Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2012-09-11 22:41:53 UTC

Update Date

2022-03-07 02:55:20 UTC

HMDB ID

HMDB0037448

Secondary Accession Numbers

HMDB37448

Metabolite Identification

Common Name

Diosmetin 8-C-(2''-rhamnosylglucoside)

Description

Diosmetin 8-C-(2''-rhamnosylglucoside) belongs to the class of organic compounds known as flavonoid-7-o-glycosides. These are phenolic compounds containing a flavonoid moiety which is O-glycosidically linked to carbohydrate moiety at the C7-position. Diosmetin 8-C-(2''-rhamnosylglucoside) has been detected, but not quantified in, fruits. This could make diosmetin 8-C-(2''-rhamnosylglucoside) a potential biomarker for the consumption of these foods. Based on a literature review very few articles have been published on Diosmetin 8-C-(2''-rhamnosylglucoside).

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI


  Mrv0541 02241216502D          

 43 47  0  0  0  0            999 V2000
    0.7149    2.8873    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7149    2.0623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4284    1.6498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4284    0.8248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1433    0.4124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1433   -0.4124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8583   -0.8248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8583   -1.6498    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7149    0.4124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.8248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.6498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7149    2.0623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7149    2.8873    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4286    1.6498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4286    0.8248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434    0.4124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7149    0.4124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7149   -0.4124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4286   -0.8248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -0.4124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8571   -0.8248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8571   -1.6498    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5720   -2.0623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5720   -2.8873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -0.8248    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.6498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7149   -2.0623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7149   -2.8873    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8583    0.8248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5719    0.4124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5719   -0.4124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868   -0.8248    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -2.0623    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4286   -1.6498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7149   -2.0623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7149   -2.8873    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5720    0.4124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5720   -0.4124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2870   -0.8248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2870   -1.6498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0005   -2.0623    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0005   -0.4124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0005   -0.4124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0  0  0  0
  2  3  1  0  0  0  0
  2 11  1  0  0  0  0
  3  4  2  0  0  0  0
  4  5  1  0  0  0  0
  4  9  1  0  0  0  0
  5  6  2  0  0  0  0
  5 29  1  0  0  0  0
  6  7  1  0  0  0  0
  7  8  1  0  0  0  0
  7 31  2  0  0  0  0
  9 10  1  0  0  0  0
 10 11  2  0  0  0  0
 10 17  1  0  0  0  0
 11 12  1  0  0  0  0
 12 13  1  0  0  0  0
 12 14  2  0  0  0  0
 14 15  1  0  0  0  0
 15 16  1  0  0  0  0
 15 17  2  0  0  0  0
 17 18  1  0  0  0  0
 18 19  1  0  0  0  0
 18 25  1  0  0  0  0
 19 20  1  0  0  0  0
 19 34  1  0  0  0  0
 20 21  1  0  0  0  0
 21 22  1  0  0  0  0
 21 38  1  0  0  0  0
 22 23  1  0  0  0  0
 23 24  1  0  0  0  0
 23 40  1  0  0  0  0
 25 26  1  0  0  0  0
 26 27  1  0  0  0  0
 26 35  1  0  0  0  0
 27 28  1  0  0  0  0
 29 30  2  0  0  0  0
 30 31  1  0  0  0  0
 31 32  1  0  0  0  0
 32 43  1  0  0  0  0
 33 34  1  0  0  0  0
 34 35  1  0  0  0  0
 35 36  1  0  0  0  0
 37 38  1  0  0  0  0
 38 39  1  0  0  0  0
 39 40  1  0  0  0  0
 39 42  1  0  0  0  0
 40 41  1  0  0  0  0
M  END

HMDB0037448
     RDKit          3D
Diosmetin 8-C-(2''-rhamnosylglucoside)
 75 79  0  0  0  0  0  0  0  0999 V2000
    5.0796   -0.6936   -4.5517 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1862    0.4288   -3.7370 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4312    0.7238   -2.6268 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4308   -0.1105   -2.2020 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6656    0.1536   -1.0874 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8705    1.3101   -0.3125 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1224    1.4743    0.9251 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2919    2.5024    1.7934 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5882    2.6372    2.9858 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7766    3.5877    3.7417 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6600    1.6392    3.2796 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0537    1.6386    4.4362 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0461    2.6062    5.3731 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9546    0.5604    4.6678 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0781   -0.4297    3.7301 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9707   -1.4916    3.9590 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3671   -0.4568    2.5455 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4462   -1.5744    1.6354 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7310   -2.8210    2.1112 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.1090   -3.7100    1.4024 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3218   -5.1431    1.6263 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4928   -6.0111    0.9085 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3280   -3.3526   -0.0372 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4044   -4.5060   -0.8476 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7952   -2.5293   -0.5560 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7666   -2.2844   -1.9196 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9815   -1.2968    0.2784 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6701   -0.1026   -0.2579 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7388    0.6870   -0.5378 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8538    0.6694   -1.9811 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1642    0.9175   -2.3314 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1757    1.4431   -3.7446 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9633    1.8117   -1.4705 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6390    2.8048   -2.2276 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2906    2.4979   -0.3410 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8399    2.1367    0.9017 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8108    2.1080   -0.2090 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4257    2.5584    1.0179 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5104    0.6115    2.3674 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2168    0.5672    1.2638 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8672    2.1367   -0.7495 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6343    1.8825   -1.8595 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6480    2.7304   -2.2928 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0197   -1.0065   -4.6132 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3948   -0.4061   -5.5864 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.6463   -1.5768   -4.1644 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.2495   -1.0162   -2.7879 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.8996   -0.4931   -0.7573 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0198    3.2713    1.5475 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.5632    3.4097    5.4432 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5041    0.5838    5.5880 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5128   -1.5492    4.7813 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.7409   -1.7338    1.3824 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.1156   -3.5372    1.9016 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3812   -5.2080    1.3420 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1499   -5.3581    2.7093 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0308   -6.6343    0.3065 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2969   -2.8231   -0.2111 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.1478   -4.2708   -1.7914 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7208   -3.1758   -0.4096 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7167   -2.0869   -2.1976 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1450   -1.3187    0.4685 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7150    0.2050   -0.2485 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6302   -0.1153   -2.4189 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3699    0.9454   -4.3250 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1819    1.3641   -4.2097 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8501    2.5321   -3.6664 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8082    1.1918   -1.0332 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2468    3.2405   -1.5845 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3113    3.5995   -0.3915 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6250    1.5802    0.7629 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3196    2.7461   -1.0103 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1467    2.6788    1.6607 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0457    3.0559   -0.1793 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.9047    3.5942   -1.8516 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
  9 11  1  0
 11 12  2  0
 12 13  1  0
 12 14  1  0
 14 15  2  0
 15 16  1  0
 15 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 20 23  1  0
 23 24  1  0
 23 25  1  0
 25 26  1  0
 25 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 31 33  1  0
 33 34  1  0
 33 35  1  0
 35 36  1  0
 35 37  1  0
 37 38  1  0
 17 39  2  0
 39 40  1  0
  6 41  1  0
 41 42  2  0
 42 43  1  0
 42  3  1  0
 40  7  1  0
 39 11  1  0
 27 18  1  0
 37 29  1  0
  1 44  1  0
  1 45  1  0
  1 46  1  0
  4 47  1  0
  5 48  1  0
  8 49  1  0
 13 50  1  0
 14 51  1  0
 16 52  1  0
 18 53  1  0
 20 54  1  0
 21 55  1  0
 21 56  1  0
 22 57  1  0
 23 58  1  0
 24 59  1  0
 25 60  1  0
 26 61  1  0
 27 62  1  0
 29 63  1  0
 31 64  1  0
 32 65  1  0
 32 66  1  0
 32 67  1  0
 33 68  1  0
 34 69  1  0
 35 70  1  0
 36 71  1  0
 37 72  1  0
 38 73  1  0
 41 74  1  0
 43 75  1  0
M  END


  Mrv0541 02241216502D          

 43 47  0  0  0  0            999 V2000
    0.7149    2.8873    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7149    2.0623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4284    1.6498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4284    0.8248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1433    0.4124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1433   -0.4124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8583   -0.8248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8583   -1.6498    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7149    0.4124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.8248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.6498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7149    2.0623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7149    2.8873    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4286    1.6498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4286    0.8248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434    0.4124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7149    0.4124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7149   -0.4124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4286   -0.8248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -0.4124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8571   -0.8248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8571   -1.6498    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5720   -2.0623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5720   -2.8873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -0.8248    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.6498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7149   -2.0623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7149   -2.8873    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8583    0.8248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5719    0.4124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5719   -0.4124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868   -0.8248    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -2.0623    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4286   -1.6498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7149   -2.0623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7149   -2.8873    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5720    0.4124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5720   -0.4124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2870   -0.8248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2870   -1.6498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0005   -2.0623    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0005   -0.4124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0005   -0.4124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0  0  0  0
  2  3  1  0  0  0  0
  2 11  1  0  0  0  0
  3  4  2  0  0  0  0
  4  5  1  0  0  0  0
  4  9  1  0  0  0  0
  5  6  2  0  0  0  0
  5 29  1  0  0  0  0
  6  7  1  0  0  0  0
  7  8  1  0  0  0  0
  7 31  2  0  0  0  0
  9 10  1  0  0  0  0
 10 11  2  0  0  0  0
 10 17  1  0  0  0  0
 11 12  1  0  0  0  0
 12 13  1  0  0  0  0
 12 14  2  0  0  0  0
 14 15  1  0  0  0  0
 15 16  1  0  0  0  0
 15 17  2  0  0  0  0
 17 18  1  0  0  0  0
 18 19  1  0  0  0  0
 18 25  1  0  0  0  0
 19 20  1  0  0  0  0
 19 34  1  0  0  0  0
 20 21  1  0  0  0  0
 21 22  1  0  0  0  0
 21 38  1  0  0  0  0
 22 23  1  0  0  0  0
 23 24  1  0  0  0  0
 23 40  1  0  0  0  0
 25 26  1  0  0  0  0
 26 27  1  0  0  0  0
 26 35  1  0  0  0  0
 27 28  1  0  0  0  0
 29 30  2  0  0  0  0
 30 31  1  0  0  0  0
 31 32  1  0  0  0  0
 32 43  1  0  0  0  0
 33 34  1  0  0  0  0
 34 35  1  0  0  0  0
 35 36  1  0  0  0  0
 37 38  1  0  0  0  0
 38 39  1  0  0  0  0
 39 40  1  0  0  0  0
 39 42  1  0  0  0  0
 40 41  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0037448

> <DATABASE_NAME>
hmdb

> <SMILES>
COC1=C(O)C=C(C=C1)C1=CC(=O)C2=C(O1)C(C1OC(CO)C(O)C(O)C1OC1OC(C)C(O)C(O)C1O)=C(O)C=C2O

> <INCHI_IDENTIFIER>
InChI=1S/C28H32O15/c1-9-20(34)22(36)24(38)28(40-9)43-27-23(37)21(35)17(8-29)42-26(27)19-13(32)6-12(31)18-14(33)7-16(41-25(18)19)10-3-4-15(39-2)11(30)5-10/h3-7,9,17,20-24,26-32,34-38H,8H2,1-2H3

> <INCHI_KEY>
TZPXUQWBAIYNEA-UHFFFAOYSA-N

> <FORMULA>
C28H32O15

> <MOLECULAR_WEIGHT>
608.5447

> <EXACT_MASS>
608.174120354

> <JCHEM_ACCEPTOR_COUNT>
15

> <JCHEM_AVERAGE_POLARIZABILITY>
59.49392941486324

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
9

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
8-[4,5-dihydroxy-6-(hydroxymethyl)-3-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]oxan-2-yl]-5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-4H-chromen-4-one

> <ALOGPS_LOGP>
-0.01

> <JCHEM_LOGP>
-0.9322287160000001

> <ALOGPS_LOGS>
-2.27

> <JCHEM_MDDR_LIKE_RULE>
1

> <JCHEM_NUMBER_OF_RINGS>
5

> <JCHEM_PHYSIOLOGICAL_CHARGE>
-1

> <JCHEM_PKA>
9.082244929454975

> <JCHEM_PKA_STRONGEST_ACIDIC>
6.1997943010147

> <JCHEM_PKA_STRONGEST_BASIC>
-3.6121826114733837

> <JCHEM_POLAR_SURFACE_AREA>
245.28999999999996

> <JCHEM_REFRACTIVITY>
143.36499999999998

> <JCHEM_ROTATABLE_BOND_COUNT>
6

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
3.30e+00 g/l

> <JCHEM_TRADITIONAL_IUPAC>
8-[4,5-dihydroxy-6-(hydroxymethyl)-3-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]oxan-2-yl]-5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)chromen-4-one

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0037448
     RDKit          3D
Diosmetin 8-C-(2''-rhamnosylglucoside)
 75 79  0  0  0  0  0  0  0  0999 V2000
    5.0796   -0.6936   -4.5517 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1862    0.4288   -3.7370 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4312    0.7238   -2.6268 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4308   -0.1105   -2.2020 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6656    0.1536   -1.0874 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8705    1.3101   -0.3125 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1224    1.4743    0.9251 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2919    2.5024    1.7934 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5882    2.6372    2.9858 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7766    3.5877    3.7417 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6600    1.6392    3.2796 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0537    1.6386    4.4362 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0461    2.6062    5.3731 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9546    0.5604    4.6678 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0781   -0.4297    3.7301 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9707   -1.4916    3.9590 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3671   -0.4568    2.5455 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4462   -1.5744    1.6354 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7310   -2.8210    2.1112 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.1090   -3.7100    1.4024 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3218   -5.1431    1.6263 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4928   -6.0111    0.9085 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3280   -3.3526   -0.0372 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4044   -4.5060   -0.8476 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7952   -2.5293   -0.5560 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7666   -2.2844   -1.9196 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9815   -1.2968    0.2784 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6701   -0.1026   -0.2579 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7388    0.6870   -0.5378 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8538    0.6694   -1.9811 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1642    0.9175   -2.3314 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1757    1.4431   -3.7446 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9633    1.8117   -1.4705 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6390    2.8048   -2.2276 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2906    2.4979   -0.3410 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8399    2.1367    0.9017 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8108    2.1080   -0.2090 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4257    2.5584    1.0179 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5104    0.6115    2.3674 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2168    0.5672    1.2638 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8672    2.1367   -0.7495 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6343    1.8825   -1.8595 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6480    2.7304   -2.2928 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0197   -1.0065   -4.6132 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3948   -0.4061   -5.5864 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.6463   -1.5768   -4.1644 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.2495   -1.0162   -2.7879 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.8996   -0.4931   -0.7573 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0198    3.2713    1.5475 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.5632    3.4097    5.4432 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5041    0.5838    5.5880 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5128   -1.5492    4.7813 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.7409   -1.7338    1.3824 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.1156   -3.5372    1.9016 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3812   -5.2080    1.3420 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1499   -5.3581    2.7093 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0308   -6.6343    0.3065 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2969   -2.8231   -0.2111 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.1478   -4.2708   -1.7914 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7208   -3.1758   -0.4096 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7167   -2.0869   -2.1976 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1450   -1.3187    0.4685 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7150    0.2050   -0.2485 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6302   -0.1153   -2.4189 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3699    0.9454   -4.3250 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1819    1.3641   -4.2097 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8501    2.5321   -3.6664 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8082    1.1918   -1.0332 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2468    3.2405   -1.5845 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3113    3.5995   -0.3915 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6250    1.5802    0.7629 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3196    2.7461   -1.0103 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1467    2.6788    1.6607 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0457    3.0559   -0.1793 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.9047    3.5942   -1.8516 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
  9 11  1  0
 11 12  2  0
 12 13  1  0
 12 14  1  0
 14 15  2  0
 15 16  1  0
 15 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 20 23  1  0
 23 24  1  0
 23 25  1  0
 25 26  1  0
 25 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 31 33  1  0
 33 34  1  0
 33 35  1  0
 35 36  1  0
 35 37  1  0
 37 38  1  0
 17 39  2  0
 39 40  1  0
  6 41  1  0
 41 42  2  0
 42 43  1  0
 42  3  1  0
 40  7  1  0
 39 11  1  0
 27 18  1  0
 37 29  1  0
  1 44  1  0
  1 45  1  0
  1 46  1  0
  4 47  1  0
  5 48  1  0
  8 49  1  0
 13 50  1  0
 14 51  1  0
 16 52  1  0
 18 53  1  0
 20 54  1  0
 21 55  1  0
 21 56  1  0
 22 57  1  0
 23 58  1  0
 24 59  1  0
 25 60  1  0
 26 61  1  0
 27 62  1  0
 29 63  1  0
 31 64  1  0
 32 65  1  0
 32 66  1  0
 32 67  1  0
 33 68  1  0
 34 69  1  0
 35 70  1  0
 36 71  1  0
 37 72  1  0
 38 73  1  0
 41 74  1  0
 43 75  1  0
M  END

HEADER    PROTEIN                                 24-FEB-12   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   24-FEB-12         0                                  
HETATM    1  O   UNK     0       1.334   5.390   0.000  0.00  0.00           O+0
HETATM    2  C   UNK     0       1.334   3.850   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0       2.666   3.080   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0       2.666   1.540   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0       4.001   0.770   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0       4.001  -0.770   0.000  0.00  0.00           C+0
HETATM    7  C   UNK     0       5.335  -1.540   0.000  0.00  0.00           C+0
HETATM    8  O   UNK     0       5.335  -3.080   0.000  0.00  0.00           O+0
HETATM    9  O   UNK     0       1.334   0.770   0.000  0.00  0.00           O+0
HETATM   10  C   UNK     0       0.000   1.540   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0       0.000   3.080   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0      -1.334   3.850   0.000  0.00  0.00           C+0
HETATM   13  O   UNK     0      -1.334   5.390   0.000  0.00  0.00           O+0
HETATM   14  C   UNK     0      -2.667   3.080   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0      -2.667   1.540   0.000  0.00  0.00           C+0
HETATM   16  O   UNK     0      -4.001   0.770   0.000  0.00  0.00           O+0
HETATM   17  C   UNK     0      -1.334   0.770   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0      -1.334  -0.770   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0      -2.667  -1.540   0.000  0.00  0.00           C+0
HETATM   20  O   UNK     0      -4.001  -0.770   0.000  0.00  0.00           O+0
HETATM   21  C   UNK     0      -5.333  -1.540   0.000  0.00  0.00           C+0
HETATM   22  O   UNK     0      -5.333  -3.080   0.000  0.00  0.00           O+0
HETATM   23  C   UNK     0      -6.668  -3.850   0.000  0.00  0.00           C+0
HETATM   24  C   UNK     0      -6.668  -5.390   0.000  0.00  0.00           C+0
HETATM   25  O   UNK     0       0.000  -1.540   0.000  0.00  0.00           O+0
HETATM   26  C   UNK     0       0.000  -3.080   0.000  0.00  0.00           C+0
HETATM   27  C   UNK     0       1.334  -3.850   0.000  0.00  0.00           C+0
HETATM   28  O   UNK     0       1.334  -5.390   0.000  0.00  0.00           O+0
HETATM   29  C   UNK     0       5.335   1.540   0.000  0.00  0.00           C+0
HETATM   30  C   UNK     0       6.668   0.770   0.000  0.00  0.00           C+0
HETATM   31  C   UNK     0       6.668  -0.770   0.000  0.00  0.00           C+0
HETATM   32  O   UNK     0       8.002  -1.540   0.000  0.00  0.00           O+0
HETATM   33  O   UNK     0      -4.001  -3.850   0.000  0.00  0.00           O+0
HETATM   34  C   UNK     0      -2.667  -3.080   0.000  0.00  0.00           C+0
HETATM   35  C   UNK     0      -1.334  -3.850   0.000  0.00  0.00           C+0
HETATM   36  O   UNK     0      -1.334  -5.390   0.000  0.00  0.00           O+0
HETATM   37  O   UNK     0      -6.668   0.770   0.000  0.00  0.00           O+0
HETATM   38  C   UNK     0      -6.668  -0.770   0.000  0.00  0.00           C+0
HETATM   39  C   UNK     0      -8.002  -1.540   0.000  0.00  0.00           C+0
HETATM   40  C   UNK     0      -8.002  -3.080   0.000  0.00  0.00           C+0
HETATM   41  O   UNK     0      -9.334  -3.850   0.000  0.00  0.00           O+0
HETATM   42  O   UNK     0      -9.334  -0.770   0.000  0.00  0.00           O+0
HETATM   43  C   UNK     0       9.334  -0.770   0.000  0.00  0.00           C+0
CONECT    1    2                                                            
CONECT    2    1    3   11                                                  
CONECT    3    2    4                                                       
CONECT    4    3    5    9                                                  
CONECT    5    4    6   29                                                  
CONECT    6    5    7                                                       
CONECT    7    6    8   31                                                  
CONECT    8    7                                                            
CONECT    9    4   10                                                       
CONECT   10    9   11   17                                                  
CONECT   11    2   10   12                                                  
CONECT   12   11   13   14                                                  
CONECT   13   12                                                            
CONECT   14   12   15                                                       
CONECT   15   14   16   17                                                  
CONECT   16   15                                                            
CONECT   17   10   15   18                                                  
CONECT   18   17   19   25                                                  
CONECT   19   18   20   34                                                  
CONECT   20   19   21                                                       
CONECT   21   20   22   38                                                  
CONECT   22   21   23                                                       
CONECT   23   22   24   40                                                  
CONECT   24   23                                                            
CONECT   25   18   26                                                       
CONECT   26   25   27   35                                                  
CONECT   27   26   28                                                       
CONECT   28   27                                                            
CONECT   29    5   30                                                       
CONECT   30   29   31                                                       
CONECT   31    7   30   32                                                  
CONECT   32   31   43                                                       
CONECT   33   34                                                            
CONECT   34   19   33   35                                                  
CONECT   35   26   34   36                                                  
CONECT   36   35                                                            
CONECT   37   38                                                            
CONECT   38   21   37   39                                                  
CONECT   39   38   40   42                                                  
CONECT   40   23   39   41                                                  
CONECT   41   40                                                            
CONECT   42   39                                                            
CONECT   43   32                                                            
MASTER        0    0    0    0    0    0    0    0   43    0   94    0
END

COMPND    HMDB0037448
HETATM    1  C1  UNL     1       5.080  -0.694  -4.552  1.00  0.00           C  
HETATM    2  O1  UNL     1       5.186   0.429  -3.737  1.00  0.00           O  
HETATM    3  C2  UNL     1       4.431   0.724  -2.627  1.00  0.00           C  
HETATM    4  C3  UNL     1       3.431  -0.111  -2.202  1.00  0.00           C  
HETATM    5  C4  UNL     1       2.666   0.154  -1.087  1.00  0.00           C  
HETATM    6  C5  UNL     1       2.871   1.310  -0.313  1.00  0.00           C  
HETATM    7  C6  UNL     1       2.122   1.474   0.925  1.00  0.00           C  
HETATM    8  C7  UNL     1       2.292   2.502   1.793  1.00  0.00           C  
HETATM    9  C8  UNL     1       1.588   2.637   2.986  1.00  0.00           C  
HETATM   10  O2  UNL     1       1.777   3.588   3.742  1.00  0.00           O  
HETATM   11  C9  UNL     1       0.660   1.639   3.280  1.00  0.00           C  
HETATM   12  C10 UNL     1      -0.054   1.639   4.436  1.00  0.00           C  
HETATM   13  O3  UNL     1       0.046   2.606   5.373  1.00  0.00           O  
HETATM   14  C11 UNL     1      -0.955   0.560   4.668  1.00  0.00           C  
HETATM   15  C12 UNL     1      -1.078  -0.430   3.730  1.00  0.00           C  
HETATM   16  O4  UNL     1      -1.971  -1.492   3.959  1.00  0.00           O  
HETATM   17  C13 UNL     1      -0.367  -0.457   2.546  1.00  0.00           C  
HETATM   18  C14 UNL     1      -0.446  -1.574   1.635  1.00  0.00           C  
HETATM   19  O5  UNL     1      -0.731  -2.821   2.111  1.00  0.00           O  
HETATM   20  C15 UNL     1       0.109  -3.710   1.402  1.00  0.00           C  
HETATM   21  C16 UNL     1      -0.322  -5.143   1.626  1.00  0.00           C  
HETATM   22  O6  UNL     1       0.493  -6.011   0.908  1.00  0.00           O  
HETATM   23  C17 UNL     1       0.328  -3.353  -0.037  1.00  0.00           C  
HETATM   24  O7  UNL     1       0.404  -4.506  -0.848  1.00  0.00           O  
HETATM   25  C18 UNL     1      -0.795  -2.529  -0.556  1.00  0.00           C  
HETATM   26  O8  UNL     1      -0.767  -2.284  -1.920  1.00  0.00           O  
HETATM   27  C19 UNL     1      -0.981  -1.297   0.278  1.00  0.00           C  
HETATM   28  O9  UNL     1      -0.670  -0.103  -0.258  1.00  0.00           O  
HETATM   29  C20 UNL     1      -1.739   0.687  -0.538  1.00  0.00           C  
HETATM   30  O10 UNL     1      -1.854   0.669  -1.981  1.00  0.00           O  
HETATM   31  C21 UNL     1      -3.164   0.918  -2.331  1.00  0.00           C  
HETATM   32  C22 UNL     1      -3.176   1.443  -3.745  1.00  0.00           C  
HETATM   33  C23 UNL     1      -3.963   1.812  -1.471  1.00  0.00           C  
HETATM   34  O11 UNL     1      -4.639   2.805  -2.228  1.00  0.00           O  
HETATM   35  C24 UNL     1      -3.291   2.498  -0.341  1.00  0.00           C  
HETATM   36  O12 UNL     1      -3.840   2.137   0.902  1.00  0.00           O  
HETATM   37  C25 UNL     1      -1.811   2.108  -0.209  1.00  0.00           C  
HETATM   38  O13 UNL     1      -1.426   2.558   1.018  1.00  0.00           O  
HETATM   39  C26 UNL     1       0.510   0.612   2.367  1.00  0.00           C  
HETATM   40  O14 UNL     1       1.217   0.567   1.264  1.00  0.00           O  
HETATM   41  C27 UNL     1       3.867   2.137  -0.749  1.00  0.00           C  
HETATM   42  C28 UNL     1       4.634   1.883  -1.860  1.00  0.00           C  
HETATM   43  O15 UNL     1       5.648   2.730  -2.293  1.00  0.00           O  
HETATM   44  H1  UNL     1       4.020  -1.007  -4.613  1.00  0.00           H  
HETATM   45  H2  UNL     1       5.395  -0.406  -5.586  1.00  0.00           H  
HETATM   46  H3  UNL     1       5.646  -1.577  -4.164  1.00  0.00           H  
HETATM   47  H4  UNL     1       3.249  -1.016  -2.788  1.00  0.00           H  
HETATM   48  H5  UNL     1       1.900  -0.493  -0.757  1.00  0.00           H  
HETATM   49  H6  UNL     1       3.020   3.271   1.547  1.00  0.00           H  
HETATM   50  H7  UNL     1       0.563   3.410   5.443  1.00  0.00           H  
HETATM   51  H8  UNL     1      -1.504   0.584   5.588  1.00  0.00           H  
HETATM   52  H9  UNL     1      -2.513  -1.549   4.781  1.00  0.00           H  
HETATM   53  H10 UNL     1       0.741  -1.734   1.382  1.00  0.00           H  
HETATM   54  H11 UNL     1       1.116  -3.537   1.902  1.00  0.00           H  
HETATM   55  H12 UNL     1      -1.381  -5.208   1.342  1.00  0.00           H  
HETATM   56  H13 UNL     1      -0.150  -5.358   2.709  1.00  0.00           H  
HETATM   57  H14 UNL     1      -0.031  -6.634   0.307  1.00  0.00           H  
HETATM   58  H15 UNL     1       1.297  -2.823  -0.211  1.00  0.00           H  
HETATM   59  H16 UNL     1       0.148  -4.271  -1.791  1.00  0.00           H  
HETATM   60  H17 UNL     1      -1.721  -3.176  -0.410  1.00  0.00           H  
HETATM   61  H18 UNL     1      -1.717  -2.087  -2.198  1.00  0.00           H  
HETATM   62  H19 UNL     1      -2.145  -1.319   0.469  1.00  0.00           H  
HETATM   63  H20 UNL     1      -2.715   0.205  -0.248  1.00  0.00           H  
HETATM   64  H21 UNL     1      -3.630  -0.115  -2.419  1.00  0.00           H  
HETATM   65  H22 UNL     1      -2.370   0.945  -4.325  1.00  0.00           H  
HETATM   66  H23 UNL     1      -4.182   1.364  -4.210  1.00  0.00           H  
HETATM   67  H24 UNL     1      -2.850   2.532  -3.666  1.00  0.00           H  
HETATM   68  H25 UNL     1      -4.808   1.192  -1.033  1.00  0.00           H  
HETATM   69  H26 UNL     1      -5.247   3.241  -1.585  1.00  0.00           H  
HETATM   70  H27 UNL     1      -3.311   3.600  -0.392  1.00  0.00           H  
HETATM   71  H28 UNL     1      -4.625   1.580   0.763  1.00  0.00           H  
HETATM   72  H29 UNL     1      -1.320   2.746  -1.010  1.00  0.00           H  
HETATM   73  H30 UNL     1      -2.147   2.679   1.661  1.00  0.00           H  
HETATM   74  H31 UNL     1       4.046   3.056  -0.179  1.00  0.00           H  
HETATM   75  H32 UNL     1       5.905   3.594  -1.852  1.00  0.00           H  
CONECT    1    2   44   45   46
CONECT    2    3
CONECT    3    4    4   42
CONECT    4    5   47
CONECT    5    6    6   48
CONECT    6    7   41
CONECT    7    8    8   40
CONECT    8    9   49
CONECT    9   10   10   11
CONECT   11   12   12   39
CONECT   12   13   14
CONECT   13   50
CONECT   14   15   15   51
CONECT   15   16   17
CONECT   16   52
CONECT   17   18   39   39
CONECT   18   19   27   53
CONECT   19   20
CONECT   20   21   23   54
CONECT   21   22   55   56
CONECT   22   57
CONECT   23   24   25   58
CONECT   24   59
CONECT   25   26   27   60
CONECT   26   61
CONECT   27   28   62
CONECT   28   29
CONECT   29   30   37   63
CONECT   30   31
CONECT   31   32   33   64
CONECT   32   65   66   67
CONECT   33   34   35   68
CONECT   34   69
CONECT   35   36   37   70
CONECT   36   71
CONECT   37   38   72
CONECT   38   73
CONECT   39   40
CONECT   41   42   42   74
CONECT   42   43
CONECT   43   75
END

HMDB0037448
     RDKit          3D
Diosmetin 8-C-(2''-rhamnosylglucoside)
 75 79  0  0  0  0  0  0  0  0999 V2000
    5.0796   -0.6936   -4.5517 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1862    0.4288   -3.7370 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4312    0.7238   -2.6268 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4308   -0.1105   -2.2020 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6656    0.1536   -1.0874 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8705    1.3101   -0.3125 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1224    1.4743    0.9251 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2919    2.5024    1.7934 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5882    2.6372    2.9858 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7766    3.5877    3.7417 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6600    1.6392    3.2796 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0537    1.6386    4.4362 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0461    2.6062    5.3731 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9546    0.5604    4.6678 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0781   -0.4297    3.7301 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9707   -1.4916    3.9590 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3671   -0.4568    2.5455 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4462   -1.5744    1.6354 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7310   -2.8210    2.1112 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.1090   -3.7100    1.4024 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3218   -5.1431    1.6263 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4928   -6.0111    0.9085 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3280   -3.3526   -0.0372 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4044   -4.5060   -0.8476 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7952   -2.5293   -0.5560 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7666   -2.2844   -1.9196 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9815   -1.2968    0.2784 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6701   -0.1026   -0.2579 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7388    0.6870   -0.5378 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8538    0.6694   -1.9811 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1642    0.9175   -2.3314 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1757    1.4431   -3.7446 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9633    1.8117   -1.4705 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6390    2.8048   -2.2276 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2906    2.4979   -0.3410 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8399    2.1367    0.9017 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8108    2.1080   -0.2090 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4257    2.5584    1.0179 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5104    0.6115    2.3674 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2168    0.5672    1.2638 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8672    2.1367   -0.7495 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6343    1.8825   -1.8595 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6480    2.7304   -2.2928 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0197   -1.0065   -4.6132 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3948   -0.4061   -5.5864 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.6463   -1.5768   -4.1644 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.2495   -1.0162   -2.7879 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.8996   -0.4931   -0.7573 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0198    3.2713    1.5475 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.5632    3.4097    5.4432 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5041    0.5838    5.5880 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5128   -1.5492    4.7813 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.7409   -1.7338    1.3824 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.1156   -3.5372    1.9016 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3812   -5.2080    1.3420 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1499   -5.3581    2.7093 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0308   -6.6343    0.3065 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2969   -2.8231   -0.2111 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.1478   -4.2708   -1.7914 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7208   -3.1758   -0.4096 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7167   -2.0869   -2.1976 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1450   -1.3187    0.4685 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7150    0.2050   -0.2485 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6302   -0.1153   -2.4189 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3699    0.9454   -4.3250 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1819    1.3641   -4.2097 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8501    2.5321   -3.6664 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8082    1.1918   -1.0332 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2468    3.2405   -1.5845 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3113    3.5995   -0.3915 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6250    1.5802    0.7629 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3196    2.7461   -1.0103 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1467    2.6788    1.6607 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0457    3.0559   -0.1793 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.9047    3.5942   -1.8516 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
  9 11  1  0
 11 12  2  0
 12 13  1  0
 12 14  1  0
 14 15  2  0
 15 16  1  0
 15 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 20 23  1  0
 23 24  1  0
 23 25  1  0
 25 26  1  0
 25 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 31 33  1  0
 33 34  1  0
 33 35  1  0
 35 36  1  0
 35 37  1  0
 37 38  1  0
 17 39  2  0
 39 40  1  0
  6 41  1  0
 41 42  2  0
 42 43  1  0
 42  3  1  0
 40  7  1  0
 39 11  1  0
 27 18  1  0
 37 29  1  0
  1 44  1  0
  1 45  1  0
  1 46  1  0
  4 47  1  0
  5 48  1  0
  8 49  1  0
 13 50  1  0
 14 51  1  0
 16 52  1  0
 18 53  1  0
 20 54  1  0
 21 55  1  0
 21 56  1  0
 22 57  1  0
 23 58  1  0
 24 59  1  0
 25 60  1  0
 26 61  1  0
 27 62  1  0
 29 63  1  0
 31 64  1  0
 32 65  1  0
 32 66  1  0
 32 67  1  0
 33 68  1  0
 34 69  1  0
 35 70  1  0
 36 71  1  0
 37 72  1  0
 38 73  1  0
 41 74  1  0
 43 75  1  0
M  END

View in JSmol View NMR Assignments View Stereo Labels

Synonyms

Value	Source
8-C-beta-D-Glucopyranosyldiosmetin 2''-O-rhamnoside	HMDB

Chemical Formula

C₂₈H₃₂O₁₅

Average Molecular Weight

608.5447

Monoisotopic Molecular Weight

608.174120354

IUPAC Name

8-[4,5-dihydroxy-6-(hydroxymethyl)-3-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]oxan-2-yl]-5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-4H-chromen-4-one

Traditional Name

8-[4,5-dihydroxy-6-(hydroxymethyl)-3-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]oxan-2-yl]-5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)chromen-4-one

CAS Registry Number

98891-92-0

SMILES

COC1=C(O)C=C(C=C1)C1=CC(=O)C2=C(O1)C(C1OC(CO)C(O)C(O)C1OC1OC(C)C(O)C(O)C1O)=C(O)C=C2O

InChI Identifier

InChI=1S/C28H32O15/c1-9-20(34)22(36)24(38)28(40-9)43-27-23(37)21(35)17(8-29)42-26(27)19-13(32)6-12(31)18-14(33)7-16(41-25(18)19)10-3-4-15(39-2)11(30)5-10/h3-7,9,17,20-24,26-32,34-38H,8H2,1-2H3

InChI Key

TZPXUQWBAIYNEA-UHFFFAOYSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as flavonoid-7-o-glycosides. These are phenolic compounds containing a flavonoid moiety which is O-glycosidically linked to carbohydrate moiety at the C7-position.

Kingdom

Organic compounds

Super Class

Phenylpropanoids and polyketides

Class

Flavonoids

Sub Class

Flavonoid glycosides

Direct Parent

Flavonoid-7-O-glycosides

Alternative Parents

Substituents

Flavonoid-7-o-glycoside
4p-methoxyflavonoid-skeleton
3'-hydroxyflavonoid
5-hydroxyflavonoid
Flavone
Hydroxyflavonoid
Phenolic glycoside
Hexose monosaccharide
Chromone
Glycosyl compound
O-glycosyl compound
Benzopyran
Methoxyphenol
1-benzopyran
Phenoxy compound
Anisole
Methoxybenzene
Phenol ether
Phenol
Pyranone
Alkyl aryl ether
1-hydroxy-4-unsubstituted benzenoid
1-hydroxy-2-unsubstituted benzenoid
Benzenoid
Pyran
Oxane
Monosaccharide
Monocyclic benzene moiety
Vinylogous acid
Heteroaromatic compound
Secondary alcohol
Ether
Organoheterocyclic compound
Acetal
Polyol
Oxacycle
Hydrocarbon derivative
Organic oxide
Organic oxygen compound
Primary alcohol
Organooxygen compound
Alcohol
Aromatic heteropolycyclic compound

Molecular Framework

Aromatic heteropolycyclic compounds

External Descriptors

Not Available

Ontology

Physiological effect

Not Available

Disposition

Biological location

Cellular substructure

Extracellular (HMDB: HMDB0037448)
Cytoplasm (HMDB: HMDB0037448)

Route of exposure

Enteral

Ingestion (HMDB: HMDB0037448)

Source

Exogenous

Food

Food (HMDB: HMDB0037448)

Fruit

Fruits (FooDB: FOOD00871)

Endogenous

Plant

Plant (HMDB: HMDB0037448)

Not Available

Nutrient (HMDB: HMDB0037448)

Physical Properties

State

Solid

Experimental Molecular Properties

Property	Value	Reference
Melting Point	214 - 216 °C	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	Not Available	Not Available
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	3.3 g/L	ALOGPS
logP	-0.01	ALOGPS
logP	-0.93	ChemAxon
logS	-2.3	ALOGPS
pKa (Strongest Acidic)	6.2	ChemAxon
pKa (Strongest Basic)	-3.6	ChemAxon
Physiological Charge	-1	ChemAxon
Hydrogen Acceptor Count	15	ChemAxon
Hydrogen Donor Count	9	ChemAxon
Polar Surface Area	245.29 Å²	ChemAxon
Rotatable Bond Count	6	ChemAxon
Refractivity	143.36 m³·mol⁻¹	ChemAxon
Polarizability	59.49 Å³	ChemAxon
Number of Rings	5	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	Yes	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DarkChem	[M+H]+	234.703	31661259
DarkChem	[M-H]-	228.692	31661259
DeepCCS	[M+H]+	227.194	30932474
DeepCCS	[M-H]-	225.005	30932474
DeepCCS	[M-2H]-	258.245	30932474
DeepCCS	[M+Na]+	233.074	30932474
AllCCS	[M+H]+	237.1	32859911
AllCCS	[M+H-H2O]+	235.7	32859911
AllCCS	[M+NH4]+	238.3	32859911
AllCCS	[M+Na]+	238.7	32859911
AllCCS	[M-H]-	236.8	32859911
AllCCS	[M+Na-2H]-	239.5	32859911
AllCCS	[M+HCOO]-	242.7	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
Diosmetin 8-C-(2''-rhamnosylglucoside)	COC1=C(O)C=C(C=C1)C1=CC(=O)C2=C(O1)C(C1OC(CO)C(O)C(O)C1OC1OC(C)C(O)C(O)C1O)=C(O)C=C2O	6061.3	Standard polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside)	COC1=C(O)C=C(C=C1)C1=CC(=O)C2=C(O1)C(C1OC(CO)C(O)C(O)C1OC1OC(C)C(O)C(O)C1O)=C(O)C=C2O	5095.1	Standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside)	COC1=C(O)C=C(C=C1)C1=CC(=O)C2=C(O1)C(C1OC(CO)C(O)C(O)C1OC1OC(C)C(O)C(O)C1O)=C(O)C=C2O	5632.2	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
Diosmetin 8-C-(2''-rhamnosylglucoside),1TMS,isomer #1	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5528.2	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),1TMS,isomer #2	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O	5530.4	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),1TMS,isomer #3	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O	5545.8	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),1TMS,isomer #4	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O	5556.6	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),1TMS,isomer #5	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O	5559.0	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),1TMS,isomer #6	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5546.8	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),1TMS,isomer #7	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5549.4	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),1TMS,isomer #8	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O	5551.8	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),1TMS,isomer #9	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O	5567.3	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TMS,isomer #1	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5410.7	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TMS,isomer #10	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O	5389.5	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TMS,isomer #11	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O	5398.6	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TMS,isomer #12	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O	5389.0	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TMS,isomer #13	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O	5392.5	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TMS,isomer #14	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5360.3	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TMS,isomer #15	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5377.8	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TMS,isomer #16	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O	5404.3	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TMS,isomer #17	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O	5386.8	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TMS,isomer #18	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O	5430.9	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TMS,isomer #19	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O	5404.6	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TMS,isomer #2	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5393.5	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TMS,isomer #20	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5374.3	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TMS,isomer #21	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5395.2	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TMS,isomer #22	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O	5409.1	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TMS,isomer #23	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O	5384.7	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TMS,isomer #24	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O	5409.5	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TMS,isomer #25	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5381.2	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TMS,isomer #26	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5406.2	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TMS,isomer #27	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O	5426.9	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TMS,isomer #28	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O	5407.4	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TMS,isomer #29	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5419.2	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TMS,isomer #3	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5386.5	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TMS,isomer #30	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5405.9	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TMS,isomer #31	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5382.9	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TMS,isomer #32	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5362.5	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TMS,isomer #33	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)C=C1O	5407.8	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TMS,isomer #34	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5408.1	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TMS,isomer #35	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5390.3	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TMS,isomer #36	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O	5395.2	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TMS,isomer #4	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5397.2	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TMS,isomer #5	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5400.8	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TMS,isomer #6	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5410.9	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TMS,isomer #7	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O[Si](C)(C)C	5374.4	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TMS,isomer #8	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O[Si](C)(C)C	5399.2	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TMS,isomer #9	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O	5408.5	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #1	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5235.3	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #10	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5221.7	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #11	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5262.6	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #12	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O[Si](C)(C)C	5201.1	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #13	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O[Si](C)(C)C	5238.2	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #14	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5234.2	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #15	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5203.1	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #16	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5244.7	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #17	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O[Si](C)(C)C	5192.9	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #18	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O[Si](C)(C)C	5219.8	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #19	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5276.1	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #2	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5236.1	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #20	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5261.3	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #21	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O[Si](C)(C)C	5208.4	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #22	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O[Si](C)(C)C	5234.8	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #23	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5262.7	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #24	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O[Si](C)(C)C	5211.9	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #25	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O[Si](C)(C)C	5241.6	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #26	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O[Si](C)(C)C	5248.2	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #27	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O[Si](C)(C)C	5262.4	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #28	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)C=C1O[Si](C)(C)C	5249.5	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #29	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O	5199.7	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #3	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5244.6	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #30	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O	5217.7	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #31	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O	5191.9	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #32	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O	5229.2	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #33	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5170.2	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #34	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5206.1	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #35	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O	5194.0	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #36	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O	5161.9	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #37	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O	5212.0	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #38	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5152.7	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #39	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5188.4	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #4	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5242.1	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #40	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O	5220.3	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #41	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O	5225.0	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #42	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5174.2	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #43	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5198.6	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #44	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O	5198.4	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #45	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5145.5	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #46	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5174.6	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #47	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5194.3	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #48	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5204.0	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #49	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)C=C1O	5195.9	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #5	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5277.3	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #50	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O	5200.4	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #51	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O	5249.8	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #52	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O	5240.8	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #53	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5181.0	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #54	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5213.9	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #55	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O	5222.1	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #56	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O	5221.3	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #57	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5160.0	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #58	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5194.2	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #59	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O	5263.9	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #6	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O[Si](C)(C)C	5212.9	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #60	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5221.6	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #61	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5241.3	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #62	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5208.4	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #63	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5222.3	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #64	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)C=C1O	5220.0	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #65	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O	5196.4	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #66	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O	5240.7	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #67	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5186.7	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #68	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5217.0	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #69	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O	5217.2	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #7	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O[Si](C)(C)C	5252.4	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #70	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5162.1	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #71	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5192.6	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #72	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5215.7	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #73	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5229.0	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #74	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)C=C1O	5221.9	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #75	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O	5245.4	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #76	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5228.6	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #77	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5241.5	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #78	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5213.3	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #79	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5223.5	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #8	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5217.1	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #80	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)C=C1O	5242.4	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #81	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5172.7	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #82	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)C=C1O	5229.9	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #83	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)C=C1O	5211.4	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #84	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5212.0	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),3TMS,isomer #9	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5225.7	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #1	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5044.4	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #10	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O[Si](C)(C)C	5000.3	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #100	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5008.4	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #101	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)C=C1O	4985.0	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #102	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O	5040.1	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #103	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	4964.7	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #104	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5003.6	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #105	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	4979.9	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #106	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	4989.0	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #107	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)C=C1O	4964.7	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #108	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5023.9	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #109	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5036.1	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #11	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O[Si](C)(C)C	5044.3	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #110	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)C=C1O	5009.6	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #111	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)C=C1O	5011.8	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #112	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O	5025.4	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #113	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	4948.1	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #114	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	4978.7	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #115	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5017.2	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #116	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5021.9	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #117	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)C=C1O	4998.5	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #118	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	4987.7	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #119	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	4998.4	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #12	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5077.7	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #120	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)C=C1O	4972.0	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #121	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)C=C1O	5019.8	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #122	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5012.9	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #123	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5027.1	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #124	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)C=C1O	5034.6	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #125	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)C=C1O	5016.6	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #126	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)C=C1O	4999.2	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #13	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5077.0	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #14	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O[Si](C)(C)C	4993.5	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #15	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O[Si](C)(C)C	5035.5	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #16	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5078.6	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #17	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O[Si](C)(C)C	4998.6	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #18	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O[Si](C)(C)C	5041.1	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #19	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O[Si](C)(C)C	5063.8	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #2	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5029.9	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #20	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O[Si](C)(C)C	5070.8	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #21	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)C=C1O[Si](C)(C)C	5046.1	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #22	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5053.6	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #23	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5032.1	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #24	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5074.1	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #25	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O[Si](C)(C)C	4990.9	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #26	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O[Si](C)(C)C	5033.2	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #27	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5060.2	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #28	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5065.6	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #29	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O[Si](C)(C)C	4981.7	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #3	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5022.3	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #30	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O[Si](C)(C)C	5027.9	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #31	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5062.3	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #32	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O[Si](C)(C)C	4979.9	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #33	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O[Si](C)(C)C	5029.2	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #34	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O[Si](C)(C)C	5053.9	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #35	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O[Si](C)(C)C	5063.2	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #36	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)C=C1O[Si](C)(C)C	5037.6	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #37	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5075.0	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #38	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5076.4	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #39	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O[Si](C)(C)C	5007.3	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #4	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5083.4	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #40	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O[Si](C)(C)C	5043.3	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #41	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5059.0	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #42	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O[Si](C)(C)C	4991.0	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #43	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O[Si](C)(C)C	5024.0	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #44	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O[Si](C)(C)C	5045.5	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #45	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O[Si](C)(C)C	5051.5	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #46	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)C=C1O[Si](C)(C)C	5018.9	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #47	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5089.1	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #48	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O[Si](C)(C)C	5027.6	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #49	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O[Si](C)(C)C	5060.4	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #5	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O[Si](C)(C)C	4990.9	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #50	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O[Si](C)(C)C	5044.3	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #51	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O[Si](C)(C)C	5050.7	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #52	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)C=C1O[Si](C)(C)C	5025.5	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #53	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O[Si](C)(C)C	5046.4	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #54	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O[Si](C)(C)C	5056.5	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #55	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)C=C1O[Si](C)(C)C	5028.7	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #56	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)C=C1O[Si](C)(C)C	5059.1	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #57	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O	5018.9	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #58	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O	5000.1	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #59	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O	5043.4	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #6	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O[Si](C)(C)C	5040.7	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #60	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	4947.3	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #61	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	4990.2	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #62	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O	5048.0	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #63	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O	5048.1	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #64	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	4971.6	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #65	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5005.9	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #66	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O	5035.2	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #67	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	4960.9	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #68	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	4993.2	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #69	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5015.2	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #7	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5065.1	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #70	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5024.1	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #71	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)C=C1O	4991.3	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #72	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O	5029.3	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #73	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O	5031.1	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #74	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	4946.9	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #75	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	4989.5	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #76	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O	5014.6	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #77	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	4937.0	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #78	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	4974.2	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #79	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	4996.0	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #8	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5045.8	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #80	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5005.5	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #81	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)C=C1O	4973.8	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #82	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O	5044.7	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #83	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	4989.0	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #84	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5014.4	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #85	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5002.6	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #86	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5013.8	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #87	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)C=C1O	4980.0	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #88	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	4984.7	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #89	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	4997.2	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #9	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5087.0	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #90	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)C=C1O	4961.7	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #91	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)C=C1O	5004.3	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #92	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O	5027.2	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #93	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O	5024.6	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #94	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	4940.7	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #95	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	4974.7	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #96	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OC(C)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O	5059.1	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #97	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	4990.4	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #98	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5019.5	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),4TMS,isomer #99	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5003.8	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),1TBDMS,isomer #1	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C(C)(C)C	5708.6	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),1TBDMS,isomer #2	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O	5725.3	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),1TBDMS,isomer #3	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O	5768.8	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),1TBDMS,isomer #4	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O	5776.4	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),1TBDMS,isomer #5	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)=C3O2)C=C1O	5785.1	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),1TBDMS,isomer #6	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)=C3O2)C=C1O	5769.3	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),1TBDMS,isomer #7	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)=C3O2)C=C1O	5769.8	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),1TBDMS,isomer #8	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O	5733.3	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),1TBDMS,isomer #9	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O	5750.9	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TBDMS,isomer #1	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C(C)(C)C	5775.5	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TBDMS,isomer #10	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C(C4OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O	5752.7	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TBDMS,isomer #11	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O	5765.5	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TBDMS,isomer #12	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O	5754.7	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TBDMS,isomer #13	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)=C3O2)C=C1O	5775.7	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TBDMS,isomer #14	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)=C3O2)C=C1O	5730.3	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TBDMS,isomer #15	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)=C3O2)C=C1O	5733.5	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TBDMS,isomer #16	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O	5780.1	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TBDMS,isomer #17	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O	5760.4	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TBDMS,isomer #18	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O	5785.3	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TBDMS,isomer #19	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4OC4OC(C)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)=C3O2)C=C1O	5784.3	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TBDMS,isomer #2	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C(C)(C)C	5758.3	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TBDMS,isomer #20	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)=C3O2)C=C1O	5742.3	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TBDMS,isomer #21	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)=C3O2)C=C1O	5742.1	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TBDMS,isomer #22	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O	5780.5	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TBDMS,isomer #23	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O	5758.0	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TBDMS,isomer #24	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4OC4OC(C)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)=C3O2)C=C1O	5781.5	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TBDMS,isomer #25	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4OC4OC(C)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)=C3O2)C=C1O	5744.1	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TBDMS,isomer #26	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)=C3O2)C=C1O	5742.1	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TBDMS,isomer #27	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)=C3O2)C=C1O	5814.7	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TBDMS,isomer #28	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)=C3O2)C=C1O	5796.2	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TBDMS,isomer #29	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C4O)=C3O2)C=C1O	5783.0	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TBDMS,isomer #3	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C(C)(C)C	5743.1	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TBDMS,isomer #30	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C(C)(C)C)C(O)C4O[Si](C)(C)C(C)(C)C)=C3O2)C=C1O	5774.5	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TBDMS,isomer #31	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)=C3O2)C=C1O	5771.8	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TBDMS,isomer #32	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)=C3O2)C=C1O	5750.4	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TBDMS,isomer #33	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C(C)(C)C)C4O[Si](C)(C)C(C)(C)C)=C3O2)C=C1O	5757.4	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TBDMS,isomer #34	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)=C3O2)C=C1O	5765.9	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TBDMS,isomer #35	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)=C3O2)C=C1O	5747.4	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TBDMS,isomer #36	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O[Si](C)(C)C(C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O	5772.9	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TBDMS,isomer #4	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C(C)(C)C	5748.8	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TBDMS,isomer #5	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C(C)(C)C	5748.8	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TBDMS,isomer #6	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C(C)(C)C	5778.2	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TBDMS,isomer #7	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)=C3O2)C=C1O[Si](C)(C)C(C)(C)C	5732.8	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TBDMS,isomer #8	COC1=CC=C(C2=CC(=O)C3=C(O)C=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)=C3O2)C=C1O[Si](C)(C)C(C)(C)C	5732.8	Semi standard non polar	33892256
Diosmetin 8-C-(2''-rhamnosylglucoside),2TBDMS,isomer #9	COC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C(C4OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O)=C3O2)C=C1O	5769.8	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - Diosmetin 8-C-(2''-rhamnosylglucoside) GC-MS (Non-derivatized) - 70eV, Positive	splash10-00fv-5204290000-2898d7cf9905d5744c5a	2017-09-01	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Diosmetin 8-C-(2''-rhamnosylglucoside) GC-MS (1 TMS) - 70eV, Positive	splash10-02os-8301449000-e1f465f4d6c37b5ab883	2017-10-06	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Diosmetin 8-C-(2''-rhamnosylglucoside) GC-MS (TMS_1_2) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Diosmetin 8-C-(2''-rhamnosylglucoside) GC-MS (TMS_1_3) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Diosmetin 8-C-(2''-rhamnosylglucoside) GC-MS (TMS_1_4) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Diosmetin 8-C-(2''-rhamnosylglucoside) GC-MS (TMS_1_5) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Diosmetin 8-C-(2''-rhamnosylglucoside) GC-MS (TMS_1_6) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Diosmetin 8-C-(2''-rhamnosylglucoside) GC-MS (TMS_1_7) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Diosmetin 8-C-(2''-rhamnosylglucoside) GC-MS (TMS_1_8) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Diosmetin 8-C-(2''-rhamnosylglucoside) GC-MS (TMS_1_9) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Diosmetin 8-C-(2''-rhamnosylglucoside) GC-MS (TMS_2_1) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Diosmetin 8-C-(2''-rhamnosylglucoside) GC-MS (TMS_2_2) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Diosmetin 8-C-(2''-rhamnosylglucoside) GC-MS (TMS_2_3) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Diosmetin 8-C-(2''-rhamnosylglucoside) GC-MS (TMS_2_4) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Diosmetin 8-C-(2''-rhamnosylglucoside) GC-MS (TMS_2_5) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Diosmetin 8-C-(2''-rhamnosylglucoside) GC-MS (TMS_2_6) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Diosmetin 8-C-(2''-rhamnosylglucoside) GC-MS (TMS_2_7) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Diosmetin 8-C-(2''-rhamnosylglucoside) GC-MS (TMS_2_8) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Diosmetin 8-C-(2''-rhamnosylglucoside) GC-MS (TMS_2_9) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Diosmetin 8-C-(2''-rhamnosylglucoside) GC-MS (TMS_2_10) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Diosmetin 8-C-(2''-rhamnosylglucoside) GC-MS (TMS_2_11) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Diosmetin 8-C-(2''-rhamnosylglucoside) GC-MS (TMS_2_12) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Diosmetin 8-C-(2''-rhamnosylglucoside) GC-MS (TMS_2_13) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Diosmetin 8-C-(2''-rhamnosylglucoside) GC-MS (TMS_2_14) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Diosmetin 8-C-(2''-rhamnosylglucoside) GC-MS (TMS_2_15) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Diosmetin 8-C-(2''-rhamnosylglucoside) 10V, Positive-QTOF	splash10-08fv-0100943000-4ad2ddb4d34b515fefe0	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Diosmetin 8-C-(2''-rhamnosylglucoside) 20V, Positive-QTOF	splash10-01ot-0200900000-39c9839bd86654c4487f	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Diosmetin 8-C-(2''-rhamnosylglucoside) 40V, Positive-QTOF	splash10-004j-1319500000-38d4a59cbf69aa5d5da7	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Diosmetin 8-C-(2''-rhamnosylglucoside) 10V, Negative-QTOF	splash10-0bt9-3311669000-aeec3cf0e1b374d94f2b	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Diosmetin 8-C-(2''-rhamnosylglucoside) 20V, Negative-QTOF	splash10-03ka-4512920000-d326598635591823f00e	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Diosmetin 8-C-(2''-rhamnosylglucoside) 40V, Negative-QTOF	splash10-03di-7917600000-7c8ea0b29bf318188d15	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Diosmetin 8-C-(2''-rhamnosylglucoside) 10V, Positive-QTOF	splash10-0a4i-0000009000-e154c0abcfa7e4d701f5	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Diosmetin 8-C-(2''-rhamnosylglucoside) 20V, Positive-QTOF	splash10-0a4i-0000039000-2a86bd239ffa885ef7c7	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Diosmetin 8-C-(2''-rhamnosylglucoside) 40V, Positive-QTOF	splash10-014i-0000190000-25e830f2582bafb16cd2	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Diosmetin 8-C-(2''-rhamnosylglucoside) 10V, Negative-QTOF	splash10-0a4i-0000019000-a3a3195770faba7c7b7f	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Diosmetin 8-C-(2''-rhamnosylglucoside) 20V, Negative-QTOF	splash10-0006-0000093000-7f8b75b36a8f7aa451c2	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Diosmetin 8-C-(2''-rhamnosylglucoside) 40V, Negative-QTOF	splash10-0a4i-0400369000-b715b235de44b909bd8a	2021-09-24	Wishart Lab	View Spectrum

NMR Spectra

Spectrum Type	Description	Deposition Date	Source	View
Predicted 1D NMR	¹³C NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Cytoplasm
Extracellular

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

FDB016507

KNApSAcK ID

C00006256

Chemspider ID

Not Available

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

74977719

PDB ID

Not Available

ChEBI ID

176220

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

Not Available

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

(). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .

Showing metabocard for Diosmetin 8-C-(2''-rhamnosylglucoside) (HMDB0037448)

MOL for HMDB0037448 (Diosmetin 8-C-(2''-rhamnosylglucoside))

3D MOL for HMDB0037448 (Diosmetin 8-C-(2''-rhamnosylglucoside))

3D SDF for HMDB0037448 (Diosmetin 8-C-(2''-rhamnosylglucoside))

3D-SDF for HMDB0037448 (Diosmetin 8-C-(2''-rhamnosylglucoside))

PDB for HMDB0037448 (Diosmetin 8-C-(2''-rhamnosylglucoside))

3D PDB for HMDB0037448 (Diosmetin 8-C-(2''-rhamnosylglucoside))

SMILES for HMDB0037448 (Diosmetin 8-C-(2''-rhamnosylglucoside))

INCHI for HMDB0037448 (Diosmetin 8-C-(2''-rhamnosylglucoside))

Structure for HMDB0037448 (Diosmetin 8-C-(2''-rhamnosylglucoside))

3D Structure for HMDB0037448 (Diosmetin 8-C-(2''-rhamnosylglucoside))

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra

NMR Spectra