| Chromatographic Method | Retention Time | Reference |
|---|
| Predicted by Siyang on May 30, 2022 | 8.8417 minutes | 33406817 |
| Predicted by Siyang using ReTip algorithm on June 8, 2022 | 8.24 minutes | 32390414 |
| Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 434.8 seconds | 40023050 |
| Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 338.9 seconds | 40023050 |
| Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 53.6 seconds | 40023050 |
| Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 231.3 seconds | 40023050 |
| RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 98.8 seconds | 40023050 |
| Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 272.0 seconds | 40023050 |
| BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 231.6 seconds | 40023050 |
| HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 806.4 seconds | 40023050 |
| UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 562.2 seconds | 40023050 |
| BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 36.3 seconds | 40023050 |
| UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 556.8 seconds | 40023050 |
| SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 207.4 seconds | 40023050 |
| RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 344.8 seconds | 40023050 |
| MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 771.5 seconds | 40023050 |
| KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 596.9 seconds | 40023050 |
| Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 422.5 seconds | 40023050 |
| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| [(1r)-1-Aminoethyl]phosphonic acid,1TMS,isomer #1 | CC(N)P(=O)(O)O[Si](C)(C)C | 1310.9 | Semi standard non polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,1TMS,isomer #1 | CC(N)P(=O)(O)O[Si](C)(C)C | 1274.9 | Standard non polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,1TMS,isomer #1 | CC(N)P(=O)(O)O[Si](C)(C)C | 2212.3 | Standard polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,1TMS,isomer #2 | CC(N[Si](C)(C)C)P(=O)(O)O | 1412.0 | Semi standard non polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,1TMS,isomer #2 | CC(N[Si](C)(C)C)P(=O)(O)O | 1304.8 | Standard non polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,1TMS,isomer #2 | CC(N[Si](C)(C)C)P(=O)(O)O | 2006.6 | Standard polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,2TMS,isomer #1 | CC(N)P(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 1325.6 | Semi standard non polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,2TMS,isomer #1 | CC(N)P(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 1406.4 | Standard non polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,2TMS,isomer #1 | CC(N)P(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 1808.8 | Standard polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,2TMS,isomer #2 | CC(N[Si](C)(C)C)P(=O)(O)O[Si](C)(C)C | 1433.5 | Semi standard non polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,2TMS,isomer #2 | CC(N[Si](C)(C)C)P(=O)(O)O[Si](C)(C)C | 1367.8 | Standard non polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,2TMS,isomer #2 | CC(N[Si](C)(C)C)P(=O)(O)O[Si](C)(C)C | 1645.3 | Standard polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,2TMS,isomer #3 | CC(N([Si](C)(C)C)[Si](C)(C)C)P(=O)(O)O | 1573.2 | Semi standard non polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,2TMS,isomer #3 | CC(N([Si](C)(C)C)[Si](C)(C)C)P(=O)(O)O | 1506.2 | Standard non polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,2TMS,isomer #3 | CC(N([Si](C)(C)C)[Si](C)(C)C)P(=O)(O)O | 1889.0 | Standard polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,3TMS,isomer #1 | CC(N[Si](C)(C)C)P(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 1446.4 | Semi standard non polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,3TMS,isomer #1 | CC(N[Si](C)(C)C)P(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 1467.8 | Standard non polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,3TMS,isomer #1 | CC(N[Si](C)(C)C)P(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 1461.1 | Standard polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,3TMS,isomer #2 | CC(N([Si](C)(C)C)[Si](C)(C)C)P(=O)(O)O[Si](C)(C)C | 1579.4 | Semi standard non polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,3TMS,isomer #2 | CC(N([Si](C)(C)C)[Si](C)(C)C)P(=O)(O)O[Si](C)(C)C | 1515.9 | Standard non polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,3TMS,isomer #2 | CC(N([Si](C)(C)C)[Si](C)(C)C)P(=O)(O)O[Si](C)(C)C | 1626.2 | Standard polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,4TMS,isomer #1 | CC(N([Si](C)(C)C)[Si](C)(C)C)P(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 1584.9 | Semi standard non polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,4TMS,isomer #1 | CC(N([Si](C)(C)C)[Si](C)(C)C)P(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 1603.7 | Standard non polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,4TMS,isomer #1 | CC(N([Si](C)(C)C)[Si](C)(C)C)P(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 1503.6 | Standard polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,1TBDMS,isomer #1 | CC(N)P(=O)(O)O[Si](C)(C)C(C)(C)C | 1558.4 | Semi standard non polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,1TBDMS,isomer #1 | CC(N)P(=O)(O)O[Si](C)(C)C(C)(C)C | 1498.1 | Standard non polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,1TBDMS,isomer #1 | CC(N)P(=O)(O)O[Si](C)(C)C(C)(C)C | 2407.8 | Standard polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,1TBDMS,isomer #2 | CC(N[Si](C)(C)C(C)(C)C)P(=O)(O)O | 1665.5 | Semi standard non polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,1TBDMS,isomer #2 | CC(N[Si](C)(C)C(C)(C)C)P(=O)(O)O | 1522.3 | Standard non polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,1TBDMS,isomer #2 | CC(N[Si](C)(C)C(C)(C)C)P(=O)(O)O | 2153.9 | Standard polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,2TBDMS,isomer #1 | CC(N)P(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 1787.9 | Semi standard non polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,2TBDMS,isomer #1 | CC(N)P(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 1801.6 | Standard non polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,2TBDMS,isomer #1 | CC(N)P(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2105.8 | Standard polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,2TBDMS,isomer #2 | CC(N[Si](C)(C)C(C)(C)C)P(=O)(O)O[Si](C)(C)C(C)(C)C | 1889.9 | Semi standard non polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,2TBDMS,isomer #2 | CC(N[Si](C)(C)C(C)(C)C)P(=O)(O)O[Si](C)(C)C(C)(C)C | 1802.2 | Standard non polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,2TBDMS,isomer #2 | CC(N[Si](C)(C)C(C)(C)C)P(=O)(O)O[Si](C)(C)C(C)(C)C | 1946.8 | Standard polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,2TBDMS,isomer #3 | CC(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)P(=O)(O)O | 1993.8 | Semi standard non polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,2TBDMS,isomer #3 | CC(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)P(=O)(O)O | 1941.8 | Standard non polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,2TBDMS,isomer #3 | CC(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)P(=O)(O)O | 2065.1 | Standard polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,3TBDMS,isomer #1 | CC(N[Si](C)(C)C(C)(C)C)P(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2068.5 | Semi standard non polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,3TBDMS,isomer #1 | CC(N[Si](C)(C)C(C)(C)C)P(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2088.8 | Standard non polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,3TBDMS,isomer #1 | CC(N[Si](C)(C)C(C)(C)C)P(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 1872.8 | Standard polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,3TBDMS,isomer #2 | CC(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)P(=O)(O)O[Si](C)(C)C(C)(C)C | 2198.4 | Semi standard non polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,3TBDMS,isomer #2 | CC(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)P(=O)(O)O[Si](C)(C)C(C)(C)C | 2174.8 | Standard non polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,3TBDMS,isomer #2 | CC(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)P(=O)(O)O[Si](C)(C)C(C)(C)C | 1991.1 | Standard polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,4TBDMS,isomer #1 | CC(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)P(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2362.0 | Semi standard non polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,4TBDMS,isomer #1 | CC(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)P(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2397.0 | Standard non polar | 33892256 |
| [(1r)-1-Aminoethyl]phosphonic acid,4TBDMS,isomer #1 | CC(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)P(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 1956.1 | Standard polar | 33892256 |