             
CONECT   28   27                                                            
CONECT   29   26                                                            
CONECT   30   12                                                            
CONECT   31   15   14   32                                                  
CONECT   32   31                                                            
CONECT   33   24   16   34                                                  
CONECT   34   33                                                            
CONECT   35   17   15   16   36                                             
CONECT   36   35                                                            
CONECT   37   27   18                                                       
CONECT   38   16                                                            
MASTER        0    0    0    0    0    0    0    0   38    0   82    0
END

COMPND    HMDB0240607
HETATM    1  C1  UNL     1       2.948  -2.220  -0.607  1.00  0.00           C  
HETATM    2  C2  UNL     1       2.812  -0.754  -0.486  1.00  0.00           C  
HETATM    3  C3  UNL     1       3.964  -0.256   0.366  1.00  0.00           C  
HETATM    4  C4  UNL     1       5.303  -0.561  -0.213  1.00  0.00           C  
HETATM    5  C5  UNL     1       6.383  -0.045   0.665  1.00  0.00           C  
HETATM    6  O1  UNL     1       6.070   0.546   1.717  1.00  0.00           O  
HETATM    7  N1  UNL     1       7.731  -0.230   0.300  1.00  0.00           N  
HETATM    8  C6  UNL     1       8.800   0.267   1.145  1.00  0.00           C  
HETATM    9  C7  UNL     1      10.124  -0.038   0.568  1.00  0.00           C  
HETATM   10  O2  UNL     1      10.210  -0.651  -0.516  1.00  0.00           O  
HETATM   11  O3  UNL     1      11.272   0.351   1.223  1.00  0.00           O  
HETATM   12  C8  UNL     1       1.570  -0.200   0.055  1.00  0.00           C  
HETATM   13  C9  UNL     1       1.718   1.334   0.063  1.00  0.00           C  
HETATM   14  C10 UNL     1       0.310   1.885  -0.149  1.00  0.00           C  
HETATM   15  C11 UNL     1      -0.517   0.691   0.062  1.00  0.00           C  
HETATM   16  C12 UNL     1      -1.926   0.722  -0.327  1.00  0.00           C  
HETATM   17  C13 UNL     1      -2.623   1.924   0.203  1.00  0.00           C  
HETATM   18  O4  UNL     1      -2.280   2.081   1.566  1.00  0.00           O  
HETATM   19  C14 UNL     1      -4.113   1.902   0.034  1.00  0.00           C  
HETATM   20  O5  UNL     1      -4.701   2.256   1.220  1.00  0.00           O  
HETATM   21  C15 UNL     1      -4.583   0.590  -0.526  1.00  0.00           C  
HETATM   22  C16 UNL     1      -6.055   0.477  -0.606  1.00  0.00           C  
HETATM   23  C17 UNL     1      -6.765   0.180   0.657  1.00  0.00           C  
HETATM   24  O6  UNL     1      -7.182   1.373   1.293  1.00  0.00           O  
HETATM   25  C18 UNL     1      -6.055  -0.723   1.603  1.00  0.00           C  
HETATM   26  C19 UNL     1      -4.571  -0.630   1.579  1.00  0.00           C  
HETATM   27  C20 UNL     1      -3.986  -0.604   0.186  1.00  0.00           C  
HETATM   28  C21 UNL     1      -4.495  -1.831  -0.564  1.00  0.00           C  
HETATM   29  C22 UNL     1      -2.506  -0.558   0.298  1.00  0.00           C  
HETATM   30  C23 UNL     1      -1.854  -1.701  -0.364  1.00  0.00           C  
HETATM   31  C24 UNL     1      -0.399  -1.669  -0.560  1.00  0.00           C  
HETATM   32  C25 UNL     1       0.299  -0.384  -0.675  1.00  0.00           C  
HETATM   33  C26 UNL     1       0.432   0.118  -2.104  1.00  0.00           C  
HETATM   34  H1  UNL     1       2.089  -2.753  -1.068  1.00  0.00           H  
HETATM   35  H2  UNL     1       3.786  -2.407  -1.349  1.00  0.00           H  
HETATM   36  H3  UNL     1       3.303  -2.726   0.318  1.00  0.00           H  
HETATM   37  H4  UNL     1       2.998  -0.314  -1.512  1.00  0.00           H  
HETATM   38  H5  UNL     1       3.902  -0.674   1.403  1.00  0.00           H  
HETATM   39  H6  UNL     1       3.918   0.856   0.511  1.00  0.00           H  
HETATM   40  H7  UNL     1       5.432  -0.092  -1.205  1.00  0.00           H  
HETATM   41  H8  UNL     1       5.399  -1.656  -0.375  1.00  0.00           H  
HETATM   42  H9  UNL     1       7.992  -0.725  -0.581  1.00  0.00           H  
HETATM   43  H10 UNL     1       8.726   1.370   1.247  1.00  0.00           H  
HETATM   44  H11 UNL     1       8.651  -0.223   2.144  1.00  0.00           H  
HETATM   45  H12 UNL     1      11.330   1.044   1.946  1.00  0.00           H  
HETATM   46  H13 UNL     1       1.411  -0.473   1.119  1.00  0.00           H  
HETATM   47  H14 UNL     1       2.402   1.674  -0.736  1.00  0.00           H  
HETATM   48  H15 UNL     1       2.129   1.673   1.040  1.00  0.00           H  
HETATM   49  H16 UNL     1       0.197   2.399  -1.101  1.00  0.00           H  
HETATM   50  H17 UNL     1       0.081   2.650   0.649  1.00  0.00           H  
HETATM   51  H18 UNL     1      -0.445   0.394   1.143  1.00  0.00           H  
HETATM   52  H19 UNL     1      -2.151   0.639  -1.406  1.00  0.00           H  
HETATM   53  H20 UNL     1      -2.197   2.816  -0.303  1.00  0.00           H  
HETATM   54  H21 UNL     1      -2.269   3.065   1.786  1.00  0.00           H  
HETATM   55  H22 UNL     1      -4.408   2.688  -0.721  1.00  0.00           H  
HETATM   56  H23 UNL     1      -4.728   3.237   1.281  1.00  0.00           H  
HETATM   57  H24 UNL     1      -4.181   0.540  -1.582  1.00  0.00           H  
HETATM   58  H25 UNL     1      -6.326  -0.273  -1.400  1.00  0.00           H  
HETATM   59  H26 UNL     1      -6.462   1.451  -1.009  1.00  0.00           H  
HETATM   60  H27 UNL     1      -7.737  -0.332   0.385  1.00  0.00           H  
HETATM   61  H28 UNL     1      -7.549   1.211   2.179  1.00  0.00           H  
HETATM   62  H29 UNL     1      -6.417  -1.789   1.504  1.00  0.00           H  
HETATM   63  H30 UNL     1      -6.386  -0.433   2.644  1.00  0.00           H  
HETATM   64  H31 UNL     1      -4.183   0.194   2.191  1.00  0.00           H  
HETATM   65  H32 UNL     1      -4.172  -1.573   2.056  1.00  0.00           H  
HETATM   66  H33 UNL     1      -4.083  -2.765  -0.191  1.00  0.00           H  
HETATM   67  H34 UNL     1      -4.411  -1.684  -1.659  1.00  0.00           H  
HETATM   68  H35 UNL     1      -5.606  -1.877  -0.365  1.00  0.00           H  
HETATM   69  H36 UNL     1      -2.161  -0.521   1.372  1.00  0.00           H  
HETATM   70  H37 UNL     1      -2.095  -2.628   0.241  1.00  0.00           H  
HETATM   71  H38 UNL     1      -2.409  -1.889  -1.333  1.00  0.00           H  
HETATM   72  H39 UNL     1       0.130  -2.283   0.229  1.00  0.00           H  
HETATM   73  H40 UNL     1      -0.197  -2.250  -1.514  1.00  0.00           H  
HETATM   74  H41 UNL     1       0.349  -0.725  -2.835  1.00  0.00           H  
HETATM   75  H42 UNL     1       1.386   0.693  -2.245  1.00  0.00           H  
HETATM   76  H43 UNL     1      -0.373   0.829  -2.381  1.00  0.00           H  
CONECT    1    2   34   35   36
CONECT    2    3   12   37
CONECT    3    4   38   39
CONECT    4    5   40   41
CONECT    5    6    6    7
CONECT    7    8   42
CONECT    8    9   43   44
CONECT    9   10   10   11
CONECT   11   45
CONECT   12   13   32   46
CONECT   13   14   47   48
CONECT   14   15   49   50
CONECT   15   16   32   51
CONECT   16   17   29   52
CONECT   17   18   19   53
CONECT   18   54
CONECT   19   20   21   55
CONECT   20   56
CONECT   21   22   27   57
CONECT   22   23   58   59
CONECT   23   24   25   60
CONECT   24   61
CONECT   25   26   62   63
CONECT   26   27   64   65
CONECT   27   28   29
CONECT   28   66   67   68
CONECT   29   30   69
CONECT   30   31   70   71
CONECT   31   32   72   73
CONECT   32   33
CONECT   33   74   75   76
END

HMDB0240607
     RDKit          3D
Glycohyocholic acid
 76 79  0  0  0  0  0  0  0  0999 V2000
    2.9482   -2.2202   -0.6066 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8119   -0.7542   -0.4862 C   0  0  2  0  0  0  0  0  0  0  0  0
    3.9644   -0.2555    0.3658 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3035   -0.5608   -0.2134 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3827   -0.0450    0.6647 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0703    0.5465    1.7170 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7313   -0.2296    0.2999 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.8002    0.2671    1.1448 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1238   -0.0381    0.5682 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2101   -0.6512   -0.5164 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.2725    0.3514    1.2226 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5698   -0.1995    0.0545 C   0  0  1  0  0  0  0  0  0  0  0  0
    1.7182    1.3335    0.0629 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3102    1.8849   -0.1492 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5169    0.6908    0.0617 C   0  0  1  0  0  0  0  0  0  0  0  0
   -1.9260    0.7216   -0.3268 C   0  0  2  0  0  0  0  0  0  0  0  0
   -2.6234    1.9243    0.2029 C   0  0  2  0  0  0  0  0  0  0  0  0
   -2.2803    2.0810    1.5657 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1134    1.9020    0.0339 C   0  0  2  0  0  0  0  0  0  0  0  0
   -4.7013    2.2559    1.2202 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5830    0.5900   -0.5258 C   0  0  2  0  0  0  0  0  0  0  0  0
   -6.0553    0.4772   -0.6065 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7651    0.1801    0.6565 C   0  0  2  0  0  0  0  0  0  0  0  0
   -7.1825    1.3729    1.2933 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0550   -0.7234    1.6032 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5711   -0.6296    1.5790 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9863   -0.6035    0.1857 C   0  0  1  0  0  0  0  0  0  0  0  0
   -4.4951   -1.8314   -0.5638 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5061   -0.5584    0.2977 C   0  0  1  0  0  0  0  0  0  0  0  0
   -1.8536   -1.7012   -0.3641 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3986   -1.6692   -0.5603 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2991   -0.3844   -0.6751 C   0  0  2  0  0  0  0  0  0  0  0  0
    0.4315    0.1178   -2.1039 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0894   -2.7529   -1.0680 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7856   -2.4071   -1.3487 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.3035   -2.7257    0.3177 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.9984   -0.3140   -1.5115 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.9023   -0.6740    1.4031 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.9182    0.8564    0.5113 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.4319   -0.0918   -1.2052 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3990   -1.6564   -0.3752 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.9916   -0.7249   -0.5812 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.7261    1.3697    1.2469 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.6505   -0.2226    2.1440 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.3295    1.0445    1.9464 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.4114   -0.4731    1.1189 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4016    1.6740   -0.7362 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1290    1.6728    1.0399 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.1967    2.3989   -1.1007 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0810    2.6502    0.6492 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4451    0.3944    1.1430 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1509    0.6385   -1.4056 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1968    2.8165   -0.3032 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2693    3.0647    1.7863 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4082    2.6875   -0.7213 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7278    3.2373    1.2813 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1807    0.5398   -1.5817 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3258   -0.2732   -1.3995 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4619    1.4509   -1.0092 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7369   -0.3320    0.3849 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5485    1.2112    2.1787 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4172   -1.7889    1.5041 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3861   -0.4335    2.6443 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1830    0.1938    2.1910 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1721   -1.5729    2.0562 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0828   -2.7645   -0.1906 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4113   -1.6835   -1.6585 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6062   -1.8774   -0.3653 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1611   -0.5212    1.3717 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0946   -2.6275    0.2413 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4086   -1.8890   -1.3326 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.1300   -2.2835    0.2287 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1967   -2.2503   -1.5137 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.3491   -0.7247   -2.8351 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3855    0.6927   -2.2454 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3733    0.8293   -2.3805 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
  9 11  1  0
  2 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 17 19  1  0
 19 20  1  0
 19 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 23 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  6
 27 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  6
 32 12  1  0
 32 15  1  0
 29 16  1  0
 27 21  1  0
  1 34  1  0
  1 35  1  0
  1 36  1  0
  2 37  1  6
  3 38  1  0
  3 39  1  0
  4 40  1  0
  4 41  1  0
  7 42  1  0
  8 43  1  0
  8 44  1  0
 11 45  1  0
 12 46  1  1
 13 47  1  0
 13 48  1  0
 14 49  1  0
 14 50  1  0
 15 51  1  1
 16 52  1  6
 17 53  1  6
 18 54  1  0
 19 55  1  6
 20 56  1  0
 21 57  1  6
 22 58  1  0
 22 59  1  0
 23 60  1  6
 24 61  1  0
 25 62  1  0
 25 63  1  0
 26 64  1  0
 26 65  1  0
 28 66  1  0
 28 67  1  0
 28 68  1  0
 29 69  1  1
 30 70  1  0
 30 71  1  0
 31 72  1  0
 31 73  1  0
 33 74  1  0
 33 75  1  0
 33 76  1  0
M  END

View in JSmol View Stereo Labels

Synonyms

Value	Source
Hyocholic acid-glycine conjugate	ChEBI
N-[(3alpha,5beta,6alpha,7alpha)-3,6,7-Trihydroxy-24-oxocholan-24-yl]glycine	ChEBI
N-Hyocholoylglycine	ChEBI
Hyocholate-glycine conjugate	Generator
Hyocholic acid-glycine conjugic acid	Generator
N-[(3a,5b,6a,7a)-3,6,7-Trihydroxy-24-oxocholan-24-yl]glycine	Generator
N-[(3Α,5β,6α,7α)-3,6,7-trihydroxy-24-oxocholan-24-yl]glycine	Generator
Glycohyocholate	Generator
g-HCA	HMDB
GHCA	HMDB
Glycine hyocholate	HMDB
Glyco-hyocholic acid	HMDB
Glycohyocholic acid	HMDB

Chemical Formula

C₂₆H₄₃NO₆

Average Molecular Weight

465.631

Monoisotopic Molecular Weight

465.309038109

IUPAC Name

2-[(4R)-4-[(1S,2R,5R,7R,8R,9S,10S,11S,14R,15R)-5,8,9-trihydroxy-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadecan-14-yl]pentanamido]acetic acid

Traditional Name

[(4R)-4-[(1S,2R,5R,7R,8R,9S,10S,11S,14R,15R)-5,8,9-trihydroxy-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadecan-14-yl]pentanamido]acetic acid

CAS Registry Number

32747-08-3

SMILES

[H][C@@]1(CC[C@@]2([H])[C@]3([H])[C@H](O)[C@H](O)[C@]4([H])C[C@H](O)CC[C@]4(C)[C@@]3([H])CC[C@]12C)[C@H](C)CCC(=O)NCC(O)=O

InChI Identifier

InChI=1S/C26H43NO6/c1-14(4-7-20(29)27-13-21(30)31)16-5-6-17-22-18(9-11-25(16,17)2)26(3)10-8-15(28)12-19(26)23(32)24(22)33/h14-19,22-24,28,32-33H,4-13H2,1-3H3,(H,27,29)(H,30,31)/t14-,15-,16-,17+,18+,19+,22+,23-,24+,25-,26-/m1/s1

InChI Key

ZQYUKJFJPJDMMR-ZDWCHQGWSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as glycinated bile acids and derivatives. Glycinated bile acids and derivatives are compounds with a structure characterized by the presence of a glycine linked to a bile acid skeleton.

Kingdom

Organic compounds

Super Class

Lipids and lipid-like molecules

Class

Steroids and steroid derivatives

Sub Class

Bile acids, alcohols and derivatives

Direct Parent

Glycinated bile acids and derivatives

Alternative Parents

Substituents

Glycinated bile acid
Trihydroxy bile acid, alcohol, or derivatives
Hydroxy bile acid, alcohol, or derivatives
3-hydroxysteroid
6-hydroxysteroid
Hydroxysteroid
7-hydroxysteroid
3-alpha-hydroxysteroid
N-acyl-alpha-amino acid
N-acyl-alpha amino acid or derivatives
Alpha-amino acid or derivatives
Fatty acyl
N-acyl-amine
Fatty amide
Cyclic alcohol
Secondary alcohol
Secondary carboxylic acid amide
Carboxamide group
Polyol
Monocarboxylic acid or derivatives
Carboxylic acid derivative
Carboxylic acid
Organooxygen compound
Organic oxygen compound
Organopnictogen compound
Organic oxide
Hydrocarbon derivative
Organic nitrogen compound
Carbonyl group
Alcohol
Organonitrogen compound
Aliphatic homopolycyclic compound

Molecular Framework

Aliphatic homopolycyclic compounds

External Descriptors

Not Available

Ontology

Physiological effect

Disposition

Biological location

Non-excretory biofluid

Biofluid or Excreta

Blood (PMID: 29458053)
Bile (PMID: 31643938)

Excreta

Biofluid or Excreta

Feces (PMID: 31643938)
Urine (PMID: 1112456)

Organ

Source

Exogenous

Exogenous (HMDB: HMDB0240607)

Process

Not Available

Role

Industrial application

Pharmaceutical industry

Biomarker

Physical Properties

State

Not Available

Experimental Molecular Properties

Property	Value	Reference
Melting Point	Not Available	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	Not Available	Not Available
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
logP	1.46	ALOGPS
logP	1.61	ChemAxon
logS	-4.4	ALOGPS
pKa (Strongest Acidic)	3.77	ChemAxon
pKa (Strongest Basic)	-1.5	ChemAxon
Physiological Charge	-1	ChemAxon
Hydrogen Acceptor Count	6	ChemAxon
Hydrogen Donor Count	5	ChemAxon
Polar Surface Area	127.09 Å²	ChemAxon
Rotatable Bond Count	6	ChemAxon
Refractivity	123.36 m³·mol⁻¹	ChemAxon
Polarizability	52.95 Å³	ChemAxon
Number of Rings	4	ChemAxon
Bioavailability	Yes	ChemAxon
Rule of Five	Yes	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	Yes	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DeepCCS	[M-2H]-	246.427	30932474
DeepCCS	[M+Na]+	220.444	30932474

Predicted Retention Times

Underivatized

Chromatographic Method	Retention Time	Reference
Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022.	5.92 minutes	32390414
Predicted by Siyang on May 30, 2022	13.0156 minutes	33406817
Predicted by Siyang using ReTip algorithm on June 8, 2022	3.87 minutes	32390414
Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid	2571.6 seconds	40023050
Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid	169.2 seconds	40023050
Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid	193.7 seconds	40023050
Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid	169.2 seconds	40023050
RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid	398.2 seconds	40023050
Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid	503.3 seconds	40023050
BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid	575.9 seconds	40023050
HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate)	195.2 seconds	40023050
UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid	972.6 seconds	40023050
BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid	504.8 seconds	40023050
UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid	1504.9 seconds	40023050
SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid	316.0 seconds	40023050
RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid	416.0 seconds	40023050
MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate	292.0 seconds	40023050
KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA	228.7 seconds	40023050
Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water	83.5 seconds	40023050

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
Glycohyocholic acid	[H][C@@]1(CC[C@@]2([H])[C@]3([H])[C@H](O)[C@H](O)[C@]4([H])C[C@H](O)CC[C@]4(C)[C@@]3([H])CC[C@]12C)[C@H](C)CCC(=O)NCC(O)=O	3964.1	Standard polar	33892256
Glycohyocholic acid	[H][C@@]1(CC[C@@]2([H])[C@]3([H])[C@H](O)[C@H](O)[C@]4([H])C[C@H](O)CC[C@]4(C)[C@@]3([H])CC[C@]12C)[C@H](C)CCC(=O)NCC(O)=O	3806.1	Standard non polar	33892256
Glycohyocholic acid	[H][C@@]1(CC[C@@]2([H])[C@]3([H])[C@H](O)[C@H](O)[C@]4([H])C[C@H](O)CC[C@]4(C)[C@@]3([H])CC[C@]12C)[C@H](C)CCC(=O)NCC(O)=O	4289.5	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
Glycohyocholic acid,1TMS,isomer #1	C[C@H](CCC(=O)NCC(=O)O)[C@H]1CC[C@H]2[C@@H]3[C@H](O[Si](C)(C)C)[C@H](O)[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C	3865.0	Semi standard non polar	33892256
Glycohyocholic acid,1TMS,isomer #2	C[C@H](CCC(=O)NCC(=O)O)[C@H]1CC[C@H]2[C@@H]3[C@H](O)[C@H](O[Si](C)(C)C)[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C	3889.9	Semi standard non polar	33892256
Glycohyocholic acid,1TMS,isomer #3	C[C@H](CCC(=O)NCC(=O)O)[C@H]1CC[C@H]2[C@@H]3[C@H](O)[C@H](O)[C@@H]4C[C@H](O[Si](C)(C)C)CC[C@]4(C)[C@H]3CC[C@@]21C	3956.7	Semi standard non polar	33892256
Glycohyocholic acid,1TMS,isomer #4	C[C@H](CCC(=O)NCC(=O)O[Si](C)(C)C)[C@H]1CC[C@H]2[C@@H]3[C@H](O)[C@H](O)[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C	3960.8	Semi standard non polar	33892256
Glycohyocholic acid,1TMS,isomer #5	C[C@H](CCC(=O)N(CC(=O)O)[Si](C)(C)C)[C@H]1CC[C@H]2[C@@H]3[C@H](O)[C@H](O)[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C	3974.5	Semi standard non polar	33892256
Glycohyocholic acid,2TMS,isomer #1	C[C@H](CCC(=O)NCC(=O)O[Si](C)(C)C)[C@H]1CC[C@H]2[C@@H]3[C@H](O[Si](C)(C)C)[C@H](O)[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C	3831.4	Semi standard non polar	33892256
Glycohyocholic acid,2TMS,isomer #10	C[C@H](CCC(=O)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@H]1CC[C@H]2[C@@H]3[C@H](O)[C@H](O)[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C	3928.3	Semi standard non polar	33892256
Glycohyocholic acid,2TMS,isomer #2	C[C@H](CCC(=O)NCC(=O)O)[C@H]1CC[C@H]2[C@@H]3[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C	3792.1	Semi standard non polar	33892256
Glycohyocholic acid,2TMS,isomer #3	C[C@H](CCC(=O)NCC(=O)O)[C@H]1CC[C@H]2[C@@H]3[C@H](O[Si](C)(C)C)[C@H](O)[C@@H]4C[C@H](O[Si](C)(C)C)CC[C@]4(C)[C@H]3CC[C@@]21C	3816.0	Semi standard non polar	33892256
Glycohyocholic acid,2TMS,isomer #4	C[C@H](CCC(=O)N(CC(=O)O)[Si](C)(C)C)[C@H]1CC[C@H]2[C@@H]3[C@H](O[Si](C)(C)C)[C@H](O)[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C	3789.7	Semi standard non polar	33892256
Glycohyocholic acid,2TMS,isomer #5	C[C@H](CCC(=O)NCC(=O)O[Si](C)(C)C)[C@H]1CC[C@H]2[C@@H]3[C@H](O)[C@H](O[Si](C)(C)C)[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C	3836.7	Semi standard non polar	33892256
Glycohyocholic acid,2TMS,isomer #6	C[C@H](CCC(=O)NCC(=O)O)[C@H]1CC[C@H]2[C@@H]3[C@H](O)[C@H](O[Si](C)(C)C)[C@@H]4C[C@H](O[Si](C)(C)C)CC[C@]4(C)[C@H]3CC[C@@]21C	3843.5	Semi standard non polar	33892256
Glycohyocholic acid,2TMS,isomer #7	C[C@H](CCC(=O)N(CC(=O)O)[Si](C)(C)C)[C@H]1CC[C@H]2[C@@H]3[C@H](O)[C@H](O[Si](C)(C)C)[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C	3806.3	Semi standard non polar	33892256
Glycohyocholic acid,2TMS,isomer #8	C[C@H](CCC(=O)NCC(=O)O[Si](C)(C)C)[C@H]1CC[C@H]2[C@@H]3[C@H](O)[C@H](O)[C@@H]4C[C@H](O[Si](C)(C)C)CC[C@]4(C)[C@H]3CC[C@@]21C	3903.8	Semi standard non polar	33892256
Glycohyocholic acid,2TMS,isomer #9	C[C@H](CCC(=O)N(CC(=O)O)[Si](C)(C)C)[C@H]1CC[C@H]2[C@@H]3[C@H](O)[C@H](O)[C@@H]4C[C@H](O[Si](C)(C)C)CC[C@]4(C)[C@H]3CC[C@@]21C	3898.0	Semi standard non polar	33892256
Glycohyocholic acid,3TMS,isomer #1	C[C@H](CCC(=O)NCC(=O)O[Si](C)(C)C)[C@H]1CC[C@H]2[C@@H]3[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C	3756.2	Semi standard non polar	33892256
Glycohyocholic acid,3TMS,isomer #10	C[C@H](CCC(=O)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@H]1CC[C@H]2[C@@H]3[C@H](O)[C@H](O)[C@@H]4C[C@H](O[Si](C)(C)C)CC[C@]4(C)[C@H]3CC[C@@]21C	3831.1	Semi standard non polar	33892256
Glycohyocholic acid,3TMS,isomer #2	C[C@H](CCC(=O)NCC(=O)O[Si](C)(C)C)[C@H]1CC[C@H]2[C@@H]3[C@H](O[Si](C)(C)C)[C@H](O)[C@@H]4C[C@H](O[Si](C)(C)C)CC[C@]4(C)[C@H]3CC[C@@]21C	3784.2	Semi standard non polar	33892256
Glycohyocholic acid,3TMS,isomer #3	C[C@H](CCC(=O)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@H]1CC[C@H]2[C@@H]3[C@H](O[Si](C)(C)C)[C@H](O)[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C	3757.1	Semi standard non polar	33892256
Glycohyocholic acid,3TMS,isomer #4	C[C@H](CCC(=O)NCC(=O)O)[C@H]1CC[C@H]2[C@@H]3[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]4C[C@H](O[Si](C)(C)C)CC[C@]4(C)[C@H]3CC[C@@]21C	3766.2	Semi standard non polar	33892256
Glycohyocholic acid,3TMS,isomer #5	C[C@H](CCC(=O)N(CC(=O)O)[Si](C)(C)C)[C@H]1CC[C@H]2[C@@H]3[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C	3714.4	Semi standard non polar	33892256
Glycohyocholic acid,3TMS,isomer #6	C[C@H](CCC(=O)N(CC(=O)O)[Si](C)(C)C)[C@H]1CC[C@H]2[C@@H]3[C@H](O[Si](C)(C)C)[C@H](O)[C@@H]4C[C@H](O[Si](C)(C)C)CC[C@]4(C)[C@H]3CC[C@@]21C	3755.8	Semi standard non polar	33892256
Glycohyocholic acid,3TMS,isomer #7	C[C@H](CCC(=O)NCC(=O)O[Si](C)(C)C)[C@H]1CC[C@H]2[C@@H]3[C@H](O)[C@H](O[Si](C)(C)C)[C@@H]4C[C@H](O[Si](C)(C)C)CC[C@]4(C)[C@H]3CC[C@@]21C	3786.7	Semi standard non polar	33892256
Glycohyocholic acid,3TMS,isomer #8	C[C@H](CCC(=O)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@H]1CC[C@H]2[C@@H]3[C@H](O)[C@H](O[Si](C)(C)C)[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C	3770.9	Semi standard non polar	33892256
Glycohyocholic acid,3TMS,isomer #9	C[C@H](CCC(=O)N(CC(=O)O)[Si](C)(C)C)[C@H]1CC[C@H]2[C@@H]3[C@H](O)[C@H](O[Si](C)(C)C)[C@@H]4C[C@H](O[Si](C)(C)C)CC[C@]4(C)[C@H]3CC[C@@]21C	3772.9	Semi standard non polar	33892256
Glycohyocholic acid,4TMS,isomer #1	C[C@H](CCC(=O)NCC(=O)O[Si](C)(C)C)[C@H]1CC[C@H]2[C@@H]3[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]4C[C@H](O[Si](C)(C)C)CC[C@]4(C)[C@H]3CC[C@@]21C	3733.6	Semi standard non polar	33892256
Glycohyocholic acid,4TMS,isomer #2	C[C@H](CCC(=O)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@H]1CC[C@H]2[C@@H]3[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C	3707.0	Semi standard non polar	33892256
Glycohyocholic acid,4TMS,isomer #3	C[C@H](CCC(=O)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@H]1CC[C@H]2[C@@H]3[C@H](O[Si](C)(C)C)[C@H](O)[C@@H]4C[C@H](O[Si](C)(C)C)CC[C@]4(C)[C@H]3CC[C@@]21C	3739.5	Semi standard non polar	33892256
Glycohyocholic acid,4TMS,isomer #4	C[C@H](CCC(=O)N(CC(=O)O)[Si](C)(C)C)[C@H]1CC[C@H]2[C@@H]3[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]4C[C@H](O[Si](C)(C)C)CC[C@]4(C)[C@H]3CC[C@@]21C	3714.0	Semi standard non polar	33892256
Glycohyocholic acid,4TMS,isomer #5	C[C@H](CCC(=O)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@H]1CC[C@H]2[C@@H]3[C@H](O)[C@H](O[Si](C)(C)C)[C@@H]4C[C@H](O[Si](C)(C)C)CC[C@]4(C)[C@H]3CC[C@@]21C	3752.0	Semi standard non polar	33892256
Glycohyocholic acid,5TMS,isomer #1	C[C@H](CCC(=O)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@H]1CC[C@H]2[C@@H]3[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]4C[C@H](O[Si](C)(C)C)CC[C@]4(C)[C@H]3CC[C@@]21C	3698.0	Semi standard non polar	33892256
Glycohyocholic acid,5TMS,isomer #1	C[C@H](CCC(=O)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@H]1CC[C@H]2[C@@H]3[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]4C[C@H](O[Si](C)(C)C)CC[C@]4(C)[C@H]3CC[C@@]21C	3868.8	Standard non polar	33892256
Glycohyocholic acid,5TMS,isomer #1	C[C@H](CCC(=O)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@H]1CC[C@H]2[C@@H]3[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]4C[C@H](O[Si](C)(C)C)CC[C@]4(C)[C@H]3CC[C@@]21C	4040.4	Standard polar	33892256
Glycohyocholic acid,1TBDMS,isomer #1	C[C@H](CCC(=O)NCC(=O)O)[C@H]1CC[C@H]2[C@@H]3[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C	4074.3	Semi standard non polar	33892256
Glycohyocholic acid,1TBDMS,isomer #2	C[C@H](CCC(=O)NCC(=O)O)[C@H]1CC[C@H]2[C@@H]3[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C	4095.7	Semi standard non polar	33892256
Glycohyocholic acid,1TBDMS,isomer #3	C[C@H](CCC(=O)NCC(=O)O)[C@H]1CC[C@H]2[C@@H]3[C@H](O)[C@H](O)[C@@H]4C[C@H](O[Si](C)(C)C(C)(C)C)CC[C@]4(C)[C@H]3CC[C@@]21C	4167.0	Semi standard non polar	33892256
Glycohyocholic acid,1TBDMS,isomer #4	C[C@H](CCC(=O)NCC(=O)O[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]2[C@@H]3[C@H](O)[C@H](O)[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C	4211.5	Semi standard non polar	33892256
Glycohyocholic acid,1TBDMS,isomer #5	C[C@H](CCC(=O)N(CC(=O)O)[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]2[C@@H]3[C@H](O)[C@H](O)[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C	4226.9	Semi standard non polar	33892256
Glycohyocholic acid,2TBDMS,isomer #1	C[C@H](CCC(=O)NCC(=O)O[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]2[C@@H]3[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C	4261.7	Semi standard non polar	33892256
Glycohyocholic acid,2TBDMS,isomer #10	C[C@H](CCC(=O)N(CC(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]2[C@@H]3[C@H](O)[C@H](O)[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C	4395.2	Semi standard non polar	33892256
Glycohyocholic acid,2TBDMS,isomer #2	C[C@H](CCC(=O)NCC(=O)O)[C@H]1CC[C@H]2[C@@H]3[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C	4203.4	Semi standard non polar	33892256
Glycohyocholic acid,2TBDMS,isomer #3	C[C@H](CCC(=O)NCC(=O)O)[C@H]1CC[C@H]2[C@@H]3[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]4C[C@H](O[Si](C)(C)C(C)(C)C)CC[C@]4(C)[C@H]3CC[C@@]21C	4230.4	Semi standard non polar	33892256
Glycohyocholic acid,2TBDMS,isomer #4	C[C@H](CCC(=O)N(CC(=O)O)[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]2[C@@H]3[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C	4239.4	Semi standard non polar	33892256
Glycohyocholic acid,2TBDMS,isomer #5	C[C@H](CCC(=O)NCC(=O)O[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]2[C@@H]3[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C	4281.1	Semi standard non polar	33892256
Glycohyocholic acid,2TBDMS,isomer #6	C[C@H](CCC(=O)NCC(=O)O)[C@H]1CC[C@H]2[C@@H]3[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]4C[C@H](O[Si](C)(C)C(C)(C)C)CC[C@]4(C)[C@H]3CC[C@@]21C	4257.9	Semi standard non polar	33892256
Glycohyocholic acid,2TBDMS,isomer #7	C[C@H](CCC(=O)N(CC(=O)O)[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]2[C@@H]3[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C	4263.0	Semi standard non polar	33892256
Glycohyocholic acid,2TBDMS,isomer #8	C[C@H](CCC(=O)NCC(=O)O[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]2[C@@H]3[C@H](O)[C@H](O)[C@@H]4C[C@H](O[Si](C)(C)C(C)(C)C)CC[C@]4(C)[C@H]3CC[C@@]21C	4352.6	Semi standard non polar	33892256
Glycohyocholic acid,2TBDMS,isomer #9	C[C@H](CCC(=O)N(CC(=O)O)[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]2[C@@H]3[C@H](O)[C@H](O)[C@@H]4C[C@H](O[Si](C)(C)C(C)(C)C)CC[C@]4(C)[C@H]3CC[C@@]21C	4371.5	Semi standard non polar	33892256
Glycohyocholic acid,3TBDMS,isomer #1	C[C@H](CCC(=O)NCC(=O)O[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]2[C@@H]3[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C	4366.7	Semi standard non polar	33892256
Glycohyocholic acid,3TBDMS,isomer #10	C[C@H](CCC(=O)N(CC(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]2[C@@H]3[C@H](O)[C@H](O)[C@@H]4C[C@H](O[Si](C)(C)C(C)(C)C)CC[C@]4(C)[C@H]3CC[C@@]21C	4532.7	Semi standard non polar	33892256
Glycohyocholic acid,3TBDMS,isomer #2	C[C@H](CCC(=O)NCC(=O)O[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]2[C@@H]3[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]4C[C@H](O[Si](C)(C)C(C)(C)C)CC[C@]4(C)[C@H]3CC[C@@]21C	4405.7	Semi standard non polar	33892256
Glycohyocholic acid,3TBDMS,isomer #3	C[C@H](CCC(=O)N(CC(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]2[C@@H]3[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C	4412.4	Semi standard non polar	33892256
Glycohyocholic acid,3TBDMS,isomer #4	C[C@H](CCC(=O)NCC(=O)O)[C@H]1CC[C@H]2[C@@H]3[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]4C[C@H](O[Si](C)(C)C(C)(C)C)CC[C@]4(C)[C@H]3CC[C@@]21C	4382.3	Semi standard non polar	33892256
Glycohyocholic acid,3TBDMS,isomer #5	C[C@H](CCC(=O)N(CC(=O)O)[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]2[C@@H]3[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C	4375.0	Semi standard non polar	33892256
Glycohyocholic acid,3TBDMS,isomer #6	C[C@H](CCC(=O)N(CC(=O)O)[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]2[C@@H]3[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]4C[C@H](O[Si](C)(C)C(C)(C)C)CC[C@]4(C)[C@H]3CC[C@@]21C	4419.6	Semi standard non polar	33892256
Glycohyocholic acid,3TBDMS,isomer #7	C[C@H](CCC(=O)NCC(=O)O[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]2[C@@H]3[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]4C[C@H](O[Si](C)(C)C(C)(C)C)CC[C@]4(C)[C@H]3CC[C@@]21C	4419.1	Semi standard non polar	33892256
Glycohyocholic acid,3TBDMS,isomer #8	C[C@H](CCC(=O)N(CC(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]2[C@@H]3[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C	4430.5	Semi standard non polar	33892256
Glycohyocholic acid,3TBDMS,isomer #9	C[C@H](CCC(=O)N(CC(=O)O)[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]2[C@@H]3[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]4C[C@H](O[Si](C)(C)C(C)(C)C)CC[C@]4(C)[C@H]3CC[C@@]21C	4437.9	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - Glycohyocholic acid GC-MS (Non-derivatized) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Glycohyocholic acid 10V, Positive-QTOF	splash10-00dj-7000900000-cd338f8c7b69f2f7031c	2019-02-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Glycohyocholic acid 20V, Positive-QTOF	splash10-00di-9001200000-59295cf76298e02c3014	2019-02-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Glycohyocholic acid 40V, Positive-QTOF	splash10-00di-9001000000-c58410967ecfefef6236	2019-02-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Glycohyocholic acid 10V, Negative-QTOF	splash10-03dj-0000900000-7e7abc66364fac2a3100	2019-02-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Glycohyocholic acid 20V, Negative-QTOF	splash10-0h2b-2001900000-502a9a10a0490922f349	2019-02-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Glycohyocholic acid 40V, Negative-QTOF	splash10-00dl-9002000000-ee97dd0d194e7c391208	2019-02-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Glycohyocholic acid 10V, Negative-QTOF	splash10-03di-0000900000-f0554f533bb15b665762	2021-09-21	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Glycohyocholic acid 20V, Negative-QTOF	splash10-03dj-0000900000-2b10cffc28c602935428	2021-09-21	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Glycohyocholic acid 40V, Negative-QTOF	splash10-0229-9003500000-b5e08c9a133e9e3d26e7	2021-09-21	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Glycohyocholic acid 10V, Positive-QTOF	splash10-014j-0001900000-c46475973a41365f488f	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Glycohyocholic acid 20V, Positive-QTOF	splash10-00r6-3465900000-b4cca4e9a810afc21024	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Glycohyocholic acid 40V, Positive-QTOF	splash10-052e-9241100000-22eca23cbd8f75005db4	2021-09-25	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Not Available

Biospecimen Locations

Blood
Urine

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Biospecimen	Status	Value	Age	Sex	Condition	Reference	Details
Blood	Detected but not Quantified	Not Quantified	Adult (>18 years old)	Both	Normal	29458053	details

Abnormal Concentrations

Biospecimen	Status	Value	Age	Sex	Condition	Reference	Details
Urine	Detected but not Quantified	Not Quantified	Not Specified	Not Specified	Cancer patients undergoing total body irradiation	31424920	details

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

Not Available

KNApSAcK ID

Not Available

Chemspider ID

57537204

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

71361462

PDB ID

Not Available

ChEBI ID

133176

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

Not Available

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

St-Pierre MV, Kullak-Ublick GA, Hagenbuch B, Meier PJ: Transport of bile acids in hepatic and non-hepatic tissues. J Exp Biol. 2001 May;204(Pt 10):1673-86. [PubMed:11316487 ]
Claudel T, Staels B, Kuipers F: The Farnesoid X receptor: a molecular link between bile acid and lipid and glucose metabolism. Arterioscler Thromb Vasc Biol. 2005 Oct;25(10):2020-30. Epub 2005 Jul 21. [PubMed:16037564 ]
Chiang JY: Bile acid regulation of hepatic physiology: III. Bile acids and nuclear receptors. Am J Physiol Gastrointest Liver Physiol. 2003 Mar;284(3):G349-56. [PubMed:12576301 ]
Davis RA, Miyake JH, Hui TY, Spann NJ: Regulation of cholesterol-7alpha-hydroxylase: BAREly missing a SHP. J Lipid Res. 2002 Apr;43(4):533-43. [PubMed:11907135 ]

Showing metabocard for Glycohyocholic acid (HMDB0240607)

MOL for HMDB0240607 (Glycohyocholic acid)

3D MOL for HMDB0240607 (Glycohyocholic acid)

3D SDF for HMDB0240607 (Glycohyocholic acid)

3D-SDF for HMDB0240607 (Glycohyocholic acid)

PDB for HMDB0240607 (Glycohyocholic acid)

3D PDB for HMDB0240607 (Glycohyocholic acid)

SMILES for HMDB0240607 (Glycohyocholic acid)

INCHI for HMDB0240607 (Glycohyocholic acid)

Structure for HMDB0240607 (Glycohyocholic acid)

3D Structure for HMDB0240607 (Glycohyocholic acid)

Predicted Collision Cross Sections

Predicted Retention Times

Underivatized

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra