| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 0.14 minutes | 32390414 |
| Predicted by Siyang on May 30, 2022 | 8.0023 minutes | 33406817 |
| Predicted by Siyang using ReTip algorithm on June 8, 2022 | 8.16 minutes | 32390414 |
| Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 467.1 seconds | 40023050 |
| Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 364.9 seconds | 40023050 |
| Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 60.4 seconds | 40023050 |
| Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 262.3 seconds | 40023050 |
| RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 150.8 seconds | 40023050 |
| Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 268.7 seconds | 40023050 |
| BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 240.6 seconds | 40023050 |
| HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 871.3 seconds | 40023050 |
| UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 583.6 seconds | 40023050 |
| BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 40.0 seconds | 40023050 |
| UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 620.5 seconds | 40023050 |
| SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 229.3 seconds | 40023050 |
| RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 379.6 seconds | 40023050 |
| MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 786.1 seconds | 40023050 |
| KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 526.4 seconds | 40023050 |
| Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 432.3 seconds | 40023050 |
| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Aminomethylphosphonic acid,1TMS,isomer #1 | C[Si](C)(C)OP(=O)(O)CN | 1289.3 | Semi standard non polar | 33892256 |
| Aminomethylphosphonic acid,1TMS,isomer #1 | C[Si](C)(C)OP(=O)(O)CN | 1209.7 | Standard non polar | 33892256 |
| Aminomethylphosphonic acid,1TMS,isomer #1 | C[Si](C)(C)OP(=O)(O)CN | 2172.4 | Standard polar | 33892256 |
| Aminomethylphosphonic acid,1TMS,isomer #2 | C[Si](C)(C)NCP(=O)(O)O | 1411.8 | Semi standard non polar | 33892256 |
| Aminomethylphosphonic acid,1TMS,isomer #2 | C[Si](C)(C)NCP(=O)(O)O | 1239.8 | Standard non polar | 33892256 |
| Aminomethylphosphonic acid,1TMS,isomer #2 | C[Si](C)(C)NCP(=O)(O)O | 2026.9 | Standard polar | 33892256 |
| Aminomethylphosphonic acid,2TMS,isomer #1 | C[Si](C)(C)OP(=O)(CN)O[Si](C)(C)C | 1331.1 | Semi standard non polar | 33892256 |
| Aminomethylphosphonic acid,2TMS,isomer #1 | C[Si](C)(C)OP(=O)(CN)O[Si](C)(C)C | 1354.6 | Standard non polar | 33892256 |
| Aminomethylphosphonic acid,2TMS,isomer #1 | C[Si](C)(C)OP(=O)(CN)O[Si](C)(C)C | 1780.9 | Standard polar | 33892256 |
| Aminomethylphosphonic acid,2TMS,isomer #2 | C[Si](C)(C)NCP(=O)(O)O[Si](C)(C)C | 1432.1 | Semi standard non polar | 33892256 |
| Aminomethylphosphonic acid,2TMS,isomer #2 | C[Si](C)(C)NCP(=O)(O)O[Si](C)(C)C | 1338.3 | Standard non polar | 33892256 |
| Aminomethylphosphonic acid,2TMS,isomer #2 | C[Si](C)(C)NCP(=O)(O)O[Si](C)(C)C | 1624.6 | Standard polar | 33892256 |
| Aminomethylphosphonic acid,2TMS,isomer #3 | C[Si](C)(C)N(CP(=O)(O)O)[Si](C)(C)C | 1552.9 | Semi standard non polar | 33892256 |
| Aminomethylphosphonic acid,2TMS,isomer #3 | C[Si](C)(C)N(CP(=O)(O)O)[Si](C)(C)C | 1498.6 | Standard non polar | 33892256 |
| Aminomethylphosphonic acid,2TMS,isomer #3 | C[Si](C)(C)N(CP(=O)(O)O)[Si](C)(C)C | 1870.0 | Standard polar | 33892256 |
| Aminomethylphosphonic acid,3TMS,isomer #1 | C[Si](C)(C)NCP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 1460.8 | Semi standard non polar | 33892256 |
| Aminomethylphosphonic acid,3TMS,isomer #1 | C[Si](C)(C)NCP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 1432.2 | Standard non polar | 33892256 |
| Aminomethylphosphonic acid,3TMS,isomer #1 | C[Si](C)(C)NCP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 1436.5 | Standard polar | 33892256 |
| Aminomethylphosphonic acid,3TMS,isomer #2 | C[Si](C)(C)OP(=O)(O)CN([Si](C)(C)C)[Si](C)(C)C | 1568.5 | Semi standard non polar | 33892256 |
| Aminomethylphosphonic acid,3TMS,isomer #2 | C[Si](C)(C)OP(=O)(O)CN([Si](C)(C)C)[Si](C)(C)C | 1540.8 | Standard non polar | 33892256 |
| Aminomethylphosphonic acid,3TMS,isomer #2 | C[Si](C)(C)OP(=O)(O)CN([Si](C)(C)C)[Si](C)(C)C | 1565.5 | Standard polar | 33892256 |
| Aminomethylphosphonic acid,4TMS,isomer #1 | C[Si](C)(C)OP(=O)(CN([Si](C)(C)C)[Si](C)(C)C)O[Si](C)(C)C | 1554.5 | Semi standard non polar | 33892256 |
| Aminomethylphosphonic acid,4TMS,isomer #1 | C[Si](C)(C)OP(=O)(CN([Si](C)(C)C)[Si](C)(C)C)O[Si](C)(C)C | 1613.6 | Standard non polar | 33892256 |
| Aminomethylphosphonic acid,4TMS,isomer #1 | C[Si](C)(C)OP(=O)(CN([Si](C)(C)C)[Si](C)(C)C)O[Si](C)(C)C | 1471.0 | Standard polar | 33892256 |
| Aminomethylphosphonic acid,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OP(=O)(O)CN | 1544.8 | Semi standard non polar | 33892256 |
| Aminomethylphosphonic acid,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OP(=O)(O)CN | 1442.7 | Standard non polar | 33892256 |
| Aminomethylphosphonic acid,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OP(=O)(O)CN | 2388.1 | Standard polar | 33892256 |
| Aminomethylphosphonic acid,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NCP(=O)(O)O | 1650.8 | Semi standard non polar | 33892256 |
| Aminomethylphosphonic acid,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NCP(=O)(O)O | 1501.4 | Standard non polar | 33892256 |
| Aminomethylphosphonic acid,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NCP(=O)(O)O | 2209.4 | Standard polar | 33892256 |
| Aminomethylphosphonic acid,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OP(=O)(CN)O[Si](C)(C)C(C)(C)C | 1786.1 | Semi standard non polar | 33892256 |
| Aminomethylphosphonic acid,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OP(=O)(CN)O[Si](C)(C)C(C)(C)C | 1735.0 | Standard non polar | 33892256 |
| Aminomethylphosphonic acid,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OP(=O)(CN)O[Si](C)(C)C(C)(C)C | 2077.8 | Standard polar | 33892256 |
| Aminomethylphosphonic acid,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NCP(=O)(O)O[Si](C)(C)C(C)(C)C | 1876.6 | Semi standard non polar | 33892256 |
| Aminomethylphosphonic acid,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NCP(=O)(O)O[Si](C)(C)C(C)(C)C | 1778.8 | Standard non polar | 33892256 |
| Aminomethylphosphonic acid,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NCP(=O)(O)O[Si](C)(C)C(C)(C)C | 1926.0 | Standard polar | 33892256 |
| Aminomethylphosphonic acid,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N(CP(=O)(O)O)[Si](C)(C)C(C)(C)C | 1962.4 | Semi standard non polar | 33892256 |
| Aminomethylphosphonic acid,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N(CP(=O)(O)O)[Si](C)(C)C(C)(C)C | 1912.3 | Standard non polar | 33892256 |
| Aminomethylphosphonic acid,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N(CP(=O)(O)O)[Si](C)(C)C(C)(C)C | 2045.1 | Standard polar | 33892256 |
| Aminomethylphosphonic acid,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NCP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2067.1 | Semi standard non polar | 33892256 |
| Aminomethylphosphonic acid,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NCP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2038.2 | Standard non polar | 33892256 |
| Aminomethylphosphonic acid,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NCP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 1852.8 | Standard polar | 33892256 |
| Aminomethylphosphonic acid,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OP(=O)(O)CN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2171.8 | Semi standard non polar | 33892256 |
| Aminomethylphosphonic acid,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OP(=O)(O)CN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2145.5 | Standard non polar | 33892256 |
| Aminomethylphosphonic acid,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OP(=O)(O)CN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 1938.3 | Standard polar | 33892256 |
| Aminomethylphosphonic acid,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OP(=O)(CN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2342.9 | Semi standard non polar | 33892256 |
| Aminomethylphosphonic acid,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OP(=O)(CN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2360.8 | Standard non polar | 33892256 |
| Aminomethylphosphonic acid,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OP(=O)(CN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 1937.4 | Standard polar | 33892256 |