| Chromatographic Method | Retention Time | Reference |
|---|
| Predicted by Siyang on May 30, 2022 | 9.8006 minutes | 33406817 |
| Predicted by Siyang using ReTip algorithm on June 8, 2022 | 8.59 minutes | 32390414 |
| Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 407.2 seconds | 40023050 |
| Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 269.6 seconds | 40023050 |
| Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 44.3 seconds | 40023050 |
| Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 166.5 seconds | 40023050 |
| RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 66.9 seconds | 40023050 |
| Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 295.3 seconds | 40023050 |
| BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 239.2 seconds | 40023050 |
| HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 988.2 seconds | 40023050 |
| UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 593.0 seconds | 40023050 |
| BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 43.4 seconds | 40023050 |
| UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 645.5 seconds | 40023050 |
| SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 173.2 seconds | 40023050 |
| RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 259.2 seconds | 40023050 |
| MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 977.7 seconds | 40023050 |
| KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 630.5 seconds | 40023050 |
| Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 452.8 seconds | 40023050 |
| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| n-carboxymethyllysine,3TMS,isomer #1 | C[Si](C)(C)NCCCCC(NCC(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 2077.0 | Semi standard non polar | 33892256 |
| n-carboxymethyllysine,3TMS,isomer #1 | C[Si](C)(C)NCCCCC(NCC(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 2131.1 | Standard non polar | 33892256 |
| n-carboxymethyllysine,3TMS,isomer #1 | C[Si](C)(C)NCCCCC(NCC(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 2382.2 | Standard polar | 33892256 |
| n-carboxymethyllysine,3TMS,isomer #2 | C[Si](C)(C)OC(=O)CN(C(CCCCN)C(=O)O[Si](C)(C)C)[Si](C)(C)C | 2021.5 | Semi standard non polar | 33892256 |
| n-carboxymethyllysine,3TMS,isomer #2 | C[Si](C)(C)OC(=O)CN(C(CCCCN)C(=O)O[Si](C)(C)C)[Si](C)(C)C | 2078.8 | Standard non polar | 33892256 |
| n-carboxymethyllysine,3TMS,isomer #2 | C[Si](C)(C)OC(=O)CN(C(CCCCN)C(=O)O[Si](C)(C)C)[Si](C)(C)C | 2808.6 | Standard polar | 33892256 |
| n-carboxymethyllysine,3TMS,isomer #3 | C[Si](C)(C)OC(=O)CNC(CCCCN([Si](C)(C)C)[Si](C)(C)C)C(=O)O | 2269.9 | Semi standard non polar | 33892256 |
| n-carboxymethyllysine,3TMS,isomer #3 | C[Si](C)(C)OC(=O)CNC(CCCCN([Si](C)(C)C)[Si](C)(C)C)C(=O)O | 2196.7 | Standard non polar | 33892256 |
| n-carboxymethyllysine,3TMS,isomer #3 | C[Si](C)(C)OC(=O)CNC(CCCCN([Si](C)(C)C)[Si](C)(C)C)C(=O)O | 2662.3 | Standard polar | 33892256 |
| n-carboxymethyllysine,3TMS,isomer #4 | C[Si](C)(C)NCCCCC(C(=O)O)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C | 2102.0 | Semi standard non polar | 33892256 |
| n-carboxymethyllysine,3TMS,isomer #4 | C[Si](C)(C)NCCCCC(C(=O)O)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C | 2179.2 | Standard non polar | 33892256 |
| n-carboxymethyllysine,3TMS,isomer #4 | C[Si](C)(C)NCCCCC(C(=O)O)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C | 2555.8 | Standard polar | 33892256 |
| n-carboxymethyllysine,3TMS,isomer #5 | C[Si](C)(C)OC(=O)C(CCCCN([Si](C)(C)C)[Si](C)(C)C)NCC(=O)O | 2266.0 | Semi standard non polar | 33892256 |
| n-carboxymethyllysine,3TMS,isomer #5 | C[Si](C)(C)OC(=O)C(CCCCN([Si](C)(C)C)[Si](C)(C)C)NCC(=O)O | 2134.2 | Standard non polar | 33892256 |
| n-carboxymethyllysine,3TMS,isomer #5 | C[Si](C)(C)OC(=O)C(CCCCN([Si](C)(C)C)[Si](C)(C)C)NCC(=O)O | 2591.5 | Standard polar | 33892256 |
| n-carboxymethyllysine,3TMS,isomer #6 | C[Si](C)(C)NCCCCC(C(=O)O[Si](C)(C)C)N(CC(=O)O)[Si](C)(C)C | 2100.2 | Semi standard non polar | 33892256 |
| n-carboxymethyllysine,3TMS,isomer #6 | C[Si](C)(C)NCCCCC(C(=O)O[Si](C)(C)C)N(CC(=O)O)[Si](C)(C)C | 2139.6 | Standard non polar | 33892256 |
| n-carboxymethyllysine,3TMS,isomer #6 | C[Si](C)(C)NCCCCC(C(=O)O[Si](C)(C)C)N(CC(=O)O)[Si](C)(C)C | 2482.9 | Standard polar | 33892256 |
| n-carboxymethyllysine,3TMS,isomer #7 | C[Si](C)(C)N(CC(=O)O)C(CCCCN([Si](C)(C)C)[Si](C)(C)C)C(=O)O | 2279.2 | Semi standard non polar | 33892256 |
| n-carboxymethyllysine,3TMS,isomer #7 | C[Si](C)(C)N(CC(=O)O)C(CCCCN([Si](C)(C)C)[Si](C)(C)C)C(=O)O | 2235.6 | Standard non polar | 33892256 |
| n-carboxymethyllysine,3TMS,isomer #7 | C[Si](C)(C)N(CC(=O)O)C(CCCCN([Si](C)(C)C)[Si](C)(C)C)C(=O)O | 2681.2 | Standard polar | 33892256 |
| n-carboxymethyllysine,4TMS,isomer #1 | C[Si](C)(C)OC(=O)CNC(CCCCN([Si](C)(C)C)[Si](C)(C)C)C(=O)O[Si](C)(C)C | 2245.3 | Semi standard non polar | 33892256 |
| n-carboxymethyllysine,4TMS,isomer #1 | C[Si](C)(C)OC(=O)CNC(CCCCN([Si](C)(C)C)[Si](C)(C)C)C(=O)O[Si](C)(C)C | 2215.4 | Standard non polar | 33892256 |
| n-carboxymethyllysine,4TMS,isomer #1 | C[Si](C)(C)OC(=O)CNC(CCCCN([Si](C)(C)C)[Si](C)(C)C)C(=O)O[Si](C)(C)C | 2288.8 | Standard polar | 33892256 |
| n-carboxymethyllysine,4TMS,isomer #2 | C[Si](C)(C)NCCCCC(C(=O)O[Si](C)(C)C)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C | 2080.3 | Semi standard non polar | 33892256 |
| n-carboxymethyllysine,4TMS,isomer #2 | C[Si](C)(C)NCCCCC(C(=O)O[Si](C)(C)C)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C | 2187.6 | Standard non polar | 33892256 |
| n-carboxymethyllysine,4TMS,isomer #2 | C[Si](C)(C)NCCCCC(C(=O)O[Si](C)(C)C)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C | 2242.2 | Standard polar | 33892256 |
| n-carboxymethyllysine,4TMS,isomer #3 | C[Si](C)(C)OC(=O)CN(C(CCCCN([Si](C)(C)C)[Si](C)(C)C)C(=O)O)[Si](C)(C)C | 2285.1 | Semi standard non polar | 33892256 |
| n-carboxymethyllysine,4TMS,isomer #3 | C[Si](C)(C)OC(=O)CN(C(CCCCN([Si](C)(C)C)[Si](C)(C)C)C(=O)O)[Si](C)(C)C | 2263.1 | Standard non polar | 33892256 |
| n-carboxymethyllysine,4TMS,isomer #3 | C[Si](C)(C)OC(=O)CN(C(CCCCN([Si](C)(C)C)[Si](C)(C)C)C(=O)O)[Si](C)(C)C | 2474.0 | Standard polar | 33892256 |
| n-carboxymethyllysine,4TMS,isomer #4 | C[Si](C)(C)OC(=O)C(CCCCN([Si](C)(C)C)[Si](C)(C)C)N(CC(=O)O)[Si](C)(C)C | 2282.8 | Semi standard non polar | 33892256 |
| n-carboxymethyllysine,4TMS,isomer #4 | C[Si](C)(C)OC(=O)C(CCCCN([Si](C)(C)C)[Si](C)(C)C)N(CC(=O)O)[Si](C)(C)C | 2237.6 | Standard non polar | 33892256 |
| n-carboxymethyllysine,4TMS,isomer #4 | C[Si](C)(C)OC(=O)C(CCCCN([Si](C)(C)C)[Si](C)(C)C)N(CC(=O)O)[Si](C)(C)C | 2408.7 | Standard polar | 33892256 |
| n-carboxymethyllysine,5TMS,isomer #1 | C[Si](C)(C)OC(=O)CN(C(CCCCN([Si](C)(C)C)[Si](C)(C)C)C(=O)O[Si](C)(C)C)[Si](C)(C)C | 2317.0 | Semi standard non polar | 33892256 |
| n-carboxymethyllysine,5TMS,isomer #1 | C[Si](C)(C)OC(=O)CN(C(CCCCN([Si](C)(C)C)[Si](C)(C)C)C(=O)O[Si](C)(C)C)[Si](C)(C)C | 2273.0 | Standard non polar | 33892256 |
| n-carboxymethyllysine,5TMS,isomer #1 | C[Si](C)(C)OC(=O)CN(C(CCCCN([Si](C)(C)C)[Si](C)(C)C)C(=O)O[Si](C)(C)C)[Si](C)(C)C | 2215.4 | Standard polar | 33892256 |
| n-carboxymethyllysine,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NCCCCC(NCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2741.8 | Semi standard non polar | 33892256 |
| n-carboxymethyllysine,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NCCCCC(NCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2674.6 | Standard non polar | 33892256 |
| n-carboxymethyllysine,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NCCCCC(NCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2664.6 | Standard polar | 33892256 |
| n-carboxymethyllysine,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)CN(C(CCCCN)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2716.2 | Semi standard non polar | 33892256 |
| n-carboxymethyllysine,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)CN(C(CCCCN)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2639.6 | Standard non polar | 33892256 |
| n-carboxymethyllysine,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)CN(C(CCCCN)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2907.7 | Standard polar | 33892256 |
| n-carboxymethyllysine,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)CNC(CCCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O | 2939.4 | Semi standard non polar | 33892256 |
| n-carboxymethyllysine,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)CNC(CCCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O | 2724.5 | Standard non polar | 33892256 |
| n-carboxymethyllysine,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)CNC(CCCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O | 2821.9 | Standard polar | 33892256 |
| n-carboxymethyllysine,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)NCCCCC(C(=O)O)N(CC(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2831.9 | Semi standard non polar | 33892256 |
| n-carboxymethyllysine,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)NCCCCC(C(=O)O)N(CC(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2691.4 | Standard non polar | 33892256 |
| n-carboxymethyllysine,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)NCCCCC(C(=O)O)N(CC(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2786.0 | Standard polar | 33892256 |
| n-carboxymethyllysine,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC(=O)C(CCCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)NCC(=O)O | 2927.1 | Semi standard non polar | 33892256 |
| n-carboxymethyllysine,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC(=O)C(CCCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)NCC(=O)O | 2694.8 | Standard non polar | 33892256 |
| n-carboxymethyllysine,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC(=O)C(CCCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)NCC(=O)O | 2781.1 | Standard polar | 33892256 |
| n-carboxymethyllysine,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)NCCCCC(C(=O)O[Si](C)(C)C(C)(C)C)N(CC(=O)O)[Si](C)(C)C(C)(C)C | 2821.8 | Semi standard non polar | 33892256 |
| n-carboxymethyllysine,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)NCCCCC(C(=O)O[Si](C)(C)C(C)(C)C)N(CC(=O)O)[Si](C)(C)C(C)(C)C | 2671.5 | Standard non polar | 33892256 |
| n-carboxymethyllysine,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)NCCCCC(C(=O)O[Si](C)(C)C(C)(C)C)N(CC(=O)O)[Si](C)(C)C(C)(C)C | 2744.0 | Standard polar | 33892256 |
| n-carboxymethyllysine,3TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)N(CC(=O)O)C(CCCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O | 2939.6 | Semi standard non polar | 33892256 |
| n-carboxymethyllysine,3TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)N(CC(=O)O)C(CCCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O | 2721.8 | Standard non polar | 33892256 |
| n-carboxymethyllysine,3TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)N(CC(=O)O)C(CCCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O | 2863.2 | Standard polar | 33892256 |
| n-carboxymethyllysine,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)CNC(CCCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 3135.6 | Semi standard non polar | 33892256 |
| n-carboxymethyllysine,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)CNC(CCCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2919.9 | Standard non polar | 33892256 |
| n-carboxymethyllysine,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)CNC(CCCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2679.6 | Standard polar | 33892256 |
| n-carboxymethyllysine,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NCCCCC(C(=O)O[Si](C)(C)C(C)(C)C)N(CC(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3020.9 | Semi standard non polar | 33892256 |
| n-carboxymethyllysine,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NCCCCC(C(=O)O[Si](C)(C)C(C)(C)C)N(CC(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2880.3 | Standard non polar | 33892256 |
| n-carboxymethyllysine,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NCCCCC(C(=O)O[Si](C)(C)C(C)(C)C)N(CC(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2694.0 | Standard polar | 33892256 |
| n-carboxymethyllysine,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)CN(C(CCCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O)[Si](C)(C)C(C)(C)C | 3155.1 | Semi standard non polar | 33892256 |
| n-carboxymethyllysine,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)CN(C(CCCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O)[Si](C)(C)C(C)(C)C | 2929.8 | Standard non polar | 33892256 |
| n-carboxymethyllysine,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)CN(C(CCCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O)[Si](C)(C)C(C)(C)C | 2794.4 | Standard polar | 33892256 |
| n-carboxymethyllysine,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=O)C(CCCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N(CC(=O)O)[Si](C)(C)C(C)(C)C | 3148.4 | Semi standard non polar | 33892256 |
| n-carboxymethyllysine,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=O)C(CCCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N(CC(=O)O)[Si](C)(C)C(C)(C)C | 2918.0 | Standard non polar | 33892256 |
| n-carboxymethyllysine,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=O)C(CCCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N(CC(=O)O)[Si](C)(C)C(C)(C)C | 2755.0 | Standard polar | 33892256 |
| n-carboxymethyllysine,5TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)CN(C(CCCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3406.8 | Semi standard non polar | 33892256 |
| n-carboxymethyllysine,5TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)CN(C(CCCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3100.1 | Standard non polar | 33892256 |
| n-carboxymethyllysine,5TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)CN(C(CCCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2731.9 | Standard polar | 33892256 |