| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Detected and Quantified |
|---|
| Creation Date | 2007-01-22 21:47:08 UTC |
|---|
| Update Date | 2022-03-07 02:49:29 UTC |
|---|
| HMDB ID | HMDB0005794 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Quercetin |
|---|
| Description | Quercetin is a flavonoid widely distributed in many plants and fruits including red grapes, citrus fruit, tomato, broccoli and other leafy green vegetables, and a number of berries, including raspberries and cranberries. Quercetin itself (aglycone quercetin), as opposed to quercetin glycosides, is not a normal dietary component. Quercetin glycosides are converted to phenolic acids as they pass through the gastrointestinal tract. Quercetin has neither been confirmed scientifically as a specific therapeutic for any condition nor been approved by any regulatory agency. The U.S. Food and Drug Administration has not approved any health claims for quercetin. Nevertheless, the interest in dietary flavonoids has grown after the publication of several epidemiological studies showing an inverse correlation between dietary consumption of flavonols and flavones and reduced incidence and mortality from cardiovascular disease and cancer. In recent years, a large amount of experimental and some clinical data have accumulated regarding the effects of flavonoids on the endothelium under physiological and pathological conditions. The meta-analysis of seven prospective cohort studies concluded that the individuals in the top third of dietary flavonol intake are associated with a reduced risk of mortality from coronary heart disease as compared with those in the bottom third, after adjustment for known risk factors and other dietary components. A limited number of intervention studies with flavonoids and flavonoid containing foods and extracts has been performed in several pathological conditions (PMID:17015250 ). |
|---|
| Structure | OC1=CC(O)=C2C(OC(=C(O)C2=O)C2=CC(O)=C(O)C=C2)=C1 InChI=1S/C15H10O7/c16-7-4-10(19)12-11(5-7)22-15(14(21)13(12)20)6-1-2-8(17)9(18)3-6/h1-5,16-19,21H |
|---|
| Synonyms | | Value | Source |
|---|
| 2-(3,4-Dihydroxyphenyl)-3,5,7-trihydroxy-4H-1-benzopyran-4-one | ChEBI | | 3,3',4',5,7-Pentahydroxyflavone | ChEBI | | 3,5,7,3',4'-Pentahydroxyflavone | ChEBI | | Sophoretin | ChEBI | | Xanthaurine | ChEBI | | 3,3',4,5,7-Pentahydroxyflavone | Kegg | | Dikvertin | MeSH | | 2-(3,4-Dihydroxy-phenyl)-3,5,7-trihydroxy-chromen-4-one | HMDB | | 3',4',5,7-Tetrahydroxyflavan-3-ol | HMDB | | 3',4',5,7-Tetrahydroxyflavon-3-ol | HMDB | | 3,4',5,5',7-Pentahydroxy-flavone | HMDB | | 3,5,7-Trihydroxy-2-(3,4-dihydroxyphenyl)-4H-chromen-4-ON | HMDB | | Flavin meletin | HMDB | | Meletin | HMDB | | Quercetin dihydrate | HMDB | | Quercetol | HMDB | | Quertin | HMDB | | 2-(3,4-Dihydroxyphenyl)-3,5,7-trihydroxy-4H-benzopyran-4-one | PhytoBank | | 3,3’,4’,5,7-Pentahydroxyflavone | PhytoBank | | 3,5,7,3’,4’-Pentahydroxyflavone | PhytoBank | | 3,5,7-Trihydroxy-2-(3,4-dihydroxyphenyl)-4H-chromen-4-one | PhytoBank | | 3'-Hydroxykaempferol | PhytoBank | | 3’-Hydroxykaempferol | PhytoBank | | Quercetine | PhytoBank | | Quertine | PhytoBank |
|
|---|
| Chemical Formula | C15H10O7 |
|---|
| Average Molecular Weight | 302.2357 |
|---|
| Monoisotopic Molecular Weight | 302.042652674 |
|---|
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4H-chromen-4-one |
|---|
| Traditional Name | quercetin |
|---|
| CAS Registry Number | 117-39-5 |
|---|
| SMILES | OC1=CC(O)=C2C(OC(=C(O)C2=O)C2=CC(O)=C(O)C=C2)=C1 |
|---|
| InChI Identifier | InChI=1S/C15H10O7/c16-7-4-10(19)12-11(5-7)22-15(14(21)13(12)20)6-1-2-8(17)9(18)3-6/h1-5,16-19,21H |
|---|
| InChI Key | REFJWTPEDVJJIY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as flavonols. Flavonols are compounds that contain a flavone (2-phenyl-1-benzopyran-4-one) backbone carrying a hydroxyl group at the 3-position. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Phenylpropanoids and polyketides |
|---|
| Class | Flavonoids |
|---|
| Sub Class | Flavones |
|---|
| Direct Parent | Flavonols |
|---|
| Alternative Parents | |
|---|
| Substituents | - 3-hydroxyflavone
- 3'-hydroxyflavonoid
- 3-hydroxyflavonoid
- 4'-hydroxyflavonoid
- 5-hydroxyflavonoid
- 7-hydroxyflavonoid
- Hydroxyflavonoid
- Chromone
- Benzopyran
- 1-benzopyran
- Catechol
- 1-hydroxy-4-unsubstituted benzenoid
- 1-hydroxy-2-unsubstituted benzenoid
- Phenol
- Pyranone
- Benzenoid
- Monocyclic benzene moiety
- Pyran
- Heteroaromatic compound
- Vinylogous acid
- Oxacycle
- Organoheterocyclic compound
- Polyol
- Organic oxide
- Organic oxygen compound
- Hydrocarbon derivative
- Organooxygen compound
- Aromatic heteropolycyclic compound
|
|---|
| Molecular Framework | Aromatic heteropolycyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Not Available | Not Available |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Molecular Properties | |
|---|
| Experimental Chromatographic Properties | Experimental Collision Cross Sections |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 5.58 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 11.6273 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 2.79 minutes | 32390414 | | AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid | 28.2 seconds | 40023050 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 2029.7 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 268.8 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 104.8 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 155.3 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 394.4 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 588.1 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 480.5 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 188.8 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 787.8 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 386.1 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1469.6 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 299.7 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 382.4 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 554.9 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 215.9 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 277.7 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Quercetin,1TMS,isomer #1 | C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC=C(O)C(O)=C3)OC2=C1 | 3305.1 | Semi standard non polar | 33892256 | | Quercetin,1TMS,isomer #2 | C[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(O)=C(C1=CC=C(O)C(O)=C1)O2 | 3246.2 | Semi standard non polar | 33892256 | | Quercetin,1TMS,isomer #3 | C[Si](C)(C)OC1=C(C2=CC=C(O)C(O)=C2)OC2=CC(O)=CC(O)=C2C1=O | 3235.5 | Semi standard non polar | 33892256 | | Quercetin,1TMS,isomer #4 | C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O | 3297.0 | Semi standard non polar | 33892256 | | Quercetin,1TMS,isomer #5 | C[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1O | 3298.2 | Semi standard non polar | 33892256 | | Quercetin,2TMS,isomer #1 | C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O)=C(C3=CC=C(O)C(O)=C3)OC2=C1 | 3220.5 | Semi standard non polar | 33892256 | | Quercetin,2TMS,isomer #10 | C[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1O[Si](C)(C)C | 3167.7 | Semi standard non polar | 33892256 | | Quercetin,2TMS,isomer #2 | C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC=C(O)C(O)=C3)OC2=C1 | 3212.8 | Semi standard non polar | 33892256 | | Quercetin,2TMS,isomer #3 | C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC=C(O[Si](C)(C)C)C(O)=C3)OC2=C1 | 3292.7 | Semi standard non polar | 33892256 | | Quercetin,2TMS,isomer #4 | C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC=C(O)C(O[Si](C)(C)C)=C3)OC2=C1 | 3262.8 | Semi standard non polar | 33892256 | | Quercetin,2TMS,isomer #5 | C[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)C=C1O | 3222.2 | Semi standard non polar | 33892256 | | Quercetin,2TMS,isomer #6 | C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O | 3203.2 | Semi standard non polar | 33892256 | | Quercetin,2TMS,isomer #7 | C[Si](C)(C)OC1=C(C2=CC=C(O)C(O)=C2)OC2=CC(O)=CC(O[Si](C)(C)C)=C2C1=O | 3160.7 | Semi standard non polar | 33892256 | | Quercetin,2TMS,isomer #8 | C[Si](C)(C)OC1=CC=C(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1O | 3180.6 | Semi standard non polar | 33892256 | | Quercetin,2TMS,isomer #9 | C[Si](C)(C)OC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O | 3155.2 | Semi standard non polar | 33892256 | | Quercetin,3TMS,isomer #1 | C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC=C(O)C(O)=C3)OC2=C1 | 3101.7 | Semi standard non polar | 33892256 | | Quercetin,3TMS,isomer #10 | C[Si](C)(C)OC1=CC=C(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1O[Si](C)(C)C | 3076.2 | Semi standard non polar | 33892256 | | Quercetin,3TMS,isomer #2 | C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O)=C(C3=CC=C(O[Si](C)(C)C)C(O)=C3)OC2=C1 | 3191.4 | Semi standard non polar | 33892256 | | Quercetin,3TMS,isomer #3 | C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O)=C(C3=CC=C(O)C(O[Si](C)(C)C)=C3)OC2=C1 | 3172.3 | Semi standard non polar | 33892256 | | Quercetin,3TMS,isomer #4 | C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC=C(O[Si](C)(C)C)C(O)=C3)OC2=C1 | 3103.8 | Semi standard non polar | 33892256 | | Quercetin,3TMS,isomer #5 | C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC=C(O)C(O[Si](C)(C)C)=C3)OC2=C1 | 3086.2 | Semi standard non polar | 33892256 | | Quercetin,3TMS,isomer #6 | C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1 | 3118.0 | Semi standard non polar | 33892256 | | Quercetin,3TMS,isomer #7 | C[Si](C)(C)OC1=CC=C(C2=C(O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)C=C1O | 3080.1 | Semi standard non polar | 33892256 | | Quercetin,3TMS,isomer #8 | C[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)C=C1O[Si](C)(C)C | 3079.4 | Semi standard non polar | 33892256 | | Quercetin,3TMS,isomer #9 | C[Si](C)(C)OC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O | 3067.0 | Semi standard non polar | 33892256 | | Quercetin,4TMS,isomer #1 | C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC=C(O[Si](C)(C)C)C(O)=C3)OC2=C1 | 3161.7 | Semi standard non polar | 33892256 | | Quercetin,4TMS,isomer #2 | C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC=C(O)C(O[Si](C)(C)C)=C3)OC2=C1 | 3147.6 | Semi standard non polar | 33892256 | | Quercetin,4TMS,isomer #3 | C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O)=C(C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1 | 3124.3 | Semi standard non polar | 33892256 | | Quercetin,4TMS,isomer #4 | C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1 | 3056.2 | Semi standard non polar | 33892256 | | Quercetin,4TMS,isomer #5 | C[Si](C)(C)OC1=CC=C(C2=C(O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)C=C1O[Si](C)(C)C | 3035.3 | Semi standard non polar | 33892256 | | Quercetin,5TMS,isomer #1 | C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1 | 3154.9 | Semi standard non polar | 33892256 | | Quercetin,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC=C(O)C(O)=C3)OC2=C1 | 3572.0 | Semi standard non polar | 33892256 | | Quercetin,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(O)=C(C1=CC=C(O)C(O)=C1)O2 | 3518.6 | Semi standard non polar | 33892256 | | Quercetin,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC1=C(C2=CC=C(O)C(O)=C2)OC2=CC(O)=CC(O)=C2C1=O | 3533.6 | Semi standard non polar | 33892256 | | Quercetin,1TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O | 3571.1 | Semi standard non polar | 33892256 | | Quercetin,1TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1O | 3576.9 | Semi standard non polar | 33892256 | | Quercetin,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C2C(=O)C(O)=C(C3=CC=C(O)C(O)=C3)OC2=C1 | 3786.7 | Semi standard non polar | 33892256 | | Quercetin,2TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1O[Si](C)(C)C(C)(C)C | 3748.0 | Semi standard non polar | 33892256 | | Quercetin,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[Si](C)(C)C(C)(C)C)=C(C3=CC=C(O)C(O)=C3)OC2=C1 | 3771.3 | Semi standard non polar | 33892256 | | Quercetin,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)OC2=C1 | 3841.1 | Semi standard non polar | 33892256 | | Quercetin,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)OC2=C1 | 3800.3 | Semi standard non polar | 33892256 | | Quercetin,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O2)C=C1O | 3787.6 | Semi standard non polar | 33892256 | | Quercetin,2TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O2)=CC=C1O | 3753.2 | Semi standard non polar | 33892256 | | Quercetin,2TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)OC1=C(C2=CC=C(O)C(O)=C2)OC2=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C2C1=O | 3726.5 | Semi standard non polar | 33892256 | | Quercetin,2TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)OC1=CC=C(C2=C(O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1O | 3774.0 | Semi standard non polar | 33892256 | | Quercetin,2TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O | 3731.1 | Semi standard non polar | 33892256 | | Quercetin,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C2C(=O)C(O[Si](C)(C)C(C)(C)C)=C(C3=CC=C(O)C(O)=C3)OC2=C1 | 3867.2 | Semi standard non polar | 33892256 | | Quercetin,3TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)OC1=CC=C(C2=C(O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1O[Si](C)(C)C(C)(C)C | 3856.3 | Semi standard non polar | 33892256 | | Quercetin,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C2C(=O)C(O)=C(C3=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)OC2=C1 | 4037.9 | Semi standard non polar | 33892256 | | Quercetin,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C2C(=O)C(O)=C(C3=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)OC2=C1 | 3995.8 | Semi standard non polar | 33892256 | | Quercetin,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[Si](C)(C)C(C)(C)C)=C(C3=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)OC2=C1 | 3937.7 | Semi standard non polar | 33892256 | | Quercetin,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[Si](C)(C)C(C)(C)C)=C(C3=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)OC2=C1 | 3898.0 | Semi standard non polar | 33892256 | | Quercetin,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C3)OC2=C1 | 3939.8 | Semi standard non polar | 33892256 | | Quercetin,3TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)OC1=CC=C(C2=C(O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O2)C=C1O | 3903.7 | Semi standard non polar | 33892256 | | Quercetin,3TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O2)C=C1O[Si](C)(C)C(C)(C)C | 3889.3 | Semi standard non polar | 33892256 | | Quercetin,3TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O2)=CC=C1O | 3864.2 | Semi standard non polar | 33892256 | | Quercetin,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C2C(=O)C(O[Si](C)(C)C(C)(C)C)=C(C3=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)OC2=C1 | 4108.1 | Semi standard non polar | 33892256 | | Quercetin,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C2C(=O)C(O[Si](C)(C)C(C)(C)C)=C(C3=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)OC2=C1 | 4060.5 | Semi standard non polar | 33892256 | | Quercetin,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C2C(=O)C(O)=C(C3=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C3)OC2=C1 | 4107.2 | Semi standard non polar | 33892256 | | Quercetin,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[Si](C)(C)C(C)(C)C)=C(C3=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C3)OC2=C1 | 3980.3 | Semi standard non polar | 33892256 | | Quercetin,4TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC1=CC=C(C2=C(O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O2)C=C1O[Si](C)(C)C(C)(C)C | 3948.5 | Semi standard non polar | 33892256 | | Quercetin,5TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C2C(=O)C(O[Si](C)(C)C(C)(C)C)=C(C3=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C3)OC2=C1 | 4175.0 | Semi standard non polar | 33892256 |
|
|---|