| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Expected but not Quantified |
|---|
| Creation Date | 2006-08-13 11:11:24 UTC |
|---|
| Update Date | 2023-02-21 17:16:56 UTC |
|---|
| HMDB ID | HMDB0004110 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Phosphonoacetate |
|---|
| Description | Phosphonoacetate, also known as fosfonet, belongs to the class of organic compounds known as organic phosphonic acids. These are organic compounds containing phosphonic acid. Phosphonoacetate exists in all living organisms, ranging from bacteria to humans. Phosphonoacetate has been detected, but not quantified in, a few different foods, such as anatidaes (Anatidae), chickens (Gallus gallus), and domestic pigs (Sus scrofa domestica). This could make phosphonoacetate a potential biomarker for the consumption of these foods. Phosphonoacetate is a primary metabolite. Primary metabolites are metabolically or physiologically essential metabolites. They are directly involved in an organism’s growth, development or reproduction. Based on a literature review a small amount of articles have been published on Phosphonoacetate. |
|---|
| Structure | InChI=1S/C2H5O5P/c3-2(4)1-8(5,6)7/h1H2,(H,3,4)(H2,5,6,7) |
|---|
| Synonyms | | Value | Source |
|---|
| Fosfonet | ChEBI | | Phosphonoacetic acid | Kegg | | Carboxymethanephosphonate | HMDB | | Carboxymethanephosphonic acid | HMDB | | Disodium carboxymethylphosphonate | HMDB | | Disodium phosphonoacetate | HMDB, MeSH | | Disodium phosphonoacetate monohydrate | HMDB | | Fosfonet sodium | HMDB, MeSH | | Fosfonoacetate | HMDB | | Fosfonoacetic acid | HMDB | | Lopac-P-6909 | HMDB | | PAE | HMDB | | Phosphonacetate | HMDB | | Phosphonacetic acid | HMDB, MeSH | | PPA | HMDB | | Acid, phosphonoacetic | MeSH, HMDB | | Phosphonoacetate, disodium | MeSH, HMDB | | Sodium, fosfonet | MeSH, HMDB | | Acid, phosphonacetic | MeSH, HMDB | | Phosphonoacetate | ChEBI |
|
|---|
| Chemical Formula | C2H5O5P |
|---|
| Average Molecular Weight | 140.0319 |
|---|
| Monoisotopic Molecular Weight | 139.987459782 |
|---|
| IUPAC Name | 2-phosphonoacetic acid |
|---|
| Traditional Name | phosphonoacetic acid |
|---|
| CAS Registry Number | 4408-78-0 |
|---|
| SMILES | OC(=O)CP(O)(O)=O |
|---|
| InChI Identifier | InChI=1S/C2H5O5P/c3-2(4)1-8(5,6)7/h1H2,(H,3,4)(H2,5,6,7) |
|---|
| InChI Key | XUYJLQHKOGNDPB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as organic phosphonic acids. These are organic compounds containing phosphonic acid. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Organic acids and derivatives |
|---|
| Class | Organic phosphonic acids and derivatives |
|---|
| Sub Class | Organic phosphonic acids |
|---|
| Direct Parent | Organic phosphonic acids |
|---|
| Alternative Parents | |
|---|
| Substituents | - Organophosphonic acid
- Monocarboxylic acid or derivatives
- Carboxylic acid
- Carboxylic acid derivative
- Organic oxygen compound
- Organopnictogen compound
- Organic oxide
- Hydrocarbon derivative
- Organophosphorus compound
- Organooxygen compound
- Carbonyl group
- Aliphatic acyclic compound
|
|---|
| Molecular Framework | Aliphatic acyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Physiological effect | Not Available |
|---|
| Disposition | |
|---|
| Process | Not Available |
|---|
| Role | |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | 143 - 146 °C | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | 392 mg/mL at 0 °C | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 1.7 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 9.5381 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 9.22 minutes | 32390414 | | AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid | 439.7 seconds | 40023050 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 553.9 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 385.8 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 55.3 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 271.1 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 153.7 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 292.5 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 259.7 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 848.7 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 618.5 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 41.2 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 694.7 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 242.8 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 390.1 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 761.4 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 525.5 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 493.4 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Phosphonoacetate,1TMS,isomer #1 | C[Si](C)(C)OC(=O)CP(=O)(O)O | 1398.9 | Semi standard non polar | 33892256 | | Phosphonoacetate,1TMS,isomer #2 | C[Si](C)(C)OP(=O)(O)CC(=O)O | 1402.2 | Semi standard non polar | 33892256 | | Phosphonoacetate,2TMS,isomer #1 | C[Si](C)(C)OC(=O)CP(=O)(O)O[Si](C)(C)C | 1432.0 | Semi standard non polar | 33892256 | | Phosphonoacetate,2TMS,isomer #1 | C[Si](C)(C)OC(=O)CP(=O)(O)O[Si](C)(C)C | 1461.7 | Standard non polar | 33892256 | | Phosphonoacetate,2TMS,isomer #1 | C[Si](C)(C)OC(=O)CP(=O)(O)O[Si](C)(C)C | 1773.5 | Standard polar | 33892256 | | Phosphonoacetate,2TMS,isomer #2 | C[Si](C)(C)OP(=O)(CC(=O)O)O[Si](C)(C)C | 1482.8 | Semi standard non polar | 33892256 | | Phosphonoacetate,2TMS,isomer #2 | C[Si](C)(C)OP(=O)(CC(=O)O)O[Si](C)(C)C | 1497.0 | Standard non polar | 33892256 | | Phosphonoacetate,2TMS,isomer #2 | C[Si](C)(C)OP(=O)(CC(=O)O)O[Si](C)(C)C | 1680.7 | Standard polar | 33892256 | | Phosphonoacetate,3TMS,isomer #1 | C[Si](C)(C)OC(=O)CP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 1497.2 | Semi standard non polar | 33892256 | | Phosphonoacetate,3TMS,isomer #1 | C[Si](C)(C)OC(=O)CP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 1534.8 | Standard non polar | 33892256 | | Phosphonoacetate,3TMS,isomer #1 | C[Si](C)(C)OC(=O)CP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 1556.5 | Standard polar | 33892256 | | Phosphonoacetate,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)CP(=O)(O)O | 1653.7 | Semi standard non polar | 33892256 | | Phosphonoacetate,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OP(=O)(O)CC(=O)O | 1676.3 | Semi standard non polar | 33892256 | | Phosphonoacetate,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)CP(=O)(O)O[Si](C)(C)C(C)(C)C | 1868.7 | Semi standard non polar | 33892256 | | Phosphonoacetate,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)CP(=O)(O)O[Si](C)(C)C(C)(C)C | 1905.9 | Standard non polar | 33892256 | | Phosphonoacetate,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)CP(=O)(O)O[Si](C)(C)C(C)(C)C | 2028.2 | Standard polar | 33892256 | | Phosphonoacetate,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OP(=O)(CC(=O)O)O[Si](C)(C)C(C)(C)C | 1930.4 | Semi standard non polar | 33892256 | | Phosphonoacetate,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OP(=O)(CC(=O)O)O[Si](C)(C)C(C)(C)C | 1901.9 | Standard non polar | 33892256 | | Phosphonoacetate,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OP(=O)(CC(=O)O)O[Si](C)(C)C(C)(C)C | 1996.6 | Standard polar | 33892256 | | Phosphonoacetate,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)CP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2116.6 | Semi standard non polar | 33892256 | | Phosphonoacetate,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)CP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2149.2 | Standard non polar | 33892256 | | Phosphonoacetate,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)CP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 1943.9 | Standard polar | 33892256 |
|
|---|