| Chromatographic Method | Retention Time | Reference |
|---|
| Predicted by Siyang on May 30, 2022 | 8.5196 minutes | 33406817 |
| Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 492.0 seconds | 40023050 |
| Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 367.8 seconds | 40023050 |
| Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 84.0 seconds | 40023050 |
| Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 278.3 seconds | 40023050 |
| RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 153.6 seconds | 40023050 |
| Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 262.0 seconds | 40023050 |
| BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 257.7 seconds | 40023050 |
| HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 829.7 seconds | 40023050 |
| UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 569.8 seconds | 40023050 |
| BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 46.1 seconds | 40023050 |
| UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 588.1 seconds | 40023050 |
| SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 233.3 seconds | 40023050 |
| RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 366.8 seconds | 40023050 |
| MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 736.8 seconds | 40023050 |
| KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 444.7 seconds | 40023050 |
| Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 402.9 seconds | 40023050 |
| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Phosphoramidic acid,1TMS,isomer #1 | C[Si](C)(C)OP(N)(=O)O | 1232.2 | Semi standard non polar | 33892256 |
| Phosphoramidic acid,1TMS,isomer #1 | C[Si](C)(C)OP(N)(=O)O | 1170.8 | Standard non polar | 33892256 |
| Phosphoramidic acid,1TMS,isomer #1 | C[Si](C)(C)OP(N)(=O)O | 2115.9 | Standard polar | 33892256 |
| Phosphoramidic acid,1TMS,isomer #2 | C[Si](C)(C)NP(=O)(O)O | 1331.0 | Semi standard non polar | 33892256 |
| Phosphoramidic acid,1TMS,isomer #2 | C[Si](C)(C)NP(=O)(O)O | 1219.2 | Standard non polar | 33892256 |
| Phosphoramidic acid,1TMS,isomer #2 | C[Si](C)(C)NP(=O)(O)O | 1796.9 | Standard polar | 33892256 |
| Phosphoramidic acid,2TMS,isomer #1 | C[Si](C)(C)OP(N)(=O)O[Si](C)(C)C | 1281.9 | Semi standard non polar | 33892256 |
| Phosphoramidic acid,2TMS,isomer #1 | C[Si](C)(C)OP(N)(=O)O[Si](C)(C)C | 1270.1 | Standard non polar | 33892256 |
| Phosphoramidic acid,2TMS,isomer #1 | C[Si](C)(C)OP(N)(=O)O[Si](C)(C)C | 1897.1 | Standard polar | 33892256 |
| Phosphoramidic acid,2TMS,isomer #2 | C[Si](C)(C)NP(=O)(O)O[Si](C)(C)C | 1359.8 | Semi standard non polar | 33892256 |
| Phosphoramidic acid,2TMS,isomer #2 | C[Si](C)(C)NP(=O)(O)O[Si](C)(C)C | 1271.6 | Standard non polar | 33892256 |
| Phosphoramidic acid,2TMS,isomer #2 | C[Si](C)(C)NP(=O)(O)O[Si](C)(C)C | 1495.2 | Standard polar | 33892256 |
| Phosphoramidic acid,2TMS,isomer #3 | C[Si](C)(C)N([Si](C)(C)C)P(=O)(O)O | 1424.5 | Semi standard non polar | 33892256 |
| Phosphoramidic acid,2TMS,isomer #3 | C[Si](C)(C)N([Si](C)(C)C)P(=O)(O)O | 1356.6 | Standard non polar | 33892256 |
| Phosphoramidic acid,2TMS,isomer #3 | C[Si](C)(C)N([Si](C)(C)C)P(=O)(O)O | 1646.5 | Standard polar | 33892256 |
| Phosphoramidic acid,3TMS,isomer #1 | C[Si](C)(C)NP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 1346.7 | Semi standard non polar | 33892256 |
| Phosphoramidic acid,3TMS,isomer #1 | C[Si](C)(C)NP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 1373.6 | Standard non polar | 33892256 |
| Phosphoramidic acid,3TMS,isomer #1 | C[Si](C)(C)NP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 1361.6 | Standard polar | 33892256 |
| Phosphoramidic acid,3TMS,isomer #2 | C[Si](C)(C)OP(=O)(O)N([Si](C)(C)C)[Si](C)(C)C | 1429.3 | Semi standard non polar | 33892256 |
| Phosphoramidic acid,3TMS,isomer #2 | C[Si](C)(C)OP(=O)(O)N([Si](C)(C)C)[Si](C)(C)C | 1424.3 | Standard non polar | 33892256 |
| Phosphoramidic acid,3TMS,isomer #2 | C[Si](C)(C)OP(=O)(O)N([Si](C)(C)C)[Si](C)(C)C | 1499.3 | Standard polar | 33892256 |
| Phosphoramidic acid,4TMS,isomer #1 | C[Si](C)(C)OP(=O)(O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 1440.6 | Semi standard non polar | 33892256 |
| Phosphoramidic acid,4TMS,isomer #1 | C[Si](C)(C)OP(=O)(O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 1524.2 | Standard non polar | 33892256 |
| Phosphoramidic acid,4TMS,isomer #1 | C[Si](C)(C)OP(=O)(O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 1423.2 | Standard polar | 33892256 |
| Phosphoramidic acid,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OP(N)(=O)O | 1484.9 | Semi standard non polar | 33892256 |
| Phosphoramidic acid,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OP(N)(=O)O | 1414.8 | Standard non polar | 33892256 |
| Phosphoramidic acid,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OP(N)(=O)O | 2337.1 | Standard polar | 33892256 |
| Phosphoramidic acid,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NP(=O)(O)O | 1559.0 | Semi standard non polar | 33892256 |
| Phosphoramidic acid,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NP(=O)(O)O | 1483.0 | Standard non polar | 33892256 |
| Phosphoramidic acid,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NP(=O)(O)O | 1924.3 | Standard polar | 33892256 |
| Phosphoramidic acid,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OP(N)(=O)O[Si](C)(C)C(C)(C)C | 1737.1 | Semi standard non polar | 33892256 |
| Phosphoramidic acid,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OP(N)(=O)O[Si](C)(C)C(C)(C)C | 1689.0 | Standard non polar | 33892256 |
| Phosphoramidic acid,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OP(N)(=O)O[Si](C)(C)C(C)(C)C | 2214.9 | Standard polar | 33892256 |
| Phosphoramidic acid,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NP(=O)(O)O[Si](C)(C)C(C)(C)C | 1829.9 | Semi standard non polar | 33892256 |
| Phosphoramidic acid,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NP(=O)(O)O[Si](C)(C)C(C)(C)C | 1692.2 | Standard non polar | 33892256 |
| Phosphoramidic acid,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NP(=O)(O)O[Si](C)(C)C(C)(C)C | 1767.4 | Standard polar | 33892256 |
| Phosphoramidic acid,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N([Si](C)(C)C(C)(C)C)P(=O)(O)O | 1847.6 | Semi standard non polar | 33892256 |
| Phosphoramidic acid,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N([Si](C)(C)C(C)(C)C)P(=O)(O)O | 1771.8 | Standard non polar | 33892256 |
| Phosphoramidic acid,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N([Si](C)(C)C(C)(C)C)P(=O)(O)O | 1870.5 | Standard polar | 33892256 |
| Phosphoramidic acid,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 1991.4 | Semi standard non polar | 33892256 |
| Phosphoramidic acid,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 1946.6 | Standard non polar | 33892256 |
| Phosphoramidic acid,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 1760.3 | Standard polar | 33892256 |
| Phosphoramidic acid,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OP(=O)(O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2077.7 | Semi standard non polar | 33892256 |
| Phosphoramidic acid,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OP(=O)(O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2028.3 | Standard non polar | 33892256 |
| Phosphoramidic acid,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OP(=O)(O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 1856.8 | Standard polar | 33892256 |
| Phosphoramidic acid,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OP(=O)(O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2262.3 | Semi standard non polar | 33892256 |
| Phosphoramidic acid,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OP(=O)(O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2273.4 | Standard non polar | 33892256 |
| Phosphoramidic acid,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OP(=O)(O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 1873.1 | Standard polar | 33892256 |