| Chromatographic Method | Retention Time | Reference |
|---|
| Predicted by Siyang on May 30, 2022 | 9.1563 minutes | 33406817 |
| Predicted by Siyang using ReTip algorithm on June 8, 2022 | 4.86 minutes | 32390414 |
| Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 532.6 seconds | 40023050 |
| Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 377.9 seconds | 40023050 |
| Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 68.1 seconds | 40023050 |
| Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 272.0 seconds | 40023050 |
| RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 139.4 seconds | 40023050 |
| Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 273.8 seconds | 40023050 |
| BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 252.5 seconds | 40023050 |
| HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 795.0 seconds | 40023050 |
| UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 601.7 seconds | 40023050 |
| BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 41.3 seconds | 40023050 |
| UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 718.9 seconds | 40023050 |
| SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 232.3 seconds | 40023050 |
| RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 358.0 seconds | 40023050 |
| MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 671.0 seconds | 40023050 |
| KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 425.4 seconds | 40023050 |
| Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 384.3 seconds | 40023050 |
| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Allophanic acid,2TMS,isomer #1 | C[Si](C)(C)NC(=O)NC(=O)O[Si](C)(C)C | 1450.2 | Semi standard non polar | 33892256 |
| Allophanic acid,2TMS,isomer #1 | C[Si](C)(C)NC(=O)NC(=O)O[Si](C)(C)C | 1403.9 | Standard non polar | 33892256 |
| Allophanic acid,2TMS,isomer #1 | C[Si](C)(C)NC(=O)NC(=O)O[Si](C)(C)C | 2204.6 | Standard polar | 33892256 |
| Allophanic acid,2TMS,isomer #2 | C[Si](C)(C)OC(=O)N(C(N)=O)[Si](C)(C)C | 1332.0 | Semi standard non polar | 33892256 |
| Allophanic acid,2TMS,isomer #2 | C[Si](C)(C)OC(=O)N(C(N)=O)[Si](C)(C)C | 1370.2 | Standard non polar | 33892256 |
| Allophanic acid,2TMS,isomer #2 | C[Si](C)(C)OC(=O)N(C(N)=O)[Si](C)(C)C | 2025.2 | Standard polar | 33892256 |
| Allophanic acid,2TMS,isomer #3 | C[Si](C)(C)N(C(=O)NC(=O)O)[Si](C)(C)C | 1545.7 | Semi standard non polar | 33892256 |
| Allophanic acid,2TMS,isomer #3 | C[Si](C)(C)N(C(=O)NC(=O)O)[Si](C)(C)C | 1463.5 | Standard non polar | 33892256 |
| Allophanic acid,2TMS,isomer #3 | C[Si](C)(C)N(C(=O)NC(=O)O)[Si](C)(C)C | 2135.5 | Standard polar | 33892256 |
| Allophanic acid,2TMS,isomer #4 | C[Si](C)(C)NC(=O)N(C(=O)O)[Si](C)(C)C | 1488.0 | Semi standard non polar | 33892256 |
| Allophanic acid,2TMS,isomer #4 | C[Si](C)(C)NC(=O)N(C(=O)O)[Si](C)(C)C | 1439.8 | Standard non polar | 33892256 |
| Allophanic acid,2TMS,isomer #4 | C[Si](C)(C)NC(=O)N(C(=O)O)[Si](C)(C)C | 1799.7 | Standard polar | 33892256 |
| Allophanic acid,3TMS,isomer #1 | C[Si](C)(C)OC(=O)NC(=O)N([Si](C)(C)C)[Si](C)(C)C | 1487.2 | Semi standard non polar | 33892256 |
| Allophanic acid,3TMS,isomer #1 | C[Si](C)(C)OC(=O)NC(=O)N([Si](C)(C)C)[Si](C)(C)C | 1455.3 | Standard non polar | 33892256 |
| Allophanic acid,3TMS,isomer #1 | C[Si](C)(C)OC(=O)NC(=O)N([Si](C)(C)C)[Si](C)(C)C | 1993.6 | Standard polar | 33892256 |
| Allophanic acid,3TMS,isomer #2 | C[Si](C)(C)NC(=O)N(C(=O)O[Si](C)(C)C)[Si](C)(C)C | 1405.5 | Semi standard non polar | 33892256 |
| Allophanic acid,3TMS,isomer #2 | C[Si](C)(C)NC(=O)N(C(=O)O[Si](C)(C)C)[Si](C)(C)C | 1434.9 | Standard non polar | 33892256 |
| Allophanic acid,3TMS,isomer #2 | C[Si](C)(C)NC(=O)N(C(=O)O[Si](C)(C)C)[Si](C)(C)C | 1674.4 | Standard polar | 33892256 |
| Allophanic acid,3TMS,isomer #3 | C[Si](C)(C)N(C(=O)O)C(=O)N([Si](C)(C)C)[Si](C)(C)C | 1547.1 | Semi standard non polar | 33892256 |
| Allophanic acid,3TMS,isomer #3 | C[Si](C)(C)N(C(=O)O)C(=O)N([Si](C)(C)C)[Si](C)(C)C | 1485.5 | Standard non polar | 33892256 |
| Allophanic acid,3TMS,isomer #3 | C[Si](C)(C)N(C(=O)O)C(=O)N([Si](C)(C)C)[Si](C)(C)C | 1696.3 | Standard polar | 33892256 |
| Allophanic acid,4TMS,isomer #1 | C[Si](C)(C)OC(=O)N(C(=O)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C | 1513.6 | Semi standard non polar | 33892256 |
| Allophanic acid,4TMS,isomer #1 | C[Si](C)(C)OC(=O)N(C(=O)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C | 1548.3 | Standard non polar | 33892256 |
| Allophanic acid,4TMS,isomer #1 | C[Si](C)(C)OC(=O)N(C(=O)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C | 1527.5 | Standard polar | 33892256 |
| Allophanic acid,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NC(=O)NC(=O)O[Si](C)(C)C(C)(C)C | 1898.5 | Semi standard non polar | 33892256 |
| Allophanic acid,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NC(=O)NC(=O)O[Si](C)(C)C(C)(C)C | 1725.0 | Standard non polar | 33892256 |
| Allophanic acid,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NC(=O)NC(=O)O[Si](C)(C)C(C)(C)C | 2173.4 | Standard polar | 33892256 |
| Allophanic acid,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)N(C(N)=O)[Si](C)(C)C(C)(C)C | 1779.1 | Semi standard non polar | 33892256 |
| Allophanic acid,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)N(C(N)=O)[Si](C)(C)C(C)(C)C | 1753.5 | Standard non polar | 33892256 |
| Allophanic acid,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)N(C(N)=O)[Si](C)(C)C(C)(C)C | 2133.5 | Standard polar | 33892256 |
| Allophanic acid,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N(C(=O)NC(=O)O)[Si](C)(C)C(C)(C)C | 1941.5 | Semi standard non polar | 33892256 |
| Allophanic acid,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N(C(=O)NC(=O)O)[Si](C)(C)C(C)(C)C | 1822.6 | Standard non polar | 33892256 |
| Allophanic acid,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N(C(=O)NC(=O)O)[Si](C)(C)C(C)(C)C | 2096.2 | Standard polar | 33892256 |
| Allophanic acid,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)NC(=O)N(C(=O)O)[Si](C)(C)C(C)(C)C | 1906.3 | Semi standard non polar | 33892256 |
| Allophanic acid,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)NC(=O)N(C(=O)O)[Si](C)(C)C(C)(C)C | 1768.7 | Standard non polar | 33892256 |
| Allophanic acid,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)NC(=O)N(C(=O)O)[Si](C)(C)C(C)(C)C | 1945.5 | Standard polar | 33892256 |
| Allophanic acid,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)NC(=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2118.0 | Semi standard non polar | 33892256 |
| Allophanic acid,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)NC(=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2009.3 | Standard non polar | 33892256 |
| Allophanic acid,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)NC(=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2144.6 | Standard polar | 33892256 |
| Allophanic acid,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NC(=O)N(C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2075.1 | Semi standard non polar | 33892256 |
| Allophanic acid,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NC(=O)N(C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 1999.1 | Standard non polar | 33892256 |
| Allophanic acid,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NC(=O)N(C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2020.9 | Standard polar | 33892256 |
| Allophanic acid,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N(C(=O)O)C(=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2141.0 | Semi standard non polar | 33892256 |
| Allophanic acid,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N(C(=O)O)C(=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2051.7 | Standard non polar | 33892256 |
| Allophanic acid,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N(C(=O)O)C(=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2027.1 | Standard polar | 33892256 |
| Allophanic acid,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)N(C(=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2352.0 | Semi standard non polar | 33892256 |
| Allophanic acid,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)N(C(=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2302.3 | Standard non polar | 33892256 |
| Allophanic acid,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)N(C(=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2030.0 | Standard polar | 33892256 |